commit b70b202e46d1bff6a77c418fb751a0812ba41db2
Author: Markus Birth <mbirth@gmail.com>
Date:   Mon Jul 15 23:19:32 2013 +0200

    Initial commit

diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..36e2f75
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,3 @@
+/!_PowerBASIC_!/
+*~
+*.pb
diff --git a/CBF.BAS b/CBF.BAS
new file mode 100644
index 0000000..64fa1d3
--- /dev/null
+++ b/CBF.BAS
@@ -0,0 +1,69 @@
+10 KEY OFF
+20 CLS
+40 ON ERROR GOTO 700
+50 CHCDE$=""
+60 CODE$=""
+70 ANF$=""
+80 CDE$=""
+90 BED$=""
+100 COLOR 14
+110 LOCATE 1,30:PRINT"CB-Funk Hilfsprogramm"
+120 LOCATE 2,40:COLOR 12:PRINT"written by RoboCop INDUSTRIES"
+130 LOCATE 4,25:COLOR 10:PRINT"(C)1995-96 by RoboCop INDUSTRIES"
+150 COLOR 15
+160 LOCATE 7,1:PRINT"Code     : ";:COLOR 14:INPUT "",CODE$
+170 IF CODE$="END" OR CODE$="end" THEN COLOR 15:END
+180 GOSUB 620
+190 ANF$=LEFT$(CODE$,1)
+200 LOCATE 7,12:COLOR 14:PRINT CODE$
+210 COLOR 15:PRINT"Kategorie: ";
+220 COLOR 13:PRINT"Suche ..."
+230 LOCATE 8,12
+240 COLOR 14
+250 IF ANF$="Q" OR ANF$="q" THEN PRINT"Q-Code   ":GOTO 340
+260 IF ANF$="S" AND LEN(CODE$)=2 AND ASC(RIGHT$(CODE$,1))>47 AND ASC(RIGHT$(CODE$,1))<58 THEN PRINT"S-Stufe  ":GOTO 340
+270 IF ASC(ANF$)>47 AND ASC(ANF$)<58 THEN PRINT"Zahlencode":GOTO 340
+280 PRINT"unbekannt":GOTO 340
+290 COLOR 15:PRINT"Datendatei erweitern [J/N] ?"
+300 A$=INKEY$:IF A$="" THEN 300
+310 IF A$="j" OR A$="J" THEN GOTO 530
+320 IF A$="n" OR A$="N" THEN GOTO 510
+330 GOTO 300
+340 COLOR 15:PRINT"Bedeutung: ";
+350 COLOR 13:PRINT"Suche ..."
+360 OPEN "I",#1,"CBF.DAT"
+370 ON ERROR GOTO 390
+380 INPUT#1,CDE$,BED$:GOTO 400
+390 COLOR 14:LOCATE 9,12:PRINT"unbekannt":CLOSE #1:GOTO 290
+400 IF CDE$=CODE$ THEN CLOSE #1:GOTO 420
+410 GOTO 380
+420 IF LEFT$(BED$,7)="Station" THEN COLOR 14:LOCATE 8,12:PRINT"Rufname / Bezeichnung"
+430 ON ERROR GOTO 690:COLOR 14:LOCATE 9,12
+440 IF LEN(BED$)>9 THEN GOTO 480
+450 FOR Y=LEN(BED$) TO 9
+460 BED$=BED$+" "
+470 NEXT Y
+480 PRINT BED$
+490 LOCATE 15,1:COLOR 9:PRINT"Taste dr�cken, wenn bereit"
+500 A$=INKEY$:IF A$="" THEN 500
+510 CLS
+520 RUN
+530 '***** Datendatei erweitern
+540 OPEN "A",#2,"CBF.DAT"
+550 CLS:LOCATE 7,1:COLOR 15:PRINT"Code     : ";CODE$
+560 INPUT"Bedeutung: ",BED$
+570 PRINT:PRINT"Alles richtig [J/N] ?"
+580 A$=INKEY$:IF A$="" THEN 580
+590 IF A$="j" OR A$="J" THEN WRITE#2,CODE$,BED$:CLOSE #2:GOTO 510
+600 IF A$="n" OR A$="N" THEN GOTO 560
+610 GOTO 580
+620 '***** kleinbuchst. ----> GRO�BUCHST.
+630 FOR X=1 TO LEN(CODE$)
+640 BUCHST$=MID$(CODE$,X,1)
+650 IF ASC(BUCHST$)>96 AND ASC(BUCHST$)<123 THEN BUCHST$=CHR$(ASC(BUCHST$)-32)
+660 CHCDE$=CHCDE$+BUCHST$
+670 NEXT X
+680 IF LEN(CODE$)=LEN (CHCDE$) THEN 690 ELSE GOTO 700
+690 CODE$=CHCDE$:RETURN
+700 COLOR 12:PRINT"FEHLER ist aufgetreten! Programmabbruch!":END
+
\ No newline at end of file
diff --git a/CBF.DAT b/CBF.DAT
new file mode 100644
index 0000000..915bff3
--- /dev/null
+++ b/CBF.DAT
@@ -0,0 +1,34 @@
+"QRA","Rufname / Kennung"
+"QRG","Frequenz / Kanal"
+"QRK","Lesbarkeit / Radiowert"
+"QRL","Besch�ftigung bei der man nicht funken kann"
+"QRM","St�rungen"
+"QRT","Ende / Schlu�"
+"QRV","Bereit / auf Empfang"
+"QRX","Bitte warten!"
+"QRZ","Kommen / Rufe ..."
+"QSA","Lautst�rke / Santiagowert"
+"QSB","Fading"
+"QSL","Empfangsbest�tigung"
+"QSO","Funkverbindung"
+"QSP","Vermittlung / Relaisstation"
+"QST","An ALLE!"
+"QSY","Frequenzwechsel / Kanalwechsel"
+"QTH","Standort"
+"QTR","Uhrzeit"
+"S1","kaum h�rbares Signal"
+"S2","sehr schwach h�rbares Signal"
+"S3","m�hsam h�rbares Signal"
+"S4","leises. aber ausreichend h�rbares Signal"
+"S5","noch schwaches. aber ziemlich gut h�rbares Signal"
+"S6","gut h�rbares Signal"
+"S7","lautes Signal"
+"S8","sehr lautes Signal. voll aufgedrehte Lautst�rke nicht mehr m�glich"
+"S9","�u�erst lautes Signal"
+"55","viel Erfolg / viele QSO's"
+"73","die besten Gr��e"
+"74","la� dich nicht erwischen"
+"99","verschwinde"
+"88","Liebe und K�sse"
+"600","weiter am Telefon"
+
\ No newline at end of file
diff --git a/DELTREE.BAS b/DELTREE.BAS
new file mode 100644
index 0000000..e29fcd2
--- /dev/null
+++ b/DELTREE.BAS
@@ -0,0 +1,14 @@
+  open "A",#1,"C:\HACKER.NFO"
+  datum$=mid$(date$,4,2)+"."+left$(date$,2)+"."+right$(date$,2)
+  print#1,"� DELTREE-Versuch �������������������������������������������������������������"
+  print#1,"Datum: ";datum$;"   ";chr$(15);"   Uhrzeit: ";time$
+  print#1,"Kommandozeile: DELTREE ";command$
+  print#1,"Erfolgreich abgewehrt."
+  BEEP
+  COLOR 12:print"* * * W A R N U N G * * *":color 15
+  print
+  print"Es wurde ein DELTREE-Versuch gemacht!"
+  print"Befehl: DELTREE ";command$
+  print
+  print"DELTREE ist auf diesem Ger�t momentan deaktiviert."
+
\ No newline at end of file
diff --git a/EDITPATH2.BAS b/EDITPATH2.BAS
new file mode 100644
index 0000000..3053fe0
--- /dev/null
+++ b/EDITPATH2.BAS
@@ -0,0 +1,155 @@
+CLS
+shell "mode co80"
+DIM PATH$(40)
+$INCLUDE "LOGO.INC"
+color 15
+print
+print"��� EditPath ��� by RoboCop INDUSTRIES"
+print
+print"Lese Path-Variable ... ";
+PATH$=ENVIRON$("PATH")
+BACKUP$=PATH$
+print "OK"
+if PATH$="" then
+  print
+  print"Pfad-Variable ist leer! Neu anlegen (J/N)?"
+  gosub InpKey
+  if a$="j" or a$="J" then goto NewPath
+  if A$="n" or A$="N" then goto Ende
+end if
+print"Splitte Path-String ... ";
+x=1
+for y=1 to 255
+  IF MID$(PATH$,y,2)=";" or mid$(path$,y,2)="" then PATHs=x:exit for
+  IF MID$(PATH$,y,1)=";" then x=x+1:goto 2
+  PATH$(x)=PATH$(x)+mid$(PATH$,y,1)
+2next y
+print "OK"
+goto EditPath
+
+NewPath:
+PATHs=1
+PATH$(1)="C:\DOS"
+goto EditPath
+
+InpKey:
+1 A$=INKEY$:IF A$="" THEN 1
+  RETURN
+
+EditPath:
+chosen=1
+oldchosen=1
+oldy=1
+cls:color 15,1
+print"��� EditPath ��� by RoboCop INDUSTRIES                              [ESC] - Ende";
+
+EP:
+locate 25,1:color 14,1:print space$(80);
+color 15,0
+y=1
+for x=1 to PATHs
+  if x+2-z>22 and y<>41 then y=41:z=20:goto 4
+  if x+2-z>22 and y=41 then end
+4 locate x+2-z,y
+  print using"## \                                   \";x;PATH$(x);
+  locate x+3-z,y
+  print space$(40);
+next x
+z=0
+ShowPaths:
+color 15,0
+locate oldchosen+2-oldz,oldy:print using"## \                                   \";oldchosen;PATH$(oldchosen);
+if chosen<=20 then y=1:z=0 else y=41:z=20
+oldchosen=chosen:oldy=y:oldz=z
+locate chosen+2-z,y
+color 0,4:print using"## \                                   \";chosen;PATH$(chosen);
+gosub InpKey
+KeyIn$=MID$(A$,2,1)
+if KeyIn$="H" and chosen>1 then sound 1000,.5:chosen=chosen-1
+if KeyIn$="P" and chosen<PATHs then sound 1000,.5:chosen=chosen+1
+if KeyIn$="K" and chosen>20 then sound 1000,.5:chosen=chosen-20
+if KeyIn$="M" and chosen<21 and PATHs>=chosen+20 then sound 1000,.5:chosen=chosen+20
+if KeyIn$="R" and PATHs<40 then sound 1500,1:goto InsertOne
+if KeyIn$="S" and PATHs>1 then sound 800,1:goto RemoveChosen
+if KeyIn$="G" and chosen>1 then sound 1000,.5:chosen=1
+if KeyIn$="O" and chosen<PATHs then sound 1000,.5:chosen=PATHs
+if a$=chr$(13) then sound 800,1:delay 1/18.2:sound 1500,1:goto EditSelected
+if a$=chr$(27) then for a=1 to 3:sound 1000,1:delay 2/18.2:next a:goto WriteItDown
+goto ShowPaths
+
+InsertOne:
+PATHs=PATHs+1
+for x=PATHs to chosen STEP -1
+  PATH$(x)=PATH$(x-1)
+next x
+path$(chosen)=""
+goto EP
+
+RemoveChosen:
+PATHs=PATHs-1
+for x=chosen to PATHs
+  PATH$(x)=PATH$(x+1)
+next x
+if PATHs+1=chosen then chosen=chosen-1:oldchosen=1
+goto EP
+
+
+EditSelected:
+color 15,0
+BAKPATH$=PATH$(chosen)
+' locate 24,1:print PATH$(chosen);
+locate 24,1:input ;"Neuer Pfad: ",PATH$(chosen)
+locate 24,1:print space$(80);
+if PATH$(chosen)="" then
+  color 14,1
+  locate 25,19:print"Keine Eingabe, L�schen oder Behalten (L/B)?";
+  for a=1 to 3:sound 1000,1:delay 2/18.2:next a
+6 gosub InpKey
+  if a$="l" or a$="L" then sound 800,1:PATH$(chosen)="":goto 7
+  if a$="b" or a$="B" then sound 1500,1:PATH$(chosen)=BAKPATH$:goto 7
+  sound 1000,1
+  goto 6
+7end if
+goto EP
+
+
+
+WriteItDown:
+Down$="@SET PATH="
+locate 25,18:color 30,1
+print"Wollen Sie die �nderungen schreiben (J/N)?";
+5gosub InpKey
+if A$="j" or a$="J" then sound 1500,1:Zustand$="Neue PATH-Variable geschrieben.":goto YoSchreiben
+if a$="n" or A$="N" then sound 800,1:Zustand$="Alte PATH-Variable beibehalten.":goto Nee
+sound 1000,1
+goto 5
+
+YoSchreiben:
+for x=1 to PATHs
+  Down$=Down$+PATH$(x)+";"
+next x
+open "O",#1,"EDITPATH.BAT"
+PRINT#1,Down$
+close #1
+goto Ende
+
+Nee:
+Down$="@SET PATH="
+Down$=Down$+BACKUP$
+open "O",#1,"EDITPATH.BAT"
+PRINT#1,Down$
+close #1
+goto Ende
+
+Ende:
+color 15,0
+cls:color 15,1
+print"��� EditPath ��� by RoboCop INDUSTRIES                                          ";
+color 15,0
+print
+print Zustand$
+print
+print"Vielen Dank f�r die Benutzung von EditPath!"
+print
+print"Bitte rufen Sie EDITPATH.BAT auf."
+end
\ No newline at end of file
diff --git a/ELFELDT.BAS b/ELFELDT.BAS
new file mode 100644
index 0000000..96cd9d7
--- /dev/null
+++ b/ELFELDT.BAS
@@ -0,0 +1,233 @@
+cls
+screen 0
+color 15
+
+
+oldposx=1:oldposy=1
+npos=4:hpos=12+16
+nneg=9:hneg=11+16
+nneu=8:hneu=15+16
+
+
+color 14
+print"-=�� Elektrische Felder ��=-"
+print
+color 7
+print"      Editor geschrieben von RoboCop <RoboCop@EarthCorp.com>"
+color 15
+print
+
+EnterFile:
+input"Dateiname (z.B. project5)([ENTER] f�r neue Datei): ",finame$
+finame$=finame$+".elf"
+cls
+screen 12
+if finame$=".elf" then goto HierWeiter1
+on error goto FileNotEx
+  open "I",#1,finame$
+  close #1
+  open "B",#1,finame$
+HierWeiter1:
+on error goto SomeError
+locate 1,1:color nneg:print"�";:color 8:print" negativ"
+locate 2,1:color npos:print"�";:color 8:print" positiv"
+locate 3,1:color nneu:print"�";:print" neutral"
+locate 5,1:color 14:print"+/-"
+locate 6,2:color 8:print"Ladung"
+locate 8,1:color 14:print"0"
+locate 9,2:color 8:print"neutral"
+locate 11,1:color 14:print"Cursor"
+locate 12,2:color 8:print"bewegen"
+locate 14,1:color 14:print"[ESC]"
+locate 15,2:color 8:print"fertig!"
+dim col(50,30)
+dim num(50,30)
+dim onum(50,30)
+dim ocol(50,30)
+for x=1 to 50
+  for y=1 to 30
+    color 8:locate y,x+14:print"�";
+    if done=0 then locate y,66:print str$(y);:if y<10 then locate y,11:print str$(y); else locate y,10:print str$(y);
+    if done=0 then locate y,14:print"�";:locate y,65:print"�";:oldy=y
+    if x=2 then done=1
+    if finame$<>".elf" then get$ #1,1,ch$ else ch$=chr$(0)
+    locate y,x+14
+    if asc(ch$)<128 then col(x,y)=npos:num(x,y)=asc(ch$)
+    if asc(ch$)>128 then col(x,y)=nneg:num(x,y)=256-asc(ch$)
+    if asc(ch$)=0 then col(x,y)=nneu
+    color col(x,y)
+    if num(x,y)<>0 then print right$(str$(num(x,y)),1); else print"�";
+    onum(x,y)=num(x,y)
+    ocol(x,y)=col(x,y)
+    if finame$<>".elf" then if eof(1) then exit for
+  next y
+  if finame$<>".elf" then if eof(1) then exit for
+next x
+if finame$<>".elf" then close #1
+newposx=1:newposy=1:gosub ShowNewPos
+2 a$=inkey$:if a$="" then goto 2
+skey$=right$(a$,1)
+if a$=chr$(27) then goto WannaSave
+if ((a$="9" OR skey$="I") AND newposy>1 AND newposx<50) then newposy=newposy-1:newposx=newposx+1
+if ((a$="8" OR skey$="H") AND newposy>1) then newposy=newposy-1
+if ((a$="7" OR skey$="G") AND newposy>1 AND newposx>1) then newposy=newposy-1:newposx=newposx-1
+if ((a$="6" OR skey$="M") AND newposx<50) then newposx=newposx+1
+if ((a$="4" OR skey$="K") AND newposx>1) then newposx=newposx-1
+if ((a$="3" OR skey$="Q") AND newposy<30 AND newposx<50) then newposy=newposy+1:newposx=newposx+1
+if ((a$="2" OR skey$="P") AND newposy<30) then newposy=newposy+1
+if ((a$="1" OR skey$="O") AND newposy<30 AND newposx>1) then newposy=newposy+1:newposx=newposx-1
+if a$="0" OR skey$="R" then col(newposx,newposy)=nneu:num(newposx,newposy)=0
+if a$="+" then
+  x=newposx:y=newposy
+  OK=0
+  if col(x,y)=nneu AND OK=0 then num(x,y)=1:col(x,y)=npos:OK=1
+  if col(x,y)=nneg AND OK=0 then num(x,y)=num(x,y)-1:OK=1:if num(x,y)=0 then col(x,y)=nneu
+  if col(x,y)=npos AND OK=0 AND num(x,y)<9 then num(x,y)=num(x,y)+1:OK=1
+end if
+if a$="-" then
+  x=newposx:y=newposy
+  OK=0
+  if col(x,y)=nneu AND OK=0 then num(x,y)=1:col(x,y)=nneg:OK=1
+  if col(x,y)=nneg AND OK=0 AND num(x,y)<9 then num(x,y)=num(x,y)+1:OK=1
+  if col(x,y)=npos AND OK=0 then num(x,y)=num(x,y)-1:OK=1:if num(x,y)=0 then col(x,y)=nneu
+end if
+gosub ShowNewPos
+goto 2
+
+ShowNewPos:
+locate OldposY,OldposX+14
+color col(OldposX,OldposY)
+if num(OldposX,OldposY)=0 then print "�"; else print right$(str$(num(OldposX,OldposY)),1);
+locate NewPosY,NewPosX+14
+color col(NewPosX,NewPosY)
+if num(NewPosX,NewPosY)=0 then
+  color hneu:print"�";
+else
+  if col(NewPosX,NewPosY)=nneg then color hneg
+  if col(NewPosX,NewPosY)=npos then color hpos
+  print right$(str$(num(NewPosX,NewPosY)),1);
+end if
+OldposX=NewposX
+OldposY=NewposY
+locate 1,73
+color 14:print using"X## Y##";newposx;newposy;
+return
+
+WannaSave:
+screen 0
+cls
+color 14
+print "-=�� Elektrische Felder ��=-"
+color 7
+print "      Editor geschrieben von RoboCop <RoboCop@EarthCorp.com>"
+print
+color 15
+for x=1 to 50
+  for y=1 to 30
+    if num(x,y)<>onum(x,y) OR col(x,y)<>ocol(x,y) then ChangedFlag=1:exit for
+  next y
+  if ChangedFlag=1 then exit for
+next x
+if ChangedFlag=1 then
+  color 12:print"ACHTUNG!! Daten wurden ver�ndert. ";
+Question:
+  color 15:print"�nderungen speichern (J/N)? ";
+3 a$=inkey$:if a$="" then 3
+  if a$="j" or A$="J" then print "J":goto SaveItNow
+  if a$="n" or a$="N" then print "N":goto DontSave
+  sound 600,1
+  goto 3
+else
+  color 15:print"Es wurde nix ver�ndert....beende Programm."
+  goto HereUpToQuit
+end if
+
+DontSave:
+print "Sind Sie sich sicher (J/N)? ";
+4 a$=inkey$:if a$="" then 4
+  if a$="j" or a$="J" then print "J":goto HereUpToQuit
+  if a$="n" or a$="N" then print "N":goto Question
+  sound 600,1
+  goto 4
+
+SaveItNow:
+color 14:print "� Speichern"
+color 15
+print
+print "Dateiname (z.B. project6)([ENTER] f�r ";finame$;"): ";
+input "",fi2name$
+fi2name$=fi2name$+".elf"
+if fi2name$=".elf" then fi2name$=finame$
+print "Speichere ... ";
+open "B",#1,fi2name$
+for x=1 to 50
+  for y=1 to 30
+    countr=countr+1
+    locate csrlin,15:print using"###%";(countr/(50*30))*100;
+    if col(x,y)=npos then put$ #1,chr$(num(x,y))
+    if col(x,y)=nneg then put$ #1,chr$(256-num(x,y))
+    if col(x,y)=nneu then put$ #1,chr$(0)
+  next y
+next x
+print " - OK"
+print "Speichere Einstellungen ...";
+put$ #1,chr$(0)+"ngeClipboardChain"+chr$(1)+chr$(0)+"�"
+for x=1 to 7
+  put$ #1,chr$(0)
+next x
+put$ #1,chr$(6)+chr$(13)+chr$(4)
+for x=1 to 5
+  put$ #1,chr$(0)
+next x
+put$ #1,"�"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+chr$(0)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)
+put$ #1,chr$(0)+chr$(0)+"R"+chr$(10)+"ChangeMenu"+chr$(1)+chr$(0)
+put$ #1,chr$(0)+chr$(1)
+for x=1 to 6
+  put$ #1,chr$(0)
+next x
+put$ #1,chr$(6)+chr$(13)+chr$(4)
+for x=1 to 5
+  put$ #1,chr$(0)
+next x
+put$ #1,"�"+chr$(1)+chr$(1)+chr$(1)+chr$(5)+chr$(0)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)
+put$ #1,"�"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+chr$(0)
+put$ #1,chr$(0)+"R"+chr$(14)+"ChangeSelector"+chr$(1)+chr$(0)+chr$(8)+chr$(1)
+for x=1 to 6
+  put$ #1,chr$(0)
+next x
+put$ #1,chr$(6)+chr$(13)+chr$(4)
+for x=1 to 5
+  put$ #1,chr$(0)
+next x
+put$ #1,">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+chr$(0)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+">"+chr$(1)
+put$ #1,chr$(1)+chr$(1)+chr$(2)+chr$(0)+chr$(0)+"R"+chr$(14)+"CheckDlgButton"+chr$(1)+chr$(0)+chr$(16)+chr$(1)
+for x=1 to 6
+  put$ #1,chr$(0)
+next x
+put$ #1,chr$(6)+chr$(13)+chr$(4)
+for x=1 to 9
+  put$ #1,chr$(0)
+next x
+put$ #1,chr$(3)+chr$(0)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+"*"+chr$(1)+chr$(1)+chr$(1)+chr$(2)+">"+chr$(1)+chr$(1)+chr$(1)+chr$(2)
+put$ #1,chr$(0)+chr$(0)+"R"+chr$(13)+"CheckMenuItem"+chr$(1)+chr$(0)+chr$(24)+chr$(1)
+for x=1 to 6
+  put$ #1,chr$(0)
+next x
+put$ #1,chr$(6)+chr$(13)+chr$(4)+chr$(0)+chr$(0)
+close #1
+print " OK"
+goto HereUpToQuit
+
+FileNotEx:
+color 12:print"FEHLER!! Diese Datei existiert nicht!"
+color 15
+resume EnterFile
+
+SomeError:
+color 12:print"FEHLER!! Es ist ein unbekannter Fehler aufgetreten."
+color 15:print"Versuchen Sie es mit einer anderen Datendatei."
+resume HereUpToQuit
+
+HereUpToQuit:
+print
+print "Programm beendet."
\ No newline at end of file
diff --git a/FORMAT.BAS b/FORMAT.BAS
new file mode 100644
index 0000000..587cec2
--- /dev/null
+++ b/FORMAT.BAS
@@ -0,0 +1,14 @@
+  open "A",#1,"C:\HACKER.NFO"
+  datum$=mid$(date$,4,2)+"."+left$(date$,2)+"."+right$(date$,2)
+  print#1,"� FORMAT-Versuch ��������������������������������������������������������������"
+  print#1,"Datum: ";datum$;"   ";chr$(15);"   Uhrzeit: ";time$
+  print#1,"Kommandozeile: FORMAT ";command$
+  print#1,"Erfolgreich abgewehrt."
+  BEEP
+  COLOR 12:print"* * * W A R N U N G * * *":color 15
+  print
+  print"Es wurde ein FORMAT-Versuch gemacht!"
+  print"Befehl: FORMAT ";command$
+  print
+  print"FORMAT ist auf diesem Ger�t momentan deaktiviert."
+
\ No newline at end of file
diff --git a/HTML2LST.BAS b/HTML2LST.BAS
new file mode 100644
index 0000000..4ebda64
--- /dev/null
+++ b/HTML2LST.BAS
@@ -0,0 +1,61 @@
+	dim eta(1000)
+	cls
+	print"� HTML to List"
+	print
+	print"Converts HTML-File of a germany.net-Userlist into a Textfile"
+	print
+	shell "DIR gnusers.htm >html2lst.tmp"
+	open "I",#1,"html2lst.tmp"
+	for x=1 to 6:line input #1,dat$:next x
+	close #1
+	kill "html2lst.tmp"
+	size$=mid$(dat$,16,3)+mid$(dat$,20,3)+mid$(dat$,24,3)
+	size=val(Size$)
+	size=size-63422
+	open "I",#1,"gnusers.htm"
+	open "O",#2,"gnusers.txt"
+	for x=1 to 10:line input#1,dummy$:next x
+	starttime=timer
+1	line input #1,dat$
+	bytecount=bytecount+Len(dat$)
+	l=l+1
+	if dat$="</pre>" or dat$="</PRE>" then goto Ende
+	for x=1 to 20
+	  x$=mid$(dat$,x,3)
+	  if x$="<b>" or x$="<B>" then a=x:exit for
+	next x
+	ot$=    mid$(dat$,a+8,10)		'Usernumber
+	ot$=ot$+mid$(dat$,a+26,99)		'Username and City
+	if inkey$=chr$(27) then end
+	if timer-1>oldtim then gosub ShowEta:oldtim=timer
+	if ot$<>"" then print #2,ot$
+	if eof(1) then goto Ende else goto 1
+
+ShowEta:
+	pro=int((bytecount/size)*100)
+	if pro>0 then
+	  tim=int(timer-starttime)
+	  eta=int(tim/(bytecount/size))
+	  if pro>5 then
+	    ect=ect+1
+	    eta(ect)=eta
+	    for y=1 to ect:etb=etb+eta(ect):next y:eta=etb/ect:etb=0
+	  end if
+	  tm=int(tim/60)
+	  ts=int(tim)-tm*60
+	  em=int(eta/60)
+	  es=int(eta)-em*60
+	end if
+	locate csrlin,1:print using "Bytes: #######/#######(Zeile: ######) ###% Zeit: ";bytecount;size;l;pro;
+	if tm<10 then print using "0#_.";tm; else print using "##_.";tm;
+	if ts<10 then print using "0#   ETA: ";ts; else print using "##   ETA: ";ts;
+	if em<10 then print using "0#_.";em; else print using "##_.";em;
+	if es<10 then print using "0#";es; else print using "##";es;
+	print "      ";
+	return
+
+Ende:
+	print
+	print"Programm beendet."
+	end
+
\ No newline at end of file
diff --git a/RUC.BAS b/RUC.BAS
new file mode 100644
index 0000000..1ec5ef7
--- /dev/null
+++ b/RUC.BAS
@@ -0,0 +1,37 @@
+   cls
+   print "-=�� Olson Software Help Tools Cracker ��=-"
+   print
+   print "RUC.INI format:"
+   print chr$(34)+"helpfile"+chr$(34)+","+chr$(34)+"name"+chr$(34)+",countstart"
+   print
+   print "helpfile is needed for REGUTIL.EXE"
+   print "name is the desired name"
+   print "countstart is the starting number from which to try"
+   print
+   print "Reading infos ... ";
+   open "I",#1,"RUC.INI"
+   input #1,hf$,nam$,x
+   close #1
+   print "OK ("+hf$+";"+nam$+";"+right$(str$(x),len(str$(x))-1)+")"
+   print "Cracking sequence begins (ESC breaks):"
+Again:
+   locate 12,1:print "�";
+   x$=right$(str$(x),len(str$(x))-1)
+   print "�";
+   open "A",#1,"regutil.out"
+   print "�";
+   print #1,chr$(13)+"["+x$+"] ";
+   print "�";
+   close #1
+   print "�";
+   print"� "+x$+" �";
+   shel$="regutil.exe "+hf$+" "+chr$(34)+nam$+chr$(34)+" "+x$+" >>regutil.out"
+   print "�";
+   shell shel$
+   print "�";
+   x=x+1
+   print "� OK";
+   if inkey$=chr$(27) then end
+   locate 12,1:print space$(79);
+   goto Again
+
\ No newline at end of file
diff --git a/TBCLEANM.BAS b/TBCLEANM.BAS
new file mode 100644
index 0000000..5b947fa
--- /dev/null
+++ b/TBCLEANM.BAS
@@ -0,0 +1,18 @@
+cls
+open "I",#1,"C:\TBAV.LOG"
+1 if eof(1)=0 then
+    line input #1,zeile$
+    if mid$(Zeile$,2,1)=":" and right$(Zeile$,2)="XE" then
+	 print "Bearbeite: "+Zeile$
+	 shellstr$="TBCLEAN "+left$(Zeile$,Len(Zeile$)-3)+"VXE "+left$(Zeile$,Len(Zeile$)-3)+"EXE"
+	 print "S�ubere...."
+	 shell shellstr$
+	 print "L�sche infizierte Datei....";
+	 kill left$(Zeile$,Len(Zeile$)-3)+"VXE"
+	 print "OK"
+	 x=x+1
+    end if
+  end if
+goto 1
+print "Komplett! ";x;" Dateien bearbeitet"
+end
\ No newline at end of file
diff --git a/agen.bas b/agen.bas
new file mode 100644
index 0000000..04e6f0c
--- /dev/null
+++ b/agen.bas
@@ -0,0 +1,186 @@
+DECLARE SUB MakePat (Zw$, ZwF%, ZwB%)
+DECLARE SUB MakeANSI (offen%)
+DECLARE FUNCTION InsPat$ (Zahl%)
+DECLARE FUNCTION PosOK% (Up%, Max%)
+DECLARE SUB MakeSITS (eingabe$, laenge%)
+CONST MaxEin = 70
+CONST MaxAus = 80
+DIM zeile AS STRING * MaxEin
+DIM SHARED Result AS STRING * MaxAus
+DIM SHARED ResultF(MaxAus + 1), ResultB(MaxAus + 1) AS INTEGER
+DIM minpat AS INTEGER
+DIM Patlen AS INTEGER
+DIM veil AS INTEGER
+RANDOMIZE TIMER
+CONST maxpat = 10
+
+CONST Zeichen = "����"
+CONST Zeichenk = 4
+CONST FColor = 16
+CONST BColor = 8
+CLS
+PRINT " AGEN V111.111�"
+PRINT " (c) Arndt Grass"
+PRINT : PRINT
+INPUT "Filename"; datei$
+INPUT "Wie soll die ANSI-Ausgabedatei hei�en"; ausdatei$
+nustart:
+OPEN datei$ FOR INPUT AS #1
+veil = FREEFILE
+OPEN ausdatei$ FOR OUTPUT AS veil
+minpat = 5
+DO
+        PRINT "Wie lang soll das Pattern gew�hlt werden (min."; minpat; " max."; maxpat; ")";
+        INPUT Patlen
+LOOP UNTIL (Patlen <= maxpat) AND (Patlen >= minpat)
+WHILE NOT EOF(1)
+        LINE INPUT #1, zeile
+        Result = ""
+        FOR i = 1 TO MaxAus
+            ResultF(i) = 0
+            ResultB(i) = 0
+        NEXT i
+        CALL MakeSITS(zeile, Patlen)
+        CALL MakeANSI(veil)
+WEND
+CLOSE
+COLOR 1, 0
+PRINT
+PRINT " (W)iederholen oder (S)peichern und Ende?"
+repeat:
+ink$ = ""
+WHILE ink$ = ""
+  ink$ = INKEY$
+WEND
+IF UCASE$(ink$) = "S" THEN
+        CLS
+        END
+ELSEIF UCASE$(ink$) = "W" THEN
+       GOTO nustart
+ELSE
+     GOTO repeat
+END IF
+
+SUB delpat (pattern$, PatPosition%, Aktuell%, change%)
+
+   FOR i = 1 TO change%
+        IF PatPosition% = Aktuell% THEN
+                pattern$ = LEFT$(pattern$, Aktuell% - 1)
+                Aktuell% = Aktuell% - 1
+                PatPosition% = PosOK%(PatPosition%, Aktuell%)
+        ELSE
+                pattern$ = LEFT$(pattern$, PatPosition% - 1) + RIGHT$(pattern$, Aktuell% - PattPosition%)
+                Aktuell% = Aktuell% - 1
+        END IF
+   NEXT i
+END SUB
+
+FUNCTION InsPat$ (Zahl%)
+        Zw$ = ""
+        FOR i = 1 TO Zahl%
+            Zw$ = Zw$ + CHR$(Start + INT(Ende * RND))
+        NEXT i
+        InsPat$ = Zw$
+END FUNCTION
+
+SUB MakeANSI (offen%)
+    FOR i = 1 TO LEN(Result)
+        p$ = CHR$(27) + "[0;"
+        IF ResultF(i) > 7 THEN
+            p$ = p$ + "1;"
+            ResultF(i) = ResultF(i) - 8
+        END IF
+        p$ = p$ + "3" + CHR$(48 + ResultF(i)) + ";4" + CHR$(48 + ResultB(i)) + "m" + MID$(Result, i, 1)
+        COLOR ResultF(i), ResultB(i)
+        PRINT MID$(Result, i, 1);
+        PRINT #offen%, p$;
+    NEXT
+    PRINT #offen%, CHR$(13);
+
+
+
+
+END SUB
+
+SUB MakePat (Zw$, ZwF%, ZwB%)
+
+    Zw$ = MID$(Zeichen, INT(Zeichenk * RND) + 1, 1)
+    ZwB% = INT(RND * BColor)
+        DO
+            ZwF% = INT(RND * FColor)
+        LOOP UNTIL ZwF% <> ZwB%
+
+END SUB
+
+SUB MakeSITS (eingabe$, laenge%)
+DIM Vore%(20), Back(20) AS INTEGER
+DIM RanDot(20) AS STRING * 1
+DIM PatPos AS INTEGER
+
+    'Pattern generieren
+    FOR ii = 1 TO laenge%
+        CALL MakePat(RanDot(ii), Vore%(ii), Back(ii))
+    NEXT ii
+    Aktuell% = laenge%
+
+        level% = 0
+        FOR i = 1 TO Aktuell% 'Leerpattern schreiben
+            MID$(Result, i) = RanDot(i)
+            ResultF(i) = Vore%(i)
+            ResultB(i) = Back(i)
+        NEXT i
+
+        PatPos = 1 'Erste Patternposition festlegen
+        FOR i = 1 TO LEN(eingabe$) 'Eingabe abarbeiten
+            a$ = MID$(eingabe$, i, 1)
+            IF a$ = " " THEN neuLevel% = 0 ELSE neuLevel% = VAL(a$)
+            IF neuLevel% <> level% THEN
+               IF level% > neuLevel% THEN
+                        change% = level% - neuLevel%
+                        FOR j = Aktuell% TO PatPos STEP -1
+                            RanDot(j + change%) = RanDot(j)
+                            Vore%(j + change%) = Vore%(j)
+                            Back(j + change%) = Back(j)
+                        NEXT
+                        FOR j = 0 TO change% - 1
+                            RanDot(j + PatPos) = MID$(Zeichen, INT(Zeichenk * RND) + 1, 1)
+                            Back(j + PatPos) = INT(RND * BColor)
+                            DO
+                                Vore%(j + PatPos) = INT(RND * FColor)
+                            LOOP UNTIL Back(j + PatPos) <> Vore%(j + PatPos)
+                        NEXT
+                        Aktuell% = Aktuell% + change%
+               ELSE 'neulevel kleiner level
+                        change% = neuLevel% - level%
+                        FOR k = 1 TO change%
+                            FOR j = PatPos TO Aktuell% - 1
+                                RanDot(j) = RanDot(j + 1)
+                                Vore%(j) = Vore%(j + 1)
+                                Back(j) = Back(j + 1)
+                            NEXT
+                            Aktuell% = Aktuell% - 1
+                            PatPos = PosOK%(PatPos, Aktuell%)
+                         NEXT k
+               END IF
+               level% = neuLevel%
+            END IF
+            MID$(Result, i + laenge%) = RanDot(PatPos)
+            ResultF(i + laenge%) = Vore%(PatPos)
+            ResultB(i + laenge%) = Back(PatPos)
+            PatPos = PatPos + 1
+            PatPos = PosOK%(PatPos, Aktuell%)
+        NEXT i
+
+END SUB
+
+FUNCTION PosOK% (Up%, Max%)
+       
+        IF Up% > Max% THEN
+                PosOK% = 1
+        ELSE
+                PosOK% = Up%
+        END IF
+
+END FUNCTION
+
+
\ No newline at end of file
diff --git a/ampel.bas b/ampel.bas
new file mode 100644
index 0000000..f391eba
--- /dev/null
+++ b/ampel.bas
@@ -0,0 +1,55 @@
+'Verkehrsampeln, zeitgesteuert (AL aktuell,S.88      )
+	SCREEN 9					'(Band 2, Oldenbourg   )
+	LOCATE 3,26:print "Ampel 1                  Ampel 2"
+	rot = 12: gelb = 14: gruen = 10: weiss = 15: schwarz = 0
+	drot= 8 :dgelb = 8 :dgruen = 8 :dweiss = 7
+'-----------------------------------------------------
+	daten:
+	DATA 6
+	DATA 1,0,0,0,0,1,5
+	DATA 1,0,0,0,1,0,3
+	DATA 1,1,0,1,0,0,3
+	DATA 0,0,1,1,0,0,5
+	DATA 0,1,0,1,0,0,3
+	DATA 1,0,0,1,1,0,3
+'-----------------------------------------------------
+	  RESTORE daten: READ phasen
+	  for i=1 to phasen: locate 2,2:print"Phase: ";i
+	    if inkey$<>"" then end
+	    READ rotein,gelbein,gruenein
+	    xa=200:ya=50:dy=150
+	    gosub ampel3
+	    read rotein,gelbein,gruenein
+	    xa=400:ya=50:dy=150
+	    gosub ampel3
+	    n=1
+	    read zeit:delay zeit
+	  next i
+'--------------------------- SUBROUTINEN ------------------
+ampel3:
+	ver=.4
+	ye=ya+dy
+	xe=xa+ver*(ye-ya):lr=(xe-xa)*.4
+	xm=xa+(xe-xa)/2
+	if n=0 then line (xa,ya)-(xe,ye),weiss,B
+	line (xa+1,ya+1)-(xe-1,ye-1),schwarz,BF
+	circle (xm,ya+1/6*(ye-ya)),lr,rot
+	if rotein then paint step(0,0),rot else paint step(0,0),drot,rot
+	circle (xm,ya+3/6*(ye-ya)),lr,gelb
+	if gelbein then paint step(0,0),gelb else paint step(0,0),dgelb,gelb
+	circle (xm,ya+5/6*(ye-ya)),lr,gruen
+	if gruenein then paint step(0,0),gruen else paint step(0,0),dgruen,gruen
+	return
+
+ampel2:
+	ver=.7
+	ye=ya+dy
+	xe=xa+ver*(ye-ya):lr=(xe-xa)*.4
+	xm=xa+(xe-xa)/2
+	line (xa,ya)-(xe,ye),weiss,B
+	line (xa+1,ya+1)-(xe-1,ye-1),schwarz,BF
+	circle (xm,ya+1/4*(ye-ya)),lr,rot
+	if rotein then paint step(0,0),rot else paint step(0,0),drot,rot
+	circle (xm,ya+3/4*(ye-ya)),lr,gruen
+	if gruenein then paint step(0,0),gruen else paint step(0,0),dgruen,gruen
+	return
\ No newline at end of file
diff --git a/ansipack.bas b/ansipack.bas
new file mode 100644
index 0000000..5e925be
--- /dev/null
+++ b/ansipack.bas
@@ -0,0 +1,104 @@
+	cls
+	maxzei=50
+	maxwert=100
+	$include "logo.inc"
+	color 15:print"��� ANSI-PACKer ��� v";ver$;" by RoboCop INDUSTRIES"
+	print
+	print"Dieses Programm sucht in ANSI-Dateien (mei�t mit .ANS Endung) nach"
+	print"doppelten Deklarationen. (z.B.: 0;36m�0;37m� ==> 0;36m�37m�)!"
+
+TryAgain:
+	print
+	color 14
+	input"Dateiname (mit Endung): ",fil$
+	if fil$="" then goto ENDE
+	on error goto WheresTheFile
+	open "I",#1,fil$
+	close #1
+	on error goto
+	outfil$=""
+	for x=1 to len(fil$)
+	  if mid$(fil$,x,1)="." then exit for
+	  outfil$=outfil$+mid$(fil$,x,1)
+	next x
+	if len(outfil$)<8 then outfil$=outfil$+"2.ANS" else outfil$=left$(outfil$,7)+"2.ANS"
+	print"Ausgabedatei          : ";outfil$
+	color 10:print"[G]ut so!                   ";
+	color 12:print"[�]ndern!?":color 14
+1	a$=inkey$:if a$="" then 1
+	if a$="g" or a$="G" then goto 2
+	if a$="�" or a$="�" then goto 3
+	goto 1
+
+WheresTheFile:
+	print
+	color 28:print"Datei nicht gefunden!!!"
+	color 12:print"�berpr�fen Sie den Dateinamen auf Richtigkeit!"
+	delay 5
+	resume TryAgain
+
+3	print
+	input"Ausgabedatei (mit Endung): ",outfil$
+	goto 2
+2    color 15
+	print
+	print"DIMensioniere Variablen auf";maxzei;"Zeilen ... ";
+	dim zeile$(maxzei)
+	dim wert$(maxwert,10)
+	print"Variablen dimensioniert"
+	print"�ffne Eingabedatei ... ";
+	open "I",#1,fil$
+	print"Datei ge�ffnet"
+	print"�ffne Ausgabedatei ... ";
+	open "O",#2,outfil$
+	print"Datei ge�ffnet"
+	anzw=0
+	print"Lese Eingabedatei ein ...";
+	x=1
+4	line input#1,zeile$(x)
+	if eof(1) then zeilen=x else x=x+1:goto 4
+	print zeilen;"Zeilen eingelesen"
+	print "Lese Werte ein ...";
+	for zei=1 to zeilen
+	  for xpos=1 to len(zeile$(zei))
+	    x$=mid$(zeile$(zei),xpos,1)
+	    if vlue=1 then value$=value$+x$
+	    if x$="m" then vlue=0:y=y+1:gosub ScrambleIt
+	    if x$="[" then vlue=1
+	  next xpos
+	next zei
+	maxw=y
+	print anzw;"Werte in";y;"Wertegruppen gelesen"
+
+
+
+
+
+
+
+	goto ENDE
+
+ScrambleIt:
+	z=1
+	x=1
+10	if mid$(value$,x,1)=";" then anzw=anzw+1:z=z+1:x=x+1:if x=len(value$) then value$="":return else goto 10
+	wert$(y,z)=wert$(y,z)+mid$(value$,x,1)
+	x=x+1:if x=len(value$) then value$="":return else goto 10
+
+
+
+
+
+
+
+
+
+
+ENDE:
+	print
+	print"Fahre Programm herunter ... ";
+	close #1
+	close #2
+	print"Programm heruntergefahren."
+	print
+	end
\ No newline at end of file
diff --git a/bargraph.bas b/bargraph.bas
new file mode 100644
index 0000000..ade73f1
--- /dev/null
+++ b/bargraph.bas
@@ -0,0 +1,33 @@
+Mode=8					'vidmode to use
+Lines=25					'number of lines in desired vidmode
+Columns=80				'number of columns in desired vidmode
+TakesPerLine=Columns/40		'calculates loops per line
+BGCol=0					'enables backgroundcolorchange
+
+if BGCol=1 then BG1=1:BG2=2:BG3=3:BG4=4 else BG1=0:BG2=0:BG3=0:BG4=0
+
+screen Mode
+WoAllesBegann:
+x=x+1
+color  9,BG1:print" ���";		'Bargraph forward
+color  9,BG3:print"� ";
+color 11,BG3:print"��";
+color 11,BG2:print"��";
+color 10,BG2:print"��";
+color 14,BG2:print"���";
+color 14,BG4:print"��";
+color 12,BG4:print"���";
+delay .05
+color 12,BG4:print"۲�";		'Bargraph backward
+color 14,BG4:print"��";
+color 14,BG2:print"۲�";
+color 10,BG2:print"۱";
+color 11,BG2:print"��";
+color 11,BG3:print"۱";
+color  9,BG3:print" �";
+color  9,BG1:print"۲� ";
+delay .1
+if inkey$=chr$(27) then end
+if x=(Lines-1)*TakesPerLine then locate Lines,1
+if x=Lines*TakesPerLine then color 15,0,0:end else goto WoAllesBegann
+
\ No newline at end of file
diff --git a/bargraph.nfo b/bargraph.nfo
new file mode 100644
index 0000000..41c7fec
--- /dev/null
+++ b/bargraph.nfo
@@ -0,0 +1,22 @@
+�: Total        ��۱ �۲��۱�۲����  888 + 888 = 888 Mb  Phys= 888
+Chr-ASCII-Code  �������������������� Chr FC BC
+FC -Vordergrund ���������������������219/12/x
+BC -Hintergrund ���������������������178/12/4
+x = egal        ���������������������177/12/4
+                ���������������������177/14/4
+                ���������������������178/14/4
+                ���������������������219/14/x
+                ���������������������178/14/2
+                ���������������������177/14/2
+                ���������������������219/10/x
+                ���������������������177/10/2
+                ���������������������177/11/2
+                ���������������������178/11/2
+                ���������������������219/11/x
+                ���������������������177/11/3
+                ��������������������� 32/ x/3
+                ���������������������177/ 9/3
+                ���������������������219/ 9/x
+                ���������������������178/ 9/1
+                ���������������������177/ 9/1
+                ��������������������� 32/ x/1
diff --git a/bildtest.bas b/bildtest.bas
new file mode 100644
index 0000000..740cfd7
--- /dev/null
+++ b/bildtest.bas
@@ -0,0 +1,60 @@
+	screen 12
+	call g(40,0)
+	call g(15,0)
+	for i=0 to 639 step 40
+	  line (i,0)-(i+40,480),i/40,bf
+	next i
+	call w(0)
+	call d(0,639,0,480,20,15,1)
+	call w(0)
+	for i=0 to 500 step 10
+	  circle (320,240),i,2
+	next
+	call w(0)
+	z=1
+	for i=0 to 630 step 160
+	  z=z+1
+	  call m(i,i+160,z,0,240)
+	next
+	z=6
+	for i=0 to 630 step 160
+	  z=z-1
+	  call m(i,i+160,z,240,479)
+	next
+	call w(0)
+	call g(40,1)
+	call d(20,620,20,460,80,80,0)
+	call d(60,620,60,460,80,80,0)
+	call w(0)
+
+	SUB w(c)
+	  c$=inkey$
+	  do
+	  loop until instat
+	  if c=0 then cls
+	END SUB
+
+	SUB g(s,c)
+	  cls
+	  for x=0 to 639 step s
+	    line (x,0)-(x,479),15
+	  next
+	  for y=10 to 479 step s
+	    line (0,y)-(639,y),15
+	  next
+	  call w(c)
+	END SUB
+
+	SUB d(x1,x2,y1,y2,s1,s2,wa)
+	  for x=x1 to x2 step s1
+	    for y=y1 to y2 step s2
+		 if wa=0 then paint (x,y),15,15 else pset (x,y)
+	    next
+	  next
+	END SUB
+
+	SUB m(x1,x2,s,j,k)
+	  for x=x1 to x2 step s
+	    line (x,j)-(x,k),15
+	  next
+	END SUB
\ No newline at end of file
diff --git a/bin-dez.bas b/bin-dez.bas
new file mode 100644
index 0000000..e326cdb
--- /dev/null
+++ b/bin-dez.bas
@@ -0,0 +1,161 @@
+shell "mode co80"
+cls
+gosub StatusPaint
+memo=26:memo$="Bitte warten...":gosub StatusDisp
+locate 1,1
+color 14:print"Umrechnungen BIN/DEZ written by RoboCop INDUSTRIES"
+color 15:print
+print"W�hlen Sie eine Umrechnung:";:color 31:print"_":for z=0 to 7500:next z
+locate 3,28:print" "
+print"_":for z=0 to 7500:next z:locate 4,1:print" "
+texta$="[1] DEZimal in BIN�r"
+textb$="[2] BIN�r in DEZimal"
+for z=1 to 20
+locate 5,z:color 15
+print mid$(texta$,z,1);:color 31:print"_"
+for x=0 to 500:next x
+next z
+for x=0 to 7500:next x
+locate 5,21:print" "
+locate 6,1:color 31:print"_"
+for x=0 to 7500:next x
+locate 6,1:print" "
+for z=1 to 20
+locate 7,z:color 15
+print mid$(textb$,z,1);:color 31:print"_"
+for x=0 to 500:next x
+next z
+for x=0 to 7500:next x
+locate 7,21:print" "
+color 31:print"_"
+for x=0 to 7500:next x
+locate 8,1:print" "
+texta$="Geben Sie eine Zahl ein: "
+for z=1 to 25
+locate 9,z:color 15
+print mid$(texta$,z,1);:color 31:print"_"
+for x=0 to 500:next x
+next z
+Anfang:
+memo=14:memo$="Ziffer eingeben!":gosub StatusDisp
+1 a$=inkey$:if a$="" then 1
+if a$="1" then goto DezToBin
+if a$="2" then goto BinToDez
+goto 1
+
+DezToBin:
+locate 9,26:color 15:print"1";:color 31:print"_"
+memo=26:memo$="Bitte warten...":gosub StatusDisp
+for z=0 to 5000:next z
+textb$="  -  Dezimal in Bin�r umrechnen"
+for z=1 to 31
+locate 9,26+z:color 15
+print mid$(textb$,z,1);:color 31:print"_"
+for x=0 to 500:next x
+next z
+cls
+gosub StatusPaint
+memo=14:memo$="Bitte Zahl eingeben":gosub StatusDisp
+locate 1,1
+color 10:print"Umrechnen von Dezimal in Bin�r"
+color 12:print"             This program was written by RoboCop INDUSTRIES"
+color 0:print"Wenn du diesen Text lesen kannst, hast du das hier ausgedruckt oder bist in"
+print"der Datei! Und das sollst du nicht! Geh weg, la� mich in ruh'!"
+print"Fick dich ins Knie!"
+color 15
+input"Geben Sie eine Dezimale Zahl ein: ",dez
+memo=26:memo$="Bitte warten...":gosub StatusDisp
+zhl=0
+erg$=""
+erg=0
+mx=67108864
+for z=1 to 27
+if zhl+mx>dez then mx=mx/2:if erg=1 then erg$=erg$+"0":goto 2 else goto 2
+erg$=erg$+"1":erg=1:zhl=zhl+mx:mx=mx/2
+2 next z
+memo=10:memo$="Bitte Taste dr�cken":gosub StatusDisp
+color 15:locate 8,1
+print"Die Bin�rzahl lautet :";erg$
+3 a$=inkey$:if a$="" then 3
+goto EndAsk
+
+BinToDez:
+locate 9,26:color 15:print"2";:color 31:print"_"
+memo=26:memo$="Bitte warten...":gosub StatusDisp
+for z=0 to 5000:next z
+textb$="  -  Bin�r in Dezimal umrechnen"
+for z=1 to 31
+locate 9,26+z:color 15
+print mid$(textb$,z,1);:color 31:print"_"
+for x=0 to 500:next x
+next z
+cls
+gosub StatusPaint
+memo=14:memo$="Bitte Code eingeben":gosub StatusDisp
+locate 1,1
+color 10:print"Umrechnen von Bin�r in Dezimal"
+color 12:print"             This program was written by RoboCop INDUSTRIES"
+color 0:print"Wenn du diesen Text lesen kannst, hast du das hier ausgedruckt oder bist in"
+print"der Datei! Und das sollst du nicht! Geh weg, la� mich in ruh'!"
+print"Fick dich ins Knie!"
+color 15
+input"Geben Sie einen Bin�r-Code ein: ",bn$
+memo=26:memo$="Bitte warten...":gosub StatusDisp
+mx=1
+for z=0-len(bn$) to -1
+zhl$=mid$(bn$,z*-1,1)
+if zhl$="1" then erg=erg+mx:goto 5
+if zhl$="0" then goto 5
+5 mx=mx*2:next z
+memo=10:memo$="Bitte Taste dr�cken":gosub StatusDisp
+color 15:locate 8,1
+print"Die Dezimalzahl lautet: ";erg
+7 a$=inkey$:if a$="" then 7
+goto EndAsk
+
+EndAsk:
+memo=12:memo$="J oder N dr�cken":gosub StatusDisp
+locate 10,1
+color 14
+print"Wollen Sie noch eine Umrechnung machen [J/N] ?"
+4 a$=inkey$:if a$="" then 4
+if a$="j" or a$="J" then goto Begin
+if a$="n" or a$="N" then goto Ende
+goto 4
+
+Begin:
+cls
+gosub StatusPaint
+memo=14:memo$="Ziffer eingeben!":gosub StatusDisp
+locate 1,1:color 14:print"Umrechnen von BIN�r- und DEZimal-Zahlen"
+color 10:print"                     written by RoboCop INDUSTRIES"
+print
+print
+color 15:print"[1] Umrechnen von DEZ in BIN"
+print
+print"[2] Umrechnen von BIN in DEZ"
+print
+print"Geben Sie eine Zahl ein: "
+goto Anfang
+
+StatusDisp:
+locate 24,3:color memo
+for z=len(memo$) to 21
+memo$=memo$+" "
+next z
+print memo$;
+return
+
+StatusPaint:
+locate 21,1:color 15:print"��������Ŀ"
+locate 22,1:color 15:print"� Status �"
+locate 23,1:color 15:print"�����������������������Ŀ"
+locate 24,1:color 15:print"� --------------------- �";
+locate 25,1:color 15:print"�����������������������ͼ";
+return
+
+Ende:
+color 15
+cls
+locate 1,1
+end
\ No newline at end of file
diff --git a/bitmap/bitmap.bas b/bitmap/bitmap.bas
new file mode 100644
index 0000000..0179bbc
--- /dev/null
+++ b/bitmap/bitmap.bas
@@ -0,0 +1,203 @@
+	CLS
+	shell "mode co80"
+	$INCLUDE "PBWINDOW.INC"
+	goto Weiter
+	$INCLUDE "FX_WRITE.INC"
+
+Weiter:
+	$INCLUDE "LOGO.INC"
+'	goto StartUp
+	TXT$="presents"
+	Lin=CSRLIN-1
+	gosub WriteText
+	print
+	TXT$="The BitMaP-Brother"
+	Lin=csrlin-1
+	gosub WriteText
+	delay 1
+	goto StartUp
+
+FileNotExist:
+	close #1
+	Msg$=Msg$+"FEHLER!"
+	call PrtWindow(5,2,Msg$)
+	call MakeWindow(10,20,6,40,ColAttr%(12,4),5,4,2)
+	call TitleWindow(2,"[ Fehler 001 ]")
+	for x=1 to 3
+	  sound 1000,1
+	  delay 1.5/18.2
+	next x
+	call PrtCWindow(2,"Diese Datei existiert nicht!")
+	call PrtCWindow(3,"Geben Sie eine existierende an.")
+	call TitleWindow(5," Taste ... ")
+3	a$=inkey$:if a$="" then 3
+	call RemoveWindow
+	call PrtWindow(5,2,"                                        ")
+	if NoError=0 then resume NeedInput else goto NeedInput
+
+StartUp:
+	call MakeWindow(10,18,11,44,ColAttr%(15,1),4,4,1)
+	call TitleWindow(1,"[ The Bitmap-Brother ]")
+	call PrtWindow(2,2,"Geben Sie die Datei an, welche nach BMPs")
+NeedInput:
+	call PrtWindow(3,2,"durchsucht werden soll:                 ")
+	locate 13,44:color 14,1
+	input "",File$
+	File$=ucase$(File$)
+	if File$="Q" then goto Ende
+	Msg$="�ffne '"+File$+"' ... "
+	on error goto FileNotExist
+	call PrtWindow(5,2,Msg$)
+	open "B",#1,File$
+	on error goto
+	DOS$="DIR "+File$+" >BITMAP.$$1"
+	shell DOS$
+	open "I",#2,"BITMAP.$$1"
+	for x=1 to 6
+	line input #2,FileInfo$
+	next x
+	close #2
+	kill "BITMAP.$$1"
+	FileSize=(val(mid$(FileInfo$,16,3))*1000000)+(val(mid$(FileInfo$,20,3))*1000)+(val(mid$(FileInfo$,24,3)))
+	if FileSize=0 then NoError=1:kill File$:goto FileNotExist
+	Msg$="�ffne '"+File$+"' ... ge�ffnet"
+	call PrtWindow(5,2,Msg$)
+	call PrtWindow(6,2,"Durchsuche Datei ... ")
+	call MakeWindow(5,5,16,64,ColAttr%(15,1),1,4,1)
+	call TitleWindow(1,"[ Durchsuche Datei ... ]")
+	ONSymb1=219
+	ONSymb2=178
+	ONSymb3=177
+	ONSymb4=176
+	OFSymb=250
+	call PrtWindow(2,2,"Starte Scan ...")
+	StartUpHour=val(mid$(Time$,1,2))
+	StartUpMinu=val(mid$(time$,4,2))
+	StartUpSeco=val(mid$(time$,7,2))
+	Time$="00:00:00"
+	Msg$="Byte XXXXXXXXX von "+using$("#########",FileSize)
+	call PrtWindow(4,2,Msg$)
+	Msg$=""
+	for x=1 to 60
+	  Msg$=Msg$+chr$(OFSymb)
+	next x
+	call PrtWindow(6,2,Msg$)
+	call PrtWindow(7,2,"0             2              5              7              1")
+	call PrtWindow(8,2,"              5              0              5              0")
+	call PrtWindow(9,2,"                                                           0")
+	ActBytes=1
+StartSearch:
+	gosub UpDisp
+	Get$ #1,54,Search$
+	Se$=mid$(search$,30,25)
+	s$=mid$(search$,30,1)
+	sf$=""
+	for x=1 to 25
+	  sf$=sf$+s$
+	next x
+	nulla$=mid$(search$,10,1)
+	nullb$=mid$(search$,22,1)
+	nullc$=mid$(search$,26,1)
+	null=ascii(nulla$)+ascii(nullb$)+ascii(nullc$)
+	nullb=0
+	for x=29 to 54
+	  nullb=nullb+ascii(mid$(search$,x,1))
+	next x
+	nullc=ascii(mid$(search$,1,1))+ascii(mid$(search$,2,1))
+	nullc=nullc+ascii(mid$(search$,3,1))+ascii(mid$(search$,19,1))
+	nullc=nullc+ascii(mid$(search$,23,1))
+	if Se$=sf$ and null=0 and nullb=0 and nullc<>0 then
+	  BMPs=BMPs+1
+	  if BMPs=1 then B$="" else B$="s"
+	  Msg$=using$("####",BMPs)+" BMP"+B$+" gefunden "
+	  call PrtWindow(12,2,Msg$)
+	  OFile$=mid$(str$(BMPs),2,10)+".BMP"
+	  Size$=mid$(Search$,3,8)
+	  V1$=Size$:gosub BVar:Size$=V2$
+	  Wid$=mid$(Search$,19,4)
+	  V1$=Wid$:gosub BVar:Wid$=V2$
+	  Hei$=mid$(Search$,23,4)
+	  V1$=Hei$:gosub BVar:Hei$=V2$
+	  Bits$=mid$(Search$,29,1)
+	  gosub WriteBMP
+	end if
+	ActBytes=ActBytes+1
+	seek #1,ActBytes
+	goto StartSearch
+
+
+
+	goto Ende
+
+BVar:
+	  V2$=""
+	  for x=len(V1$) to 1 step -1
+	    V2$=V2$+mid$(V1$,x,1)
+	  next x
+	  return
+
+Hex2Dec:
+'	H=&H$
+
+WriteBMP:
+	open "O",#2,OFile$
+	close #2
+	return
+
+UpDisp:
+	Msg$="Byte "+using$("#########",ActBytes)
+	call PrtWindow(4,2,Msg$)
+	if ShowPer=10 then ShowPer=0 else SkipPer
+	Percent=ActBytes/FileSize
+	Blocks=Percent*60
+11	if Blocks>=1 then Blocks=Blocks-1:Per$=Per$+Chr$(ONSymb1):goto 11
+	B1=Blocks
+12	if Blocks/.75>=1 then Blocks=Blocks-int(Blocks/.75)*.75:Per$=Per$+Chr$(ONSymb2):goto 12
+	B2=Blocks
+13	if Blocks/.5>=1 then Blocks=Blocks-int(Blocks/.5)*.5:Per$=Per$+Chr$(ONSymb3):goto 13
+	B3=Blocks
+14	if Blocks/.25>=1 then Blocks=Blocks-int(Blocks/.25):Per$=Per$+Chr$(ONSymb4):goto 14
+	B4=Blocks
+	call PrtWindow(6,2,Per$)
+	Per$=""
+SkipPer:
+	ShowPer=ShowPer+1
+	Msg$="Zeit: "+Time$
+	call PrtWindow(10,2,Msg$)
+	if Percent>0 then else goto SkipRTime
+	HD=val(mid$(time$,1,2))
+	MD=val(mid$(time$,4,2))
+	SD=val(mid$(time$,7,2))
+	TiDiff=HD*100+MD+(SD/100)/.6
+	ATime=(ATime+TiDiff)/2
+	if Now<300 then SkipRTime else Now=0
+	RTime=ATime/Percent
+	RTime2=int(Rtime)
+	RH=int(Rtime2/100)
+	RM=int(RTime2-RH*100)
+	RS=(Rtime-Rtime2)*100*.6
+	if RS>=59.5 then RM=RM+1:RS=RS-59.5
+	if RM>=59.5 then RH=RH+1:RM=RM-59.5
+	rH$=mid$(str$(int(RH)),2,2)
+	rM$=mid$(str$(int(RM)),2,2)
+	rS$=mid$(str$(int(RS)),2,2)
+	if inkey$=chr$(27) then end
+	if len(rH$)<2 then RH$="0"+rh$
+	if len(rM$)<2 then RM$="0"+rm$
+	if len(rS$)<2 then RS$="0"+rs$
+	TEnd$=RH$+":"+RM$+":"+RS$
+	Msg$="vorr. Ende: "+TEnd$
+	call PrtWindow(10,25,Msg$)
+SkipRTime:
+	Now=Now+1
+	if ActBytes>=FileSize then Ende
+	return
+
+
+
+Ende:
+	NowHour=val(mid$(time$,1,2))
+	NowMinu=val(mid$(time$,4,2))
+	NowSeco=val(mid$(time$,7,2))
+	TimeNow$=using$("##:",StartUpHour+NowHour)+using$("##:",StartUpMinu+NowMinu)+using$("##",StartUpSeco+NowSeco)
+	Time$=TimeNow$
\ No newline at end of file
diff --git a/bitmap/bitmap.txt b/bitmap/bitmap.txt
new file mode 100644
index 0000000..80fd7df
--- /dev/null
+++ b/bitmap/bitmap.txt
@@ -0,0 +1,45 @@
+Header     : 54 Bytes
+Farbtabelle: 1024 Bytes (nur bei 256 Farben)
+Bildinfo   : BxHxX  (siehe Tabelle)
+             �������
+Gr��e      :  H+F+B
+            ���������
+
+X Farbtiefe
+- ---------
+1 256 Farben/256 Graustufen/16 Farben
+2 32767 Farben/RealColor
+2 65535 Farben/HighColor
+3 16777216 Farben/TrueColor
+
+256C - 253638 Bytes (siehe unten)
+TC   - 675054 Bytes
+
+
+Byte   256C  TC
+ 02     C6   E6
+ 03     DE   8F
+ 04     03   0B
+ 0B     04   00
+ 1C     08   18
+
+616x410 - 253638 Bytes (ohne Header&Farbtab - 252560)
+308x205 - 63398 Bytes (ohne Header&Farbtab - 63140)
+
+Byte   616x410  308x205
+ 02      C6       A6  ķ
+ 03      DE       F7   �� Dateigr��e (komplett)
+ 04      03       00  Ľ
+ 12      68       30  ��� Breite
+ 13      02       01  Ľ
+ 16      9A       CD  ��� H�he
+ 17      01       00  Ľ
+ 1C      08       08  ��� Farbtiefe (08-8bit, 0F - 16bit, 18-24bit)
+
+Byte(s)    Beschreibung
+---------- ------------------------------------
+0000-0001  Kennung "BM" f�r BitMap
+0002-0009  Gr��e der Datei
+0012-0015  Breite des Bildes
+0016-0019  H�he des Bildes
+  0001C    Anzahl Bits pro Pixel
diff --git a/bootinfo.bas b/bootinfo.bas
new file mode 100644
index 0000000..2a59715
--- /dev/null
+++ b/bootinfo.bas
@@ -0,0 +1,132 @@
+	ver$="1.3"
+	BeginCheck=10000
+	print"Scanning for Checksum .";
+	shell "DIR BOOTINFO.EXE > BOOTINFO.TMP"
+	print".";
+	for x=1 to len(command$)
+	  if File=0 then LogFile$=LogFile$+mid$(command$,x,1)
+	  if File=1 then OutText$=OutText$+mid$(command$,x,1)
+	  if mid$(command$,x+1,1)=" " then File=1
+	next x
+	print".";
+	open "I",#1,"BOOTINFO.TMP"
+	for z=1 to 5
+	  line input#1,DummesZeugs$
+	next z
+	print".";
+	line input#1,DateiInfo$
+	close #1
+	kill "BOOTINFO.TMP"
+	print".";
+	open "O",#1,"BOOTINFO.TMP"
+	print#1,"PHYSICALLY DELETED! HARHARHAR!"
+	close #1
+	kill "BOOTINFO.TMP"
+	print".";
+	FileSize=val(mid$(DateiInfo$,14,5))*1000000+val(mid$(DateiInfo$,20,3))*1000+val(mid$(DateiInfo$,24,3))
+	FileDate$=mid$(DateiInfo$,28,8)
+	FileTime$=mid$(DateiInfo$,39,5)
+	ver$=ver$+"   ("+FileDate$+" / "+FileTime$+")"
+	open "BOOTINFO.EXE" FOR BINARY AS #1
+	get$ #1,256,CheckSum$
+	print".";
+	CheckSumme=0
+	get$ #1,BeginCheck-1,Dummy$
+	Dummy$=""
+	for x=BeginCheck to FileSize step 4
+	  if x=23738 or x=23740 then goto HereIsNext
+	  get$ #1,2,CheckSum$
+	  CurrentCheckSumL=ASCII(left$(CheckSum$,1))
+	  CurrentCheckSumR=ASCII(right$(CheckSum$,1))
+	  if CurrentCheckSumL=-1 then CurrentCheckSumL=0
+	  if CurrentCheckSumR=-1 then CurrentCheckSumR=0
+	  CheckSumme=CheckSumme+CurrentCheckSumL+CurrenCheckSumR
+	  if CheckSumme>65535 then CheckSumme=-65535+CheckSumme
+HereIsNext:
+	next x
+	close #1
+	CheckSum$=hex$(CheckSumme)
+	print". ";
+	IF FileSize<>0025488 then goto FileSizeAlert
+	if CheckSum$<>"9055" then goto CheckSumAlert
+	print"Veryfied (";mid$(str$(FileSize),2,20);" / ";CheckSum$;")"
+	IF COMMAND$="" THEN GOTO Syntax
+	sound 750,2
+	delay 3/18.2
+	sound 1250,1
+	delay 2/18.2
+	sound 1250,1
+	delay 2/18.2
+	sound 1500,2
+	color 7:print"Writing BootInfo .";
+	open "A",#1,LogFile$
+	print".";
+	dat$=mid$(date$,4,2)+"."+mid$(date$,1,2)+"."+mid$(date$,7,4)
+	OutText$=dat$+" / "+time$+"   "+OutText$
+	print".";
+	print#1,OutText$
+	print".";
+	close #1
+	print". ";
+	print"Written (";mid$(str$(len(OutText$)),2,4);" Chars)"
+	goto Ende
+
+Syntax:
+	$INCLUDE "LOGO.INC"
+	color 14
+	print"another program from RoboCop INDUSTRIES"
+	print:color 10
+	print"BootInfo - v";ver$:color 15
+	print
+	print"Syntax: BootInfo [Log-File] [Information]"
+	print:color 7
+	print"Log-File      - Filename of the Log-File"
+	print"                If it exists the entry will be added."
+	print"Information   - The Text, which will be written to the Log-File"
+	goto Ende
+
+CheckSumAlert:
+	print"Alert [CheckSum does not match (";CheckSum$;")]"
+	goto VirusAlert
+
+FileSizeAlert:
+	print"Alert [FileSize does not match (";mid$(str$(FileSize),2,20);")]"
+	goto VirusAlert
+
+VirusAlert:
+	$INCLUDE "LOGO.INC"
+	color 28
+	print
+	print"VIRUS ALERT!!!!!!!"
+	color 12
+	print
+	print"The File-Checksum is changed, possibly a virus"
+	print"infected this file or some HACKERs have done it's work."
+	print:color 26
+	print"This program locks up in 5 seconds...";
+	for y=1 to 30
+	  for x=1 to 500 step 75
+	    sound 750+x,.5
+	  next x
+	next y
+	color 10
+	print"LOCKED UP"
+	delay 1.5
+	sound 750,1
+	sound 1250,1
+	print"BOOT UP Sequence engaged, please confirm..."
+	delay 1
+	sound 1250,1
+	sound 1500,2
+	sound 800,3
+	print"BOOT UP Sequence confirmed. Boot.";
+	for x=1 to 4
+	  delay 1
+	  print ".";
+	next x
+	print
+	$INLINE "INLINES\BOOT_R.COM"
+
+
+
+Ende:
\ No newline at end of file
diff --git a/bootpass/access.dat b/bootpass/access.dat
new file mode 100644
index 0000000..d0a48df
--- /dev/null
+++ b/bootpass/access.dat
@@ -0,0 +1 @@
+"RoboCop","Markus Birth","16. Nov 1980","Musterstrasse 1","12345 Musterstadt","(0123) 4567","(0123) 4567 [9600 Baud]","",1,"RC","RC"
diff --git a/bootpass/bootpass.bas b/bootpass/bootpass.bas
new file mode 100644
index 0000000..00398f2
--- /dev/null
+++ b/bootpass/bootpass.bas
@@ -0,0 +1,695 @@
+	on error goto Fehler
+	dim pname$(25)
+	dim rname$(25)
+	dim birth$(25)
+	dim adress1$(25)
+	dim adress2$(25)
+	dim tele$(25)
+	dim fax$(25)
+	dim codenum$(25)
+	dim master(25)
+	dim mpasswd1$(25)
+	dim mpasswd2$(25)
+	cls
+	color 15:print"USER VERIFICATION"
+	locate 1,73:color 31:print"STRICTED";
+	color 7
+	print
+	input "Type in tha name: ",nam$
+	print
+	gosub GetInfo
+	color 15:print"Real Name   :";:color 7:? rname$;:color 23
+	if MASTER=1 then print"      *** MASTER ACCESS ABILITY ***" else print
+	color 15:print"Birthday    :";:color 7:? birth$
+	color 15:print"Age (DATE$) :";:color 7:? compage$
+	color 15:print"Adress      :";:color 7:? adress1$
+	print"             ";adress2$
+	color 15:print"Telephone   :";:color 7:? tele$
+	color 15:print"FAX         :";:color 7:? fax$
+	print
+	try=1
+	print"And now tha ";
+3	print"Code-numba (";mid$(str$(try),2,20);". Try): ";
+	gosub GetCode
+	if try>=3 and cod$<>codenum$ then msg$="Your 3 Trys are out:":goto FuckHim
+	if cod$=codenum$ and try<=3 then pass=1 else try=try+1:print:goto 3
+	if MASTER=1 then goto MASTERPROG else goto CONTBOOT
+
+GetInfo:
+	msg$="Trying to cheat ??? --->"
+	on error goto FuckHim
+	open "I",#1,"access.dat"
+1	input#1,pname$,rname$,birth$,adress1$,adress2$,tele$,fax$,codenum$,MASTER,mpasswd1$,mpasswd2$
+	if pname$=nam$ then
+	  datd=val(left$(date$,2))
+	  datm=val(mid$(date$,4,2))
+	  daty=val(right$(date$,2))
+	  hed=val(left$(birth$,2))
+	  hm$=mid$(birth$,5,3)
+	  if hm$="Jan" then hem=1
+	  if hm$="Feb" then hem=2
+	  if hm$="Mar" then hem=3
+	  if hm$="Apr" then hem=4
+	  if hm$="May" then hem=5
+	  if hm$="Jun" then hem=6
+	  if hm$="Jul" then hem=7
+	  if hm$="Aug" then hem=8
+	  if hm$="Sep" then hem=9
+	  if hm$="Oct" then hem=10
+	  if hm$="Nov" then hem=11
+	  if hm$="Dec" then hem=12
+	  if hem=0 then hem=6
+	  hey=val(right$(birth$,2))
+	  compage=daty-hey
+	  if datm<hem and datd<hed then compage=compage-1
+	  if hed>0 and hem>0 and hey>0 then compage$=mid$(str$(compage),2,3)+" years" else compage$="<unknown>"
+	  close #1:reset
+	  on error goto Fehler
+	  return
+	else
+	  goto 1
+	end if
+
+GetCode:
+	cod$=""
+2	a$=inkey$:if a$="" then 2
+	if a$=chr$(13) then return
+	cod$=cod$+a$
+	print"+";
+	goto 2
+
+Fehler:
+	cls
+	color 31:print"!!! WARNING !!!"
+	color 7
+	print
+	print"An error has occured. The"
+	print"program will stop here and"
+	print"beep! To get access to ur"
+	print"system, press the reset-"
+	print"Button or switch ya compu"
+	print"off and then on."
+	delay 10
+	msg$="Ahh, an error:"
+	goto FuckHim
+FuckHim:
+	cls
+	color 10
+	print msg$
+	locate 5,1
+	color 28,0,0
+	print"  �����  �       ������� �����  �������"
+	print" �     � �       �       �    �    �"
+	print" ������� �       �����   ������    �"
+	print" �     � �       �       �  ��     �"
+	print" �     � ������� ������� �   ��    �"
+	color 12
+	print
+	print"Formatting Harddisk ..."
+	sec=5
+4	locate 12,1:print "... in";sec;"seconds! "
+	if sec<=0 then dl=3:goto BOOTSTOP
+	delay 1
+	sec=sec-1
+	goto 4
+
+BOOTSTOP:
+	color 31,0,0
+	cls
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"�������           ����             �����         �����          ����������������";
+	print"�����   �������������������   ��������   �������   ���  �������  ���������������";
+	print"�����   �������������������   ��������   �������   ���  �������  ���������������";
+	print"�����   �������������������   ��������   �������   ���  �������  ���������������";
+	print"�������           ���������   ��������   �������   ���          ����������������";
+	print"�����������������   �������   ��������   �������   ���  ������������������������";
+	print"�����������������   �������   ��������   �������   ���  ������������������������";
+	print"�����������������   �������   ��������   �������   ���  ������������������������";
+	print"�������           ���������   ����������         �����  ������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	print"��������������������������������������������������������������������������������";
+	locate 25,1:print"��������������������������������������������������������������������������������";
+6	for tim=1 to 5
+	delay dl
+	for z=1 to 4
+	sound 2000,1.0
+	delay 1.5/18.2
+	next z
+	next tim
+	if dl>1 then
+	  dl=dl-1
+	elseif dl>0.1 then
+	  dl=dl-.2
+	else
+	  dl=0
+	end if
+	goto 6
+
+CONTBOOT:
+	cls
+	color 31:print"BOOT VERIFICATION ... OK":color 7
+	print
+	system
+
+MASTERPROG:
+	cls
+	color 31:print"MASTER PROGRAM START SEQUENCE ..."
+	color 7
+	print
+	print"Enter Code #1 :";
+	gosub GetCode
+	if cod$<>mpasswd1$ then goto CONTBOOT
+	print
+	print"Enter Code #2 :";
+	gosub GetCode
+	if cod$<>mpasswd2$ then goto CONTBOOT
+	goto MPR
+
+MPR:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 7
+	print
+	print"1 - User-Control"
+	print"2 - System Files"
+	print"3 - Informations"
+	print"4 - Continue BOOT"
+	print
+7	locate 8,1:input"Ya choose :",i
+	if i=1 then goto USA
+	if i=2 then goto SYS
+	if i=3 then goto INF
+	if i=4 then goto CONTBOOT
+	goto 7
+
+USA:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 31:print"     USER CONTROL"
+	color 7
+	print
+	print"1 - Add a User"
+	print"2 - Delete a User"
+	print"3 - Change a User"
+	print"4 - Back to Main Menu"
+	print
+8	locate 9,1:input"Ur choose :",i
+	if i=1 then goto UserAdd
+	if i=2 then goto UserDel
+	if i=3 then goto UserChg
+	if i=4 then goto MPR
+	goto 8
+
+UserAdd:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 07:print"     USER CONTROL"
+	color 31:print"      ADD A USER"
+	color 7
+	print
+	print"--------------------------------------------------------------------------------";
+10	input"Codename/ID            :",pname$
+	input"Code Number            :",codenum$
+	input"Real Name              :",rname$
+	input"Birthday (dd. mmm yyyy):",birth$
+	input"Adress #1 (Street)     :",adress1$
+	input"Adress #2 (City)       :",adress2$
+	input"Telephone Number       :",tele$
+	input"FAX Number             :",fax$
+	input"MASTER access (0/1)    :",master
+	if MASTER=1 then input"MASTER Password #1     :",mpasswd1$
+	if MASTER=1 then input"MASTER Password #2     :",mpasswd2$
+	print"--------------------------------------------------------------------------------";
+9	locate 19,1:input"Is thiz correct (Y/N/B) ?",answ$
+	if answ$="y" or answ$="Y" then goto UserAddWrite
+	if answ$="n" or answ$="N" then locate 6,1:goto 10
+	if answ$="b" or answ$="B" then goto USA
+	goto 9
+
+UserAddWrite:
+	color 15
+	locate 19,1:print space$(70)
+	locate 19,1:print"Opening Channel ... ";
+	open "A",#1,"access.dat"
+	print"OK"
+	print"Writing Data ... ";
+	write#1,pname$,rname$,birth$,adress1$,adress2$,tele$,fax$,codenum$,master,mpasswd1$,mpasswd2$
+	print"OK"
+	print"Closing Channel ... ";
+	close #1:reset
+	print"OK"
+	print"Resetting Data ... ";
+	pname$="":rname$="":birth$="":adress1$="":adress2$="":tele$="":fax$="":master=0:mpasswd1$="":mpasswd2$="":codenum$=""
+	print"OK"
+	color 0,7:print"User Add Complete."
+	color 7,0,0
+	delay 1.5
+	goto USA
+
+UserDel:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 07:print"     USER CONTROL"
+	color 31:print"    DELETE A USER"
+	color 7
+	print
+	print"Opening Channel ... ";
+	reset
+	open "I",#1,"access.dat"
+	print"OK"
+	print"Reading User Data ... ";
+	x=0
+11	x=x+1
+	if eof(1) then goto 12
+	input#1,pname$(x),rname$(x),birth$(x),adress1$(x),adress2$(x),tele$(x),fax$(x),codenum$(x),master(x),mpasswd1$(x),mpasswd2$(x)
+	goto 11
+12	endx=x:on error goto Fehler:print"OK"
+	print"Closing Channel ... ";
+	close#1
+	RESET
+	print"OK"
+	color 0,7:print"USER DATA INPUT COMPLETE":color 7,0,0
+	delay 1.5
+	goto UserDelChoose
+
+UserDelChoose:
+	locate 10,1:print"--------------------------------------------------------------------------------";
+	x=1
+13	locate 11,1:print"Codename/ID   : ";pname$(x);space$(40-len(pname$(x)))
+	if x=1 then print"Codenumber    : ";:color 31:print"*** SECRET ***":color 7 else print"Codenumber    : ";codenum$(x);space$(40-len(codenum$(x)))
+	print"Real Name     : ";rname$(x);space$(40-len(rname$(x)))
+	print"Birthday      : ";birth$(x);space$(40-len(birth$(x)))
+	print"Adress        : ";adress1$(x);space$(40-len(adress1$(x)))
+	print"                ";adress2$(x);space$(40-len(adress2$(x)))
+	print"Telephone     : ";tele$(x);space$(40-len(tele$(x)))
+	print"FAX           : ";fax$(x);space$(40-len(tele$(x)))
+	print"MASTER access : ";
+	if master(x)=1 then print"YES" else print"NO "
+	if x=1 then print"MASTER Pswrd#1: ";:color 31:print"*** SECRET ***":color 7 else print"MASTER Pswrd#1: ";mpasswd1$(x);space$(40-len(mpasswd1$(x)))
+	if x=1 then print"MASTER Pswrd#2: ";:color 31:print"*** SECRET ***":color 7 else print"MASTER Pswrd#2: ";mpasswd2$(x);space$(40-len(mpasswd2$(x)))
+	print"--------------------------------------------------------------------------------";
+	print"  PgUp/PgDn - Look Up/Down      [ENTER] - Delete                  [ESC] - Back";
+	print"--------------------------------------------------------------------------------";
+14	a$=inkey$:if a$="" then 14
+	if mid$(a$,2,1)="I" and x>1 then x=x-1:goto 13
+	if mid$(a$,2,1)="Q" and x<endx-1 then x=x+1:goto 13
+	if a$=chr$(13) then goto UserDelSelected
+	if a$=chr$(27) then goto USA
+	goto 14
+
+UserDelSelected:
+	locate 23,1:print space$(80);
+	locate 23,1
+	if rname$(x)="Markus Birth" then print"Cannot delete programmer!":delay 3:goto 13
+18	input"Delete ^this^ User (Y/N) ??? ";choose$
+	if choose$="y" or choose$="Y" then goto 15
+	if choose$="n" or choose$="N" then goto 13
+	goto 18
+15	cls
+	selx=x
+	color 15:print"*** MASTER PROGRAM ***"
+	color 07:print"     USER CONTROL"
+	color 31:print"    DELETE A USER"
+	print
+	color 7
+	print"Opening Channel ... ";
+	open "O",#1,"access2.dat"
+	print"OK"
+	print"Writing New Data ... ";
+	x=1
+16	if x=selx then x=x+1:goto 16
+	if x=endx then 17
+	write#1,pname$(x),rname$(x),birth$(x),adress1$(x),adress2$(x),tele$(x),fax$(x),codenum$(x),master(x),mpasswd1$(x),mpasswd2$(x)
+	x=x+1
+	goto 16
+17	print"OK"
+	print"Closing Channel ... ";
+	close #1
+	RESET
+	print"OK"
+	print"Killing Original ... ";
+	kill "access.dat"
+	print"OK"
+	print"Renaming TEMP-File ... ";
+	name "access2.dat" as "access.dat"
+	print"OK"
+	print "Deleting Vars ... ";
+	for x=1 to endx
+	pname$(x)="":rname$(x)="":birth$(x)="":adress1$(x)="":adress2$(x)=""
+	tele$(x)="":fax$(x)="":codenum$(x)="":master=0:mpasswd1$(x)="":mpasswd2$(x)=""
+	next x
+	print"OK"
+	color 0,7,0
+	print"USER DELETION COMPLETE"
+	color 7,0,0
+	delay 1.5
+	goto UserDel
+
+UserChg:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 7:print "     USER CONTROL"
+	color 31:print"     CHANGE A USER"
+	color 7:print
+	print"Opening Channel ... ";
+	reset
+	open "I",#1,"access.dat"
+	print"OK"
+	print"Reading User Data ... ";
+	x=0
+19	x=x+1
+	if eof(1) then goto 20
+	input#1,pname$(x),rname$(x),birth$(x),adress1$(x),adress2$(x),tele$(x),fax$(x),codenum$(x),master(x),mpasswd1$(x),mpasswd2$(x)
+	goto 19
+20	endx=x:print"OK"
+	print"Closing Channel ... ";
+	close #1
+	reset
+	print"OK"
+	color 0,7:print"USER DATA INPUT COMPLETE":color 7,0,0
+	delay 1.5
+	goto UserChgChoose
+
+UserChgChoose:
+	locate 10,1:print"--------------------------------------------------------------------------------";
+	x=1
+21	locate 11,1:print"Codename/ID   : ";pname$(x);space$(40-len(pname$(x)))
+	if x=1 then print"Codenumber    : ";:color 31:print"*** SECRET ***":color 7 else print"Codenumber    : ";codenum$(x);space$(40-len(codenum$(x)))
+	print"Real Name     : ";rname$(x);space$(40-len(rname$(x)))
+	print"Birthday      : ";birth$(x);space$(40-len(birth$(x)))
+	print"Adress        : ";adress1$(x);space$(40-len(adress1$(x)))
+	print"                ";adress2$(x);space$(40-len(adress2$(x)))
+	print"Telephone     : ";tele$(x);space$(40-len(tele$(x)))
+	print"FAX           : ";fax$(x);space$(40-len(fax$(x)))
+	print"MASTER access : ";
+	if master(x)=1 then print"YES" else print "NO "
+	if x=1 then print"MASTER Pswrd#1: ";:color 31:print"*** SECRET ***":color 7 else print"MASTER Pswrd#1: ";mpasswd1$(x);space$(40-len(mpasswd1$(x)))
+	if x=1 then print"MASTER Pswrd#2: ";:color 31:print"*** SECRET ***":color 7 else print"MASTER Pswrd#2: ";mpasswd2$(x);space$(40-len(mpasswd2$(x)))
+	print"--------------------------------------------------------------------------------";
+	print"  PgUp/PgDn - Look Up/Down      [ENTER] - Change                  [ESC] - Back";
+	print"--------------------------------------------------------------------------------";
+22	a$=inkey$:if a$="" then 22
+	if mid$(a$,2,1)="I" and x>1 then x=x-1:goto 21
+	if mid$(a$,2,1)="Q" and x<endx-1 then x=x+1:goto 21
+	if a$=chr$(13) then seluser=x:goto UserChgSelected
+	if a$=chr$(27) then goto USA
+	goto 22
+
+UserChgSelected:
+	if seluser=1 then goto ChgRC
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 07:print"     USER CONTROL"
+	color 31:print"     CHANGE A USER"
+	print
+27	color 7
+	print"--------------------------------------------------------------------------------";
+23	locate 06,1:input"Codename/ID   : ",pname$
+	if pname$="" then pname$=pname$(seluser)
+	locate 06,17:print pname$
+	input"Codenumber    : ",codenum$
+	if codenum$="" then
+	  locate 7,50:print"Delete Codenumber (Y/N)?"
+30	  a$=inkey$:if a$="" then goto 30
+	  if a$="y" or a$="Y" then codenum$="":goto 33
+	  if a$="n" or a$="N" then codenum$=codenum$(seluser):goto 33
+	  goto 30
+	end if
+33	locate 7,17:print codenum$
+	input"Real Name     : ",rname$
+	if rname$="" then rname$=rname$(seluser)
+	locate 8,17:print rname$
+	input"Birthday      : ",birth$
+	if birth$="" then birth$=birth$(seluser)
+	locate 9,17:print birth$
+	input"Adress #1 (St): ",adress1$
+	if adress1$="" then adress1$=adress1$(seluser)
+	locate 10,17:print adress1$
+	input"Adress #2 (Ct): ",adress2$
+	if adress2$="" then adress2$=adress2$(seluser)
+	locate 11,17:print adress2$
+	input"Telephone     : ",tele$
+	if tele$="" then tele$=tele$(seluser)
+	locate 12,17:print tele$
+	input"FAX           : ",fax$
+	if fax$="" then fax$=fax$(seluser)
+	locate 13,17:print fax$
+	input"MASTER access*: ",master$
+	if master$="" then master=master(seluser) else master=val(mid$(master$,2,1))
+	locate 14,17:print master
+	input"MASTER Pswrd#1: ",mpasswd1$
+	if mpasswd1$="" then
+	  locate 15,50:print"Delete Password#1 (Y/N)?"
+31	  a$=inkey$:if a$="" then 31
+	  if a$="y" or a$="Y" then mpasswd1$="":goto 34
+	  if a$="n" or a$="N" then mpasswd1$=mpasswd1$(seluser):goto 34
+	  goto 31
+	end if
+34	locate 15,17:print mpasswd1$
+	input"MASTER Pswrd#2: ",mpasswd2$
+	if mpasswd2$="" then
+	  locate 16,50:print"Delete Password#2 (Y/N)?"
+32	  a$=inkey$:if a$="" then 32
+	  if a$="y" or a$="Y" then mpasswd2$="":goto 35
+	  if a$="n" or a$="N" then mpasswd2$=mpasswd2$(seluser):goto 35
+	  goto 32
+	end if
+35	locate 16,17:print mpasswd2$
+	print"--------------------------------------------------------------------------------";
+24	locate 18,1:input"Is ^this^ correct (Y/N/B) ?",answ$
+	if answ$="y" or answ$="Y" then goto UserChgWrite
+	if answ$="n" or answ$="N" then goto 23
+	if answ$="b" or answ$="B" then goto USA
+	goto 24
+
+UserChgWrite:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 7:print"     USER CONTROL"
+	color 31:print"    CHANGE A USER"
+	color 7:print
+	print"Opening Channel ... ";
+	open "O",#1,"access2.dat"
+	print"OK"
+	print"Writing Changed Data ... ";
+	x=1
+25   if x=endx then 26
+	if x=seluser then
+	  write#1,pname$,rname$,birth$,adress1$,adress2$,tele$,fax$,codenum$,master,mpasswd1$,mpasswd2$
+	  x=x+1:goto 25
+	else
+	  write#1,pname$(x),rname$(x),birth$(x),adress1$(x),adress2$(x),tele$(x),fax$(x),codenum$(x),master(x),mpasswd1$(x),mpasswd2$(x)
+	  x=x+1:goto 25
+	end if
+26	print"OK"
+	print"Closing Channel ... ";
+	close #1
+	reset
+	print"OK"
+	print"Killing Original ... ";
+	kill "access.dat"
+	print"OK"
+	print"Renaming TEMP-File ... ";
+	name "access2.dat" as "access.dat"
+	print "OK"
+	print"Deleting Vars ... ";
+	for x=1 to endx
+	pname$(x)="":rname$(x)="":birth$(x)="":adress1$(x)="":adress2$(x)=""
+	tele$(x)="":fax$(x)="":codenum$(x)="":master=0:mpasswd1$(x)="":mpasswd2$(x)=""
+	next x
+	print"OK"
+	color 0,7,0
+	print"USER CHANGE COMPLETE"
+	color 7,0,0
+	delay 1.5
+	goto UserChg
+
+ChgRC:
+	cls
+	color 15:print"*** MASTER PROGRAM ***"
+	color 07:print"     USER CONTROL"
+	color 31:print"  CHANGE PROGRAMMER"
+	color 7:print
+	sound 2000,(18.2*1)*.23
+	delay (1/18.2)*.30
+	sound 2000,18.2*1
+	print"If you want to change the Programmer-Info, you have to"
+	print"know the MAGIC WORD!"
+	print
+	print"What is it ? ";
+	gosub GetCode
+	if cod$="BITTE" then 28
+	print"Second and last Try!"
+	print"The Magic Word is : ";
+	gosub GetCode
+	if cod$="BITTE" then 28
+	goto FuckHim
+28	locate 6,1
+	for z=1 to 5
+	print space$(80);
+	next z
+	locate 5,1:goto 27
+
+SYS:
+	shell"mode co80"
+	cls
+	color 15,0:print"*** MASTER PROGRAM ***"
+	color 31,0:print"     SYSTEM FILES"
+	color 7
+	print
+	print"1 - Look AUTOEXEC.BAT"
+	print"2 - Look CONFIG.SYS"
+	print"3 - Change AUTOEXEC.BAT"
+	print"4 - Change CONFIG.SYS"
+	print"5 - Change ACCESS.DAT"
+	print"6 - Back to Main Menu"
+	print
+36	locate 11,1:input"Ya choose? ",i
+	if i=1 then goto LookAUTO
+	if i=2 then goto LookCONF
+	if i=3 then goto EditAUTO
+	if i=4 then goto EditCONF
+	if i=5 then goto EditACCE
+	if i=6 then goto MPR
+	goto 36
+
+LookAUTO:
+	locate 13,1:color 0,7
+	print"LOOKING ON AUTOEXEC.BAT"
+	color 7,0,0
+	print"Search & Run WPVIEW.EXE ... ";
+	shell"C:\NORTON\NC\WPVIEW.EXE C:\AUTOEXEC.BAT"
+	print"COMPLETE"
+	color 0,7
+	print"AUTOEXEC.BAT VIEWING SOLVED"
+	color 7,0
+	delay 1
+	goto SYS
+
+LookCONF:
+	locate 13,1:color 0,7
+	print"LOOKING ON CONFIG.SYS"
+	color 7,0
+	print"Search & Run WPVIEW.EXE ... ";
+	shell"C:\NORTON\NC\WPVIEW.EXE C:\CONFIG.SYS"
+	print"COMPLETE"
+	color 0,7
+	print"CONFIG.SYS VIEWING SOLVED"
+	color 7,0
+	delay 1
+	goto SYS
+
+EditAUTO:
+	locate 13,1:color 0,7
+	print"EDITING AUTOEXEC.BAT"
+	color 7,0
+	print"Search & Run NCEDIT.EXE ... ";
+	shell"C:\NORTON\NC\NCEDIT.EXE C:\AUTOEXEC.BAT"
+	print"COMPLETE"
+	color 0,7
+	print"AUTOEXEC.BAT EDITING SOLVED"
+	color 7,0
+	delay 1
+	goto SYS
+
+EditCONF:
+	locate 13,1:color 0,7
+	print"EDITING CONFIG.SYS"
+	color 7,0
+	print"Search & Run NCEDIT.EXE ... ";
+	shell"C:\NORTON\NC\NCEDIT.EXE C:\CONFIG.SYS"
+	print"COMPLETE"
+	color 0,7
+	print"CONFIG.SYS EDITING SOLVED"
+	color 7,0
+	delay 1
+	goto SYS
+
+EditACCE:
+	locate 13,1:color 0,7
+	print"EDITING ACCESS.DAT"
+	color 7,0
+	print"Search & Run NCEDIT.EXE ... ";
+	shell"C:\NORTON\NC\NCEDIT.EXE C:\ACCESS.DAT"
+	print"COMPLETE"
+	color 0,7
+	print"ACCESS.DAT EDITING SOLVED"
+	color 7,0
+	delay 1
+	goto SYS
+
+INF:
+	cls
+	color 15,0:print"*** MASTER PROGRAM ***"
+	color 31,0:print"     INFORMATIONS"
+	color 7:print
+	print"1 - FreeMem on C:"
+	print"2 - ChkDsk of C:"
+	print"3 - Mem"
+	print"4 - Back to Main Menu"
+	print
+37	locate 9,1:input"Your choose? ",i
+	if i=1 then goto FreeMemC
+	if i=2 then goto ChkDskC
+	if i=3 then goto Mem
+	if i=4 then goto MPR
+	goto 37
+
+FreeMemC:
+	locate 11,1
+	color 0,7
+	print"EXECING INFO.EXE"
+	color 7,0
+	print"Launching C:\DOS\INFO.EXE ... ";
+	shell"C:\DOS\INFO.EXE"
+	color 0,7
+	locate 25,33:print"LAUNCH COMPLETE";
+	color 7,0
+	delay 3
+	goto INF
+
+ChkDskC:
+	locate 11,1
+	color 0,7
+	print"EXECING CHKDSK.EXE"
+	color 7,0
+	print"Launching C:\DOS\CHKDSK.EXE ... ";
+	print
+	print
+	print
+	print
+	shell"C:\DOS\chkdsk.EXE"
+	color 0,7
+	locate 25,33:print"LAUNCH COMPLETE"
+	color 7,0
+	delay 7
+	goto INF
+
+Mem:
+	locate 11,1
+	color 0,7
+	print"EXECING MEM.EXE"
+	color 7,0
+	print"Launching C:\DOS\MEM.EXE ... ";
+	print
+	print
+	print
+	print
+	shell"C:\DOS\MEM.EXE"
+	color 0,7
+	locate 25,33:print"LAUNCH COMPLETE";
+	color 7,0
+	delay 7
+	goto INF
\ No newline at end of file
diff --git a/bootpass/warn b/bootpass/warn
new file mode 100644
index 0000000..5f352b2
--- /dev/null
+++ b/bootpass/warn
@@ -0,0 +1,25 @@
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+�������           ����             �����         �����          ����������������
+�����   �������������������   ��������   �������   ���  �������  ���������������
+�����   �������������������   ��������   �������   ���  �������  ���������������
+�����   �������������������   ��������   �������   ���  �������  ���������������
+�������           ���������   ��������   �������   ���          ����������������
+�����������������   �������   ��������   �������   ���  ������������������������
+�����������������   �������   ��������   �������   ���  ������������������������
+�����������������   �������   ��������   �������   ���  ������������������������
+�������           ���������   ����������         �����  ������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
+��������������������������������������������������������������������������������
diff --git a/bpm.bas b/bpm.bas
new file mode 100644
index 0000000..5d342c8
--- /dev/null
+++ b/bpm.bas
@@ -0,0 +1,128 @@
+cls
+BPMTime=5
+on timer(BPMTime) GOSUB CalcBPM
+color 15
+print"-=� Beats Per Minute �=-"
+print"  by RoboCop INDUSTRIES"
+print
+print" [1] - Automatik (nicht sicher)"
+print" [2] - Manuelle Eingabe (";BPMTime;"sek. lang [  0  ] im Takt dr�cken)"
+print
+print" [3] - Beenden!"
+print
+print"Dr�cken Sie die gew�nschte Taste"
+1 a$=inkey$:if a$="" then 1
+if a$="1" or a$="!" then goto Automatic
+if a$="2" or a$=chr$(34) then goto Manuell
+if a$="3" then cls:goto Ende
+goto 1
+
+Manuell:
+cls
+print"-=� Beats Per Minute �=-"
+print"    Manuelle Eingabe"
+print
+print"Dr�cken Sie jetzt immer im Takt die 0-Taste auf dem Numerischen"
+print"Tastenfeld. Ab dem ersten Tastendruck beginnt die Z�hlerei";BPMTime;"sek."
+print"lang."
+2 a$=inkey$
+if a$="0" then locate 1,1:print"                          ":timer on:beats=1:goto 3
+goto 2
+3 a$=inkey$
+if beat=0  then locate 1,1:print" BEAT "; else beat=beat-1
+if BPS<>0 then goto WaitItAb
+if a$="0" then locate 1,1:color 12:print"�BEAT�";:beat=1000:beats=beats+1
+goto 3
+
+WaitItAb:
+cls
+timer off
+color 15
+print using"Beats: #####";oldbeats
+print using"BPS:  ###.##";bps
+print using"BPM: ####.##";bpm
+print
+print"Ende mit Tastendruck!"
+4 a$=inkey$:if a$="" or a$="0" then 4 else Ende
+
+Automatic:
+timer on
+dim check(640)
+FOR SbPort = &H210 to &H280 STEP &H10
+  OUT SbPort + &H6, 1
+  FOR a = 1 to 10:next
+  OUT SbPort + &H6, 0
+  FOR a = 1 to 100
+    IF INP(SbPort + &HA) = &HAA THEN GOTO SbFound
+  NEXT
+NEXT
+PRINT "kein SoundBlaster => Ende..."
+END
+
+SbFound:
+cls
+locate 1,1
+color 10:print"SoundBlaster an Adresse ";hex$(SbPort);"h gefunden."
+color 15:locate 1,1:print"                                                   "
+DO
+  OUT SbPort + &HC, &H20
+  DO:LOOP UNTIL INP(SbPort + &HE) AND 128
+  value=(256-125+(inp(sbport+&HA)-125))/256*480
+  locate 2,1
+  color 15
+  print using "Aussteuerung: ###.##";value
+  if maxvalue<>oldmax then locate 1,8:color 14:print using "Max: ###.#";maxvalue
+  if beats=oldbeats then NoNew=NoNew+1 else NowNew=0
+  oldbeats=beats
+  if NoNew=20 then maxvalue=abs(value)
+  oldmax=maxvalue
+  maxvalue=max(Maxvalue,abs(value))
+  if beat>0 then beat=beat-1:goto SkipIT
+  FaktMax=20
+  if value>maxvalue-(maxvalue/FaktMax) then
+    color 12
+    locate 1,1
+    diff=value-(maxvalue-(maxvalue/FaktMax))
+    BeatStage=0
+    Fakt1=50
+    Fakt2=80
+    Fakt3=100
+    if diff>=0 and diff<=(MAXDIFF/100)*Fakt1 then BeatStage=1
+    if diff>(MAXDIFF/100)*Fakt1 and diff<=(maxdiff/100)*Fakt2 then BeatStage=2
+    if diff>(maxdiff/100)*Fakt2 and diff<=(maxdiff/100)*Fakt3 then BeatStage=3
+    if beats/2=int(beats/2) and BeatStage=1 then print"�BEAT�";
+    if beats/2<>int(beats/2) and BeatStage=1 then print"�BEAT�";
+    if beats/2=int(beats/2) and BeatStage=2 then print"�BEAT�";
+    if beats/2<>int(beats/2) and BeatStage=2 then print"�BEAT�";
+    if BeatStage=3 then print"������";
+    maxdiff=max(maxdiff,diff)
+    beats=beats+1
+    beat=200
+  else
+    locate 1,1
+    print"      ";
+  end if
+
+SkipIT:
+  a$=inkey$
+  if a$="+" then del=del+.01
+  if a$="-" then del=del-.01:if del<0 then del=0
+  if a$="*" then del=del+.1
+  if a$="/" then del=del-.1:if del<0 then del=0
+  if a$="0" then del=0
+  if a$="1" then del=1
+LOOP UNTIL a$=chr$(27)
+Goto Ende
+
+CalcBPM:
+	BPS=Beats/BPMTime
+	oldbeats=beats
+	Beats=0
+	BPM=BPS*60
+	color 10
+	locate 1,20:print using"BPS: ###.##   BPM: ####.##";bps;bpm;
+	return
+
+Ende:
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/bpm2.bas b/bpm2.bas
new file mode 100644
index 0000000..3e7c726
--- /dev/null
+++ b/bpm2.bas
@@ -0,0 +1,56 @@
+MainMenu:
+cls
+Beats=0
+InpBeats=10
+ATime=0:ETime=0
+BPS=0:BPM=0
+color 15
+print"-=� Beats Per Minute �=-"
+print"  by RoboCop INDUSTRIES"
+print
+print" [RET] - Manuelle Eingabe (";InpBeats;"x [  0  ] im Takt dr�cken)"
+print
+print" [ESC] - Beenden!"
+print
+print"Dr�cken Sie die gew�nschte Taste"
+1 a$=inkey$:if a$="" then 1
+if a$=chr$(13) then goto Manuell
+if a$=chr$(27) then cls:goto Ende
+goto 1
+
+Manuell:
+cls
+print"-=� Beats Per Minute �=-"
+print"    Manuelle Eingabe"
+print
+print"Dr�cken Sie jetzt immer im Takt die 0-Taste auf dem Numerischen"
+print"Tastenfeld. Ab dem ersten Tastendruck beginnt die Z�hlerei";InpBeats;"Beats"
+print"lang."
+2 a$=inkey$
+if a$="0" then ATime=timer:beats=1:cls:locate 2,1:print"============":locate 4,1:print"BPS:  ---.--":print"BPM: ----.--":goto 3
+goto 2
+3 a$=inkey$
+locate 3,1:color 15:print using"Time: ###.## (#####.## to #####.##)";timer-ATime;ATime;timer
+locate 1,1:print using"Beats: #####";beats
+if beat=0  then locate 1,15:color 12:print" BEAT "; else beat=beat-1
+if a$="0" then locate 1,15:color 12:print"�BEAT�";:beat=500:beats=beats+1
+if beats>=InpBeats then locate 1,15:print"      ":ETime=timer:goto WaitItAb
+goto 3
+
+WaitItAb:
+BPS=Beats/(ETime-ATime)
+BPM=BPS*60
+color 15
+locate 1,1
+print using"Beats: #####";Beats
+print"============"
+print using"Time: ###.## (#####.## to #####.##)";ETime-ATime,ATime,ETime
+print using"BPS:  ###.##";BPS
+print using"BPM: ####.##";BPM
+print
+print"Weiter mit Tastendruck!"
+4 a$=inkey$:if a$="" or a$="0" then 4 else MainMenu
+
+Ende:
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/bpm_dl.bas b/bpm_dl.bas
new file mode 100644
index 0000000..2eb02eb
--- /dev/null
+++ b/bpm_dl.bas
@@ -0,0 +1,135 @@
+cls:screen 12
+BPMTime=3
+'open "O",#1,"KLATSCH.RAW"
+timer on
+dim check(640)
+FOR SbPort = &H210 to &H280 STEP &H10
+  OUT SbPort + &H6, 1
+  FOR a = 1 to 10:next
+  OUT SbPort + &H6, 0
+  FOR a = 1 to 100
+    IF INP(SbPort + &HA) = &HAA THEN GOTO SbFound
+  NEXT
+NEXT
+PRINT "kein SoundBlaster => Ende..."
+END
+
+SbFound:
+on timer(BPMTime) GOSUB CalcBPM
+locate 1,1
+color 10:print"SoundBlaster an Adresse ";hex$(SbPort);"h gefunden."
+color 15:locate 1,1:print"                                                   "
+DO
+  OUT SbPort + &HC, &H20
+  DO:LOOP UNTIL INP(SbPort + &HE) AND 128
+  'locate 2,1:print Wert;"/";inp(sbport+&HA)
+  'gosub ShowLEV
+  if minus=0 then strecke=strecke+1
+  if minus=1 then strecke=strecke-1
+  if strecke>639 then minus=1
+  if strecke<1 then minus=0
+  value=(256-125+(inp(sbport+&HA)-125))/256*480
+  'locate 2,1:print value;
+  pset (strecke,check(strecke)),0
+  if value>190 or value<290 then col=10
+  if (value>155 and value<190) or (value >290 and value <325) then col=14
+  if value<155 or value>325 then col=12
+  col=15
+  if minus=0 then ls=strecke+1 else ls=strecke-1
+'          �� y1
+  line (ls,13)-(ls,480),0		'Wer mit der MAX-Anzeige arbeitet sollte y1 auf 13 setzen
+  pset (veryolds,veryoldv),8
+  pset (olds,oldv),7	'Diese Zeile sollte ungeREMt bleiben
+  if maxvalue<>oldmax then locate 1,8:color 14:print using "Max: ###.#";maxvalue
+  if beats<>oldbeats then NoNew=0 else NoNew=NoNew+1
+  oldbeats=beats
+  oldmax=maxvalue		'alles mit einem 'max' in der Variablen geh�rt zur Maxerkennung
+  if NoNew>=750 then maxvalue=value
+  if strecke=1 then pset(0,240),0
+  pset (strecke,value),col	'Wer aus 'line -' ein 'pset ' macht, und alle anderen REMs entfernt, hat auch einen coolen FX
+'  line (strecke,1)-(strecke,5),12
+  line (strecke,479)-(strecke,475),12
+  if minus=0 then ps=strecke-1 else ps=strecke+1
+'  line (ps,1)-(ps,5),4
+  line (ps,479)-(ps,475),4
+  if minus=0 then ps2=ps-1 else ps2=ps+1
+'  line (ps2,2)-(ps2,5),0
+  line (ps2,478)-(ps2,475),0
+  maxvalue=max(Maxvalue,abs(value))
+  if beat>0 then beat=beat-1:goto SkipIT
+  FaktMax=7
+  if value>=maxvalue-(maxvalue/FaktMax) then
+    color 12
+    locate 1,1
+    diff=value-(maxvalue-(maxvalue/FaktMax))
+    BeatStage=0
+    Fakt1=50
+    Fakt2=80
+    Fakt3=100
+    if diff>=0 and diff<=(MAXDIFF/100)*Fakt1 then BeatStage=1
+    if diff>(MAXDIFF/100)*Fakt1 and diff<=(maxdiff/100)*Fakt2 then BeatStage=2
+    if diff>(maxdiff/100)*Fakt2 and diff<=(maxdiff/100)*Fakt3 then BeatStage=3
+    if beats/2=int(beats/2) and BeatStage=1 then print"�BEAT�";
+    if beats/2<>int(beats/2) and BeatStage=1 then print"�BEAT�";
+    if beats/2=int(beats/2) and BeatStage=2 then print"�BEAT�";
+    if beats/2<>int(beats/2) and BeatStage=2 then print"�BEAT�";
+    if BeatStage=3 then print"������";
+    maxdiff=max(maxdiff,diff)
+    beats=beats+1
+    beat=50
+  else
+    locate 1,1
+    print"      ";
+  end if
+SkipIT:
+  veryolds=olds
+  veryoldv=oldv
+  olds=strecke		'Wenn man die beiden oldx's REMt erh�lt man einen recht
+  oldv=value		'lustigen Effekt!!!
+  delay del
+  check(strecke)=value
+  'print#1,chr$(inp(sbport+&HA));
+  a$=inkey$
+  if a$="+" then del=del+.01
+  if a$="-" then del=del-.01:if del<0 then del=0
+  if a$="*" then del=del+.1
+  if a$="/" then del=del-.1:if del<0 then del=0
+  if a$="0" then del=0
+  if a$="1" then del=1
+LOOP UNTIL a$=chr$(27)
+Goto Ende
+
+CalcBPM:
+	BPS=Beats/BPMTime
+	Beats=0
+	BPM=BPS*60
+	color 10
+	locate 1,20:print using"BPS: ###.##   BPM: ####.##";bps;bpm;
+	return
+
+ShowLEV:
+y=3
+Zeichen=176
+Einheit=256/80
+Wert=inp(sbport+&HA)
+Einheiten=round(Wert/Einheit,0)
+for x=1 to 80
+  locate y,x:if x<=Einheiten then
+			if x>=0 and x<=45 then color 10
+			if x>45 and x<=70 then color 14
+			if x>70 and x<=80 then color 12
+		   else
+			if x>=0 and x<=45 then color 2
+			if x>45 and x<=70 then color 6
+			if x>70 and x<=80 then color 4
+		   end if
+  print chr$(Zeichen);
+  locate y+1,x
+  print chr$(Zeichen);
+next x
+return
+
+Ende:
+screen 0:width 80
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/bpm_dlux.bas b/bpm_dlux.bas
new file mode 100644
index 0000000..a6ac366
--- /dev/null
+++ b/bpm_dlux.bas
@@ -0,0 +1,131 @@
+cls:screen 12
+BPMTime=5
+'open "O",#1,"KLATSCH.RAW"
+timer on
+dim check(640)
+FOR SbPort = &H210 to &H280 STEP &H10
+  OUT SbPort + &H6, 1
+  FOR a = 1 to 10:next
+  OUT SbPort + &H6, 0
+  FOR a = 1 to 100
+    IF INP(SbPort + &HA) = &HAA THEN GOTO SbFound
+  NEXT
+NEXT
+PRINT "kein SoundBlaster => Ende..."
+END
+
+SbFound:
+OuterString$="Scanne Eingangssignal...":OuterCol=15
+OS=1
+on timer(BPMTime) GOSUB CalcBPM
+locate 1,1
+color 10:print"SoundBlaster an Adresse ";hex$(SbPort);"h gefunden."
+color 15:locate 1,1:print"                                                   "
+DO
+'######
+' if ScrollIt/30=int(ScrollIt/30) then ScrollIt=ScrollIt+1 else ScrollIt=ScrollIt+1:goto SkipText
+' OuterS$=SPACE$(40)+OuterString$
+' Outer$=mid$(OuterS$,OS,40)
+' locate 30,20:color OuterCol:print using"\                                     \";Outer$;
+' OS=OS+1
+' if len(Outer$)<=0 then OS=1
+'######
+
+SkipText:
+  OUT SbPort + &HC, &H20
+  DO:LOOP UNTIL INP(SbPort + &HE) AND 128
+  strecke=strecke+1
+  if strecke>639 then strecke=1
+  value=(256-125+(inp(sbport+&HA)-125))/256*465
+'######
+' if int(value)=245 and OS<=1 then OuterCol=12:OuterString$="Kein Signal!"
+' if int(value)<>245 and OS<=1 then OuterCol=15:OuterString$="Scanne Eingangssignal..."
+'######
+'  pset (strecke,check(strecke)),0
+  if value>190 or value<290 then col=10
+  if (value>155 and value<190) or (value >290 and value <325) then col=14
+  if value<155 or value>325 then col=12
+'  col=15
+  ls=strecke+1
+'                  �468 bzw. 480
+  line (ls,12)-(ls,474),0
+  pset (olds,oldv),0	'Diese Zeile sollte ungeREMt bleiben
+  if maxvalue=oldmax and refresha>=100 then refresha=0:locate 1,58:print"         "; else refresha=refresha+1
+  if maxvalue<>oldmax then locate 1,9:color 14:print using "Max: ###.#  Min: ###.#";maxvalue;maxvalue-(maxvalue/FaktMax);:locate 1,58:color 14:print"�ADJUST�";
+  if oldlm<>lockmax then
+    locate 1,68:color 14
+    if lockmax=1 then print "-=�LOCKED�=-"; else print "            ";
+  end if
+  if beats<>oldbeats then NoNew=0 else NoNew=NoNew+1
+  oldmax=maxvalue		'alles mit einem 'max' in der Variablen geh�rt zur Maxerkennung
+  oldbeats=beats
+  if NoNew>=750 and lockmax=0 then nmaxvalue=value
+  if strecke=1 then pset(0,240),0
+  line -(strecke,value),col	'Wer aus 'line -' ein 'pset ' macht, und alle anderen REMs entfernt, hat auch einen coolen FX
+  if lockmax=0 and nmaxvalue=maxvalue then nmaxvalue=max(Maxvalue,abs(value))
+  if nmaxvalue<maxvalue then maxvalue=maxvalue-1
+  if nmaxvalue>maxvalue then maxvalue=maxvalue+1
+  if abs(nmaxvalue-maxvalue)<1 then maxvalue=nmaxvalue
+'######
+'  if maxvalue<>oldmc then
+'    line (oldmc,475)-(oldmc,480),0
+'    oldmc=maxvalue
+'    line (maxvalue,475)-(maxvalue,480),15
+'  end if
+'######
+  if beat>0 then beat=beat-1:goto SkipIT
+  FaktMax=7
+  if value>=maxvalue-(maxvalue/FaktMax) then
+    color 12
+    locate 1,1
+    diff=value-(maxvalue-(maxvalue/FaktMax))
+    BeatStage=0
+    Fakt1=60
+    Fakt2=90
+    Fakt3=100
+    if diff>=0 and diff<=(MAXDIFF/100)*Fakt1 then BeatStage=1
+    if diff>(MAXDIFF/100)*Fakt1 and diff<=(maxdiff/100)*Fakt2 then BeatStage=2
+    if diff>(maxdiff/100)*Fakt2 and diff<=(maxdiff/100)*Fakt3 then BeatStage=3
+    if beats/2=int(beats/2) and BeatStage=1 then print"�BEAT�";
+    if beats/2<>int(beats/2) and BeatStage=1 then print"�BEAT�";
+    if beats/2=int(beats/2) and BeatStage=2 then print"�BEAT�";
+    if beats/2<>int(beats/2) and BeatStage=2 then print"�BEAT�";
+    if BeatStage=3 then print"������";
+    maxdiff=max(maxdiff,diff)
+    beats=beats+1
+    beat=50
+  else
+    locate 1,1
+    print"      ";
+  end if
+
+SkipIT:
+  olds=strecke		'Wenn man die beiden oldx's REMt erh�lt man einen recht
+  oldv=value		'lustigen Effekt!!!
+  delay del
+  check(strecke)=value
+  oldlm=lockmax
+  lpress=0
+  a$=inkey$
+  if a$=" " then nmaxvalue=value
+  if a$="+" then nmaxvalue=maxvalue+1
+  if a$="-" then nmaxvalue=maxvalue-1
+  if a$="*" then nmaxvalue=maxvalue+10
+  if a$="/" then nmaxvalue=maxvalue-10
+  if (a$="l" or a$="L") and lockmax=0 and lpress=0 then lockmax=1:lpress=1 else lpress=0
+  if (a$="l" or a$="L") and lockmax=1 and lpress=0 then lockmax=0:lpress=1 else lpress=0
+LOOP UNTIL a$=chr$(27)
+Goto Ende
+
+CalcBPM:
+	BPS=Beats/BPMTime
+	Beats=0
+	BPM=BPS*60
+	color 10
+	locate 1,33:print using"BPS: ##.##  BPM: ###.##  ";bps;bpm;
+	return
+
+Ende:
+screen 0:width 80
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/bruch.bas b/bruch.bas
new file mode 100644
index 0000000..e126cba
--- /dev/null
+++ b/bruch.bas
@@ -0,0 +1,61 @@
+10 DIM TIR(100)
+20 STP=50
+30 CLS
+40 COLOR 15
+50 LOCATE 1,31:PRINT"K�rzen von Br�chen"
+60 KEY OFF:LOCATE 25,1:PRINT"Z�hler eingeben";
+70 LOCATE 3,1:INPUT"",ZHL
+80 IF ZHL=INT(ZHL) THEN 90 ELSE GOTO 70
+90 LOCATE 25,1:PRINT"Nenner eingeben";
+100 LOCATE 5,1:INPUT"",NENN
+110 IF NENN=INT(NENN) THEN 120 ELSE GOTO 100
+120 IF NENN<>0 THEN GOTO 130 ELSE GOTO 100
+130 IF LEN(STR$(ZHL))>LEN(STR$(NENN)) THEN Y=LEN(STR$(ZHL)) ELSE Y=LEN(STR$(NENN))
+140 LOCATE 4,1:FOR Z=1 TO Y-1:PRINT"�";:NEXT Z
+150 MINU=VAL(MID$(TIME$,4,2)):SEC=VAL(RIGHT$(TIME$,2)):TI=MINU+(SEC/100)/.6
+160 LOCATE 25,1:COLOR 31:PRINT"Berechne...        ";:COLOR 15
+170 LOCATE 24,13:PRINT"X     %   Zeit  Maximal  0%                50%               100%";:COLOR 8
+180 LOCATE 25,38:PRINT"����������������������������������������";:COLOR 15
+190 IF ZHL<NENN THEN MX=NENN:MINI=ZHL ELSE MX=ZHL:MINI=NENN
+200 FOR X=1 TO MINI
+210 QUOT=X*MX/MINI
+220 PROZ=X/MINI
+230 MIND=VAL(MID$(TIME$,4,2)):SECD=VAL(RIGHT$(TIME$,2)):TID=MIND+(SECD/100)/.6
+240 TIDIFF=TID-TI:MN=INT(TIDIFF):SC=(TIDIFF-MN)*100*.6
+250 NOW=NOW+1
+260 TIR(NOW)=TIDIFF/PROZ
+270 IF NOW=STP THEN NOW=0 ELSE GOTO 320
+280 FOR NUMM=1 TO STP
+290 TIR=TIR+TIR(NUMM)
+300 NEXT NUMM
+305 TIR=TIR/STP
+310 BM=INT(TIR):BS=((TIR)-BM)*100*.6
+320 LOCATE 25,23:PRINT USING"##:## ##:##";MN;SC;BM;BS;
+330 GOSUB 470
+340 LOCATE 25,12:PRINT X;
+350 LOCATE 25,18:PRINT INT(PROZ*100);
+360 IF QUOT=INT(QUOT) THEN 380
+370 NEXT X
+380 GGT=MiNi/X
+390 LOCATE 7,1:PRINT"gek�rzter Bruch:"
+395 alpha=zhl/ggt
+400 LOCATE 9,1:PRINT alpha
+410 LOCATE 11,1:PRINT NENN/GGT
+420 IF LEN(STR$(ZHL/GGT))>LEN(STR$(NENN/GGT)) THEN Y=LEN(STR$(ZHL/GGT)) ELSE Y=LEN(STR$(NENN/GGT))
+430 LOCATE 10,2:FOR Z=1 TO Y-1:PRINT"�";:NEXT Z
+440 LOCATE 25,1:COLOR 15:PRINT"Fertig!    ";
+450 LOCATE 13,1
+460 END
+470 PLUS=INT(PROZ/.025)
+480 ZEI=INT(PROZ/.0125)
+490 LOCATE 25,38+PLUS
+500 IF PLUS<=19 THEN W=10
+510 IF PLUS>19 AND PLUS<=32 THEN W=14
+520 IF PLUS>32 THEN W=12
+530 COLOR W
+540 IF ZEI/2=INT(ZEI/2) THEN ZEI$="�" ELSE ZEI$="�"
+550 IF PROZ=1 THEN ZEI$=" "
+560 PRINT ZEI$;
+570 COLOR 15
+580 RETURN
+
\ No newline at end of file
diff --git a/chem_dia/chem_dia.bas b/chem_dia/chem_dia.bas
new file mode 100644
index 0000000..3e846d7
--- /dev/null
+++ b/chem_dia/chem_dia.bas
@@ -0,0 +1,122 @@
+      shell"savefont >chem_dia.ft_"
+      shell"loadfont <chem_dia.fnt"
+      color 0,1:cls
+      gosub PrintCover
+      for z=1 to 75
+	 a=int(rnd*15)+1
+	 color a,1
+	 gosub PrintChem
+	 delay .03
+	 a=int(rnd*15)+1
+	 color a,1
+	 gosub PrintDia
+	 delay .03
+      next z
+      color 15,1:gosub PrintDia:gosub PrintChem
+      play "MFO2L4T255CDGP20GGFP20FFEGDC"
+      color 0,1:cls
+      gosub PrintCover
+      color 15,1
+      locate 3,1
+      print" Dieses Programm  erstellt  an Hand  der Ordnungszahl,  Periode und Hauptgruppe"
+      print" die in dem Fach Chemie h�ufig verwendeten Schalen-Diagramme. Ein Schalendiagr."
+      print" sieht in etwa folgenderma�en aus:"
+      print
+      print" �          ";:color 11:print"   Die Zahlen 1-3 sind die Schalen, Al ist der":color 15
+      print" ��������� 3";:color 11:print"   Stoff (Alu), 13 ist die Ordnungszahl, die �":color 15
+      print" �����8��� 2";:color 11:print"   sind die  Ionen und die  2 bzw. 8  sind die":color 15
+      print" �����2��� 1";:color 11:print"   Anzahl  der � auf  der Schale,  da  nur die":color 15
+      print"   ��Al";:color 11:print"        �u�erste Schale interressant ist.":color 15
+      print"   ��"
+      print" Auf die Schalen kann maximal nur eine bestimmte Anzahl von Ionen,"
+      print" die aus der nachfolgenden Tabelle ersichtlich ist."
+      print
+      print" Schale:	1	2	 3	 4	 5	 6	 7"
+      print" Ionen:		2	8	18	32	50	72	98"
+      locate 25,49
+      color 0,3:print"Bitte dr�cken Sie eine Taste...";
+1     a$=inkey$:if a$="" then 1
+      color 0,1
+      cls
+      gosub PrintCover
+      color 15,1:locate 7,1
+      print"    �"
+      print"    ����������������������� 7"
+      print"    ����������������������� 6"
+      print"    ����������������������� 5"
+      print"    ����������������������� 4"
+      print"    ����������������������� 3"
+      print"    ����������������������� 2"
+      print"    ����������������������� 1"
+      color 14,1
+2     locate 3,2:input"Ordnungszahl      : ",ordn
+      if ordn<1 or ordn>109 then 2
+      gosub SearchElement
+      locate 15,15:print ele$
+3     locate 4,2:input"Periode           : ",peri
+      if peri<1 or peri>7 then 3
+4     locate 5,2:input"Gruppe (H/N+Zahl) : ",grup$
+      lgr$=left$(grup$,1)
+      if lgr$="H" or lgr$="h" or lgr$="N" or lgr$="n" then  else 4
+
+
+
+
+
+
+
+      shell"loadfont <chem_dia.ft_"
+      shell"ECHO Diese Datei wurde physikalisch gel�scht !!! >ZERO.DAT"
+      shell"ECHO indem sie mit diesem Text �berschrieben und DANN gel�scht wurde >>ZERO.DAT"
+      shell"move ZERO.DAT chem_dia.ft_ >NUL"
+      shell"del chem_dia.ft_ >NUL"
+      end
+
+PrintCover:
+      locate 1,1
+      color 0,3:print"                 Chemie-Diagramm written by RoboCop INDUSTRIES                  "
+      locate 25,1
+      print" (C)1995 by RoboCop INDUSTRIES                                                  ";
+      return
+
+PrintChem:
+      locate 2,1
+      print"          �����������Ŀ ��Ŀ  ��Ŀ ��������Ŀ ������Ŀ        ������Ŀ"
+      print"          �           � �  �  �  � �        � �      Ȼ      ��      �"
+      print"          �    ������ͼ �  �  �  � �   ����ͼ �       Ȼ    ��       �"
+      print"          �    �        �  �  �  � �   �      �        Ȼ  ��        �"
+      print"          �    �        �  ����  � �   ���Ŀ  �         ����         �"
+      print"          �    �        �        � �       �  �    ɻ          ɻ    �"
+      print"          �    �        �  ��ͻ  � �   ���ͼ  �    ���        ɼ�    �"
+      print"          �    �        �  �  �  � �   �      �    � ��      ɼ �    �"
+      print"          �    ������Ŀ �  �  �  � �   ����Ŀ �    �  ��    ɼ  �    �"
+      print"          �           � �  �  �  � �        � �    �   ��  ɼ   �    �"
+      print"          �����������ͼ ��ͼ  ��ͼ ��������ͼ ����ͼ    ��ͼ    ����ͼ";
+      return
+
+PrintDia:
+      locate 14,1
+      print"          ����������������Ŀ  ����������Ŀ  ������������������������Ŀ"
+      print"          �                �  �          �  �        ������ͻ        �"
+      print"          �    �������ͻ   �  �          �  �        �      �        �"
+      print"          �    �       �   �  �          �  �        �      �        �"
+      print"          �    �       �   �  �          �  �        �      �        �"
+      print"          �    �       �   �  �          �  �        ��������        �"
+      print"          �    �       �   �  �          �  �        ������ͻ        �"
+      print"          �    �       �   �  �          �  �        �      �        �"
+      print"          �    ���������   �  �          �  �        �      �        �"
+      print"          �                �  �          �  �        �      �        �"
+      print"          ����������������ͼ  ����������ͼ  ��������ͼ      ��������ͼ";
+      return
+
+SearchElement:
+5     read b,ele$,bez$,zust$,eneg,atu,s(1),s(2),s(3),s(4),s(5),s(6),s(7)
+      if b=ordn then return
+      if b=0 and b$="XXX" then restore
+      goto 5
+      data 1,H,Wasserstoff,gasf�rmig,2.1,1.008,1,0,0,0,0,0,0
+      data 2,He,Helium,gasf�rmig,,4,2,0,0,0,0,0,0
+      data 3,Li,Lithium,fest,1,6.94,2,1,0,0,0,0,0
+      data 4,Be,Beryllium,fest,1.5,9.01,2,2,0,0,0,0,0
+      data 5,B,Bor,2,10.81,2,3,0,0,0,0,0
+      data 6,C,Kohlenstoff,2.5,12.01,2,4,0,0,0,0,0
\ No newline at end of file
diff --git a/chem_dia/chem_dia.fnt b/chem_dia/chem_dia.fnt
new file mode 100644
index 0000000..30bcf15
--- /dev/null
+++ b/chem_dia/chem_dia.fnt
@@ -0,0 +1,4354 @@
+16
+000-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+001-----
+
+
+########
+#      #
+# #  # #
+#      #
+#      #
+# #### #
+#  ##  #
+#      #
+#      #
+########
+
+
+
+
+002-----
+
+
+########
+########
+## ## ##
+########
+########
+##    ##
+###  ###
+########
+########
+########
+
+
+
+
+003-----
+
+
+
+
+ ## ##
+#######
+#######
+#######
+#######
+ #####
+  ###
+   #
+
+
+
+
+004-----
+
+
+
+
+   #
+  ###
+ #####
+#######
+ #####
+  ###
+   #
+
+
+
+
+
+005-----
+
+
+
+   ##
+  ####
+  ####
+########
+########
+########
+#  ##  #
+   ##
+  ####
+
+
+
+
+006-----
+
+
+
+   ##
+  ####
+ ######
+########
+########
+########
+   ##
+   ##
+  ####
+
+
+
+
+007-----
+
+
+
+
+
+
+  ####
+  ####
+  ####
+  ####
+
+
+
+
+
+
+008-----
+########
+########
+########
+########
+########
+########
+##    ##
+##    ##
+##    ##
+##    ##
+########
+########
+########
+########
+########
+########
+009-----
+
+
+
+
+
+ ######
+ #    #
+ #    #
+ #    #
+ #    #
+ ######
+
+
+
+
+
+010-----
+########
+########
+########
+########
+########
+#      #
+# #### #
+# #### #
+# #### #
+# #### #
+#      #
+########
+########
+########
+########
+########
+011-----
+
+
+   ####
+    ###
+   ## #
+  ##
+######
+##  ##
+##  ##
+##  ##
+##  ##
+######
+
+
+
+
+012-----
+
+
+ ######
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ######
+   ##
+ ######
+   ##
+   ##
+
+
+
+
+013-----
+
+
+  ######
+  ##  ##
+  ######
+  ##
+  ##
+  ##
+  ##
+####
+####
+####
+
+
+
+
+014-----
+
+
+ #######
+ ##   ##
+ #######
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+ ##  ###
+###  ###
+###  ###
+###
+
+
+
+015-----
+
+
+
+   ##
+   ##
+## ## ##
+  ####
+###  ###
+  ####
+## ## ##
+   ##
+   ##
+
+
+
+
+016-----
+
+#
+##
+###
+####
+#####
+######
+#####
+####
+###
+##
+#
+
+
+
+
+017-----
+
+      #
+     ##
+    ###
+   ####
+  #####
+ ######
+  #####
+   ####
+    ###
+     ##
+      #
+
+
+
+
+018-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+019-----
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+ ##  ##
+ ##  ##
+
+
+
+
+020-----
+
+
+########
+## ## ##
+## ## ##
+## ## ##
+##### ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+
+
+
+
+021-----
+
+#######
+##   ##
+ ##
+  ###
+ ## ##
+##   ##
+##   ##
+ ## ##
+  ###
+    ##
+##   ##
+#######
+
+
+
+022-----
+
+
+
+
+
+
+
+
+
+
+
+#######
+#######
+#######
+#######
+
+023-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+ ######
+
+
+
+024-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+025-----
+
+
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+026-----
+
+
+
+
+
+   ##
+   ###
+#######
+   ###
+   ##
+
+
+
+
+
+
+027-----
+
+
+
+
+
+  ##
+ ###
+#######
+ ###
+  ##
+
+
+
+
+
+
+028-----
+
+
+
+
+
+##
+##
+##
+##
+#######
+
+
+
+
+
+
+029-----
+
+
+
+
+
+  #  #
+ ##  ##
+########
+ ##  ##
+  #  #
+
+
+
+
+
+
+030-----
+
+
+
+
+   #
+  ###
+  ###
+ #####
+ #####
+#######
+#######
+
+
+
+
+
+031-----
+
+
+
+
+#######
+#######
+ #####
+ #####
+  ###
+  ###
+   #
+
+
+
+
+
+032-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+033-----
+
+
+   ##
+  ####
+  ####
+  ####
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+034-----
+
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+
+
+
+
+
+
+
+
+
+
+
+035-----
+
+
+
+ ## ##
+ ## ##
+#######
+ #####
+ #####
+ #####
+#######
+ ## ##
+ ## ##
+
+
+
+
+036-----
+   ##
+   ##
+ #####
+##   ##
+##    #
+##
+ #####
+     ##
+#    ##
+##   ##
+ #####
+   ##
+   ##
+
+
+
+037-----
+
+
+
+
+##    #
+##   ##
+    ##
+   ##
+  ##
+ ##
+##   ##
+#    ##
+
+
+
+
+038-----
+
+
+  ###
+ ## ##
+ ## ##
+  ###
+ ### ##
+## ###
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+039-----
+
+  ##
+  ##
+  ##
+ ##
+
+
+
+
+
+
+
+
+
+
+
+040-----
+
+
+    ##
+   ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+   ##
+    ##
+
+
+
+
+041-----
+
+
+  ##
+   ##
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+   ##
+  ##
+
+
+
+
+042-----
+
+
+
+
+
+ ##  ##
+  ####
+########
+  ####
+ ##  ##
+
+
+
+
+
+
+043-----
+
+
+
+
+
+   ##
+   ##
+########
+   ##
+   ##
+
+
+
+
+
+
+044-----
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+   ##
+  ##
+
+
+
+045-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+046-----
+
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+047-----
+
+
+
+
+      #
+     ##
+    ##
+   ##
+  ##
+ ##
+##
+#
+
+
+
+
+048-----
+
+
+ #####
+##   ##
+##   ##
+##  ###
+## # ##
+## # ##
+###  ##
+##   ##
+##   ##
+ #####
+
+
+
+
+049-----
+
+
+   ##
+  ###
+ ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+ ######
+
+
+
+
+050-----
+
+
+ #####
+##   ##
+     ##
+    ##
+   ##
+  ##
+ ##
+##
+##   ##
+#######
+
+
+
+
+051-----
+
+
+ #####
+##   ##
+     ##
+     ##
+  ####
+     ##
+     ##
+     ##
+##   ##
+ #####
+
+
+
+
+052-----
+
+
+    ##
+   ###
+  ####
+ ## ##
+##  ##
+#######
+    ##
+    ##
+    ##
+   ####
+
+
+
+
+053-----
+
+
+#######
+##
+##
+##
+######
+    ###
+     ##
+     ##
+##   ##
+ #####
+
+
+
+
+054-----
+
+
+  ###
+ ##
+##
+##
+######
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+055-----
+
+
+#######
+##   ##
+     ##
+     ##
+    ##
+   ##
+  ##
+  ##
+  ##
+  ##
+
+
+
+
+056-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+057-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+     ##
+     ##
+    ##
+ ####
+
+
+
+
+058-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+
+
+
+
+
+059-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+  ##
+
+
+
+
+060-----
+
+
+
+     ##
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+     ##
+
+
+
+
+061-----
+
+
+
+
+
+
+#######
+
+
+#######
+
+
+
+
+
+
+062-----
+
+
+
+ ##
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+ ##
+
+
+
+
+063-----
+
+
+ #####
+##   ##
+##   ##
+    ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+064-----
+
+
+
+ #####
+##   ##
+##   ##
+## ####
+## ####
+## ####
+## ###
+##
+ #####
+
+
+
+
+065-----
+
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+066-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+######
+
+
+
+
+067-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+##
+##
+##    #
+ ##  ##
+  ####
+
+
+
+
+068-----
+
+
+#####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ## ##
+#####
+
+
+
+
+069-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+070-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##
+ ##
+####
+
+
+
+
+071-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+## ####
+##   ##
+##   ##
+ ##  ##
+  ### #
+
+
+
+
+072-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+073-----
+
+
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+074-----
+
+
+   ####
+    ##
+    ##
+    ##
+    ##
+    ##
+##  ##
+##  ##
+##  ##
+ ####
+
+
+
+
+075-----
+
+
+###  ##
+ ##  ##
+ ## ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+076-----
+
+
+####
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+077-----
+
+
+##    ##
+###  ###
+########
+## ## ##
+## ## ##
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+
+
+
+
+078-----
+
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+079-----
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+080-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+081-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+## # ##
+## ####
+ #####
+    ##
+    ###
+
+
+082-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+083-----
+
+
+ #####
+##   ##
+##   ##
+ ##
+  ###
+    ##
+     ##
+##   ##
+##   ##
+ #####
+
+
+
+
+084-----
+
+
+########
+## ## ##
+#  ##  #
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+085-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+086-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ## ##
+  ###
+   #
+
+
+
+
+087-----
+
+
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+ ##  ##
+
+
+
+
+088-----
+
+
+##   ##
+##   ##
+ ## ##
+ ## ##
+  ###
+  ###
+ ## ##
+ ## ##
+##   ##
+##   ##
+
+
+
+
+089-----
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+090-----
+
+
+########
+##    ##
+#     ##
+     ##
+    ##
+   ##
+  ##
+ ##    #
+##    ##
+########
+
+
+
+
+091-----
+
+
+  #####
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  #####
+
+
+
+
+092-----
+
+
+
+#
+##
+###
+ ###
+  ###
+   ###
+    ###
+     ##
+      #
+
+
+
+
+093-----
+
+
+  #####
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+  #####
+
+
+
+
+094-----
+   #
+  ###
+ ## ##
+##   ##
+
+
+
+
+
+
+
+
+
+
+
+
+095-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+########
+
+
+096-----
+  ##
+  ##
+   ##
+
+
+
+
+
+
+
+
+
+
+
+
+
+097-----
+
+
+
+
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+098-----
+
+
+###
+ ##
+ ##
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+## ###
+
+
+
+
+099-----
+
+
+
+
+
+ #####
+##   ##
+##
+##
+##
+##   ##
+ #####
+
+
+
+
+100-----
+
+
+   ###
+    ##
+    ##
+  ####
+ ## ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+101-----
+
+
+
+
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+102-----
+
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+103-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+##  ##
+ ####
+
+104-----
+
+
+###
+ ##
+ ##
+ ## ##
+ ### ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+105-----
+
+
+   ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+106-----
+
+
+     ##
+     ##
+
+    ###
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+ ##  ##
+ ##  ##
+  ####
+
+107-----
+
+
+###
+ ##
+ ##
+ ##  ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+###  ##
+
+
+
+
+108-----
+
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+109-----
+
+
+
+
+
+###  ##
+########
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+
+
+
+
+110-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+111-----
+
+
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+112-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+####
+
+113-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+    ##
+   ####
+
+114-----
+
+
+
+
+
+## ###
+ ### ##
+ ##   #
+ ##
+ ##
+ ##
+####
+
+
+
+
+115-----
+
+
+
+
+
+ #####
+##   ##
+ ##
+  ###
+    ##
+##   ##
+ #####
+
+
+
+
+116-----
+
+
+   #
+  ##
+  ##
+######
+  ##
+  ##
+  ##
+  ##
+  ## ##
+   ###
+
+
+
+
+117-----
+
+
+
+
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+118-----
+
+
+
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+
+
+
+
+119-----
+
+
+
+
+
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+
+
+
+
+120-----
+
+
+
+
+
+##   ##
+ ## ##
+  ###
+  ###
+  ###
+ ## ##
+##   ##
+
+
+
+
+121-----
+
+
+
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+#####
+
+122-----
+
+
+
+
+
+#######
+##  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+123-----
+
+
+    ###
+   ##
+   ##
+   ##
+ ###
+   ##
+   ##
+   ##
+   ##
+    ###
+
+
+
+
+124-----
+
+
+   ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+125-----
+
+
+ ###
+   ##
+   ##
+   ##
+    ###
+   ##
+   ##
+   ##
+   ##
+ ###
+
+
+
+
+126-----
+
+
+ ### ##
+## ###
+
+
+
+
+
+
+
+
+
+
+
+
+127-----
+
+
+
+
+   #
+  ###
+ #####
+#######
+#######
+#######
+#######
+
+
+
+
+
+128-----
+
+
+#######
+##
+##
+##
+##
+##
+##
+##
+#######
+    ##
+    ##
+ #####
+
+
+129-----
+
+
+
+##  ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+
+
+
+
+130-----
+
+
+
+
+
+
+
+
+
+
+
+
+   
+   #
+  ##
+ # #
+131-----
+   #
+   #
+   #
+
+
+
+
+
+
+
+
+
+
+
+
+
+132-----
+
+
+##  ##
+##  ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+133-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ##
+  #  #
+    #
+134-----
+   #
+  #
+  ####
+
+
+
+
+
+
+
+
+
+
+
+
+
+135-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ###
+  #   #
+    ##
+136-----
+      #
+  #   #
+   ###
+
+
+
+
+
+
+
+
+
+
+
+
+
+137-----
+
+
+##   ##
+##   ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+138-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+  #
+  #  #
+  #####
+139-----
+     #
+     #
+     #
+
+
+
+
+
+
+
+
+
+
+
+
+
+140-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+  #####
+  #
+  ####
+141-----
+      #
+  #   #
+   ###
+
+
+
+
+
+
+
+
+
+
+
+
+
+142-----
+
+##   ##
+##   ##
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+143-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ###
+  #
+  #
+144-----
+  ####
+  #   #
+   ###
+
+
+
+
+
+
+
+
+
+
+
+
+
+145-----
+
+
+
+
+
+### ###
+  # # #
+  # # #
+### ###
+# # #
+# # #
+### ###
+
+
+
+
+146-----
+
+
+### ###
+# # #
+# # #
+# # #
+### ##
+# # #
+# # #
+# # #
+# # #
+# # ###
+
+
+
+
+147-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+148-----
+
+
+##   ##
+##   ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+149-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+  #####
+     #
+   ####
+150-----
+    #
+   #
+  #
+
+
+
+
+
+
+
+
+
+
+
+
+
+151-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ###
+  #   #
+   ###
+152-----
+  #   #
+  #   #
+   ###
+
+
+
+
+
+
+
+
+
+
+
+
+
+153-----
+
+##   ##
+##   ##
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+154-----
+
+##   ##
+##   ##
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+155-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ###
+  #   #
+   ###
+156-----
+      #
+      #
+   ###
+
+
+
+
+
+
+
+
+
+
+
+
+
+157-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ###
+  #  ##
+  # # #
+158-----
+  # # #
+  ##  #
+   ###
+
+
+
+
+
+
+
+
+
+
+
+
+
+159-----
+
+    ###
+   ## ##
+   ##
+   ##
+   ##
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+ ###
+
+
+160-----
+
+   ##
+  ##
+ ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+161-----
+
+    ##
+   ##
+  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+162-----
+
+   ##
+  ##
+ ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+163-----
+
+   ##
+  ##
+ ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+164-----
+
+
+ ### ##
+## ###
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+165-----
+ ### ##
+## ###
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+
+
+
+
+166-----
+
+ ######
+ ##   #
+ ##   #
+ ######
+
+ ######
+
+
+
+
+
+
+
+
+
+167-----
+
+ #####
+ #   #
+ #   #
+ #####
+
+ #####
+
+
+
+
+
+
+
+
+
+168-----
+
+
+  ##
+  ##
+
+  ##
+  ##
+ ##
+##
+##   ##
+##   ##
+#######
+
+
+
+
+169-----
+
+
+
+
+
+
+#######
+##
+##
+##
+##
+
+
+
+
+
+170-----
+
+
+
+
+
+
+#######
+     ##
+     ##
+     ##
+     ##
+
+
+
+
+
+171-----
+
+##
+##
+##   ##
+##   ##
+##  ##
+   ##
+  ##
+ ##
+##  ####
+##    ##
+    ####
+    ##
+    ####
+
+
+172-----
+
+##
+##
+##    #
+##   ##
+##  ##
+   ##
+  ##
+ ##  ##
+##  ###
+#  ## #
+  ######
+     ##
+    ####
+
+
+173-----
+
+
+   ##
+   ##
+
+   ##
+  ###
+  ###
+ ####
+ ####
+#####
+#####
+
+
+
+
+174-----
+
+
+
+
+  ### 
+ ## ##
+##   ##
+########
+##   ##
+ ## ##
+  ###
+
+
+
+
+
+175-----
+
+
+
+
+   
+   ##
+   ##
+  ####
+  ####
+ ######
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+176-----
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+177-----
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+178-----
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+179-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+180-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ###
+#####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+181-----
+   ##
+   ##
+   ##
+   ##
+  ###
+#####
+#####
+#####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+182-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ ######
+#######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+183-----
+
+
+
+
+
+
+
+###### 
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+184-----
+
+
+
+
+
+#### 
+#####
+#####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+185-----
+  #####
+  #####
+  #####
+  #####
+ ######
+#######
+#######
+#######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+186-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+187-----
+
+
+
+
+
+###### 
+#######
+#######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+188-----
+  #####
+  #####
+  #####
+  #####
+ ######
+#######
+#######
+######
+
+
+
+
+
+
+
+
+189-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ ######
+######
+
+
+
+
+
+
+
+
+190-----
+   ##
+   ##
+   ##
+   ##
+  ###
+#####
+#####
+####
+
+
+
+
+
+
+
+
+191-----
+
+
+
+
+
+
+
+####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+192-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ###
+    ####
+
+
+
+
+
+
+
+
+193-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+
+
+
+
+
+
+
+
+194-----
+
+
+
+
+
+
+
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+195-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ###
+   #####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+196-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+197-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+198-----
+   ##
+   ##
+   ##
+   ##
+   ###
+   #####
+   #####
+   #####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+199-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  ######
+  #######
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+200-----
+  #####
+  #####
+  #####
+  #####
+  ######
+  ######
+  ######
+   #####
+
+
+
+
+
+
+
+
+201-----
+
+
+
+
+
+   #####
+  ######
+  ######
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+202-----
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+########
+########
+
+
+
+
+
+
+
+
+203-----
+
+
+
+
+
+########
+########
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+204-----
+  #####
+  #####
+  #####
+  #####
+  ######
+  ######
+  ######
+  ######
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+205-----
+
+
+
+
+
+########
+########
+########
+
+
+
+
+
+
+
+
+206-----
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+########
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+207-----
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+########
+########
+
+
+
+
+
+
+
+
+208-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+
+
+
+
+
+
+
+
+209-----
+
+
+
+
+
+########
+########
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+210-----
+
+
+
+
+
+
+
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+211-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  ######
+   #####
+
+
+
+
+
+
+
+
+212-----
+   ##
+   ##
+   ##
+   ##
+   ###
+   #####
+   #####
+    ####
+
+
+
+
+
+
+
+
+213-----
+
+
+
+
+
+    ####
+   #####
+   #####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+214-----
+
+
+
+
+
+
+
+   #####
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+215-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+216-----
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+########
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+217-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ###
+####
+
+
+
+
+
+
+
+
+218-----
+
+
+
+
+
+
+
+    ####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+219-----
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+220-----
+
+
+
+
+
+
+
+########
+########
+########
+########
+########
+########
+########
+########
+########
+221-----
+
+
+
+
+  ### 
+ ## ##
+##   ##
+########
+##   ##
+ ## ##
+  ###
+
+
+
+
+
+222-----
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+223-----
+########
+########
+########
+########
+########
+########
+########
+
+
+
+
+
+
+
+
+
+224-----
+
+
+
+
+
+ ### ##
+## ###
+## ##
+## ##
+## ##
+## ###
+ ### ##
+
+
+
+
+225-----
+
+
+
+
+
+######
+##   ##
+######
+##   ##
+##   ##
+######
+##
+##
+##
+
+
+226-----
+
+
+#######
+##   ##
+##   ##
+##
+##
+##
+##
+##
+##
+##
+
+
+
+
+227-----
+
+
+
+
+#
+#######
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+228-----
+
+
+
+#######
+##   ##
+ ##
+  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+229-----
+
+
+
+
+
+ ######
+## ##
+## ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+230-----
+
+
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+##
+
+
+
+231-----
+
+
+
+
+ ### ##
+## ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+232-----
+
+
+
+ ######
+   ##
+  ####
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+ ######
+
+
+
+
+233-----
+
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+234-----
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+### ###
+
+
+
+
+235-----
+
+
+   ####
+  ##
+   ##
+    ##
+  #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+
+
+
+
+236-----
+
+
+
+
+
+ ######
+## ## ##
+## ## ##
+## ## ##
+ ######
+
+
+
+
+
+
+237-----
+
+
+
+      ##
+     ##
+ ######
+##  ####
+## ## ##
+####  ##
+ ######
+ ##
+##
+
+
+
+
+238-----
+
+
+   ###
+  ##
+ ##
+ ##
+ #####
+ ##
+ ##
+ ##
+  ##
+   ###
+
+
+
+
+239-----
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+240-----
+
+
+
+
+#######
+
+
+#######
+
+
+#######
+
+
+
+
+
+241-----
+
+
+
+
+   ##
+   ##
+########
+   ##
+   ##
+
+
+########
+
+
+
+
+242-----
+
+
+
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+
+ ######
+
+
+
+
+243-----
+
+
+
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+
+ ######
+
+
+
+
+244-----
+
+
+    ###
+   ## ##
+   ## ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+245-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+246-----
+
+
+
+
+   ##
+   ##
+
+########
+
+   ##
+   ##
+
+
+
+
+
+247-----
+
+
+
+
+
+ ### ##
+## ###
+
+ ### ##
+## ###
+
+
+
+
+
+
+248-----
+
+  ###
+ ## ##
+ ## ##
+  ###
+
+
+
+
+
+
+
+
+
+
+
+249-----
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+
+
+
+250-----
+
+
+
+
+
+
+
+
+   ##
+
+
+
+
+
+
+
+251-----
+
+    ####
+    ##
+    ##
+    ##
+    ##
+    ##
+### ##
+ ## ##
+ ## ##
+  ####
+   ###
+
+
+
+
+252-----
+
+## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+
+
+
+
+
+253-----
+
+ ###
+#  ##
+  ##
+ ##
+##  #
+#####
+
+
+
+
+
+
+
+
+
+254-----
+
+
+
+
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+
+
+
+
+
+255-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+--------
diff --git a/chem_dia/chem_dia.ft_ b/chem_dia/chem_dia.ft_
new file mode 100644
index 0000000..6b84c16
--- /dev/null
+++ b/chem_dia/chem_dia.ft_
@@ -0,0 +1,4354 @@
+16
+000-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+001-----
+
+
+ ######
+#      #
+# #  # #
+#      #
+#      #
+# #### #
+#  ##  #
+#      #
+#      #
+ ######
+
+
+
+
+002-----
+
+
+ ######
+########
+## ## ##
+########
+########
+##    ##
+###  ###
+########
+########
+ ######
+
+
+
+
+003-----
+
+
+
+
+ ## ##
+#######
+#######
+#######
+#######
+ #####
+  ###
+   #
+
+
+
+
+004-----
+
+
+
+
+   #
+  ###
+ #####
+#######
+ #####
+  ###
+   #
+
+
+
+
+
+005-----
+
+
+
+   ##
+  ####
+  ####
+###  ###
+###  ###
+###  ###
+   ##
+   ##
+  ####
+
+
+
+
+006-----
+
+
+
+   ##
+  ####
+ ######
+########
+########
+ ######
+   ##
+   ##
+  ####
+
+
+
+
+007-----
+
+
+
+
+
+
+   ##
+  ####
+  ####
+   ##
+
+
+
+
+
+
+008-----
+########
+########
+########
+########
+########
+########
+###  ###
+##    ##
+##    ##
+###  ###
+########
+########
+########
+########
+########
+########
+009-----
+
+
+
+
+
+  ####
+ ##  ##
+ #    #
+ #    #
+ ##  ##
+  ####
+
+
+
+
+
+010-----
+########
+########
+########
+########
+########
+##    ##
+#  ##  #
+# #### #
+# #### #
+#  ##  #
+##    ##
+########
+########
+########
+########
+########
+011-----
+
+
+   ####
+    ###
+   ## #
+  ##  #
+ ####
+##  ##
+##  ##
+##  ##
+##  ##
+ ####
+
+
+
+
+012-----
+
+
+  ####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+ ######
+   ##
+   ##
+
+
+
+
+013-----
+
+
+  ######
+  ##  ##
+  ######
+  ##
+  ##
+  ##
+  ##
+ ###
+####
+###
+
+
+
+
+014-----
+
+
+ #######
+ ##   ##
+ #######
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+ ##  ###
+###  ###
+###  ##
+##
+
+
+
+015-----
+
+
+
+   ##
+   ##
+## ## ##
+  ####
+###  ###
+  ####
+## ## ##
+   ##
+   ##
+
+
+
+
+016-----
+
+#
+##
+###
+####
+#####
+#######
+#####
+####
+###
+##
+#
+
+
+
+
+017-----
+
+      #
+     ##
+    ###
+   ####
+  #####
+#######
+  #####
+   ####
+    ###
+     ##
+      #
+
+
+
+
+018-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+
+019-----
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+ ##  ##
+ ##  ##
+
+
+
+
+020-----
+
+
+ #######
+## ## ##
+## ## ##
+## ## ##
+ #### ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+
+
+
+
+021-----
+
+ #####
+##   ##
+ ##
+  ###
+ ## ##
+##   ##
+##   ##
+ ## ##
+  ###
+    ##
+##   ##
+ #####
+
+
+
+022-----
+
+
+
+
+
+
+
+
+#######
+#######
+#######
+#######
+
+
+
+
+023-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+ ######
+
+
+
+
+024-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+025-----
+
+
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+026-----
+
+
+
+
+
+   ##
+    ##
+#######
+    ##
+   ##
+
+
+
+
+
+
+027-----
+
+
+
+
+
+  ##
+ ##
+#######
+ ##
+  ##
+
+
+
+
+
+
+028-----
+
+
+
+
+
+
+##
+##
+##
+#######
+
+
+
+
+
+
+029-----
+
+
+
+
+
+  #  #
+ ##  ##
+########
+ ##  ##
+  #  #
+
+
+
+
+
+
+030-----
+
+
+
+
+   #
+  ###
+  ###
+ #####
+ #####
+#######
+#######
+
+
+
+
+
+031-----
+
+
+
+
+#######
+#######
+ #####
+ #####
+  ###
+  ###
+   #
+
+
+
+
+
+032-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+033-----
+
+
+   ##
+  ####
+  ####
+  ####
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+034-----
+
+ ##  ##
+ ##  ##
+ ##  ##
+  #  #
+
+
+
+
+
+
+
+
+
+
+
+035-----
+
+
+
+ ## ##
+ ## ##
+#######
+ ## ##
+ ## ##
+ ## ##
+#######
+ ## ##
+ ## ##
+
+
+
+
+036-----
+   ##
+   ##
+ #####
+##   ##
+##    #
+##
+ #####
+     ##
+     ##
+#    ##
+##   ##
+ #####
+   ##
+   ##
+
+
+037-----
+
+
+
+
+##    #
+##   ##
+    ##
+   ##
+  ##
+ ##
+##   ##
+#    ##
+
+
+
+
+038-----
+
+
+  ###
+ ## ##
+ ## ##
+  ###
+ ### ##
+## ###
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+039-----
+
+  ##
+  ##
+  ##
+ ##
+
+
+
+
+
+
+
+
+
+
+
+040-----
+
+
+    ##
+   ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+   ##
+    ##
+
+
+
+
+041-----
+
+
+  ##
+   ##
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+   ##
+  ##
+
+
+
+
+042-----
+
+
+
+
+
+ ##  ##
+  ####
+########
+  ####
+ ##  ##
+
+
+
+
+
+
+043-----
+
+
+
+
+
+   ##
+   ##
+ ######
+   ##
+   ##
+
+
+
+
+
+
+044-----
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+   ##
+  ##
+
+
+
+045-----
+
+
+
+
+
+
+
+#######
+
+
+
+
+
+
+
+
+046-----
+
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+047-----
+
+
+
+
+      #
+     ##
+    ##
+   ##
+  ##
+ ##
+##
+#
+
+
+
+
+048-----
+
+
+  ####
+ ##  ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+##    ##
+##    ##
+ ##  ##
+  ####
+
+
+
+
+049-----
+
+
+   ##
+  ###
+ ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+ ######
+
+
+
+
+050-----
+
+
+ #####
+##   ##
+     ##
+    ##
+   ##
+  ##
+ ##
+##
+##   ##
+#######
+
+
+
+
+051-----
+
+
+ #####
+##   ##
+     ##
+     ##
+  ####
+     ##
+     ##
+     ##
+##   ##
+ #####
+
+
+
+
+052-----
+
+
+    ##
+   ###
+  ####
+ ## ##
+##  ##
+#######
+    ##
+    ##
+    ##
+   ####
+
+
+
+
+053-----
+
+
+#######
+##
+##
+##
+######
+     ##
+     ##
+     ##
+##   ##
+ #####
+
+
+
+
+054-----
+
+
+  ###
+ ##
+##
+##
+######
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+055-----
+
+
+#######
+##   ##
+     ##
+     ##
+    ##
+   ##
+  ##
+  ##
+  ##
+  ##
+
+
+
+
+056-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+057-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+     ##
+     ##
+    ##
+ ####
+
+
+
+
+058-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+
+
+
+
+
+059-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+  ##
+
+
+
+
+060-----
+
+
+
+     ##
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+     ##
+
+
+
+
+061-----
+
+
+
+
+
+ ######
+
+
+ ######
+
+
+
+
+
+
+
+062-----
+
+
+
+ ##
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+ ##
+
+
+
+
+063-----
+
+
+ #####
+##   ##
+##   ##
+    ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+064-----
+
+
+
+ #####
+##   ##
+##   ##
+## ####
+## ####
+## ####
+## ###
+##
+ #####
+
+
+
+
+065-----
+
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+066-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+######
+
+
+
+
+067-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+##
+##
+##    #
+ ##  ##
+  ####
+
+
+
+
+068-----
+
+
+#####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ## ##
+#####
+
+
+
+
+069-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+070-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##
+ ##
+####
+
+
+
+
+071-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+## ####
+##   ##
+##   ##
+ ##  ##
+  ### #
+
+
+
+
+072-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+073-----
+
+
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+074-----
+
+
+   ####
+    ##
+    ##
+    ##
+    ##
+    ##
+##  ##
+##  ##
+##  ##
+ ####
+
+
+
+
+075-----
+
+
+###  ##
+ ##  ##
+ ##  ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+076-----
+
+
+####
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+077-----
+
+
+##    ##
+###  ###
+########
+########
+## ## ##
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+
+
+
+
+078-----
+
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+079-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+080-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+081-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+## # ##
+## ####
+ #####
+    ##
+    ###
+
+
+082-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+083-----
+
+
+ #####
+##   ##
+##   ##
+ ##
+  ###
+    ##
+     ##
+##   ##
+##   ##
+ #####
+
+
+
+
+084-----
+
+
+########
+## ## ##
+#  ##  #
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+085-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+086-----
+
+
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+ ##  ##
+  ####
+   ##
+
+
+
+
+087-----
+
+
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+ ##  ##
+
+
+
+
+088-----
+
+
+##    ##
+##    ##
+ ##  ##
+  ####
+   ##
+   ##
+  ####
+ ##  ##
+##    ##
+##    ##
+
+
+
+
+089-----
+
+
+##    ##
+##    ##
+##    ##
+ ##  ##
+  ####
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+090-----
+
+
+########
+##    ##
+#    ##
+    ##
+   ##
+  ##
+ ##
+##     #
+##    ##
+########
+
+
+
+
+091-----
+
+
+  ####
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ####
+
+
+
+
+092-----
+
+
+
+#
+##
+###
+ ###
+  ###
+   ###
+    ###
+     ##
+      #
+
+
+
+
+093-----
+
+
+  ####
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+  ####
+
+
+
+
+094-----
+   #
+  ###
+ ## ##
+##   ##
+
+
+
+
+
+
+
+
+
+
+
+
+095-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+########
+
+
+096-----
+  ##
+  ##
+   ##
+
+
+
+
+
+
+
+
+
+
+
+
+
+097-----
+
+
+
+
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+098-----
+
+
+###
+ ##
+ ##
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+
+
+
+
+099-----
+
+
+
+
+
+ #####
+##   ##
+##
+##
+##
+##   ##
+ #####
+
+
+
+
+100-----
+
+
+   ###
+    ##
+    ##
+  ####
+ ## ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+101-----
+
+
+
+
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+102-----
+
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+103-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+##  ##
+ ####
+
+104-----
+
+
+###
+ ##
+ ##
+ ## ##
+ ### ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+105-----
+
+
+   ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+106-----
+
+
+     ##
+     ##
+
+    ###
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+ ##  ##
+ ##  ##
+  ####
+
+107-----
+
+
+###
+ ##
+ ##
+ ##  ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+###  ##
+
+
+
+
+108-----
+
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+109-----
+
+
+
+
+
+###  ##
+########
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+
+
+
+
+110-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+111-----
+
+
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+112-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+####
+
+113-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+    ##
+   ####
+
+114-----
+
+
+
+
+
+## ###
+ ### ##
+ ##  ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+115-----
+
+
+
+
+
+ #####
+##   ##
+ ##
+  ###
+    ##
+##   ##
+ #####
+
+
+
+
+116-----
+
+
+   #
+  ##
+  ##
+######
+  ##
+  ##
+  ##
+  ##
+  ## ##
+   ###
+
+
+
+
+117-----
+
+
+
+
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+118-----
+
+
+
+
+
+##    ##
+##    ##
+##    ##
+##    ##
+ ##  ##
+  ####
+   ##
+
+
+
+
+119-----
+
+
+
+
+
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+
+
+
+
+120-----
+
+
+
+
+
+##    ##
+ ##  ##
+  ####
+   ##
+  ####
+ ##  ##
+##    ##
+
+
+
+
+121-----
+
+
+
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+#####
+
+122-----
+
+
+
+
+
+#######
+##  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+123-----
+
+
+    ###
+   ##
+   ##
+   ##
+ ###
+   ##
+   ##
+   ##
+   ##
+    ###
+
+
+
+
+124-----
+
+
+   ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+125-----
+
+
+ ###
+   ##
+   ##
+   ##
+    ###
+   ##
+   ##
+   ##
+   ##
+ ###
+
+
+
+
+126-----
+
+
+ ### ##
+## ###
+
+
+
+
+
+
+
+
+
+
+
+
+127-----
+
+
+
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+#######
+
+
+
+
+
+128-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+##
+##    #
+ ##  ##
+  ####
+    ##
+     ##
+ #####
+
+
+129-----
+
+
+##  ##
+
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+130-----
+
+    ##
+   ##
+  ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+131-----
+
+   #
+  ###
+ ## ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+132-----
+
+
+##  ##
+
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+133-----
+
+ ##
+  ##
+   ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+134-----
+
+  ###
+ ## ##
+  ###
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+135-----
+
+
+
+
+  ####
+ ##  ##
+ ##
+ ##
+ ##  ##
+  ####
+    ##
+     ##
+  ####
+
+
+
+136-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+137-----
+
+
+##   ##
+
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+138-----
+
+ ##
+  ##
+   ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+139-----
+
+
+ ##  ##
+
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+140-----
+
+   ##
+  ####
+ ##  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+141-----
+
+ ##
+  ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+142-----
+
+##   ##
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+143-----
+  ###
+ ## ##
+  ###
+
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+144-----
+   ##
+  ##
+ ##
+
+#######
+ ##  ##
+ ##
+ #####
+ ##
+ ##
+ ##  ##
+#######
+
+
+
+
+145-----
+
+
+
+
+
+ ## ###
+  ### ##
+   ## ##
+ ######
+## ##
+## ###
+ ### ###
+
+
+
+
+146-----
+
+
+  #####
+ ## ##
+##  ##
+##  ##
+#######
+##  ##
+##  ##
+##  ##
+##  ##
+##  ###
+
+
+
+
+147-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+148-----
+
+
+##   ##
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+149-----
+
+ ##
+  ##
+   ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+150-----
+
+  ##
+ ####
+##  ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+151-----
+
+ ##
+  ##
+   ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+152-----
+
+
+##   ##
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+ ####
+
+153-----
+
+##   ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+154-----
+
+##   ##
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+155-----
+
+   ##
+   ##
+ ######
+##    ##
+##
+##
+##
+##    ##
+ ######
+   ##
+   ##
+
+
+
+
+156-----
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+###  ##
+######
+
+
+
+
+157-----
+
+
+##    ##
+ ##  ##
+  ####
+   ##
+########
+   ##
+########
+   ##
+   ##
+   ##
+
+
+
+
+158-----
+
+######
+ ##  ##
+ ##  ##
+ #####
+ ##   #
+ ##  ##
+ ## ####
+ ##  ##
+ ##  ##
+ ##  ##
+####  ##
+
+
+
+
+159-----
+
+    ###
+   ## ##
+   ##
+   ##
+   ##
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+ ###
+
+
+160-----
+
+   ##
+  ##
+ ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+161-----
+
+    ##
+   ##
+  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+162-----
+
+   ##
+  ##
+ ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+163-----
+
+   ##
+  ##
+ ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+164-----
+
+
+ ### ##
+## ###
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+165-----
+ ### ##
+## ###
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+
+
+
+
+166-----
+
+  ####
+ ## ##
+ ## ##
+  #####
+
+ ######
+
+
+
+
+
+
+
+
+
+167-----
+
+  ###
+ ## ##
+ ## ##
+  ###
+
+ #####
+
+
+
+
+
+
+
+
+
+168-----
+
+
+  ##
+  ##
+
+  ##
+  ##
+ ##
+##
+##   ##
+##   ##
+ #####
+
+
+
+
+169-----
+
+
+
+
+
+
+#######
+##
+##
+##
+##
+
+
+
+
+
+170-----
+
+
+
+
+
+
+#######
+     ##
+     ##
+     ##
+     ##
+
+
+
+
+
+171-----
+
+##
+##
+##    #
+##   ##
+##  ##
+   ##
+  ##
+ ##
+##  ###
+#  ## ##
+     ##
+    ##
+   #####
+
+
+172-----
+
+##
+##
+##    #
+##   ##
+##  ##
+   ##
+  ##
+ ##  ##
+##  ###
+#  # ##
+  #####
+     ##
+     ##
+
+
+173-----
+
+
+   ##
+   ##
+
+   ##
+   ##
+   ##
+  ####
+  ####
+  ####
+   ##
+
+
+
+
+174-----
+
+
+
+
+
+  ## ##
+ ## ##
+## ##
+ ## ##
+  ## ##
+
+
+
+
+
+
+175-----
+
+
+
+
+
+## ##
+ ## ##
+  ## ##
+ ## ##
+## ##
+
+
+
+
+
+
+176-----
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+177-----
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+178-----
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+179-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+180-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+181-----
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+   ##
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+182-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+183-----
+
+
+
+
+
+
+
+#######
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+184-----
+
+
+
+
+
+#####
+   ##
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+185-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ##
+     ##
+#### ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+186-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+187-----
+
+
+
+
+
+#######
+     ##
+#### ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+188-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ##
+     ##
+#######
+
+
+
+
+
+
+
+
+189-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#######
+
+
+
+
+
+
+
+
+190-----
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+   ##
+#####
+
+
+
+
+
+
+
+
+191-----
+
+
+
+
+
+
+
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+192-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+
+
+
+
+
+
+
+
+193-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+
+
+
+
+
+
+
+
+194-----
+
+
+
+
+
+
+
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+195-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+196-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+197-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+198-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+   ##
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+199-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+200-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ###
+  ##
+  ######
+
+
+
+
+
+
+
+
+201-----
+
+
+
+
+
+  ######
+  ##
+  ## ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+202-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ###
+
+########
+
+
+
+
+
+
+
+
+203-----
+
+
+
+
+
+########
+
+#### ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+204-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ###
+  ##
+  ## ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+205-----
+
+
+
+
+
+########
+
+########
+
+
+
+
+
+
+
+
+206-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ###
+
+#### ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+207-----
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+
+########
+
+
+
+
+
+
+
+
+208-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+########
+
+
+
+
+
+
+
+
+209-----
+
+
+
+
+
+########
+
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+210-----
+
+
+
+
+
+
+
+########
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+211-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ######
+
+
+
+
+
+
+
+
+212-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+   ##
+   #####
+
+
+
+
+
+
+
+
+213-----
+
+
+
+
+
+   #####
+   ##
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+214-----
+
+
+
+
+
+
+
+  ######
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+215-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+########
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+216-----
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+   ##
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+217-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+
+
+
+
+
+
+
+
+218-----
+
+
+
+
+
+
+
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+219-----
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+220-----
+
+
+
+
+
+
+
+########
+########
+########
+########
+########
+########
+########
+########
+########
+221-----
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+222-----
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+223-----
+########
+########
+########
+########
+########
+########
+########
+
+
+
+
+
+
+
+
+
+224-----
+
+
+
+
+
+ ### ##
+## ###
+## ##
+## ##
+## ##
+## ###
+ ### ##
+
+
+
+
+225-----
+
+
+ ####
+##  ##
+##  ##
+##  ##
+## ##
+##  ##
+##   ##
+##   ##
+##   ##
+##  ##
+
+
+
+
+226-----
+
+
+#######
+##   ##
+##   ##
+##
+##
+##
+##
+##
+##
+##
+
+
+
+
+227-----
+
+
+
+
+#######
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+228-----
+
+
+
+#######
+##   ##
+ ##
+  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+229-----
+
+
+
+
+
+ ######
+## ##
+## ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+230-----
+
+
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+##
+
+
+
+231-----
+
+
+
+
+ ### ##
+## ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+232-----
+
+
+
+ ######
+   ##
+  ####
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+ ######
+
+
+
+
+233-----
+
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+234-----
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+### ###
+
+
+
+
+235-----
+
+
+   ####
+  ##
+   ##
+    ##
+  #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+
+
+
+
+236-----
+
+
+
+
+
+ ######
+## ## ##
+## ## ##
+## ## ##
+ ######
+
+
+
+
+
+
+237-----
+
+
+
+      ##
+     ##
+ ######
+## ## ##
+## ## ##
+####  ##
+ ######
+ ##
+##
+
+
+
+
+238-----
+
+
+   ###
+  ##
+ ##
+ ##
+ #####
+ ##
+ ##
+ ##
+  ##
+   ###
+
+
+
+
+239-----
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+240-----
+
+
+
+
+#######
+
+
+#######
+
+
+#######
+
+
+
+
+
+241-----
+
+
+
+
+   ##
+   ##
+ ######
+   ##
+   ##
+
+
+########
+
+
+
+
+242-----
+
+
+
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+
+ ######
+
+
+
+
+243-----
+
+
+
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+
+ ######
+
+
+
+
+244-----
+
+
+    ###
+   ## ##
+   ## ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+245-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+246-----
+
+
+
+
+   ##
+   ##
+
+ ######
+
+   ##
+   ##
+
+
+
+
+
+247-----
+
+
+
+
+
+ ### ##
+## ###
+
+ ### ##
+## ###
+
+
+
+
+
+
+248-----
+
+  ###
+ ## ##
+ ## ##
+  ###
+
+
+
+
+
+
+
+
+
+
+
+249-----
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+
+
+
+250-----
+
+
+
+
+
+
+
+
+   ##
+
+
+
+
+
+
+
+251-----
+
+    ####
+    ##
+    ##
+    ##
+    ##
+    ##
+### ##
+ ## ##
+ ## ##
+  ####
+   ###
+
+
+
+
+252-----
+
+## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+
+
+
+
+
+253-----
+
+ ###
+## ##
+  ##
+ ##
+##  #
+#####
+
+
+
+
+
+
+
+
+
+254-----
+
+
+
+
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+
+
+
+
+
+255-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+--------
diff --git a/chem_dia/loadfont.com b/chem_dia/loadfont.com
new file mode 100644
index 0000000..360de2d
Binary files /dev/null and b/chem_dia/loadfont.com differ
diff --git a/chem_dia/savefont.com b/chem_dia/savefont.com
new file mode 100644
index 0000000..fbe3c9c
Binary files /dev/null and b/chem_dia/savefont.com differ
diff --git a/chngdfv.bas b/chngdfv.bas
new file mode 100644
index 0000000..56042b6
--- /dev/null
+++ b/chngdfv.bas
@@ -0,0 +1,85 @@
+	color 15
+	print"Dark Forces Voice Name Changer (DFVNC) v1.00"
+	print"                               written by RoboCop INDUSTRIES"
+	color 7
+	PARA$=COMMAND$
+	IF PARA$="+4933223198 NUM2NAM" THEN GOTO NumbersToNames
+	IF PARA$="+4933223198 NAM2NUM" THEN GOTO NamesToNumbers
+	GOTO Syntax
+
+NumbersToNames:
+	print"Gew�hlte Funktion: ";:color 14:print"Nummer ==> Name"
+	color 7
+	OPEN "I",#1,"NAMES.LST"
+	OPEN "O",#2,"DFVNC.LOG"
+	on error goto FEHLER
+	PRINT#2,"� LOG-Datei vom Dark Forces Voice Name Changer v1.00"
+	print#2,"� von RoboCop INDUSTRIES"
+	print#2,"�"
+	print#2,"� Gew�hlte Funktion: NUM2NAM"
+	print#2,"---------------------------------------------------"
+	X=1
+1	line input#1,FIL$
+	x$=str$(x)+".VOC"
+	print"Benenne ";x$;" in ";FIL$;" um ... ";
+	print#2,X$;" ===> ";FIL$;" ... ";
+	name x$ as fil$
+	print "OK"
+	print#2,"OK"
+	x=x+1
+	if eof(1) then
+	  print#2,"� <EOLF - End Of List File >"
+	  goto Ende
+	end if
+	goto 1
+
+NamesToNumbers:
+	print"Gew�hlte Funktion: ";:color 14:print"Name ==> Nummer"
+	color 7
+	OPEN "I",#1,"NAMES.LST"
+	OPEN "O",#2,"DFVNC.LOG"
+	ON ERROR GOTO FEHLER
+	PRINT#2,"� LOG-Datei vom Dark Forces Voice Name Changer v1.00"
+	print#2,"� von RoboCop INDUSTRIES"
+	print#2,"�"
+	print#2,"� Gew�hlte Funktion: NAM2NUM"
+	print#2,"---------------------------------------------------"
+	X=1
+2	line input#1,FIL$
+	x$=str$(x)+".VOC"
+	print"Benenne ";FIL$;" in ";X$;" um ... ";
+	print#2,FIL$;" ===> ";X$;" ... ";
+	name fil$ as x$
+	print "OK"
+	print#2,"OK"
+	x=x+1
+	if eof(1) then
+	  print#2,"� <EOLF - End Of List File >"
+	  goto Ende
+	end if
+	goto 2
+
+FEHLER:
+	print#2,"====================================================="
+	PRINT#2,"�                     !!!WARNUNG!!!"
+	print#2,"� Ein unbekannter Fehler ist  aufgetreten! Vielleicht"
+	print#2,"� haben Sie die FALSCHE FUNKTION gew�hlt. Wenn es das"
+	print#2,"� nicht  war, k�nnen  wir  Ihnen  auch  nicht helfen."
+	print#2,"====================================================="
+
+	Syntax:
+	print
+	print"Syntax: DFVNC [Serialnummer] [Funktion]
+	print
+	print"        Serialnummer - Ihre Serialnummer"
+	print"        Funktion     - gew�nschte Funktion:"
+	print"                       NUM2NAM - Nummern zu Namen"
+	print"                                 (z.B.: 1.VOC => DOOR2-1.VOC, ...)"
+	print"                       NAM2NUM - Namen zu Nummern"
+	print"                                 (z.B.: DOOR2-2.VOC => 2.VOC, ...)"
+	print
+	goto Ende
+
+Ende:
+	print#2,"� Programm beendet."
+
\ No newline at end of file
diff --git a/cit_095.bas b/cit_095.bas
new file mode 100644
index 0000000..25b2b8d
--- /dev/null
+++ b/cit_095.bas
@@ -0,0 +1,18 @@
+WIDTH "LPT1:",255
+lprint chr$(27);"1"
+for n=1 to 20
+read x
+flag$=flag$+chr$(x)
+next
+lprint chr$(27);"K";chr$(20);chr$(0);flag$
+flag$=""
+for n=1 to 20
+read x
+flag$=flag$+chr$(x)
+next
+lprint chr$(27);"K";chr$(20);chr$(0);flag$
+data 85,42,85,42,85,42,85,42,85,42
+data 85,85,85,85,85,85,85,85,85,85
+data 42,42,42,42,42,42,42,42,42,42
+data 42,42,42,42,42,42,42,42,42,42
+
\ No newline at end of file
diff --git a/cit_100.bas b/cit_100.bas
new file mode 100644
index 0000000..228af58
--- /dev/null
+++ b/cit_100.bas
@@ -0,0 +1,104 @@
+	dim matrix(15,15):lx=1:ly=1
+	dim wert(15)
+	dim wert$(15)
+	for x=1 to 11
+	  for y=1 to 9
+	    matrix(x,y)=0
+	  next y
+	next x
+	cls:screen 12:color 15
+	print"��� CITIZEN 120D ���"
+	print
+	gosub ShowIt
+2	locate lx+2,ly
+	if matrix(ly,lx)=0 then color 30:print"�" else color 26:print"�"
+	color 15
+1	a$=inkey$:if a$="" then 1
+	if mid$(a$,2,1)="P" and lx<9 then lx=lx+1:gosub ShowIt:goto 2
+	if mid$(a$,2,1)="H" and lx>1 then lx=lx-1:gosub ShowIt:goto 2
+	if mid$(a$,2,1)="K" and ly>1 then ly=ly-1:gosub ShowIt:goto 2
+	if mid$(a$,2,1)="M" and ly<11 then ly=ly+1:gosub ShowIt:goto 2
+	if a$=" " and matrix(ly,lx)=0 then matrix(ly,lx)=1:gosub ShowIt:goto 2
+	if a$=" " and matrix(ly,lx)=1 then matrix(ly,lx)=0:gosub ShowIt:goto 2
+	if a$=chr$(27) then goto Fertig
+	goto 1
+
+ShowIt:
+	for x=1 to 11
+	  for y=1 to 9
+	    locate y+2,x
+	    if matrix(x,y)=1 then color 15:print"�"
+	    if matrix(x,y)=0 then color 8:print"�"
+	  next y
+	next x
+	return
+
+Fertig:
+	for x=1 to 11
+	  for y=1 to 9
+	    locate y+2,x
+	    if matrix(x,y)=1 then color 15:print"�"
+	    if matrix(x,y)=0 then color 8:print"�"
+	  next y
+	next x
+	for x=1 to 11
+	  for y=1 to 9
+	    if y=1 and matrix(x,y)=1 then wert=wert+128
+	    if y=2 and matrix(x,y)=1 then wert=wert+64
+	    if y=3 and matrix(x,y)=1 then wert=wert+32
+	    if y=4 and matrix(x,y)=1 then wert=wert+16
+	    if y=5 and matrix(x,y)=1 then wert=wert+8
+	    if y=6 and matrix(x,y)=1 then wert=wert+4
+	    if y=7 and matrix(x,y)=1 then wert=wert+2
+	    if y=8 and matrix(x,y)=1 then wert=wert+1
+	    if y=9 and matrix(x,y)=1 then wert=wert+0
+	  next y
+	  wert(x)=wert
+	  wert=0
+	next x
+	for x=1 to 11
+	  wert$(x)=using$("###",wert(x))
+	next x:color 10
+	for x=1 to 11
+	  for y=12 to 14
+	    locate y,x
+	    print mid$(wert$(x),y-11,1);
+	  next y
+	  locate 15,x:color 11:print chr$(wert(x));:color 10
+	next x
+	for x=1 to 11
+	  for y=1 to 9
+	    if matrix(x,y)=1 then pset (x+150,y+45),15
+	  next y
+	next x
+5	locate 17,1:input"ASCII-Code: ",asci
+	if asci<32 or asci>126 then 5
+	locate 17,20:print"Altes Zeichen: ";chr$(asci)
+6	locate 18,1:input"Stimmt das (Ja/Nein/Anderer ASCII-Code)? ",YN$
+	if yn$="j" or yn$="J" then goto JaStimmt
+	if yn$="n" or yn$="N" then goto 2
+	if yn$="a" or yn$="A" then goto 5
+	goto 6
+JaStimmt:
+	color 10
+	print"Sende Daten ... ";
+	lprint chr$(27);":";chr$(0);chr$(0);chr$(0);
+	lprint chr$(27);"=";chr$(15);chr$(0);chr$(20);chr$(asci);chr$(0);chr$(0);
+	for x=1 to 11
+	  lprint chr$(wert(x));
+	next x
+	lprint
+	lprint chr$(27);"I";chr$(4);
+	lprint "��� CITIZEN 120D ���       ";
+	lprint "Neues Zeichen: ";chr$(asci)
+	print "OK"
+7	locate 20,1:print"Noch ein Zeichen programmieren (J/N)? ",YN$
+	if YN$="j" or YN$="J" then run
+	if YN$="n" or YN$="N" then goto Ende
+	goto 7
+
+Ende:
+	screen 0,0,0:color 15:print"��� CITIZEN 120D ���  was written by RoboCop INDUSTRIES"
+	print
+	end
+
\ No newline at end of file
diff --git a/col_tab.bas b/col_tab.bas
new file mode 100644
index 0000000..747bcac
--- /dev/null
+++ b/col_tab.bas
@@ -0,0 +1,7 @@
+	for x=0 to 31
+	  for y=0 to 7
+	    color x,y:print using" ##_,#�>��";x,y;
+	  next y
+	  print
+	next x
+
\ No newline at end of file
diff --git a/compi/andreas.cfg b/compi/andreas.cfg
new file mode 100644
index 0000000..7764494
--- /dev/null
+++ b/compi/andreas.cfg
@@ -0,0 +1,2 @@
+3,3,3,1,2,2,1,3,3,2,2,2,3,2
+1
diff --git a/compi/arne.cfg b/compi/arne.cfg
new file mode 100644
index 0000000..598f8c9
--- /dev/null
+++ b/compi/arne.cfg
@@ -0,0 +1,2 @@
+2,3,2,1,2,2,1,2,2,2,2,2,2,2
+1
diff --git a/compi/co&m.cfg b/compi/co&m.cfg
new file mode 100644
index 0000000..8d93779
--- /dev/null
+++ b/compi/co&m.cfg
@@ -0,0 +1,2 @@
+2,0,2,3,1,2,2,2,1,3,1,1,0,2
+0
diff --git a/compi/compi.bas b/compi/compi.bas
new file mode 100644
index 0000000..d32ddb4
--- /dev/null
+++ b/compi/compi.bas
@@ -0,0 +1,257 @@
+5 FLE$="COMPI.CFG"
+10 CLS
+20 KEY OFF
+30 CO=10
+40 OF=8
+50 PIN=14
+60 BR=15
+70 A=2:B=2:C=2:D=2:E=2:F=2:G=2
+80 H=2:I=2:J=2:K=2:L=2:M=2:N=2
+90 TUR=0
+100 REM Anzeigeroutine
+110 COLOR 15:LOCATE 5,30:PRINT"W     - Werte speichern [";FLE$;"]"
+120 LOCATE 6,30:PRINT"R     - Werte laden [";FLE$;"]"
+130 LOCATE 7,30:PRINT"S     - Datei �ndern (momentan: ";FLE$;")"
+140 LOCATE 8,30:PRINT"Q     - Werte zur�cksetzen"
+150 LOCATE 9,30:PRINT"Z     - Zufallswerte setzen"
+160 LOCATE 10,30:PRINT"T     - TURBO AN/AUS"
+170 LOCATE 11,30:PRINT"U     - m�gliche Dateinamen"
+180 LOCATE 12,30:PRINT"A-N   - Werte einzeln �ndern"
+190 LOCATE 13,30:PRINT"^/�   - EXIT TO DOS"
+200 LOCATE 14,30:PRINT"[SPCE]- alle Werte �ndern"
+210 LOCATE 1,2:IF A=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+220 LOCATE 2,1:IF A=2 THEN COLOR BR:PRINT"��" ELSE IF A=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+230 LOCATE 3,2:IF A=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+240 LOCATE 1,4:IF B=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+250 LOCATE 2,3:IF B=2 THEN COLOR BR:PRINT"��" ELSE IF B=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+260 LOCATE 3,4:IF B=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+270 LOCATE 1,6:IF C=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+280 LOCATE 2,5:IF C=2 THEN COLOR BR:PRINT"��" ELSE IF C=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+290 LOCATE 3,6:IF C=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+300 LOCATE 1,8:IF D=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+310 LOCATE 2,7:IF D=2 THEN COLOR BR:PRINT"��" ELSE IF D=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+320 LOCATE 3,8:IF D=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+330 LOCATE 1,10:IF E=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+340 LOCATE 2,9:IF E=2 THEN COLOR BR:PRINT"��" ELSE IF E=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+350 LOCATE 3,10:IF E=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+360 LOCATE 1,12:IF F=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+370 LOCATE 2,11:IF F=2 THEN COLOR BR:PRINT"��" ELSE IF F=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+380 LOCATE 3,12:IF F=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+390 LOCATE 1,14:IF G=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+400 LOCATE 2,13:IF G=2 THEN COLOR BR:PRINT"��" ELSE IF G=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+410 LOCATE 3,14:IF G=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+420 REM Untere Reihe
+430 LOCATE 13,2:IF H=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+440 LOCATE 14,1:IF H=2 THEN COLOR BR:PRINT"��" ELSE IF H=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+450 LOCATE 15,2:IF H=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+460 LOCATE 13,4:IF I=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+470 LOCATE 14,3:IF I=2 THEN COLOR BR:PRINT"��" ELSE IF I=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+480 LOCATE 15,4:IF I=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+490 LOCATE 13,6:IF J=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+500 LOCATE 14,5:IF J=2 THEN COLOR BR:PRINT"��" ELSE IF J=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+510 LOCATE 15,6:IF J=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+520 LOCATE 13,8:IF K=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+530 LOCATE 14,7:IF K=2 THEN COLOR BR:PRINT"��" ELSE IF K=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+540 LOCATE 15,8:IF K=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+550 LOCATE 13,10:IF L=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+560 LOCATE 14,9:IF L=2 THEN COLOR BR:PRINT"��" ELSE IF L=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+570 LOCATE 15,10:IF L=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+580 LOCATE 13,12:IF M=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+590 LOCATE 14,11:IF M=2 THEN COLOR BR:PRINT"��" ELSE IF M=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+600 LOCATE 15,12:IF M=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+610 LOCATE 13,14:IF N=1 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+620 LOCATE 14,13:IF N=2 THEN COLOR BR:PRINT"��" ELSE IF N=0 THEN COLOR PIN:PRINT"oo" ELSE COLOR PIN:PRINT"o";:COLOR BR:PRINT"�"
+630 LOCATE 15,14:IF N=3 THEN COLOR BR:PRINT"�" ELSE COLOR PIN:PRINT"o"
+640 LOCATE 1,40:IF TUR=0 THEN COLOR OF:PRINT"���" ELSE COLOR 14:PRINT"���"
+650 COLOR 15:LOCATE 2,39:PRINT"TURBO"
+660 IF A=1 AND TUR=0 OR A=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+670 IF A=2 THEN COLOR CO
+680 LOCATE 6,2:PRINT"�":LOCATE 7,2:PRINT"�"
+690 IF B=1 AND TUR=0 OR B=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+700 IF B=2 THEN COLOR CO
+710 LOCATE 8,3:PRINT"���"
+720 IF C=1 AND TUR=0 OR C=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+730 IF C=2 THEN COLOR CO
+740 LOCATE 5,3:PRINT"���"
+750 IF D=1 AND TUR=0 OR D=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+760 IF D=2 THEN COLOR CO
+770 LOCATE 6,6:PRINT"�":LOCATE 7,6:PRINT"�"
+780 IF E=1 AND TUR=0 OR E=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+790 IF E=2 THEN COLOR CO
+800 LOCATE 6,9:PRINT"�":LOCATE 7,9:PRINT"�"
+810 IF F=1 AND TUR=0 OR F=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+820 IF F=2 THEN COLOR CO
+830 LOCATE 5,10:PRINT"���"
+840 IF G=1 AND TUR=0 OR G=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+850 IF G=2 THEN COLOR CO
+860 LOCATE 6,13:PRINT"�":LOCATE 7,13:PRINT"�"
+870 REM Untere Reihe
+880 IF H=1 AND TUR=0 OR H=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+890 IF H=2 THEN COLOR CO
+900 LOCATE 9,2:PRINT"�":LOCATE 10,2:PRINT"�"
+910 IF I=1 AND TUR=0 OR I=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+920 IF I=2 THEN COLOR CO
+930 LOCATE 11,3:PRINT"���"
+940 IF J=1 AND TUR=0 OR J=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+950 IF J=2 THEN COLOR CO
+960 LOCATE 9,6:PRINT"�":LOCATE 10,6:PRINT"�"
+970 IF K=1 AND TUR=0 OR K=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+980 IF K=2 THEN COLOR CO
+990 LOCATE 9,9:PRINT"�":LOCATE 10,9:PRINT"�"
+1000 IF L=1 AND TUR=0 OR L=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+1010 IF L=2 THEN COLOR CO
+1020 LOCATE 11,10:PRINT"���"
+1030 IF M=1 AND TUR=0 OR M=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+1040 IF M=2 THEN COLOR CO
+1050 LOCATE 8,10:PRINT"���"
+1060 IF N=1 AND TUR=0 OR N=3 AND TUR=1 THEN COLOR CO ELSE COLOR OF
+1070 IF N=2 THEN COLOR CO
+1080 LOCATE 9,13:PRINT"�":LOCATE 10,13:PRINT"�"
+1090 COLOR OF:LOCATE 11,7:PRINT"�":LOCATE 11,14:PRINT"�"
+1100 LOCATE 16,30:COLOR 15:PRINT" A  B  C  D  E  F  G  H  I  J  K  L  M  N"
+1110 LOCATE 17,30
+1120 X=A:GOSUB 1150:X=B:GOSUB 1150:X=C:GOSUB 1150:X=D:GOSUB 1150:X=E:GOSUB 1150:X=F:GOSUB 1150:X=G:GOSUB 1150
+1130 X=H:GOSUB 1150:X=I:GOSUB 1150:X=J:GOSUB 1150:X=K:GOSUB 1150:X=L:GOSUB 1150:X=M:GOSUB 1150:X=N:GOSUB 1150
+1140 GOTO 1200
+1150 IF X=0 THEN COLOR 15
+1160 IF X=1 THEN COLOR 8
+1170 IF X=2 THEN COLOR 10
+1180 IF X=3 THEN COLOR 14
+1190 PRINT X;:RETURN
+1200 REM Eingaberoutine
+1210 A$=INKEY$:IF A$="" THEN 1210
+1220 IF A$="T" OR A$="t" THEN IF TUR=0 THEN TUR=1:GOTO 640 ELSE TUR=0:GOTO 640
+1230 IF A$=" " THEN 1890
+1240 IF A$="w" OR A$="W" THEN 2120
+1250 IF A$="q" OR A$="Q" THEN 2310
+1260 IF A$="r" OR A$="R" THEN 2190
+1270 IF A$="s" OR A$="S" THEN 2260
+1280 IF A$="u" OR A$="U" THEN 2490
+1290 IF A$="z" OR A$="Z" THEN 2330
+1300 IF A$="a" OR A$="A" THEN 1470
+1310 IF A$="b" OR A$="B" THEN 1500
+1320 IF A$="c" OR A$="C" THEN 1530
+1330 IF A$="d" OR A$="D" THEN 1560
+1340 IF A$="e" OR A$="E" THEN 1590
+1350 IF A$="f" OR A$="F" THEN 1620
+1360 IF A$="g" OR A$="G" THEN 1650
+1370 IF A$="h" OR A$="H" THEN 1680
+1380 IF A$="i" OR A$="I" THEN 1710
+1390 IF A$="j" OR A$="J" THEN 1740
+1400 IF A$="k" OR A$="K" THEN 1770
+1410 IF A$="l" OR A$="L" THEN 1800
+1420 IF A$="m" OR A$="M" THEN 1830
+1430 IF A$="n" OR A$="N" THEN 1860
+1440 IF A$="^" OR A$="�" THEN CLS:COLOR 15:END
+1450 GOTO 1210
+1460 REM INPUT
+1470 LOCATE 17,1:INPUT "Neuer Wert f�r A: ",A
+1480 IF A<0 OR A>3 THEN 1470
+1490 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1500 LOCATE 17,1:INPUT "Neuer Wert f�r B: ",B
+1510 IF B<0 OR B>3 THEN 1500
+1520 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1530 LOCATE 17,1:INPUT "Neuer Wert f�r C: ",C
+1540 IF C<0 OR C>3 THEN 1530
+1550 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1560 LOCATE 17,1:INPUT "Neuer Wert f�r D: ",D
+1570 IF D<0 OR D>3 THEN 1560
+1580 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1590 LOCATE 17,1:INPUT "Neuer Wert f�r E: ",E
+1600 IF E<0 OR E>3 THEN 1590
+1610 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1620 LOCATE 17,1:INPUT "Neuer Wert f�r F: ",F
+1630 IF F<0 OR F>3 THEN 1620
+1640 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1650 LOCATE 17,1:INPUT "Neuer Wert f�r G: ",G
+1660 IF G<0 OR G>3 THEN 1650
+1670 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1680 LOCATE 17,1:INPUT "Neuer Wert f�r H: ",H
+1690 IF H<0 OR H>3 THEN 1680
+1700 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1710 LOCATE 17,1:INPUT "Neuer Wert f�r I: ",I
+1720 IF I<0 OR I>3 THEN 1710
+1730 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1740 LOCATE 17,1:INPUT "Neuer Wert f�r J: ",J
+1750 IF J<0 OR J>3 THEN 1740
+1760 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1770 LOCATE 17,1:INPUT "Neuer Wert f�r K: ",K
+1780 IF K<0 OR K>3 THEN 1770
+1790 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1800 LOCATE 17,1:INPUT "Neuer Wert f�r L: ",L
+1810 IF L<0 OR L>3 THEN 1800
+1820 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1830 LOCATE 17,1:INPUT "Neuer Wert f�r M: ",M
+1840 IF M<0 OR M>3 THEN 1830
+1850 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1860 LOCATE 17,1:INPUT "Neuer Wert f�r N: ",N
+1870 IF N<0 OR N>3 THEN 1860
+1880 LOCATE 17,1:PRINT SPACE$(25):GOTO 100
+1890 REM Gesamteingabe
+1900 COLOR 15
+1910 LOCATE 17,1:INPUT"A=",A:IF A<0 OR A>3 THEN 1910
+1920 INPUT"B=",B:IF B<0 OR B>3 THEN LOCATE 18,1:GOTO 1920
+1930 INPUT"C=",C:IF C<0 OR C>3 THEN LOCATE 19,1:GOTO 1930
+1940 INPUT"D=",D:IF D<0 OR D>3 THEN LOCATE 20,1:GOTO 1940
+1950 INPUT"E=",E:IF E<0 OR E>3 THEN LOCATE 21,1:GOTO 1950
+1960 INPUT"F=",F:IF E<0 OR E>3 THEN LOCATE 22,1:GOTO 1960
+1970 INPUT"G=",G:IF G<0 OR G>3 THEN LOCATE 23,1:GOTO 1970
+1980 LOCATE 17,5:INPUT"H=",H:IF H<0 OR H>3 THEN 1980
+1990 LOCATE 18,5:INPUT"I=",I:IF I<0 OR I>3 THEN 1990
+2000 LOCATE 19,5:INPUT"J=",J:IF J<0 OR J>3 THEN 2000
+2010 LOCATE 20,5:INPUT"K=",K:IF K<0 OR K>3 THEN 2010
+2020 LOCATE 21,5:INPUT"L=",L:IF L<0 OR L>3 THEN 2020
+2030 LOCATE 22,5:INPUT"M=",M:IF M<0 OR M>3 THEN 2030
+2040 LOCATE 23,5:INPUT"N=",N:IF N<0 OR N>3 THEN 2040
+2050 LOCATE 17,1:PRINT SPACE$(70)
+2060 PRINT SPACE$(70)
+2070 PRINT SPACE$(70)
+2080 PRINT SPACE$(70)
+2090 PRINT SPACE$(70)
+2100 PRINT SPACE$(70)
+2110 PRINT SPACE$(70):GOTO 100
+2120 REM Werte speichern
+2130 OPEN "O",#1,FLE$
+2140 LOCATE 17,1:COLOR 15:PRINT"Werte gesichert!"
+2150 WRITE#1,A,B,C,D,E,F,G,H,I,J,K,L,M,N
+2160 WRITE#1,TUR
+2170 CLOSE #1
+2180 GOTO 1200
+2190 REM Werte laden
+2200 OPEN "I",#1,FLE$
+2210 LOCATE 17,1:COLOR 15:PRINT"Werte geladen!  "
+2220 INPUT#1,A,B,C,D,E,F,G,H,I,J,K,L,M,N
+2230 INPUT#1,TUR
+2240 CLOSE #1
+2250 GOTO 100
+2260 REM Datei �ndern
+2270 LOCATE 17,1:COLOR 15:INPUT"Neuer Dateiname: ",NFLE$
+2280 IF NFLE$="" THEN CLS:GOTO 100
+2290 FLE$=NFLE$
+2300 CLS:GOTO 100
+2310 REM RESET
+2320 GOTO 70
+2330 REM Zufall
+2340 A=INT(RND(1)*4)
+2350 B=INT(RND(1)*4)
+2360 C=INT(RND(1)*4)
+2370 D=INT(RND(1)*4)
+2380 E=INT(RND(1)*4)
+2390 F=INT(RND(1)*4)
+2400 G=INT(RND(1)*4)
+2410 H=INT(RND(1)*4)
+2420 I=INT(RND(1)*4)
+2430 J=INT(RND(1)*4)
+2440 K=INT(RND(1)*4)
+2450 L=INT(RND(1)*4)
+2460 M=INT(RND(1)*4)
+2470 N=INT(RND(1)*4)
+2480 GOTO 100
+2490 REM Directory
+2500 LOCATE 17,1:COLOR 15
+2510 FILES "*.CFG"
+2520 PRINT"Bitte Taste dr�cken!"
+2530 A$=INKEY$:IF A$="" THEN 2530
+2540 LOCATE 17,1:FOR Z=1 TO 7:PRINT SPACE$(79):NEXT Z
+2550 GOTO 1200
+
\ No newline at end of file
diff --git a/compi/compi.cfg b/compi/compi.cfg
new file mode 100644
index 0000000..8d93779
--- /dev/null
+++ b/compi/compi.cfg
@@ -0,0 +1,2 @@
+2,0,2,3,1,2,2,2,1,3,1,1,0,2
+0
diff --git a/compi/hans.cfg b/compi/hans.cfg
new file mode 100644
index 0000000..09c4f60
--- /dev/null
+++ b/compi/hans.cfg
@@ -0,0 +1,3 @@
+3,3,0,2,1,3,2,0,0,2,3,3,2,1
+1
+
\ No newline at end of file
diff --git a/compi/hans2.cfg b/compi/hans2.cfg
new file mode 100644
index 0000000..d256e45
--- /dev/null
+++ b/compi/hans2.cfg
@@ -0,0 +1,3 @@
+3,2,2,2,3,2,2,0,2,2,3,2,1,2
+1
+
\ No newline at end of file
diff --git a/compi/hcv386.cfg b/compi/hcv386.cfg
new file mode 100644
index 0000000..54248e4
--- /dev/null
+++ b/compi/hcv386.cfg
@@ -0,0 +1,3 @@
+1,3,2,2,1,2,2,1,2,2,1,2,2,2
+1
+
\ No newline at end of file
diff --git a/compi/hcv3862.cfg b/compi/hcv3862.cfg
new file mode 100644
index 0000000..50e1ee7
--- /dev/null
+++ b/compi/hcv3862.cfg
@@ -0,0 +1,3 @@
+0,3,3,3,1,2,2,0,3,3,1,2,2,2
+1
+
\ No newline at end of file
diff --git a/compi/maik.cfg b/compi/maik.cfg
new file mode 100644
index 0000000..acc1a39
--- /dev/null
+++ b/compi/maik.cfg
@@ -0,0 +1,2 @@
+2,3,0,2,2,2,2,0,0,2,2,2,0,2
+0
diff --git a/csafe.bas b/csafe.bas
new file mode 100644
index 0000000..e64359f
--- /dev/null
+++ b/csafe.bas
@@ -0,0 +1,76 @@
+$COMPILE EXE
+	on error goto 4
+	comm$=command$
+	msg$="Befehl oder Dateiname nicht gefunden                                           "+chr$(13)
+	wdi$="Ung�ltiges Verzeichnis                                                         "+chr$(13)
+	x=1
+1	x$=mid$(comm$,x,1)
+	if x$=chr$(32) or x$="" then x=x+1:goto 2
+	c1$=c1$+x$
+	x=x+1
+	goto 1
+2	x$=mid$(comm$,x,1)
+	if x$=chr$(32) or x$="" then x=x+1:goto 3
+	c2$=c2$+x$
+	x=x+1
+	goto 2
+3	if c1$="" then goto Syntax
+	pass$=c1$
+	if c2$="" then LogIt=0 else LogIt=1:file$=c2$
+	if LogIt=1 then open "A",#1,file$
+	if LogIt=1 then print#1,""
+	if LogIt=1 then print#1,"����������������������������������������������������������������������������"
+	if LogIt=1 then print#1,"�����������������۲���������������������������������������������������������"
+	if LogIt=1 then print#1,"����������������۲����������������������������������������������������������"
+	if LogIt=1 then print#1,"���������������۲������������ CSAFE-LOG-FILE �������������������������������"
+	if LogIt=1 then print#1,"��������������۲����� (C)1995 by RoboCop INDUSTRIES ������������������������"
+	if LogIt=1 then print#1,"���������������۲�����������������������������������������������������������"
+	if LogIt=1 then print#1,"����������������۲����������������������������������������������������������"
+	if LogIt=1 then print#1,"����������������������������������������������������������������������������"
+	if LogIt=1 then print#1,"Datum: ";date$;"    Uhrzeit: ";time$;"    Passwort: ";pass$
+	if LogIt=1 then print#1,""
+	if LogIt=1 then print#1,"Datum      Uhrzeit  Eingabe                                           getan?"
+	if LogIt=1 then print#1,"���������� �������� ������������������������������������������������� ������"
+	color 7
+4	print curdir$;:input ">",eingabe$(1),eingabe$(2),eingabe$(3),eingabe$(4),eingabe$(5),eingabe$(6)
+	if eingabe$(6)<>"" then eingabe$=eingabe$(1)+","+eingabe$(2)+","+eingabe$(3)+","+eingabe$(4)+","+eingabe$(5)+","+eingabe$(6):goto 5
+	if eingabe$(5)<>"" then eingabe$=eingabe$(1)+","+eingabe$(2)+","+eingabe$(3)+","+eingabe$(4)+","+eingabe$(5):goto 5
+	if eingabe$(4)<>"" then eingabe$=eingabe$(1)+","+eingabe$(2)+","+eingabe$(3)+","+eingabe$(4):goto 5
+	if eingabe$(3)<>"" then eingabe$=eingabe$(1)+","+eingabe$(2)+","+eingabe$(3):goto 5
+	if eingabe$(2)<>"" then eingabe$=eingabe$(1)+","+eingabe$(2):goto 5
+	if eingabe$(1)<>"" then eingabe$=eingabe$(1):goto 5
+5	if eingabe$=pass$ then goto OKEnde
+	if lcase$(eingabe$)="cls" then goto ClearScreen
+	if LogIt=1 then stat$="NEIN":gosub WriteLog
+	print msg$
+	goto 4
+
+ClearScreen:
+	if LogIt=1 then stat$="JA":gosub WriteLog
+	cls
+	goto 4
+
+WriteLog:
+	if len(eingabe$)>49 then eingabe$=left$(eingabe$,46)+"..."
+	if LogIt=1 then print#1,using "\        \ \      \ \                                               \ \    \";date$;time$;eingabe$;stat$
+	return
+
+Syntax:
+	color 10:print"-=� CSAFE v2.00 �=-":color 15
+	print
+	print"Syntax: ";:color 14:?"CSAFE Passwort [Log-Datei]":color 7
+	print
+	print"�Passwort  - Das Passwort, das eingegeben werden mu�"
+	print"�Log-Datei - Die Datei, in die die Eingaben geschrieben werden sollen"
+	print:color 12
+	print"(C)1995 by Markus Birth":color 7
+	goto Ende
+
+OKEnde:
+	stat$="ENDE"
+	if LogIt=1 then gosub WriteLog
+	print"Befehl oder Dateiname nicht gefunden"
+	goto Ende
+
+Ende:
+
\ No newline at end of file
diff --git a/dart.bas b/dart.bas
new file mode 100644
index 0000000..6b27dd1
--- /dev/null
+++ b/dart.bas
@@ -0,0 +1,107 @@
+	print"Dart was written by"
+	$INCLUDE "LOGO.INC"
+	DELAY .5
+Menu:
+	CLS
+	locate 1,1:color 15:print"��� DART ��� by RoboCop INDUSTRIES"
+	print:color 14
+	print"Dieses Programm ist abgestimmt auf die DARTGAME~-Zielscheibe"
+	print"von BEST sporting!"
+	print:color 10
+	print"W�hlen Sie eine Option:":color 15
+	print" A - Spielregeln"
+	print" B - Dart"
+	print" C - Zielscheibe":color 12
+	print" X - Ende"
+	print
+1	a$=inkey$:if a$="" then 1
+	if a$="a" or a$="A" then goto Rules
+	if a$="b" or a$="B" then goto Dart
+	if a$="c" or a$="C" then goto Target
+	if a$="x" or a$="X" then goto Ende
+	sound 1000,.25
+	goto 1
+
+Rules:
+	cls
+	color 15:print"��� Spielregeln ���":color 14
+	print
+	print"Punkteverteilung:  Auge          - 50 Punkte"
+	print"                   25-Ring       - 25 Punkte"
+	print"                   mittlere Zone - 2x"
+	print"                   �u�ere Zone   - 3x"
+	print
+	color 10:print"                     === Taste dr�cken, wenn bereit ===":color 15
+2	a$=inkey$:if a$="" then 2
+	print"��� Spielregeln ���":color 14
+	print
+	print"Regeln:  1. Die Zielscheibe ist so aufzuh�ngen, da� die Mitte 1,72m �ber dem"
+	print"            Fu�boden h�ngt. Der Abstand von der Wurflinie zur Scheibe betr�gt"
+	print"            2,44m, die Wurflinie darf nicht �bertreten werden."
+	print"         2. Jeder Spieler wirft zun�chst nur einen Dart auf die Schiebe. Der-"
+	print"            jenige Spieler oder diejenige Mannschaft deren Dart dem Mittelpunkt"
+	print"            am n�chsten kommt, beginnt das Spiel."
+	print"         3. Jeder Spieler wirft abwechselnd 3 Darts. Treffer werden nur ge-"
+	print"            wertet, wenn die Darts in der Scheibe steckenbleiben."
+	print"         4. Es wird mit 301 Punkten bzw. bei Mannschaften mit 501 oder 1001"
+	print"            begonnen. Von dieser Punktzahl werden die jeweils geworfenen"
+	print"            Punkte abgezogen."
+	print"         5. Das Spiel kann nur beendet werden, wenn ein Feld im Doppelring oder"
+	print"            der Mittelpunkt getroffen wird. Mit der geworfenen Doppelziffer"
+	print"            oder mit der Ziffer 50 mu� exakt ";chr$(34);"Null";chr$(34);" erreicht werden."
+	print"         6. Wird in der Endphase eine gr��ere Punktzahl geworfen als n�tig, um"
+	print"            ";chr$(34);"Null";chr$(34);" zu erreichen, so ist die geworfene Punktzahl ung�ltig, die"
+	print"            Punktzahl bleibt, wir sie vor dem Wurf war. Der Spieler"
+	print"            (bzw. Mannschaft), der zuerst ";chr$(34);"Null";chr$(34);" erreicht hat, ist Sieger."
+	print
+	print
+	print:color 10
+	print"                     === Taste dr�cken, wenn bereit ===";:color 15
+3	a$=inkey$:if a$="" then 3
+	goto Menu
+
+Dart:
+	cls
+	color 15:print"��� DARTGAME ���"
+	print
+	input"Anzahl Spieler  : ",players
+	for x=1 to players
+	  print"Name Spieler";x;
+	  input" :",playername$(x)
+	next x
+	open "O",#1,"DART.GAM"
+	print#1,"��� DARTGAME ��� (by RoboCop INDUSTRIES)"
+	print#1,""
+	print#1,"Name         Wurf Pfeil Punkte ges.Punkte   �   "
+	print#1,"============ ==== ===== ====== ========== ===== "
+	cls
+	color 15:print"��� DARTGAME ���"
+	print
+	for maximum=1 to 500
+	  for x=1 to players
+	    throw(x)=throw(x)+1
+	    locate 3,1:print"Spieler";x;":  "
+	    locate 4,1:print playername$(x);"          "
+	    locate 5,1:print"Statistik:"
+	    locate 7,1:print"Wurf Pfeil Punkte ges.Punkte   �   "
+	    locate 8,1:print"==== ===== ====== ========== ======"
+	    for y=1 to 3
+		 arrow(x)=arrow(x)+1
+		 locate 9,12:input"",points
+		 points(x)=points(x)+points
+		 locate 9,1:print using"#### ##### ###### ########## ###.##";throw(x);y;points;points(x);points(x)/arrow(x);
+		 print #1,using"#### ##### ###### ########## ###.##";throw(x);y;points;points(x);points(x)/arrow(x);
+	    next y
+	  next x
+	next maximum
+
+
+Target:
+
+Ende:
+	cls
+	color 15:print"��� DART ��� was written by"
+	$INCLUDE "LOGO.INC"
+	print
+	end
+
\ No newline at end of file
diff --git a/dart.gam b/dart.gam
new file mode 100644
index 0000000..47a6d06
--- /dev/null
+++ b/dart.gam
@@ -0,0 +1,4 @@
+��� DARTGAME ��� (by RoboCop INDUSTRIES)
+
+Name         Wurf Pfeil Punkte ges.Punkte   �   
+============ ==== ===== ====== ========== ===== 
diff --git a/decode.bas b/decode.bas
new file mode 100644
index 0000000..ea5238b
--- /dev/null
+++ b/decode.bas
@@ -0,0 +1,65 @@
+cls
+open "I",#1,"USER.DAT"
+line input #1,nam$
+line input #1,num$
+num$="Unlizensierte Kopie !!"
+close #1
+stp=0
+1 rem cls
+color 15
+locate 1,1
+print "Codierter USER #1: ";nam$
+print "Codierter USER #2: ";num$
+print
+print "Decodierter #1   : ";dnam$
+print "Decodierter #2   : ";dnum$
+print
+print "Schrittweite : ";stp
+dnam$=""
+dnum$=""
+for z=1 to len(nam$)
+  x$=mid$(nam$,z,1)
+  x=asc(x$)
+  soll=x+stp
+  locate 4,19+z
+  print chr$(soll)
+  dnam$=dnam$+chr$(soll)
+next z
+
+for y=1 to len(num$)
+  x$=mid$(num$,y,1)
+  x=asc(x$)
+  soll=x+stp
+  locate 5,19+y
+  print chr$(soll)
+  dnum$=dnum$+chr$(soll)
+next y
+2 a$=inkey$:if a$="" then 2
+  if a$="i" or a$="I" then gosub InputNumb:goto 1
+  if a$="-" then stp=stp-1:goto 1
+  if a$="+" then stp=stp+1:goto 1
+  if a$=chr$(13) then locate 10,1:goto WriteErg
+  if a$=chr$(27) then locate 10,1:goto Ende
+  goto 2
+goto 1
+
+InputNumb:
+locate 10,1
+color 15:input"Geben Sie die Verschiebung ein :",stp
+locate 10,1:print space$(79)
+return
+
+WriteErg:
+print"Benenne USER.DAT in USER2.DAT um ... ";
+name "USER.DAT" as "USER2.DAT"
+print "OK"
+print"Schreibe USER.DAT ... ";
+open "O",#1,"USER.DAT"
+print#1,"";dnam$
+print#1,"";dnum$
+close #1
+print"OK"
+print
+
+Ende:
+print"Programm-Ende."
\ No newline at end of file
diff --git a/decrypt.bas b/decrypt.bas
new file mode 100644
index 0000000..49d98c6
--- /dev/null
+++ b/decrypt.bas
@@ -0,0 +1,38 @@
+	cls
+	open "I",#1,"TRICK.DAT"
+	dim l$(80)
+	line input#1,line1$
+	close #1
+	locate 1,1:color 15:print"Original:  ";line1$
+	for x=1 to len(line1$)
+	  l$(x)=mid$(line1$,x,1)
+	next x
+	locate 2,1:color 15:print"Crypted :  ";:color 7
+	for x=1 to len(line1$)
+	  print l$(x);
+	next x
+	x=1
+2	  locate 2,11+x:color 14:print l$(x)
+1	  a$=inkey$: if a$="" then 1
+	  if a$="+" then l$(x)=chr$(asc(l$(x))+1):goto 2
+	  if a$="-" then l$(x)=chr$(asc(l$(x))-1):goto 2
+	  if a$=chr$(27) then 3
+	  if a$=chr$(8) then locate 2,11+x:color 7:print l$(x):x=x-1:goto 2
+	  if a$=chr$(13) then color 15:locate 2,11+x:print l$(x):x=x+1:if x>len(line1$) then 3 else goto 2
+3	print:color 15
+	print"ASCII-Werte:"
+	for x=1 to len(line1$)
+	  print asc(l$(x));
+	next x
+	print
+	print"Schreibe Daten in DECRYPT.OUT ... ";
+	open "o",#1,"decrypt.out"
+	print#1,"No C O ASC ASO Diff"
+	for x=1 to len(line1$)
+	  unt=asc(l$(x))-asc(mid$(line1$,x,1))
+	  print #1, using "## ! ! ### ### +###";x;mid$(line1$,x,1);l$(x);asc(mid$(line1$,x,1));asc(l$(x));unt
+	next x
+	print"OK"
+	close #1
+
+
\ No newline at end of file
diff --git a/delpick.bas b/delpick.bas
new file mode 100644
index 0000000..d07c81a
--- /dev/null
+++ b/delpick.bas
@@ -0,0 +1,216 @@
+$INCLUDE "LOGO.INC"
+$INCLUDE "PBWINDOW.INC"
+	if command$="SKIP" or command$="skip" then goto SkipIt
+	color 15
+	Lin=csrlin-1
+	txt$="proudly presents"
+	txt$(1)=txt$
+	gosub WriteText
+	txt$="The Paintbrush Pick Info Remover"
+	txt$(2)=txt$
+	print
+	Lin=csrlin-1
+	delay 1
+	gosub WriteText
+	delay 1
+	color 9
+	Anf1=40-int(len(txt$(1))/2)+1
+	Anf2=40-int(len(txt$(2))/2)+1
+	locate Lin-1,Anf1:print txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	delay .15
+	color 3
+	locate Lin-1,Anf1:print txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	delay .15
+	color 11
+	locate Lin-1,Anf1:print Txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	delay .15
+	color 15
+	locate Lin-1,Anf1:print txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	goto Program
+
+WriteText:
+	AnfLocX=40-int(len(txt$)/2)
+	x=1
+1	if x>0 then LetA$=mid$(txt$,x,1)
+	if x>1 then LetB$=mid$(txt$,x-1,1)
+	if x>2 then LetC$=mid$(txt$,x-2,1)
+	if x>3 then LetD$=mid$(txt$,x-3,1)
+	if x>4 then LetE$=mid$(txt$,x-4,1)
+	if x>0 then color 15:locate Lin,AnfLocX+x:print LetA$
+	if x>1 then color 11:locate Lin,AnfLocX+x-1:print LetB$
+	if x>2 then color 3:locate Lin,AnfLocX+x-2:print LetC$
+	if x>3 then color 9:locate Lin,AnfLocX+x-3:print LetD$
+	if x>4 then color 1:locate Lin,AnfLocX+x-4:print LetE$
+	x=x+1:if x>len(txt$)+4 then 2 else delay .05:goto 1
+2	delay 1
+	color 15:locate Lin,AnfLocX+1:print txt$
+	delay .1:color 11:locate Lin,AnfLocX+1:print txt$
+	delay .1:color  3:locate Lin,AnfLocX+1:print txt$
+	delay .1:color  9:locate Lin,AnfLocX+1:print txt$
+	delay .1:color  1:locate Lin,AnfLocX+1:print txt$
+	return
+
+SkipIt:
+	color 15
+	txt$="proudly presents"
+	locate csrlin-1,40-int(len(txt$)/2):print txt$
+	txt$="The Paintbrush Pick Info Remover"
+	locate csrlin,40-int(len(txt$)/2):print txt$
+	goto Program
+
+Program:
+	Item$(0)="[Programm w�hlen]"
+	gosub PF2:test=1
+	gosub CheckForPresence
+	gosub PF3:test=2
+	gosub CheckForPresence
+	gosub PCP:test=3
+	gosub CheckForPresence
+	Lin=17
+	call MakeWindow (15,9,5,63,ColAttr%(11,0),2,4,2)
+	call TitleWindow (1,"[Information]")
+	txt$="Zum Abbrechen [ESC] dr�cken, ansonsten eine Auswahl treffen"
+	if command$="skip" or command$="SKIP" then
+	  locate Lin,40-int(len(txt$)/2)
+	  color 15,0
+	  print txt$
+	  goto 7
+	end if
+	gosub WriteText:delay 1
+	color 9:locate 17,AnfLocX+1:print txt$:delay .15
+	color 3:locate 17,AnfLocX+1:print txt$:delay .15
+	color 11:locate 17,AnfLocX+1:print txt$:delay .15
+	color 15:locate 17,AnfLocX+1:print txt$
+7	Call MakeMenu (3,3,ColAttr%(11,1),ColAttr%(0,3),4,4,2,1,3,Item$())
+	if CurntPos%=0 then ag=0:goto BreakItUp
+	if CurntPos%=1 and right$(Item$(1),17)<>"[nicht vorhanden]" then ag=0:gosub PF2:goto 20 else ag=1:goto 7
+	if CurntPos%=2 and right$(Item$(2),17)<>"[nicht vorhanden]" then ag=0:gosub PF3:goto 20 else ag=1:goto 7
+	if CurntPos%=3 and right$(Item$(3),17)<>"[nicht vorhanden]" then ag=0:gosub PCP:goto 20 else ag=1:goto 7
+20	if ag=0 then Call RemoveWindow
+	goto ChangeWININI
+
+CheckForPresence:
+	open "I",#1,"C:\WINDOWS\WIN.INI"
+10	if eof(1) then close #1:return
+	line input#1,dummy$
+	if left$(dummy$,1)="[" then
+	  tit$=""
+	  for dummy=2 to 80
+	    if mid$(dummy$,dummy,1)="]" then exit for else tit$=tit$+mid$(dummy$,dummy,1)
+	  next dummy
+	else
+	  goto 10
+	end if
+	if tit$=Title$ then Item$(test)=ProgInfo$:close #1:return else Item$(test)=ProgInfo$+" [nicht vorhanden]":goto 10
+
+PF2:
+	Title$="PhotoFinish"
+	ProgInfo$="Photo Finish 2.0"
+	PickInfo$=lcase$("Pick")
+	return
+
+PF3:
+	Title$="Photo Finish 3.0"
+	ProgInfo$="Photo Finish 3.0"
+	PickInfo$=lcase$("Pick")
+	return
+
+PCP:
+	Title$="PC Paintbrush"
+	ProgInfo$="PC Paintbrush 1.0"
+	PickInfo$=lcase$("Pick")
+	return
+
+ChangeWININI:
+	call MakeWindow(5,5,15,70,ColAttr%(14,1),1,4,1)
+	WinTit$="[Editing C:\WINDOWS\WIN.INI]���[Mode: "+Title$+"]"
+	call TitleWindow(1,WinTit$)
+	per%=0
+	color 14,1
+	locate 7,8:print"Erstelle Sicherheitskopie von Ausgangs-Datei ... ";
+	CopyOrd$="COPY C:\WINDOWS\WIN.INI C:\WINDOWS\WIN.PPR /V /Y >NUL"
+	shell CopyOrd$
+	print "OK"
+	locate 8,8:print"�ffne Eingabe-Datei ... ";
+	open "I",#1,"C:\WINDOWS\WIN.INI"
+	print "OK"
+	locate 9,8:print"�ffne Temp-Datei ... ";
+	open "O",#2,"C:\WINDOWS\PPR.$$$"
+	print "OK"
+	zeil=1
+6	line input#1,dummy$
+	if eof(1) then 5 else zeil=zeil+1:goto 6
+5    close #1:open "I",#1,"C:\WINDOWS\WIN.INI"
+	locate 10,8:print "Bearbeite Temp-Datei ... ";  '10,33 ist HIER
+	gosub ShowGraph
+	aktz=1
+3	line input#1,zei$
+	if left$(zei$,1)="[" then
+	  tit$=""
+	  for g=2 to 80
+	    if mid$(zei$,g,1)="]" then exit for else tit$=tit$+mid$(zei$,g,1)
+	  next g
+	  per%=(aktz/zeil)*100
+	  gosub ShowGraph
+	  print#2,zei$
+	  locate 11,8:print"Momentane Gruppe: ";tit$
+	else
+	  raus$=zei$
+	  gosub CheckForParam
+	  print#2,raus$
+	end if
+	if eof(1) then goto 4
+	aktz=aktz+1
+	goto 3
+4	locate 11,8:print space$(64)
+	locate 11,8:print"Schlie�e Eingabe-Datei ... ";
+	close #1
+	print"OK"
+	locate 12,8:print"Schlie�e Temp-Datei ... ";
+	close #2
+	print "OK"
+	locate 13,8:print"L�sche alte WIN.INI ... ";
+	kill "C:\WINDOWS\WIN.INI"
+	print "OK"
+	locate 14,8:print"Benenne Temp-Datei in WIN.INI um ... ";
+	name "C:\WINDOWS\PPR.$$$" as "C:\WINDOWS\WIN.INI"
+	print "OK"
+	locate 16,8:print"Operation abgeschlossen!"
+	delay 1
+	call RemoveWindow
+	color 15,0
+	locate 24,1:print:print
+	locate 24,1
+	print"Alle Pick-Eintr�ge von ";chr$(34);Title$;chr$(34);" wurden entfernt!"
+	print
+	end
+
+CheckForParam:
+	if lcase$(left$(zei$,len(PickInfo$)+2))=PickInfo$+"1=" and tit$=Title$ then raus$=PickInfo$+"1="
+	if lcase$(left$(zei$,len(PickInfo$)+2))=PickInfo$+"2=" and tit$=Title$ then raus$=PickInfo$+"2="
+	if lcase$(left$(zei$,len(PickInfo$)+2))=PickInfo$+"3=" and tit$=Title$ then raus$=PickInfo$+"3="
+	if lcase$(left$(zei$,len(PickInfo$)+2))=PickInfo$+"4=" and tit$=Title$ then raus$=PickInfo$+"4="
+	return
+
+ShowGraph:
+	locate 10,57:print using"### %";per%
+	locate 10,35:print"��������������������"
+	locate 10,35
+	for z=0 to per%/5
+	  if tst=1 then print "�"; else tst=1
+	next z
+	return
+
+BreakItUp:
+	locate 24,1:print:print
+	call MakeWindow(10,27,5,26,ColAttr%(14,1),5,4,2)
+	call TitleWindow(1,"[Information]")
+	color 12,1:locate 12,29:print"Programm abgebrochen !"
+	if command$="skip" or command$="SKIP" then locate 24,1:end
+	delay 1.75
+	call RemoveWindow
+	locate 24,1:end
\ No newline at end of file
diff --git a/dfvnc.bas b/dfvnc.bas
new file mode 100644
index 0000000..d32e10a
--- /dev/null
+++ b/dfvnc.bas
@@ -0,0 +1,106 @@
+	ON ERROR GOTO FEHL
+	color 15
+	print"Dark Forces Voice Name Changer (DFVNC) v1.00"
+	print"                               written by RoboCop INDUSTRIES"
+	color 7
+	PARA$=COMMAND$
+	IF PARA$="+4933223198 NUM2NAM" THEN GOTO NumbersToNames
+	IF PARA$="+4933223198 NAM2NUM" THEN GOTO NamesToNumbers
+	GOTO Syntax
+FEHL:
+	print
+	print"!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!"
+	print"!!            WARNUNG            !!"
+	print"!! Ein  Fehler  ist  aufgetreten !!"
+	print"!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!"
+	goto GanzEnde
+
+NumbersToNames:
+	print"Gew�hlte Funktion: ";:color 14:print"Nummer ==> Name"
+	color 7
+	OPEN "I",#1,"NAMES.LST"
+	OPEN "O",#2,"DFVNC.LOG"
+	on error goto FEHLER
+	PRINT#2,"� LOG-Datei vom Dark Forces Voice Name Changer v1.00"
+	print#2,"� von RoboCop INDUSTRIES"
+	print#2,"�"
+	print#2,"� Gew�hlte Funktion: NUM2NAM"
+	print#2,"---------------------------------------------------"
+	X=1
+1	line input#1,FIL$
+	x$=mid$(str$(x),2,20)+".VOC"
+	print"Benenne ";x$;" in ";FIL$;" um ... ";
+	print#2,X$;" ===> ";FIL$;" ... ";
+	name x$ as fil$
+	print "OK"
+	print#2,"OK"
+	x=x+1
+	if eof(1) then
+	  print#2,"� <EOLF - End Of List File >"
+	  goto Ende
+	end if
+	goto 1
+
+NamesToNumbers:
+	print"Gew�hlte Funktion: ";:color 14:print"Name ==> Nummer"
+	color 7
+	OPEN "I",#1,"NAMES.LST"
+	OPEN "O",#2,"DFVNC.LOG"
+	ON ERROR GOTO FEHLER
+	PRINT#2,"� LOG-Datei vom Dark Forces Voice Name Changer v1.00"
+	print#2,"� von RoboCop INDUSTRIES"
+	print#2,"�"
+	print#2,"� Gew�hlte Funktion: NAM2NUM"
+	print#2,"---------------------------------------------------"
+	X=1
+2	line input#1,FIL$
+	x$=MID$(str$(x),2,20)+".VOC"
+	print"Benenne ";FIL$;" in ";X$;" um ... ";
+	print#2,FIL$;" ===> ";X$;" ... ";
+	name fil$ as x$
+	print "OK"
+	print#2,"OK"
+	x=x+1
+	if eof(1) then
+	  print#2,"� <EOLF - End Of List File >"
+	  goto Ende
+	end if
+	goto 2
+
+FEHLER:
+	print#2,""
+	print#2,"==================================================="
+	PRINT#2,"                   !!!WARNUNG!!!"
+	print#2,"Ein unbekannter Fehler ist  aufgetreten! Vielleicht"
+	print#2,"haben Sie die FALSCHE FUNKTION gew�hlt. Wenn es das"
+	print#2,"nicht  war, k�nnen  wir  Ihnen  auch  nicht helfen."
+	print#2,"==================================================="
+	color 12
+	print
+	print"==================================================="
+	PRINT"                   !!!WARNUNG!!!"
+	print"Ein unbekannter Fehler ist  aufgetreten! Vielleicht"
+	print"haben Sie die FALSCHE FUNKTION gew�hlt. Wenn es das"
+	print"nicht  war, k�nnen  wir  Ihnen  auch  nicht helfen."
+	print"==================================================="
+	color 7
+	goto GanzEnde
+
+	Syntax:
+	print
+	print"Syntax: DFVNC [Serialnummer] [Funktion]
+	print
+	print"        Serialnummer - Ihre Serialnummer"
+	print"        Funktion     - gew�nschte Funktion:"
+	print"                       NUM2NAM - Nummern zu Namen"
+	print"                                 (z.B.: 1.VOC => DOOR2-1.VOC, ...)"
+	print"                       NAM2NUM - Namen zu Nummern"
+	print"                                 (z.B.: DOOR2-2.VOC => 2.VOC, ...)"
+	print
+	goto GanzEnde
+
+Ende:
+	print#2,"� Programm beendet."
+
+GanzEnde:
+
\ No newline at end of file
diff --git a/dostrend.bas b/dostrend.bas
new file mode 100644
index 0000000..1898080
--- /dev/null
+++ b/dostrend.bas
@@ -0,0 +1,71 @@
+	cls
+	color 15
+	print"��� DOS Trend - Sortierer ���";:color 7:print" written by"
+	$INCLUDE"LOGO.INC"
+	color 15:print
+	if command$="" then goto Syntax
+	fle$=command$
+	print"Sortiere Eingabedatei ... ";
+	dos$="sort <"+fle$+" >temp.$$$"
+	shell dos$
+	print"OK"
+	on error goto Syntax
+	print"�ffne Kanal #1 ... ";
+	open "I",#1,"TEMP.$$$"
+	print"OK"
+	on error goto
+	print"�ffne Kanal #2 ... ";
+	open "O",#2,"DOSTREND.OUT"
+	print"OK"
+	print"Schreibe Dateikopf ... ";
+	print#2,"��� DOS Trend - Sortierer ���"
+	print#2,"   written by RoboCop INDUSTRIES"
+	print#2,""
+	print#2,""
+	print#2,"Folgende Programme sind sofort verf�gbar:"
+	print#2,""
+	print"OK"
+	print"Beginne L�schsequenz ... ";
+	x=csrlin:y=pos(0)
+	locate 25,1:color 10:print"������";
+	line input#1,zle$
+2	locate 25,1:color 12:print"������";
+	print#2,zle$
+1	if eof(1) then 3
+	locate 25,1:color 10:print"������";
+	line input#1,zle2$
+	locate 25,1:color 14:print"������";
+	if zle2$=zle$ then goto 1 else let zle$=zle2$:goto 2
+3	locate 25,1:color 15:print"      ";
+	locate x,y:print"OK"
+	print"Schlie�e Kanal #1 ... ";
+	close #1
+	print"OK"
+	print"Schlie�e Kanal #2 ... ";
+	close #2
+	print"OK"
+	print"L�sche TEMP.$$$ Datei ... ";
+	kill "temp.$$$"
+	shell "echo .>temp.$$$"
+	kill "temp.$$$"
+	print"OK"
+	print
+	print"�������������������������ͻ"
+	print"� Die Liste befindet sich �"
+	print"�  sortiert in der Datei  �"
+	print"�      DOSTREND.OUT.      �"
+	print"�������������������������ͼ"
+	print
+	print"Programm beendet."
+	goto Ende
+
+Syntax:
+	print
+	print"Syntax: DOSTREND <Eingabedatei>"
+	print
+	print"Eingabedatei - Datei mit dem Inhalt der DOS Trend CDs"
+	print
+	goto Ende
+
+Ende:
+
\ No newline at end of file
diff --git a/editpath.bas b/editpath.bas
new file mode 100644
index 0000000..873c3b6
--- /dev/null
+++ b/editpath.bas
@@ -0,0 +1,153 @@
+CLS
+shell "mode co80"
+DIM PATH$(40)
+$INCLUDE "LOGO.INC"
+color 15
+print
+print"��� EditPath ��� by RoboCop INDUSTRIES"
+print
+print"Lese Path-Variable ... ";
+PATH$=ENVIRON$("PATH")
+BACKUP$=PATH$
+print "OK"
+if PATH$="" then
+  print
+  print"Pfad-Variable ist leer! Neu anlegen (J/N)?"
+  gosub InpKey
+  if a$="j" or a$="J" then goto NewPath
+  if A$="n" or A$="N" then goto Ende
+end if
+print"Splitte Path-String ... ";
+x=1
+for y=1 to 255
+  IF MID$(PATH$,y,2)=";" or mid$(path$,y,2)="" then PATHs=x:exit for
+  IF MID$(PATH$,y,1)=";" then x=x+1:goto 2
+  PATH$(x)=PATH$(x)+mid$(PATH$,y,1)
+2next y
+print "OK"
+goto EditPath
+
+NewPath:
+PATHs=1
+PATH$(1)="C:\DOS"
+goto EditPath
+
+InpKey:
+1 A$=INKEY$:IF A$="" THEN 1
+  RETURN
+
+EditPath:
+chosen=1
+oldchosen=1
+oldy=1
+cls:color 15,1
+print"��� EditPath ��� by RoboCop INDUSTRIES                                  Q - Ende";
+
+EP:
+locate 25,1:color 14,1:print space$(80);
+color 15,0
+y=1
+for x=1 to PATHs
+  if x+2-z>22 and y<>41 then y=41:z=20:goto 4
+  if x+2-z>22 and y=41 then end
+4 locate x+2-z,y
+  print using"## \                                   \";x;PATH$(x);
+  locate x+3-z,y
+  print space$(40);
+next x
+z=0
+ShowPaths:
+color 15,0
+locate oldchosen+2-oldz,oldy:print using"## \                                   \";oldchosen;PATH$(oldchosen);
+if chosen<=20 then y=1:z=0 else y=41:z=20
+oldchosen=chosen:oldy=y:oldz=z
+locate chosen+2-z,y
+color 0,4:print using"## \                                   \";chosen;PATH$(chosen);
+gosub InpKey
+KeyIn$=MID$(A$,2,1)
+if KeyIn$="H" and chosen>1 then sound 1000,.5:chosen=chosen-1
+if KeyIn$="P" and chosen<PATHs then sound 1000,.5:chosen=chosen+1
+if KeyIn$="K" and chosen>20 then sound 1000,.5:chosen=chosen-20
+if KeyIn$="M" and chosen<21 and PATHs>=chosen+20 then sound 1000,.5:chosen=chosen+20
+if KeyIn$="R" and PATHs<40 then sound 1500,1:goto InsertOne
+if KeyIn$="S" and PATHs>1 then sound 800,1:goto RemoveChosen
+if a$=chr$(13) then sound 800,1:delay 1/18.2:sound 1500,1:goto EditSelected
+if a$="q" or a$="Q" then for a=1 to 3:sound 1000,1:delay 2/18.2:next a:goto WriteItDown
+goto ShowPaths
+
+InsertOne:
+PATHs=PATHs+1
+for x=PATHs to chosen STEP -1
+  PATH$(x)=PATH$(x-1)
+next x
+path$(chosen)=""
+goto EP
+
+RemoveChosen:
+PATHs=PATHs-1
+for x=chosen to PATHs
+  PATH$(x)=PATH$(x+1)
+next x
+if PATHs+1=chosen then chosen=chosen-1:oldchosen=1
+goto EP
+
+
+EditSelected:
+color 15,0
+BAKPATH$=PATH$(chosen)
+' locate 24,1:print PATH$(chosen);
+locate 24,1:input ;"Neuer Pfad: ",PATH$(chosen)
+locate 24,1:print space$(80);
+if PATH$(chosen)="" then
+  color 14,1
+  locate 25,19:print"Keine Eingabe, L�schen oder Behalten (L/B)?";
+  for a=1 to 3:sound 1000,1:delay 2/18.2:next a
+6 gosub InpKey
+  if a$="l" or a$="L" then sound 800,1:PATH$(chosen)="":goto 7
+  if a$="b" or a$="B" then sound 1500,1:PATH$(chosen)=BAKPATH$:goto 7
+  sound 1000,1
+  goto 6
+7end if
+goto EP
+
+
+
+WriteItDown:
+Down$="@SET PATH="
+locate 25,18:color 30,1
+print"Wollen Sie die �nderungen schreiben (J/N)?";
+5gosub InpKey
+if A$="j" or a$="J" then sound 1500,1:Zustand$="Neue PATH-Variable geschrieben.":goto YoSchreiben
+if a$="n" or A$="N" then sound 800,1:Zustand$="Alte PATH-Variable beibehalten.":goto Nee
+sound 1000,1
+goto 5
+
+YoSchreiben:
+for x=1 to PATHs
+  Down$=Down$+PATH$(x)+";"
+next x
+open "O",#1,"EDITPATH.BAT"
+PRINT#1,Down$
+close #1
+goto Ende
+
+Nee:
+Down$="@SET PATH="
+Down$=Down$+BACKUP$
+open "O",#1,"EDITPATH.BAT"
+PRINT#1,Down$
+close #1
+goto Ende
+
+Ende:
+color 15,0
+cls:color 15,1
+print"��� EditPath ��� by RoboCop INDUSTRIES                                          ";
+color 15,0
+print
+print Zustand$
+print
+print"Vielen Dank f�r die Benutzung von EditPath!"
+print
+print"Bitte rufen Sie EDITPATH.BAT auf."
+end
\ No newline at end of file
diff --git a/fx7700ge.bas b/fx7700ge.bas
new file mode 100644
index 0000000..962935e
--- /dev/null
+++ b/fx7700ge.bas
@@ -0,0 +1,13 @@
+$COMPILE UNIT
+sub Drawfx
+   screen 7
+   for z=10 to 107
+   pset (z,10),7
+   pset (z,75),7
+   next z
+   for z=10 to 75
+   pset (10,z),7
+   pset (107,z),7
+   next z
+end sub
+
\ No newline at end of file
diff --git a/gam_mast.bas b/gam_mast.bas
new file mode 100644
index 0000000..fa97728
--- /dev/null
+++ b/gam_mast.bas
@@ -0,0 +1,271 @@
+	$link "text.obj"
+	dim x(100)
+	dim title$(100)
+	dim file$(100)
+	declare sub putchar(integer,integer,integer,integer,string)
+	noz=0
+	gosub Logo
+1	a$=inkey$:if a$="" then 1
+	screen 0,0,0
+12	width 40
+	color 14:print"*** GAME * MASTER ***"
+	color 11:print"         written by Markus Birth"
+	print
+	color 15
+	print"W�hlen Sie ein System:"
+	print
+	print"   System           Anzahl Tips"
+	msk$="*.MD_":gosub GetFileNum
+	MDNum=filenum
+	print"   [M]ega Drive    ";MDNum
+	msk$="*.TIP":gosub GetFileNum
+	PCNum=filenum
+	msk$="*.HEX":gosub GetFileNum
+	PCNum=PCNum+filenum
+	msk$="*.ADV":gosub GetFileNum
+	PCNum=PCNum+filenum
+	msk$="*.COD":gosub GetFileNum
+	PCNum=PCNum+filenum
+	print"   [P]C            ";PCNum
+	print"   [E]nde"
+	print
+	print"Geben Sie einen Buchstaben ein: ";
+2	a$=inkey$:if A$="" then 2
+	  if (a$="m" or a$="M") and MDNum>0 then print "M":gosub Roger:goto MegaDrive
+	  if (A$="p" or a$="P") and PCNum>0 then print "P":gosub Roger:goto PC
+	  if a$="e" or a$="E" then print "E":gosub Roger:goto Ende
+	gosub Signal
+	goto 2
+
+MegaDrive:
+	cls
+	width 80
+	color 15
+	print"Zu folgenden Spielen existiert ein Text: (Auswahl mit 8/2/RET/ESC)"
+	x=0
+'********* MDGetName
+	x=x+1
+	dat$=dir$("*.md_")
+3	open "I",#1,dat$
+	file$(x)=dat$
+	line input #1, title$(x)
+	close #1
+	x=x+1
+	dat$=dir$
+	if dat$="" then mx=x-1:a=1:goto 4
+	goto 3
+
+4	for f=a to mx
+	if f+y>21 then more=1:exit for
+	locate f+y+2,1
+	print title$(f)
+	next f
+	if x=0 or x>21 then x=1
+'************ MDPrintItOut
+6	locate x+y+2,1:color 0,7:print title$(x);space$(80-len(title$(x)))
+	if oldx<>0 then mem=oldx:oldx=0:goto 10
+	a$=inkey$:if a$="" then 6
+10	locate x+y+2,1:color 15,0:print title$(x);space$(80-len(title$(x)))
+	altx=x
+	if mem<>0 then x=mem:mem=0
+	if a$=chr$(27) then gosub Roger:goto 12
+	if x<mx and (a$="2" or a$=chr$(34)) then x=x+1:gosub Roger
+	if x>20 and mx>21 and a$="2" or a$=chr$(34) then a=a+1:y=y-1:x=x+1:gosub Roger:goto 4
+	if x>=2 and (a$="8" or a$="(") then x=x-1:gosub Roger
+	if a$=chr$(13) then gosub ReadyBeep:goto 7
+	if altx=x then gosub Signal
+	goto 6
+'********* MDGotIt
+7	num=x
+	file$=file$(x)
+	bez$=title$(x)
+	cls:color 15
+	print bez$:color 7
+	print
+	print"[1] Ansehen"
+	print"[2] Editieren"
+	fill$=mid$(str$(num),2,5)
+8	if len(fill$)<5 then fill$="0"+fill$:goto 8 else FUCK=0
+	sav$="GM_"+fill$+".DAT"
+	print"[3] Abspeichern als ";sav$
+	print"[4] Ausdrucken auf PRN"
+	print"[5] L�SCHEN"
+	print:color 15
+	print"[6] Zur�ck":color 7
+	print
+	print"Geben Sie eine Zahl ein: "
+9	a$=inkey$:if a$="" then 9
+	  if a$="1" or a$="!" then goto MDView
+	  if a$="2" or a$=chr$(34) then goto MDEdit
+	  if a$="3" then goto MDSave
+	  if a$="4" or a$="$" then goto MDPrint
+	  if a$="5" or a$="%" then gosub Roger:goto MDKill
+	  if a$="6" or a$="&" then oldx=num:gosub Roger:goto MegaDrive
+	goto 9
+
+MDView:
+	cls
+	shl$="wpview "+file$
+	gosub ReadyBeep
+	shell shl$
+	oldx=num
+	goto MegaDrive
+
+MDEdit:
+	cls
+	shl$="ncedit "+file$
+	gosub ReadyBeep
+	shell shl$
+	oldx=num-1
+	goto MegaDrive
+
+MDSave:
+	cls
+	print"Speichere '";bez$;"' in ";chr$(34);sav$;chr$(34);" ... ";
+	shl$="copy "+file$+" "+sav$+" >NUL"
+	shell shl$
+	print"OK"
+	oldx=num
+	gosub ReadyBeep
+	goto MegaDrive
+
+MDPrint:
+	cls
+	print"Drucke '";bez$;"' nach LPT1 ... ";
+	shl$="copy "+file$+" LPT1 >NUL"
+	shell shl$
+	print"OK"
+	oldx=num
+	gosub ReadyBeep
+	goto MegaDrive
+
+MDKill:
+	cls
+	print"Wollen Sie die Datei '";file$;"' mit den Tips f�r"
+	print"'";bez$;"'"
+	input"l�schen (Ja/n)? ",ans$
+	if ans$="Ja" or ans$="ja" then goto MDKillItNow
+	oldx=num
+	goto MegaDrive
+  MDKillItNow:
+	  print
+	  print"L�sche '";file$;"' ... ";
+	  kill file$
+	  print "OK"
+	  gosub ReadyBeep
+	  goto MegaDrive
+
+PC:
+
+	end
+
+Signal:
+	for z=1 to 3
+	sound 1000,1.0
+	delay 1.5/18.2
+	next z
+	return
+
+Roger:
+	sound 1200,1
+	return
+
+Logo:
+	screen 9
+	color 15,0
+	line (179,13)-(36,13),15
+	line -(36,135),15
+	line -(180,135),15
+	line -(180,74),15
+	line -(114,74),15
+	line -(114,94),15
+	line -(148,94),15
+	line -(148,112),15
+	line -(66,112),15
+	line -(66,37),15
+	line -(180,37),15
+	line -(180,13),15
+	line (194,135)-(194,13),15
+	line -(292,13),15
+	line -(292,135),15
+	line -(261,135),15
+	line -(261,92),15
+	line -(226,92),15
+	line -(226,135),15
+	line -(194,135),15
+	line (226,64)-(261,33),15,b
+	line (305,135)-(305,13),15
+	line -(352,13),15
+	line -(390,72),15
+	line -(417,13),15
+	line -(467,13),15
+	line -(467,135),15
+	line -(438,135),15
+	line -(438,37),15
+	line -(403,107),15
+	line -(375,107),15
+	line -(334,37),15
+	line -(334,135),15
+	line -(305,135),15
+	line (479,135)-(479,13),15
+	line -(607,13),15
+	line -(607,40),15
+	line -(522,40),15
+	line -(522,107),15
+	line -(607,107),15
+	line -(607,135),15
+	line -(479,135),15
+	line (522,65)-(569,85),15,b
+	if noz<>1 then sound 130.81,54.6
+	call putchar(480,140,15,14,"**** MASTER ****")
+	if noz<>1 then delay 54.6/18.2
+	if noz<>1 then sound 174.61,36.4
+	call putchar(36,4,3,8,"(C)1995 by RoboCop INDUSTRIES")
+	if noz<>1 then delay 36.4/18.2
+	if noz<>1 then sound 220,36.4
+	call putchar(150,317,15,8,"----- Bitte Taste dr�cken,       -----")
+	if noz<>1 then delay 36.4/18.2
+	if noz<>1 then sound 523.25,4
+	if noz<>1 then delay 3/18.2
+	paint (165,113),14,15
+	paint (212,86),12,15
+	paint (323,86),10,15
+	if noz<>1 then sound 493.88,36.4
+	paint (505,78),10,15
+	paint (531,78),10,15
+	paint (508,93),8,15
+	paint (536,81),8,15
+	call putchar(150,317,15,8,"----- Bitte Taste dr�cken, jetzt -----")
+	if noz<>1 then 14
+	gosub ReadyBeep
+14	return
+
+ReadyBeep:
+	sound 800,1
+	delay 1.5/18.2
+	sound 1000,1
+	delay 1.5/18.2
+	sound 1200,1
+	return
+
+GetFileNum:
+	filenum=0
+	x=0
+	dat$=dir$(msk$)
+	if dat$="" then return
+	x=x+1
+5	dat$=dir$
+	if dat$="" then
+	  filenum=x
+	  return
+	else
+	  x=x+1
+	  goto 5
+	end if
+
+Ende:
+	noz=1
+	gosub Logo
+11	a$=inkey$:if a$="" then 11 else gosub Roger
+	screen 0,0,0
+	end
\ No newline at end of file
diff --git a/graftest/2dgraph.bas b/graftest/2dgraph.bas
new file mode 100644
index 0000000..3fcc441
--- /dev/null
+++ b/graftest/2dgraph.bas
@@ -0,0 +1,6 @@
+screen 12
+cls
+for x=0 to 20
+y=int(x)
+pset (x,y)
+next
\ No newline at end of file
diff --git a/graftest/2dgraph1.bas b/graftest/2dgraph1.bas
new file mode 100644
index 0000000..ff03c62
--- /dev/null
+++ b/graftest/2dgraph1.bas
@@ -0,0 +1,6 @@
+screen 12
+cls
+for x=0 to 20
+  y=int(x)
+  pset (x,y)
+next
\ No newline at end of file
diff --git a/graftest/2dgraph2.bas b/graftest/2dgraph2.bas
new file mode 100644
index 0000000..e8e67e8
--- /dev/null
+++ b/graftest/2dgraph2.bas
@@ -0,0 +1,13 @@
+screen 12
+cls
+maxx=640
+maxy=480
+line (maxx/2,0)-(maxx/2,maxy)
+line (0,maxy/2)-(maxx,maxy/2)
+pset (maxx/2,maxy/2)
+for l=1 to 125
+  y=l^2
+  x=(maxx/2)+l
+  y=(maxy/2)-y
+  line -(x,y)
+next l
\ No newline at end of file
diff --git a/graftest/3dline.bas b/graftest/3dline.bas
new file mode 100644
index 0000000..b854d91
--- /dev/null
+++ b/graftest/3dline.bas
@@ -0,0 +1,23 @@
+cls
+screen 12
+delay 1
+def fn y(x,z)=exp(-x^2-z^2)
+puanz=15              'Anzahl Punkte pro Linie
+wz=1                  'Winkel von Z- zur X-Achse
+masz=1                'Stauch/Streckfaktor f�r Z-Achsenteilung
+projzx=cos(wz)*masz:projzy=sin(wz)*masz    'Projektion Z-Achse
+xuntg=-3:xobg=3:xl=xobg-xuntg
+yuntg=0:yobg=1:yl=yobg-yuntg
+zuntg=-3:zobg=3:zl=zobg-zuntg
+masx=5000/(xl+zl*projzx)
+masy=5000/(yl+zl*projzy)
+for z=zobg to zuntg step -zl/puanz
+  pset ((zobg-z)*projzx*masx,(fn y(xuntg,zobg)-yuntg-projzy*(z-zobg))*masy)
+  for x=xuntg to xobg step xl/puanz
+    y=fn y(x,z)
+    xk=(x-xuntg-projzx*(z-zobg))*masx
+    yk=(y-yuntg-projzy*(z-zobg))*masy
+    line -(xk,yk)
+    pset (xk,yk)
+  next x
+next z
\ No newline at end of file
diff --git a/graftest/graftest.bas b/graftest/graftest.bas
new file mode 100644
index 0000000..7243ab0
--- /dev/null
+++ b/graftest/graftest.bas
@@ -0,0 +1,31 @@
+cls
+screen 12
+call WriteLn("Calculating and Drawing Graphic, please wait ... ( )",30,80)
+for z=400 to 480 step 2
+pset (0,z),0
+for s=1 to 640 step 2
+if st=0 then st=1
+st=st+.01
+if st>=5 then st=1
+locate 30,64
+if st>=1 then st$="-"
+if st>=2 then st$="\"
+if st>=3 then st$="|"
+if st>=4 then st$="/"
+print st$;
+anz$=" Aktuelle Pos.: Z"+mid$(str$(z),2,5)+" S"+mid$(str$(s),2,5)+"  Farbe: "+str$(farbe)+" "
+call WriteLn(anz$,29,80)
+farbe=0  'farbe=int(rnd(1)*256)+1
+pset (s,z),farbe    'line -(s,z),farbe
+next s
+next z
+locate 1,80:print" ";
+call WriteLn("Graphic contruction complete.",30,80)
+goto Ende
+
+sub WriteLn (s$,x,ymax) SHARED PUBLIC
+  locate x,(ymax/2)-len(s$)/2
+  print s$;
+end sub
+
+Ende:
\ No newline at end of file
diff --git a/graftest/grftest2.bas b/graftest/grftest2.bas
new file mode 100644
index 0000000..2e45444
--- /dev/null
+++ b/graftest/grftest2.bas
@@ -0,0 +1,64 @@
+cls
+screen 12
+locate 1,1
+1 x1=int(rnd(1)*640)
+x2=int(rnd(1)*640)
+y1=int(rnd(1)*480)
+y2=int(rnd(1)*480)
+far=int(rnd(1)*256)
+line (x1,y1)-(x2,y2),far,BF
+zahl=zahl+1
+locate 30,1:print"Anzahl Rechtecke: ";zahl;
+if inkey$=" " then 2
+goto 1
+
+2 REM Fucking Hostile is back
+
+goto Fade
+'goto RoboCop
+'goto ARoboCop
+
+RoboCop:
+for x=0 to 480 step 2
+line (0,x)-(640,x),0
+next x
+goto Ende
+
+ARoboCop:
+
+' 1 Zeile Schrift = 16 Pixel
+' 1 Buchstabe     = 8 Pixel
+'=> Schrift       = 8x16
+
+z=50
+for x=0 to 640 step 2
+line (x,0)-(x,480),0
+next x
+goto Ende
+
+Fade:
+an=.5
+st=1
+for g=1 to 9
+an=an*2
+st=st*2
+gosub DoIt
+9 a$=inkey$:if a$="" then 9
+ if a$="r" or a$="R" then exit for
+next g
+
+goto Ende
+
+DoIt:
+z=an-st
+s=an-st
+6 REM FuckHost
+z=z+st
+s=s+st
+if z>480 then 7
+line (0,z)-(640,z),0
+7 line (s,0)-(s,480),0
+if s>640 and z>480 then return
+goto 6
+
+Ende:
\ No newline at end of file
diff --git a/graftest/grftest3.bas b/graftest/grftest3.bas
new file mode 100644
index 0000000..2fa7b10
--- /dev/null
+++ b/graftest/grftest3.bas
@@ -0,0 +1,48 @@
+cls
+open "O",#1,"GRFTEST3.OUT"
+print#1,"OUTPUT-Datei von GRFTEST3.BAS"
+print#1,""
+print#1,"Die Datei hat folgendes Format:"
+print#1,"X  : Zufalls X-Koordinate"
+print#1,"Y  : Zufalls Y-Koordinate"
+print#1,"0/1: X,Y schon belegt NEIN/JA"
+print#1,"#  : Nummer der schon belegten Pixel (640x480)"
+print#1,""
+open "O",#2,"GRFTEST3.OU2"
+print#2,"OUTPUT-Datei von GRFTEST3.BAS"
+print#2,""
+print#2,"Die Datei hat folgendes Format:"
+print#2,"0/1: Pixel schon belegt NEIN/JA"
+print#2,""
+dim o(640)
+dim p(480)
+screen 12
+locate 1,1
+1 x1=int(rnd(1)*640)
+x2=int(rnd(1)*640)
+y1=int(rnd(1)*480)
+y2=int(rnd(1)*480)
+far=int(rnd(1)*256)
+line (x1,y1)-(x2,y2),far,BF
+if inkey$=" " then 2
+goto 1
+
+2 REM Fucking Hostile is back
+for g=1 to 640*480
+randomize timer
+5 x=int(rnd(1)*640)
+y=int(rnd(1)*480)
+if inkey$=chr$(27) then end
+if o(x)=255 and p(y)=255 and o(x+1)=255 and p(y+1)=255 then
+  locate 30,1:print using "X ###   Y ###   0/1:#   _#######/307200";x;y;0;g;
+  print#1,using"X ###   Y ###   0/1:#   _#######/307200";x;y;0;g
+  print#2,"0";
+  goto 5
+else
+  line (x,y)-(x+1,y+1),0,BF:o(x)=255:p(y)=255:o(x+1)=255:p(y+1)=255
+  locate 30,1:print using "X ###   Y ###   0/1:#   _#######/307200";x;y;1;g;
+  print#1,using "X ###   Y ###   0/1:#   _#######/307200";x;y;1;g
+  print#2,"1";
+end if
+next g
+
\ No newline at end of file
diff --git a/hallo.bas b/hallo.bas
new file mode 100644
index 0000000..7e813d7
--- /dev/null
+++ b/hallo.bas
@@ -0,0 +1,45 @@
+1	'Programm: HALLO.BAS
+2	'Funktion: Sprachausgabe mit BASIC
+3	'Sprache : GW-Basic
+4	'Autor   : John Lupton
+6	input r:
+7	if r>0 then z=int(1193280! / R)
+10	f=1850:i=97:dim d(f):b=.2
+20	out 67,182:out 66,z and 255:
+21	out 66,z\256:h=inp(i) or 3:
+22	out i,h:l=inp(i) and 252:
+23	out i,l
+30	key(1) on: key(2) on: key(5) on:
+31	key(6) on: on key(1) gosub 200:
+32	on key(2) gosub 210:
+33	on key(5) gosub 220:
+34	on key(6) gosub 230
+40	while a>-1
+50	  read a:if a=0 then a=1
+60	  d(a+a1)=1:a1=a1+a
+70	wend
+80	while inkey$=""
+90	  for t=1 to f step b
+100	    if d(t) then out i,h
+110	    if s>0 then for n=2 to s:next n
+120	    out i,l
+130	  next t
+140	wend
+150	out i,l:end
+200	s=s-2
+210	s=s+1:return
+220	b=b+.005:return
+230	b=b-.005:if b<.005 then b=.005
+240	return
+500	data 374,21,4,,5,15,,4,6,6,,9,4,,5,,12,
+501	data 4,6,11,,4,,,4,,10,5,,5,,8,,5,6,
+502	data 8,,5,,5,,8,6,,,6,6,,,6,,,9,,,,8,
+503	data 9,3,8,12,,19,,,56,24,11,28,,,9,,9,
+504	data ,,7,2,10,,2,6,3,9,,,,6,,,10,,,,7,,
+505	data 11,,,7,,11,,10,11,,9,,10,,7,,13,,
+510	data 7,,12,,,7,,12,,8,,12,,8,,12,,8,,11
+511	data ,,,7,,,11,,,7,,,10,,,8,,11,,,8,,10
+512	data ,,,8,,,10,,9,,10,,,8,,,9,,,8,,,9,,
+513	data ,9,,10,,9,,10,,9,,10,,5,5,10,,,9,,
+514	data 9,,,9,,10,,,9,11,,,20,,,,21,,14,8,
+515	data ,,14,9,,,23,,,27,,33,-1
\ No newline at end of file
diff --git a/hd-data.bas b/hd-data.bas
new file mode 100644
index 0000000..fc6edd1
--- /dev/null
+++ b/hd-data.bas
@@ -0,0 +1,89 @@
+color 1,1
+cls
+color 14,1
+locate 5,5:print "       HEADS "
+locate 7,5:print "   CYLINDERS "
+locate 9,5:print "     SECTORS "
+locate 12,5:print"        SIZE "
+locate 17,5:print"LANDING ZONE "
+color 11,1
+locate 9,27:print"* 512 Bytes"
+locate 12,32:print"Bytes"
+locate 13,32:print"kBytes"
+locate 14,32:print"MBytes"
+locate 15,32:print"GBytes"
+color 15,1
+locate 5,40:print "Up/Down    - Switch between HEADS,"
+locate 6,40:print "             CYLINDERS and SECTORS"
+locate 7,40:print "Right/Left - Increase  /  decrease"
+locate 8,40:print "             selected value"
+locate 9,40:print "[ENTER]    - enter value directly"
+locate 10,40:print"[ESC]ape   - Quit this nice proggy"
+color 16,7:locate 2,27:print" HARDDISK-SIZE-CALCULATOR "
+gosub PrintItOut
+1 a$=inkey$:if a$="" then 1
+if a$=chr$(27) then goto Ende
+if mid$(a$,2,1)="H" and active>1 then active=active-1
+if mid$(a$,2,1)="P" and active<3 then active=active+1
+if active=1 then value=heads
+if active=2 then value=cylinders
+if active=3 then value=sectors
+if mid$(a$,2,1)="M" and value<999999 then Incr Value
+if mid$(a$,2,1)="K" and value>0 then Decr Value
+if a$=chr$(13) and active<>0 then gosub InputIt
+if active=1 then heads=value
+if active=2 then cylinders=value
+if active=3 then sectors=value
+gosub PrintItOut
+goto 1
+
+InputIt:
+locate 19,10:color 14,1:print"Enter the new value for ";
+if active=1 then print"HEADS";
+if active=2 then print"CYLINDERS";
+if active=3 then print"SECTORS";
+print " :";
+oldvalue=value
+color 11,1:input "",value
+if value=0 then value=oldvalue
+if value>999999 then value=oldvalue
+locate 19,10:print space$(70);
+return
+
+PrintItOut:
+color 0,3
+locate 5,19:print using "######";heads
+locate 7,19:print using "######";cylinders
+locate 9,19:print using "######";sectors
+color 11+16,1
+if active=0 then goto 2
+if active=1 then l=5
+if active=2 then l=7
+if active=3 then l=9
+locate 5,18:if l=5 then print chr$(16); else print " ";
+locate 7,18:if l=7 then print chr$(16); else print " ";
+locate 9,18:if l=9 then print chr$(16); else print " ";
+locate 5,25:if l=5 then print chr$(17); else print " ";
+locate 7,25:if l=7 then print chr$(17); else print " ";
+locate 9,25:if l=9 then print chr$(17); else print " ";
+2 color 0,7
+locate 17,18:print using "#######";cylinders+1
+sizeb=heads*cylinders*sectors*512
+sizek=sizeb/1024
+sizem=sizek/1024
+sizeg=sizem/1024
+locate 12,18
+if sizeb<9999999999 then print using ",,,,,,,,,,,,,";sizeb else color 12,7:print"* OVERFLOW * ":color 0,7
+locate 13,18
+if sizek<9999999999 then print using ",,,,,,,,,,,,,";sizek else color 12,7:print"* OVERFLOW * ":color 0,7
+locate 14,18
+if sizem<9999999999 then print using ",,,,,,,,,,,,,";sizem else color 12,7:print"* OVERFLOW * ":color 0,7
+locate 15,18
+if sizeg<9999999999 then print using ",,,,,,,,,,,,,";sizeg else color 12,7:print"* OVERFLOW * ":color 0,7
+return
+
+Ende:
+color 7,0
+cls
+print "READY."
+end
\ No newline at end of file
diff --git a/inst_xw/go.bas b/inst_xw/go.bas
new file mode 100644
index 0000000..51fb8a1
--- /dev/null
+++ b/inst_xw/go.bas
@@ -0,0 +1,193 @@
+Start:
+     color 1,1
+     cls
+     color 0,3
+     print"                         X-Wing Installationsprogramm                           "
+     color 7,0
+     locate 25,1
+     color 7,0:print"1";:color 0,3:print"      ";
+     for z=2 to 9
+     color 7,0:print left$(str$(z),2);
+     color 0,3:print"      ";
+     next z
+     color 7,0:print" 10";:color 0,3:print"      ";
+     defint m
+     def seg=0
+     mseg=256*peek(207)+peek(206)
+     mouse=256*peek(205)+peek(204)+2
+     if mseg or  (mouse-2) then mse=1 else mse=0
+     if mse<>1 then 1
+     def seg=mseg
+     if peek(mouse-2)=207 then mse=0:goto 1
+     m1%=0
+     call absolute mouse(m1%,m2%,m3%,m4%)
+     mse=0
+     if m1=-1 then mse=1
+1    color 0,7
+     locate 3,3
+     if mse=1 then print" MAUSUNTERST�TZUNG " else print"                   "
+     locate 3,23
+     if mse=1 then
+       print m2%;"Tasten "
+       m1=1:call absolute mouse(m1%,m2%,m3%,m4%)
+       m1=10:m2=0:m3=2:m4=5:call absolute mouse(m1%,m2%,m3%,m4%)
+     else
+       print "          "
+     end if
+  DriveAsk:
+     locate 25,2:color 0,3:print"LW C:";
+     locate 25,10:print"LW D:";
+     locate 25,18:print"LW E:";
+     locate 25,26:print"LW F:";
+     locate 25,34:print"LW G:";
+     locate 25,75:print"Ende";
+     locate 5,2:color 11,1:print"Bitte dr�cken Sie die F-Taste mit der Nummer, die vor der Laufwerksbezeichnung"
+     print" des gew�nschten Ziellaufwerks steht";
+     if mse=1 then print" oder klicken Sie die Fl�che an." else print"."
+     locate 6,2
+     print"Es werden w�hrend der Installation ca. 25,5 MB sp�ter ca. 17 MB ben�tigt."
+     ReadKoord1:
+     if mse=0 then 2
+     m1=3
+     call absolute mouse(m1%,m2%,m3%,m4%)
+     x=m3:y=m4:butt=m2
+2    a$=inkey$
+     if a$="" and butt=0 then ReadKoord1
+     f$=mid$(a$,2,1)
+     lw$=""
+     if f$=";" or (butt>0 and x>=0 and x<=48 and y=192) then LW$="C"
+     if f$="<" or (butt>0 and x>=64 and x<=112 and y=192) then lw$="D"
+     if f$="=" or (butt>0 and x>=128 and x<=176 and y=192) then lw$="E"
+     if f$=">" or (butt>0 and x>=192 and x<=240 and y=192) then lw$="F"
+     if f$="?" or (butt>0 and x>=256 and x<=304 and y=192) then lw$="G"
+     if f$="D" or (butt>0 and x>=576 and x<=632 and y=192) then goto Beenden
+     if lw$="" then ReadKoord1
+     locate 5,2:color 0,1:print space$(78):print space$(79):print space$(79)
+     locate 5,2:color 11,1:print"Ziellaufwerk:  C   D   E   F   G"
+     color 0,3
+     if lw$="C" then locate 5,16:?" C "
+     if lw$="D" then locate 5,20:?" D "
+     if lw$="E" then locate 5,24:?" E "
+     if lw$="F" then locate 5,28:?" F "
+     if lw$="G" then locate 5,32:?" G "
+     locate 25,2:print"      ";
+     locate 25,10:print"      ";
+     locate 25,18:print"      ";
+     locate 25,26:print"      ";
+     locate 25,34:print"      ";
+     locate 25,75:print"      ";
+     gosub MemTest
+     if mry=1 then locate 5,36:color 0,3:print" OK ":goto MemOK
+     if mry=0 then
+       locate 9,2:color 11,1:print"Der Speicherplatz auf Laufwerk ";lw$;" reicht nicht aus."
+       print" Folgende Informationen wurden ermittelt:"
+       print using" � Ben�tigt     : ,,,,,,,,,,,,";17*(1024^2)
+       print " � Frei auf ";lw$;:print using":  :  ,,,,,,,,,,,";frei*1000
+       print using" � Noch ben�tigt:  ,,,,,,,,,,,";(17*(1024^2))-(frei*1000)
+       print
+       print" W�hlen Sie ein anderes Laufwerk oder beenden Sie."
+       goto DriveAsk
+     end if
+
+     MemOK:
+     color 11,1
+     locate 9,2:print space$(78):print space$(79):print space$(79):print space$(79):print space$(79):print space$(79):print space$(79)
+     locate 7,2:print"Verzeichnis : ";
+     color 0,3:print"\                                               "
+     locate 7,16:input "\",verz$
+     verz$="\"+verz$
+     pfad$=lw$+":"+verz$
+     color 12,1:locate 9,2:print"Sollen die obigen Einstellungen verwendet werden?"
+     color 0,7:locate 14,2:print"     JA     ";:color 8,1:?"�"
+     color 0,7:locate 14,17:print"   �NDERN   ";:color 8,1:?"�"
+     color 0,7:locate 14,32:print"    ENDE    ";:color 8,1:?"�"
+     for z=3 to 33 step 15
+     locate 15,z:print"������������"
+     next z
+     color 0,3
+     locate 25,2:print"JA";
+     locate 25,10:print"�NDERN";
+     locate 25,75:print"Ende";
+     color 11,1:locate 16,2:print"Bitte F1,F2,F10 oder [ENTER] dr�cken";
+     if mse=1 then print" oder einen Knopf oder einen Bereich":print" in der F-Leiste mit der Maus anklicken." else print"."
+     ReadKoord2:
+     if mse=0 then 3
+     m1=3
+     call absolute mouse(m1%,m2%,m3%,m4%)
+     x=m3:y=m4:butt=m2
+3    a$=inkey$
+     if a$="" and butt=0 then ReadKoord2
+     f$=mid$(a$,2,1)
+     wahl$=""
+     if f$=";" or (butt>0 and x>=0 and x<=48 and y=192) or (butt>0 and x>=8 and x<=96 and y=104) then wahl$="J":c=2
+     if f$="<" or (butt>0 and x>=64 and x<=112 and y=192) or (butt>0 and x>=128 and x<=216 and y=104) then wahl$="�":c=17
+     if f$="D" or (butt>0 and x>=576 and x<=632 and y=192) or (butt>0 and x>=248 and x<=336 and y=104) then wahl$="E":c=32
+     if wahl$="" then ReadKoord2
+     locate 14,c:color 7,1
+     print" ������������"
+     locate 15,c
+     print" ������������"
+     locate 16,2:print space$(79);
+     locate 17,2:print space$(79);
+     delay 1
+     if wahl$="J" then InstallRout
+     if wahl$="�" then Start
+     if wahl$="E" then Beenden
+
+     InstallRout:
+     mkdir pfad$
+     exec$="C:\DEICE.COM "+lw$+" "+verz$
+     color 15,0
+     cls
+     color 0,3
+     print"                         X-Wing Installationsprogramm                           ";
+     color 15,0
+     print
+     shell exec$
+     goto Ende
+
+     Beenden:
+     color 15,0
+     cls
+     color 0,3
+     locate 1,1
+     print"                         X-Wing Installationsprogramm                           ";
+     color 11,1
+     print"Installation abgebrochen...                                                     ";
+     end
+
+     Ende:
+     shell "Del C:\RAR.cfg >NUL"
+     shell "Del C:\rar.exe >NUL"
+     shell "del C:\deice.com >NUL"
+     shell "del C:\go.exe >NUL"
+
+     color 15,0
+     cls
+     color 0,3
+     locate 1,1
+     print"                         X-Wing Installationsprogramm                           ";
+     color 11,1
+     print"Installation beendet...                                                         ";
+     print space$(80);
+     print"Viel Spa� noch mit X-Wing, B-Wing und Imperial Pursuits!                        ";
+     print"Start von alledem mit <XWING>                                                   ";
+     shell "Del c:\inst.exe >NUL"
+     end
+
+     MemTest:
+     shell"Chkdsk "+lw$+": >C:\MEMCHK.XW"
+     open "I",#1,"C:\MEMCHK.XW"
+     locate 5,1
+     color 14,0
+4    line input#1,ZEILE$
+     if mid$(zeile$,15,24)="Byte auf dem Datentr�ger" then memory=0 else goto 4
+     close #1
+     kill "C:\MEMCHK.XW"
+     frei$=left$(zeile$,13)
+     mem$=mid$(frei$,1,5)+mid$(frei$,7,3)+mid$(frei$,11,3)
+     frei=val(mem$)/1000
+     kbfrei=val(mem$)/(1024^2)
+     if kbfrei<25.5 then mry=0
+     if kbfrei>=25.5 then mry=1
+     return
\ No newline at end of file
diff --git a/inst_xw/install.bas b/inst_xw/install.bas
new file mode 100644
index 0000000..4900c79
--- /dev/null
+++ b/inst_xw/install.bas
@@ -0,0 +1,5 @@
+      shell"copy go.exe C:\go.exe >NUL"
+      shell"copy deice.com C:\deice.com >NUL"
+      shell"copy rar.exe C:\rar.exe >NUL"
+      shell"copy rar.cfg C:\rar.cfg >NUL"
+      execute "C:\go.exe"
\ No newline at end of file
diff --git a/joy.bas b/joy.bas
new file mode 100644
index 0000000..1fa9c60
--- /dev/null
+++ b/joy.bas
@@ -0,0 +1,26 @@
+10 CLS:STRIG ON
+20 PRINT"Dies ist ein Joystick-Test f�r den HCV 386-DX."
+30 PRINT"Dr�cken Sie eine Taste zum Start !!!"
+40 B$=INKEY$:IF B$="" THEN 40
+50 CLS
+60 PRINT"Left = 4-6     Right = 181-185     Up = 5-7     Down = 127-133"
+70 PRINT"Fire Button 1 = -1                 Fire Button 2 = -1"
+80 LOCATE 15,30
+90 A=STICK(0):B=STICK(1)
+100 C=STRIG(1):D=STRIG(4)
+110 LOCATE 15,1
+120 PRINT "                         Left/Right : ";A;"Up/Down : ";B;"                "
+130 LOCATE 16,1
+140 PRINT"                     Fire Button 1 : ";C;"Fire Button 2 : ";D;"                "
+150 IF A=5 OR A=6 OR A=7 THEN LOCATE 15,1:PRINT"��� Left"
+160 IF A=152 OR A=153 OR A=154 OR A=155 THEN LOCATE 15,60:PRINT"Right ���"
+170 IF B=5 OR B=6 OR B=7 THEN LOCATE 15,1:PRINT"7 Up"
+180 IF B=151 OR B=152 OR B=153 OR B=154 OR B=155 THEN LOCATE 15,60:PRINT"8 Down"
+190 IF C=-1 THEN LOCATE 16,1:PRINT"6 Fire Button 1"
+200 IF D=-1 THEN LOCATE 16,61:PRINT"6 Fire Button 2"
+210 B$=INKEY$:IF B$=" " THEN 230
+220 GOTO 90
+230 PRINT"^C"
+240 PRINT"BREAK in 240"
+250 A$="Quick"
+
\ No newline at end of file
diff --git a/joytest.bas b/joytest.bas
new file mode 100644
index 0000000..7abad97
--- /dev/null
+++ b/joytest.bas
@@ -0,0 +1,15 @@
+CLS:STRIG ON
+1 PRINT"Joystick A"
+PRINT USING"X       ###";STICK(0)
+PRINT USING"Y       ###";STICK(1)
+2 PRINT USING"Button A ##";STRIG(0)
+PRINT USING"Button B ##";STRIG(4)
+PRINT
+PRINT"Joystick B"
+PRINT USING"X       ###";STICK(2)
+PRINT USING"Y       ###";STICK(3)
+PRINT USING"Button A ##";STRIG(2)
+PRINT USING"Button B ##";STRIG(6)
+IF INKEY$=CHR$(27) THEN END
+LOCATE 1,1:GOTO 1
+
\ No newline at end of file
diff --git a/keypro.bas b/keypro.bas
new file mode 100644
index 0000000..319a0c3
--- /dev/null
+++ b/keypro.bas
@@ -0,0 +1,22 @@
+dim x$(12)
+color 15:print"Bitte dr�cken Sie [Prog]+[Esc] zusammen.":color 7
+for y=1 to 12
+for z=1 to 20
+1 a$=inkey$:if a$="" then 1
+if a$=chr$(27) then exit for
+x$(y)=x$(y)+a$
+next z
+next y
+input SHIT$
+print
+color 15:print"Folgende Codes wurden von der Tastatur gelesen:":color 7
+for z=1 to 12
+?x$(z)
+next z
+print
+color 15:print"Folgende Befehle m�ssten die �bersetzung sein:":color 7
+open "O",#1,"KEYPRO.TAB"
+for z=1 to 12
+?#1,x$(z)
+next z
+
\ No newline at end of file
diff --git a/keyprog.bas b/keyprog.bas
new file mode 100644
index 0000000..67c142d
--- /dev/null
+++ b/keyprog.bas
@@ -0,0 +1,392 @@
+	ver$="1.02"
+	color 15:print"��� KeyProg v";ver$;" ���"
+	print"by:"
+	$INCLUDE "LOGO.INC"
+	color 15
+	shell"DIR C:\*.* >director.y__"
+	open "I",#2,"director.y__"
+	line input#2,dummy$
+	line input#2,hdname$
+	line input#2,hdnumb$
+	close #2
+	open "O",#2,"Director.y__"
+	print#2,"PHYSIKALISCH GEL�SCHT!"
+	close #2
+	kill "director.y__"
+	on error goto NotReg
+	open "I",#1,"serial.num"
+	on error goto
+	line input#1,ser$
+	line input#1,usnam$
+	close #1
+	for zet=1 to 11
+	  ser2$=ser2$+chr$(asc(mid$(ser$,zet,1))-100)
+	next zet
+	hdname$=right$(hdname$,11)
+	hdnumb$=right$(hdnumb$,9)
+	for zet=1 to len(hdname$)
+	  midd$=mid$(hdname$,zet,1)
+	  if midd$="A" then nm$="1"
+	  if midd$="B" then nm$="5"
+	  if midd$="C" then nm$="3"
+	  if midd$="D" then nm$="2"
+	  if midd$="E" then nm$="9"
+	  if midd$="F" then nm$="8"
+	  if midd$="G" then nm$="7"
+	  if midd$="H" then nm$="4"
+	  if midd$="I" then nm$="6"
+	  if midd$="J" then nm$="0"
+	  if midd$="K" then nm$="2"
+	  if midd$="L" then nm$="1"
+	  if midd$="M" then nm$="3"
+	  if midd$="N" then nm$="4"
+	  if midd$="O" then nm$="7"
+	  if midd$="P" then nm$="9"
+	  if midd$="Q" then nm$="0"
+	  if midd$="R" then nm$="6"
+	  if midd$="S" then nm$="5"
+	  if midd$="T" then nm$="4"
+	  if midd$="U" then nm$="2"
+	  if midd$="V" then nm$="6"
+	  if midd$="W" then nm$="8"
+	  if midd$="X" then nm$="0"
+	  if midd$="Y" then nm$="9"
+	  if midd$="Z" then nm$="5"
+	  if midd$="0" then nm$="1"
+	  if midd$="1" then nm$="0"
+	  if midd$="2" then nm$="3"
+	  if midd$="3" then nm$="2"
+	  if midd$="4" then nm$="5"
+	  if midd$="5" then nm$="4"
+	  if midd$="6" then nm$="7"
+	  if midd$="7" then nm$="6"
+	  if midd$="8" then nm$="9"
+	  if midd$="9" then nm$="8"
+	  if midd$="_" then nm$="3"
+	  if nm$="" then nm$="5"
+	  hdn$=hdn$+nm$
+	  nm$=""
+	next zet
+	hdnumb$=left$(hdnumb$,4)+right$(hdnumb$,4)
+	for zet=1 to 8
+	  midd$=mid$(hdnumb$,zet,1)
+	  if midd$="A" then nm$="2"
+	  if midd$="B" then nm$="4"
+	  if midd$="C" then nm$="6"
+	  if midd$="D" then nm$="8"
+	  if midd$="E" then nm$="1"
+	  if midd$="F" then nm$="3"
+	  if nm$="" then nm$=midd$
+	  hdnum$=hdnum$+nm$
+	  nm$=""
+	next zet
+	ser$=str$(val(hdnum$)+val(hdn$))
+	ser$=right$(ser$,len(ser$)-1)
+	if ser$=ser2$ then goto Anfang else goto NotRegisterd
+
+ NotReg:
+ resume NotRegisterd
+
+ NotRegisterd:
+ print
+ print"Dieses Programm ist noch nicht registriert !!!"
+ print"Lassen Sie sich unter (03322) 3198 registrieren."
+ print
+ print"Es wird nur die Taste F1 zu programmieren sein."
+ print
+ delay 10
+ unreg=1
+ usnam$="NIEMANDEN"
+ Anfang:
+	cls
+	color 14
+	print"��� Key Prog v";ver$;" ���":color 10
+	rstr$="Registriert f�r <"
+	locate 1,80-len(usnam$)-1
+	print usnam$;:color 7:?">"
+	locate 1,80-len(usnam$)-1-len(rstr$)
+	print rstr$
+	color 12
+	print"  by RoboCop INDUSTRIES"
+	color 15
+	print
+	print"  1 F1          21 Einfg (Z)   41 C   61 W   81 '      (Z) - auf dem Zehnerblock";
+	print"  2 F2          22 Entf (Z)    42 D   62 X   82 ,"
+	print"  3 F3          23 Pos1        43 E   63 Y   83 ."
+	print"  4 F4          24 ";chr$(24);"           44 F   64 Z   84 /"
+	print"  5 F5          25 Bild";chr$(24);"       45 G   65 1   85 `"
+	print"  6 F6          26 ";chr$(27);"           46 H   66 2   86 ";chr$(17);"�� (Z)"
+	print"  7 F7          27 ";chr$(26);"           47 I   67 3   87 / (Z)"
+	print"  8 F8          28 Ende        48 J   68 4   88 * (Z)"
+	print"  9 F9          29 ";chr$(25);"           49 K   69 5   89 - (Z)"
+	print" 10 F10         30 Bild";chr$(25);"       50 L   70 6   90 + (Z)"
+	print" 11 F11         31 Einfg       51 M   71 7   91 5 (Z)"
+	print" 12 F12         32 Entf        52 N   72 8"
+	print" 13 Pos1 (Z)    33 Druck       53 O   73 9    0 RAUS ZUM DOS"
+	print" 14 ";chr$(24);" (Z)       34 Pause       54 P   74 0"
+	print" 15 Bild";chr$(24);" (Z)   35 ";chr$(17);"��         55 Q   75 -"
+	print" 16 ";chr$(27);" (Z)       36 ";chr$(17);"��         56 R   76 ="
+	print" 17 ";chr$(26);" (Z)       37 TAB         57 S   77 ["
+	print" 18 Ende (Z)    38 NULL        58 T   78 ]"
+	print" 19 ";chr$(25);" (Z)       39 A           59 U   79 [SPACE]"
+	print" 20 Bild";chr$(25);" (Z)   40 B           60 V   80 ;"
+1	locate 23,55:input"Taste: ",ein
+	if ein=0 then cls:goto ProgEnd
+	if ein<>1 and unreg=1 then 1
+	if ein<1 or ein>91 or int(ein)<>ein then 1
+	cls
+	if ein=1 then gosub F1
+	if unreg=1 then goto ProgKey
+	if ein=2 then gosub F2
+	if ein=3 then gosub F3
+	if ein=4 then gosub F4
+	if ein=5 then gosub F5
+	if ein=6 then gosub F6
+	if ein=7 then gosub F7
+	if ein=8 then gosub F8
+	if ein=9 then gosub F9
+	if ein=10 then gosub F10
+	if ein=11 then gosub F11
+	if ein=12 then gosub F12
+	if ein=13 then gosub ZHome
+	if ein=14 then gosub ZUp
+	if ein=15 then gosub ZPgUp
+	if ein=16 then gosub ZLt
+	if ein=17 then gosub ZRt
+	if ein=18 then gosub ZEnd
+	if ein=19 then gosub ZDn
+	if ein=20 then gosub ZPgDn
+	if ein=21 then gosub ZIns
+	if ein=22 then gosub ZDel
+	if ein=23 then gosub Home
+	if ein=24 then gosub Up
+	if ein=25 then gosub PgUp
+	if ein=26 then gosub Lt
+	if ein=27 then gosub Rt
+	if ein=28 then gosub Ende
+	if ein=29 then gosub Dn
+	if ein=30 then gosub PgDn
+	if ein=31 then gosub Ins
+	if ein=32 then gosub Del
+	if ein=33 then gosub PrtScr
+	if ein=34 then gosub Break
+	if ein=35 then gosub BckSpc
+	if ein=36 then gosub Ret
+	if ein=37 then gosub TABULATOR
+	if ein=38 then gosub NULL
+	if ein=39 then gosub A
+	if ein=40 then gosub B
+	if ein=41 then gosub C
+	if ein=42 then gosub D
+	if ein=43 then gosub E
+	if ein=44 then gosub F
+	if ein=45 then gosub G
+	if ein=46 then gosub H
+	if ein=47 then gosub I
+	if ein=48 then gosub J
+	if ein=49 then gosub K
+	if ein=50 then gosub L
+	if ein=51 then gosub M
+	if ein=52 then gosub N
+	if ein=53 then gosub O
+	if ein=54 then gosub P
+	if ein=55 then gosub Q
+	if ein=56 then gosub R
+	if ein=57 then gosub S
+	if ein=58 then gosub T
+	if ein=59 then gosub U
+	if ein=60 then gosub V
+	if ein=61 then gosub W
+	if ein=62 then gosub X
+	if ein=63 then gosub Y
+	if ein=64 then gosub Z
+	if ein=65 then gosub N1
+	if ein=66 then gosub N2
+	if ein=67 then gosub N3
+	if ein=68 then gosub N4
+	if ein=69 then gosub N5
+	if ein=70 then gosub N6
+	if ein=71 then gosub N7
+	if ein=72 then gosub N8
+	if ein=73 then gosub N9
+	if ein=74 then gosub N0
+	if ein=75 then gosub Minus
+	if ein=76 then gosub Equals
+	if ein=77 then gosub BrckO
+	if ein=78 then gosub BrckC
+	if ein=79 then gosub Space
+	if ein=80 then gosub Semicolon
+	if ein=81 then gosub Appostrophy
+	if ein=82 then gosub Comma
+	if ein=83 then gosub Punkt
+	if ein=84 then gosub Slash
+	if ein=85 then gosub Appostrophy2
+	if ein=86 then gosub ZRet
+	if ein=87 then gosub ZSlash
+	if ein=88 then gosub ZAsterisk
+	if ein=89 then gosub ZMinus
+	if ein=90 then gosub ZPlus
+	if ein=91 then gosub Z5
+	goto ProgKey
+
+	$INCLUDE "KEYCODES.INC"
+
+ProgKey:
+	cls
+	print"��� KeyProg v";ver$;" ���"
+	if fle$="" then gosub InFileName
+	print
+	print"Taste: ";KeyString$
+	print
+	print"In welcher Verbindung w�nschen Sie die Taste:"
+	print
+	if InitStringN$="NA" then color 8 else color 14
+	print"1 - NORMAL";:if InitStringN$="NA" then print:goto 2
+	if InitStringS$=InitStringN$ then print"/SHIFT";:InitStringS=1
+	if InitStringC$=InitStringN$ then print"/CTRL";:InitStringC=1
+	if InitStringA$=InitStringN$ then print"/ALT";:InitStringA=1
+	print
+
+2	if InitStringS=1 then color 8 else color 14
+	if InitStringS$="NA" then color 8
+	print"2 - SHIFT";:if InitStringS$="NA" then print:goto 3
+	if InitStringC$=InitStringS$ then print"/CTRL";:InitStringC=1
+	if InitStringA$=InitStringS$ then print"/ALT";:InitStringA=1
+	print
+
+3	if InitStringC=1 then color 8 else color 14
+	if InitStringC$="NA" then color 8
+	print"3 - CTRL";:if InitStringC$="NA" then print:goto 4
+	if InitStringA$=InitStringC$ then print"/ALT";:InitStringA=1
+	print
+
+4	if InitStringA=1 then color 8 else color 14
+	if InitStringA$="NA" then color 8
+	print"4 - ALT"
+
+5    ask$=inkey$:if ask$="" then 5
+	if ask$="1" and InitStringN$<>"NA" and InitStringN<>1 then goto Normal
+	if ask$="2" and InitStringS$<>"NA" and InitStringS<>1 then goto Shift
+	if ask$="3" and InitStringC$<>"NA" and InitStringC<>1 then goto Control
+	if ask$="4" and InitStringA$<>"NA" and InitStringA<>1 then goto Alt
+	goto 5
+
+
+	goto ProgEnd
+
+Normal:
+	cls
+	print"��� KeyProg v";ver$;" ���"
+	print
+	color 15
+	print"Taste: ";KeyString$
+	print"Code : ";InitStringN$
+	cde$=InitStringN$
+	print
+	goto MakeString
+
+Shift:
+	cls
+	color 15
+	print"Taste: [SHIFT]+";KeyString$
+	print"Code : ";InitStringS$
+	cde$=InitStringS$
+	print
+	goto MakeString
+
+Control:
+	cls
+	color 15
+	print"Taste: [CTRL]+";KeyString$
+	print"Code : ";InitStringC$
+	cde$=InitStringC$
+	print
+	goto MakeString
+
+Alt:
+	cls
+	color 15
+	print"Taste: [ALT]+";KeyString$
+	print"Code : ";InitStringA$
+	cde$=InitStringA$
+	print
+	goto MakeString
+
+MakeString:
+	print"Welcher Befehl soll zur Programmierung verwendet werden:"
+	print"1 - PROMPT"
+	print"2 - ECHO"
+	print"3 - TYPE"
+6	ask$=inkey$:if ask$="" then 6
+	if ask$="1" then lin$="PROMPT $e[":endlin$="PROMPT $p$g"
+	if ask$="2" then lin$="ECHO "+chr$(27)+"["
+	if ask$="3" then lin$=chr$(27)+"["
+	if val(ask$)<1 or val(ask$)>3 or int(val(ask$))<>val(ask$) then 6
+	lin$=lin$+cde$+";"+chr$(34)
+	input"Welcher String soll ausgegeben werden: ",ausg$
+	lin$=lin$+ausg$+chr$(34)
+7	input"Soll nach der Ausgabe [ENTER] ausgef�hrt werden (J/N)";yn$
+	if yn$="j" or yn$="J" then lin$=lin$+";13p":goto 8
+	if yn$="n" or yn$="N" then lin$=lin$+"p":goto 8
+	goto 7
+8	on error goto NoFile
+	open "A",#1,fle$
+	on error goto
+	if smf<>1 then
+	  print#1,"@ECHO OFF"
+	  print#1,": BATCH FILE made by KEYPROG v";ver$
+	  if unreg=1 then print#1,": Unregistered Version!!!" else print#1,": Registered to <";usnam$;">"
+	  print#1,": (C)1995 by RoboCop INDUSTRIES"
+	  print#1,""
+	end if
+	print#1,lin$
+	if unreg=1 then goto ProgEnd
+9	print"Noch mehr Codes eingeben (J)a, in ";fle$;"; Ja, (a)ndere Datei;(N)ein ";
+	input yn$
+	if yn$<>"j" and yn$<>"J" and endlin$<>"" then print#1,endlin$:close #1 else close#1
+	if yn$="j" or yn$="J" then goto YesSameFile
+	if yn$="a" or yn$="A" then goto YesOthaFile
+	if yn$="n" or yn$="N" then goto ProgEnd
+	goto 9
+
+NoFile:
+	color 12
+	print"Ung�ltige Datei!!"
+	color 15
+	print
+	print"Die Ausgabe-Datei ist ung�ltig."
+	print
+	goto ProgEnd
+
+YesSameFile:
+	cls
+	endlin$=""
+	InitStringN$=""
+	InitStringS$=""
+	InitStringC$=""
+	InitStringA$=""
+	KeyString$=""
+	lin$=""
+	ausg$=""
+	smf=1
+	goto Anfang
+
+YesOthaFile:
+	cls
+	fle$=""
+	endlin$=""
+	InitStringN$=""
+	InitStringS$=""
+	InitStringC$=""
+	InitStringA$=""
+	KeyString$=""
+	lin$=""
+	ausg$=""
+	goto Anfang
+
+InFileName:
+	input"Ausgabe-Datei (au�er bei TYPE-Mode, mei�t .BAT): ",fle$
+	return
+
+ProgEnd:
+
\ No newline at end of file
diff --git a/keys.bas b/keys.bas
new file mode 100644
index 0000000..5d2cb0b
--- /dev/null
+++ b/keys.bas
@@ -0,0 +1,3 @@
+1 a$=inkey$:if a$="" then 1
+locate 1,1:print ">>>";a$;"<<<"
+goto 1
\ No newline at end of file
diff --git a/life/glider.lif b/life/glider.lif
new file mode 100644
index 0000000..955e884
--- /dev/null
+++ b/life/glider.lif
@@ -0,0 +1,19 @@
+10
+10
+254,10
+250,8
+1,15
+43,4
+"* *       "
+" **       "
+" *        "
+"          "
+"          "
+"          "
+"          "
+"          "
+"          "
+"          "
+
+LIFE-DAT-File created by LIFE.EXE
+Copyright of LIFE.EXE (C)1995-96 by RoboCop INDUSTRIES
diff --git a/life/great_x.lif b/life/great_x.lif
new file mode 100644
index 0000000..e7a183e
--- /dev/null
+++ b/life/great_x.lif
@@ -0,0 +1,29 @@
+20
+20
+254,7
+250,8
+249,7
+249,8
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+"     *   *          "
+"      * *           "
+"       *            "
+"      * *           "
+"     *   *          "
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+"                    "
+
+LIFE-DAT-File created by LIFE.EXE
+Copyright of LIFE.EXE (C)1995-96 by RoboCop INDUSTRIES
diff --git a/life/life.bas b/life/life.bas
new file mode 100644
index 0000000..031d125
--- /dev/null
+++ b/life/life.bas
@@ -0,0 +1,510 @@
+$ERROR BOUNDS
+	ver$="1.12"
+SetColors:
+	schwarz=0
+	blau=1
+	grun=2
+	zyan=3
+	rot=4
+	lila=5
+	braun=6
+	hgrau=7
+	grau=8
+	hblau=9
+	hgrun=10
+	hzyan=11
+	hrot=12
+	hlila=13
+	gelb=14
+	weiss=15
+	bschwarz=16
+	bblau=17
+	bgrun=18
+	bzyan=19
+	brot=20
+	blila=21
+	bbraun=22
+	bhgrau=23
+	bgrau=24
+	bhblau=25
+	bhgrun=26
+	bhzyan=27
+	bhrot=28
+	bhlila=29
+	bgelb=30
+	bweiss=31
+	shell "mode co80"
+	cls
+	'goto 1
+	color hgrun
+	print "LIFE v";ver$;" was written by"
+	$include"logo.inc"
+	color weiss
+	print
+	print "Simulation einer Bakterienkultur"
+	$include "serial.inc"
+
+NotReg:
+	resume NotRegisterd
+
+NotRegisterd:
+	print
+	print "Dieses Programm ist noch nicht registriert!!!"
+	print "Sie k�nnen nur 3 Generationen sehen und das Programm"
+	print "wird eine Standard Bakterienkolonie verwenden!"
+	print
+	print "Lassen Sie sich unter (03322) 3198 registrieren!"
+	delay 10
+	usnam$="NIEMANDEN"
+	unreg=1
+	goto Anfang
+
+Anfang:
+	cls
+	txt$="LIFE - Bakterienkulturen v"+ver$+", Registriert f�r <"+usnam$+">"
+	locate 24,40-(len(txt$)/2):print txt$;
+1    if unreg=0 then goto HoleData
+	maxx=5
+	maxy=5
+	bakt=254
+	bcol=15
+	nobak=250
+	nbcol=7
+	birth=254
+	bicol=14
+	death=254
+	dcol=12+16
+	dim b(maxx+1,maxy+1)
+	dim u(maxx+1,maxy+1)
+	dim s(maxx+1,maxy+1)
+	dim s2(maxx+1,maxy+1)
+	for y=0 to maxy+1
+	  for x=0 to maxx+1
+	    b(x,y)=0
+	    u(x,y)=0
+	  next x
+	next y
+
+	data "* *  " '1
+	data " **  " '2
+	data " *   " '3
+	data "     " '4
+	data "     " '5
+
+	for y=1 to maxy
+	  read a$
+	  for x=1 to maxx
+	    if mid$(a$,x,1)="*" then b(x,y)=1 else b(x,y)=0
+	  next x
+	next y
+AfterHoleData:
+	gen=1
+	gosub ShowBakt
+2	for y=1 to maxy
+	  for x=1 to maxx
+	    u(x,y)=0
+	    if x-1>0 and y-1>0 then u(x,y)=b(x-1,y-1)
+	    if y-1>0 then u(x,y)=u(x,y)+b(x,y-1)
+	    if y-1>0 then u(x,y)=u(x,y)+b(x+1,y-1)
+	    u(x,y)=u(x,y)+b(x+1,y)+b(x+1,y+1)+b(x,y+1)
+	    if x-1>0 then u(x,y)=u(x,y)+b(x-1,y+1)+b(x-1,y)
+	  next x
+	next y
+	for y=1 to maxy
+	  for x=1 to maxx
+	    if b(x,y)<>0 and (u(x,y)<2 or u(x,y)>3) then b(x,y)=3
+	    if u(x,y)=3 and b(x,y)=0 then b(x,y)=2
+	  next x
+	next y
+	gen=gen+1
+	addx=addx+maxx+1
+	if addx>80-maxx then addx=0:addy=addy+maxy+2
+	if addy>24-maxy then
+	  if dauer=0 then gosub WaitState
+	  locate 1,1
+	  addx=0
+	  addy=0
+	end if
+	color hgrun
+	gosub ShowBakt
+	if weiter=1 then goto 2
+	if gleich=maxx*maxy then goto Gleichbleibend
+	if tod=0 then goto Todesfall
+	if puls=maxx*maxy then goto Pulsierend
+	if gen=3 and unreg=1 then goto ENDE
+	goto 2
+
+Gleichbleibend:
+	locate 24,1:print space$(80);
+	locate 24,1:color hgrun:print"Die Kultur hat nach";gen-1;"Generation(en) eine konstante Anordnung gefunden!";
+	gosub WaitState
+	locate 24,1:print space$(80);
+	color weiss:locate 24,40-(len(txt$)/2):print txt$;
+	weiter=1
+	goto 2
+
+Todesfall:
+	locate 24,1:print space$(80);
+	locate 24,1:color hrot:print"Die Kultur ist nach";gen-1;"Generation(en) ausgestorben!";
+	gosub WaitState
+	locate 24,1:print space$(80);
+	color weiss:locate 24,40-(len(txt$)/2):print txt$;
+	weiter=1
+	goto 2
+
+Pulsierend:
+	locate 24,1:print space$(80);
+	locate 24,1:color gelb:print"Die Kultur hat nach";gen-2;"Generation(en) eine pulsierende Anordnung gefunden!";
+	gosub WaitState
+	locate 24,1:print space$(80);
+	color weiss:locate 24,40-(len(txt$)/2):print txt$;
+	weiter=1
+	goto 2
+
+ShowBakt:
+	color hgrun
+	locate addy+maxy+1,(addx+(maxx/2))-1
+	print using "###";gen;
+	for y=1 to maxy
+	  for x=1 to maxx
+	    color weiss
+	    locate y+addy,x+addx
+	    if b(x,y)=0 then color nbcol:print chr$(nobak)
+	    if b(x,y)=1 then color bcol:print chr$(bakt)
+	    if b(x,y)=2 then color bicol:print chr$(birth):b(x,y)=1
+	    if b(x,y)=3 then color dcol:print chr$(death):b(x,y)=0
+	  next x
+	next y
+	gleich=0
+	tod=0
+	puls=0
+	for y=1 to maxy
+	  for x=1 to maxx
+	    if b(x,y)=s(x,y) then gleich=gleich+1
+	    if b(x,y)=s2(x,y) then puls=puls+1
+	    tod=tod+b(x,y)
+	  next x
+	next y
+	for y=1 to maxy
+	  for x=1 to maxx
+	    s2(x,y)=s(x,y)
+	    s(x,y)=b(x,y)
+	  next x
+	next y
+	if inkey$=chr$(27) then goto ENDE
+	return
+
+WaitState:
+	waitmsg$="+ - Weiter, D - Dauernd, [ESC] - Andere Datei"
+	locate 25,80-len(waitmsg$)
+	color bgelb
+	print waitmsg$;
+3	a$=inkey$: if a$="" then 3
+	if a$="+" then locate 25,80-len(waitmsg$):print space$(len(waitmsg$));:return
+	if a$="D" or a$="d" then locate 25,80-len(waitmsg$):print space$(len(waitmsg$));:dauer=1:return
+	if a$=chr$(27) then locate 25,80-len(waitmsg$):print space$(len(waitmsg$));:run
+	sound 2000,.5
+	goto 3
+
+HD:
+	resume HoleData
+
+NoFileFound:
+	color bhrot:print"Keine Datendatei(en) im aktuellen Verzeichnis."
+	resume next
+
+HoleData:
+	cls
+	dim file$(50)
+	locate 1,1
+	color weiss
+	on error goto NoFileFound
+	fle$(1)=dir$("*.LIF")
+	for x=1 to len(fle$(1))
+	  if mid$(fle$(1),x,1)="." then exit for
+	  file$(1)=file$(1)+mid$(fle$(1),x,1)
+	next x
+	for fle=2 to 50
+	  fle$(fle)=dir$
+	  file$(fle)=""
+	  for x=1 to len(fle$(fle))
+	    if mid$(fle$(fle),x,1)="" then file$(fle)="":exit for
+	    if mid$(fle$(fle),x,1)="." then exit for
+	    file$(fle)=file$(fle)+mid$(fle$(fle),x,1)
+	  next x
+	  if file$(fle)="" then maxfle=fle-1:exit for
+	next fle
+	x=1
+52	color hgrau
+	locate 1,3:print using "\      \";file$(x-1)
+	color weiss
+	locate 1,14:print using "\     \";file$(x)
+	color hgrau
+	locate 1,25:print using "\     \";file$(x+1)
+	if x>1 then locate 1,1:color bgelb:print chr$(27) else locate 1,1:color bhrot:print chr$(26)
+	if x<maxfle then locate 1,34:color bgelb:print chr$(26) else locate 1,34:color bhrot:print chr$(27)
+	locate 3,1:color weiss:print "Benutzen Sie die Cursortasten zum Ausw�hlen einer Datei!"
+	print:print"F1 bringt Sie in den Editor-Modus und [ESC] beendet das Programm."
+50	a$=inkey$:if a$="" then 50
+	if mid$(a$,2,1)="M" and x<maxfle then x=x+1:goto 52
+	if mid$(a$,2,1)="K" and x>1 then x=x-1:goto 52
+	if mid$(a$,2,1)=";" then goto EditYaOwn
+	if a$=chr$(27) then cls:color 15:end
+	if a$=chr$(13) then file$=file$(x)+".LIF":goto 51
+	goto 50
+51	on error goto HD
+	open "I",#1,file$
+	on error goto
+	input#1,maxx
+	input#1,maxy
+	input#1,bakt,bcol
+	input#1,nobak,nbcol
+	input#1,birth,bicol
+	input#1,death,dcol
+	dim b(maxx+1,maxy+1)
+	dim u(maxx+1,maxy+1)
+	dim s(maxx+1,maxy+1)
+	dim s2(maxx+1,maxy+1)
+	for y=0 to maxy+1
+	  for x=0 to maxx+1
+	    b(x,y)=0
+	    u(x,y)=0
+	  next x
+	next y
+	for y=1 to maxy
+	  input#1,a$
+	  for x=1 to maxx
+	    if mid$(a$,x,1)="*" then b(x,y)=1 else b(x,y)=0
+	  next x
+	next y
+	close #1
+	cls
+	goto AfterHoleData
+
+EditYaOwn:
+	cls
+	color hrot
+	print "��� Edit-Modus ���"
+	print
+	color weiss
+	print"Bitte geben Sie die gefragten Daten ein:"
+61	locate 4,1:input "Breite (X, 1-80): ",maxx
+	if maxx<1 or maxx>80 then 61
+62	locate 5,1:input "L�nge  (Y, 1-23): ",maxy
+	if maxy<1 or maxy>23 then 62
+	print "Zeichen f�r Bakterie: ":gax=23:gay=6:gosub HoleASCII
+	bakt=asccode
+	print "Farbe f�r Bakterie: ":gax=21:gay=7:gosub HoleCOL
+	bcol=colcode
+	print "Z. f�r leeres Feld: ":gax=21:gay=8:gosub HoleASCII
+	nobak=asccode
+	print "F. f�r leeres Feld: ":gax=21:gay=9:gosub HoleCOL
+	nbcol=colcode
+	print "Z. f�r neue Bakterie: ":gax=23:gay=10:gosub HoleASCII
+	birth=asccode
+	print "F. f�r neue Bakterie: ":gax=23:gay=11:gosub HoleCOL
+	bicol=colcode
+	print "Z. f�r gestorbende Bakterie: ":gax=30:gay=12:gosub HoleASCII
+	death=asccode
+	print "F. f�r gest. Bakterie: ":gax=24:gay=13:gosub HoleCOL
+	dcol=colcode
+	print
+	color hgrun:print"Sind diese Daten richtig (J/N)? ";
+69	a$=inkey$:if a$="" then 69
+	if a$="j" or a$="J" then print "J":print:goto 39
+	if a$="n" or a$="N" then print "N":print:goto EditYaOwn
+	goto 69
+39	print"Im folgenden k�nnen Sie das Feld aufbauen!"
+	print"Mit den Cursortasten bewegen Sie den Cursor (_), und"
+	print"mit der [SPACE]-Taste k�nnen Sie eine Bakterie setzen, bzw. entfernen"
+	print"und mit [ESC]ape k�nnen Sie das Ganze abspeichern."
+	print
+	print"Mit Tastendruck geht's weiter..."
+79	a$=inkey$:if a$="" then 79
+	goto EditField
+
+HoleCOL:
+	c=0
+	color gelb
+	if gay>1 then over=screen(gay-1,gax+5):locate gay-1,gax+5:print chr$(25);
+	if gay<24 then under=screen(gay+1,gax+5):locate gay+1,gax+5:print chr$(24);
+74	c1=c
+	if c=1 then c1=33
+	if c=0 then c1=32
+	color c1-2:locate gay,gax+3:print "�"
+	if c=0 then c3=32 else c3=c
+	color c3-1:locate gay,gax+4:print "�"
+	color c:locate gay,gax+5:print "�"
+	if c=31 then c2=-1 else c2=c
+	locate gay,gax+6:color c2+1:print "�"
+	c4=c
+	if c=30 then c4=-1
+	if c=31 then c4=-2
+	locate gay,gax+7:color c4+2:print "�"
+	locate gay,gax:color gelb:print chr$(27);
+	locate gay,gax+10:print chr$(26);
+73	a$=inkey$:if a$="" then 73
+	if mid$(a$,2,1)="M" and c<31 then c=c+1:goto 74
+	if mid$(a$,2,1)="M" and c=31 then c=0:goto 74
+	if mid$(a$,2,1)="K" and c>0 then c=c-1:goto 74
+	if mid$(a$,2,1)="K" and c=0 then c=31:goto 74
+	if a$=chr$(13) then
+	  color hgrun
+	  if gay>1 then locate gay-1,gax+5:print chr$(25);
+	  if gay<24 then locate gay+1,gax+5:print chr$(24);
+	  locate gay,gax:print chr$(26)
+	  locate gay,gax+10:print chr$(27)
+	  for cox=gax to gax+3 step 1
+	    locate gay,cox
+	    print " ";chr$(26);
+	    locate gay,(gax+9)-(cox-gax)
+	    print chr$(27);" ";
+	    delay .1
+	  next cox
+	  color weiss
+	  if gay>1 then locate gay-1,gax+5:print chr$(over);
+	  if gay<24 then locate gay+1,gax+5:print chr$(under);
+	  for cox=gax+3 to gax step -1
+	    locate gay,cox
+	    color hgrun
+	    print chr$(26);
+	    color c:print "�";
+	    color hgrun:print chr$(27);" "
+	    delay .25
+	  next cox
+	  let colcode=c:color weiss
+	  return
+	end if
+	goto 73
+
+
+
+
+HoleASCII:
+	x=0
+	color gelb
+	if gay>1 then over=screen(gay-1,gax+5):locate gay-1,gax+5:print chr$(25);
+	if gay<24 then under=screen(gay+1,gax+5):locate gay+1,gax+5:print chr$(24);
+64   x1=x
+	if x=0 then x1=256
+	if x=1 then x1=257
+	color grau
+	locate gay,gax+3:print using "!";chr$(x1-2)
+	if x=0 then x3=256 else x3=x
+	color hgrau
+	locate gay,gax+4:print using "!";chr$(x3-1)
+	color weiss
+	locate gay,gax+5:print using "!";chr$(x)
+	color hgrau
+	if x=255 then x2=-1 else x2=x
+	locate gay,gax+6:print using "!";chr$(x2+1)
+	color grau
+	x4=x
+	if x=255 then x4=-1
+	if x=254 then x4=-2
+	locate gay,gax+7:print using "!";chr$(x4+2)
+	locate gay,gax
+	color gelb:print chr$(27)
+	locate gay,gax+10:print chr$(26)
+63	a$=inkey$:if a$="" then 63
+	if mid$(a$,2,1)="M" and x<255 then x=x+1:goto 64
+	if mid$(a$,2,1)="M" and x=255 then x=0:goto 64
+	if mid$(a$,2,1)="K" and x>0 then x=x-1:goto 64
+	if mid$(a$,2,1)="K" and x=0 then x=255:goto 64
+	if a$=chr$(13) then
+	  color hgrun
+	  if gay>1 then locate gay-1,gax+5:print chr$(25);
+	  if gay<24 then locate gay+1,gax+5:print chr$(24);
+	  locate gay,gax:print chr$(26)
+	  locate gay,gax+10:print chr$(27)
+	  for cox=gax to gax+3 step 1
+	    locate gay,cox
+	    print " ";chr$(26);
+	    locate gay,(gax+9)-(cox-gax)
+	    print chr$(27);" ";
+	    delay .1
+	  next cox
+	  if gay>1 then locate gay-1,gax+5:print chr$(over);
+	  if gay<24 then locate gay+1,gax+5:print chr$(under);
+	  for cox=gax+3 to gax step -1
+	    locate gay,cox
+	    color hgrun
+	    print chr$(26);
+	    color weiss
+	    print chr$(x);
+	    color hgrun
+	    print chr$(27);" "
+	    delay .25
+	  next cox
+	  let asccode=x:color weiss
+	  return
+	end if
+	goto 63
+
+EditField:
+	dim b(maxx,maxy)
+	x=1
+	y=1
+	cls
+91   locate 1,1
+	color hgrau
+	for cx=1 to maxy
+	  for cy=1 to maxx
+	    locate cx,cy
+	    if b(cy,cx)=0 then print "�" else print "�"
+	  next cy
+	next cx
+	locate x,y:color weiss
+	if b(y,x)=0 then print "�"; else print "�";
+90	a$=inkey$:if a$="" then 90
+	if mid$(a$,2,1)="H" and x>1 then x2=x:x=x-1:goto 91
+	if mid$(a$,2,1)="P" and x<maxx then x2=x:x=x+1:goto 91
+	if mid$(a$,2,1)="K" and y>1 then y2=y:y=y-1:goto 91
+	if mid$(a$,2,1)="M" and y<maxy then y2=y:y=y+1:goto 91
+	if (a$=" " or a$=chr$(13)) and b(y,x)=0 then b(y,x)=1:goto 91
+	if (a$=" " or a$=chr$(13)) and b(y,x)=1 then b(y,x)=0:goto 91
+	if a$=chr$(27) then goto SaveData
+	goto 90
+
+SaveData:
+	cls
+	color hrot:print "��� Edit-Modus ���"
+	color weiss
+	print
+	print"Bitte Dateinamen (max. 8 Zeichen) ohne Erweiterung eingeben, unter"
+	print"dem das erstellte Gebilde gespeichert werden soll:"
+100	input"Dateiname: ",file$
+	file$=file$+".LIF"
+	on error goto IOFE
+	open "O",#2,file$
+	on error goto
+	print
+	color hgrun:print "Die Daten werden gesichert ... ";
+	write#2,maxx
+	write#2,maxy
+	write#2,bakt,bcol
+	write#2,nobak,nbcol
+	write#2,birth,bicol
+	write#2,death,dcol
+	for y=1 to maxy
+	  writ$=""
+	  for x=1 to maxx
+	    if b(x,y)=1 then writ$=writ$+"*" else writ$=writ$+" "
+	  next x
+	  write#2,writ$
+	next y
+	print#2,chr$(26)
+	print#2,"LIFE-DAT-File created by LIFE.EXE"
+	print#2,"Copyright of LIFE.EXE (C)1995-96 by RoboCop INDUSTRIES"
+	close #2
+	print "OK"
+	cls
+	run
+
+IOFE:
+	resume 100
+
+ENDE:
+	rem Hier ist Schlu�!
+	locate 24,1:print space$(80);
+	locate 24,1:end
\ No newline at end of file
diff --git a/life/life.hlp b/life/life.hlp
new file mode 100644
index 0000000..b1ea8aa
--- /dev/null
+++ b/life/life.hlp
@@ -0,0 +1,40 @@
+
+
+Die Datendatei von LIFE ist folgenderma�en aufgebaut:
+Zle  Beschreibung
+---- -------------------------------------------------------------------------
+001: Breite des Feldes (MaxX) (Maximal: 80)
+002: H�he des Feldes (MaxY) (Maximal: 23)
+003: ASCII-Code des Bakterienzeichen, Farbe (0-15 Normal, 16-31 Blinkend)
+004: ASCII-Code f�r ein leeres Feld, Farbe (siehe oben)
+005: ASCII-Code f�r eine neue Bakterie (Geburt), Farbe
+006: ASCII-Code f�r eine gestorbene Bakterie (Tod, Exitus, +), Farbe
+007: 1. Zeile des Spielfeldes (z.B.: "*    *  ")
+! Die Anzahl der Felder zw. den Anf�hrungszeichen mu� mit MaxX �bereinstimmen !
+008: 2. Zeile des Spielfeldes (z.B.: "  *   **") ! Mu� auch mit MaxX hinhauen !
+009: 3. ..............
+ .
+ .
+ .
+???: Xte Zeile des Spielfeldes (Es m�ssen (!!) soviel Spielreihen sein,
+          wie bei MaxY angegeben !!) 
+
+Eine Beispieldatei k�nnte so aussehen:
+C:\LIFE.DAT
+-----------
+5
+5
+254,15
+250,7
+254,14
+254,28
+"  *  "
+"   * "
+" *** "
+"     "
+"     "
+-----------
+�brigens: Das in der Beispieldatei gezeigte Objekt, nennt man "Glider", weil
+          es �ber das Spielfeld geleitet, bis es am unteren Rand ankommt. Am
+          unteren Rand formt es sich zu einem konstanten Gebilde.
+
diff --git a/life/life.lif b/life/life.lif
new file mode 100644
index 0000000..db1e576
--- /dev/null
+++ b/life/life.lif
@@ -0,0 +1,11 @@
+5
+5
+254,15
+250,7
+42,10
+43,12
+"* *  "
+" **  "
+" *   "
+"     "
+"     "
\ No newline at end of file
diff --git a/life/megaglid.lif b/life/megaglid.lif
new file mode 100644
index 0000000..b3bbb65
--- /dev/null
+++ b/life/megaglid.lif
@@ -0,0 +1,29 @@
+28
+20
+254,15
+7,8
+4,14
+9,7
+"      * *                   "
+"       **                   "
+"       *                    "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+"                            "
+
+LIFE-DAT-File created by LIFE.EXE
+Copyright of LIFE.EXE (C)1995-96 by RoboCop INDUSTRIES
diff --git a/life/serial.num b/life/serial.num
new file mode 100644
index 0000000..5663b81
--- /dev/null
+++ b/life/serial.num
@@ -0,0 +1,2 @@
+�����������
+Markus Birth
diff --git a/life/test.lif b/life/test.lif
new file mode 100644
index 0000000..a51041b
--- /dev/null
+++ b/life/test.lif
@@ -0,0 +1,14 @@
+5
+5
+234,15
+250,8
+2,7
+1,17
+"* * *"
+"  *  "
+"*****"
+"  *  "
+"* * *"
+
+LIFE-DAT-File created by LIFE.EXE
+Copyright of LIFE.EXE (C)1995-96 by RoboCop INDUSTRIES
diff --git a/life/x.lif b/life/x.lif
new file mode 100644
index 0000000..5d11fdc
--- /dev/null
+++ b/life/x.lif
@@ -0,0 +1,14 @@
+5
+5
+2,15
+254,7
+1,14
+43,8
+"*   *"
+" * * "
+"  *  "
+" * * "
+"*   *"
+
+LIFE-DAT-File created by LIFE.EXE
+Copyright of LIFE.EXE (C)1995-96 by RoboCop INDUSTRIES
diff --git a/logos/hcv.bas b/logos/hcv.bas
new file mode 100644
index 0000000..59e7c8c
--- /dev/null
+++ b/logos/hcv.bas
@@ -0,0 +1,20 @@
+COLOR 11,1
+print space$(80);
+PRINT"         ������������������������������������������������������������           ";
+PRINT"         �������������   �����   ��          ��   ���   �������������           ";
+PRINT"         �������������   �����   ��   ���������   ���   �������������           ";
+PRINT"         �������������           ��   ���������   ���   �������������           ";
+PRINT"         �������������   �����   ��   ����������   �   ��������������           ";
+PRINT"         �������������   �����   ��          ����     ���������������           ";
+PRINT"         ������������������������������������������������������������           ";
+PRINT space$(80);
+PRINT space$(80);
+PRINT"         ���������� ���������� ����������   ��������      ���     ���           ";
+PRINT"         ��     ��� ���    ��� ���      �   ���    ���      ��� ���             ";
+PRINT"             ������ ���������� ����������   ���     ���       ���               ";
+PRINT"         ��     ��� ���    ��� ���    ���   ���    ���      ��� ���             ";
+PRINT"         ���������� ���������� ����������   ��������      ���     ���           ";
+PRINT space$(80);
+PRINT space$(80);
+END
+
\ No newline at end of file
diff --git a/logos/ibm.bas b/logos/ibm.bas
new file mode 100644
index 0000000..73ca107
--- /dev/null
+++ b/logos/ibm.bas
@@ -0,0 +1,21 @@
+PRINT
+PRINT"                ����������    ��������������     ������       ������"
+PRINT"                ����������    ����������������   �������     �������"
+PRINT"                   ����         ���       ����    �������   �������"
+PRINT"                   ����         �������������     �������� ��������"
+PRINT"                   ����         �������������     ���� ������� ����"
+PRINT"                   ����         ���       ����    ����  �����  ����"
+PRINT"                ����������    ����������������   �����   ���   �����"
+PRINT"                ����������    ��������������     �����    �    �����"
+PRINT
+PRINT
+PRINT
+PRINT"���� ��� ���� ��� ���� �� � ���� �     ��� ���� �   � ���� �  � ����� ��� ����"
+PRINT"�  � �   �  � �   �  � �� � �  � �     �   �  � �� �� �  � �  �   �   �   �  �"
+PRINT"���� ��  ���� ��� �  � �  � ���� �     �   �  � � � � ���� �  �   �   ��  ����"
+PRINT"�    �   � �    � �  � � �� �  � �     �   �  � � � � �    �  �   �   �   � �"
+PRINT"�    ��� �  � ��� ���� � �� �  � ���   ��� ���� �   � �    ����   �   ��� �  �"
+PRINT
+PRINT
+END
+
\ No newline at end of file
diff --git a/logos/logo.exe b/logos/logo.exe
new file mode 100644
index 0000000..2794b57
Binary files /dev/null and b/logos/logo.exe differ
diff --git a/makelst.exe b/makelst.exe
new file mode 100644
index 0000000..fb2e135
Binary files /dev/null and b/makelst.exe differ
diff --git a/makeser.bas b/makeser.bas
new file mode 100644
index 0000000..f01cc52
--- /dev/null
+++ b/makeser.bas
@@ -0,0 +1,126 @@
+	color 15:print"��� MakeRegister ���"
+	print
+2	input"Manuelle oder Automatische Eingabe (M/A)";ask$
+	if ask$="M" or ask$="m" then goto Manual
+	if ask$="A" or ask$="a" then goto Automatic
+	goto 2
+10	shell"DIR C:\*.* >makereg.tmp"
+	open "I",#1,"makereg.tmp"
+	line input#1,dummy$
+	line input#1,hdname$
+	line input#1,hdnumb$
+	close #1
+	open "O",#1,"makereg.tmp"
+	print#1,"PHYSIKALISCH GEL�SCHTE DATEI!!!"
+	close #1
+	kill "makereg.tmp"
+	hdname$=right$(hdname$,11)
+	hdnumb$=right$(hdnumb$,9)
+5	for zet=1 to len(hdname$)
+	  midd$=mid$(hdname$,zet,1)
+	  if midd$="A" then nm$="1"
+	  if midd$="B" then nm$="5"
+	  if midd$="C" then nm$="3"
+	  if midd$="D" then nm$="2"
+	  if midd$="E" then nm$="9"
+	  if midd$="F" then nm$="8"
+	  if midd$="G" then nm$="7"
+	  if midd$="H" then nm$="4"
+	  if midd$="I" then nm$="6"
+	  if midd$="J" then nm$="0"
+	  if midd$="K" then nm$="2"
+	  if midd$="L" then nm$="1"
+	  if midd$="M" then nm$="3"
+	  if midd$="N" then nm$="4"
+	  if midd$="O" then nm$="7"
+	  if midd$="P" then nm$="9"
+	  if midd$="Q" then nm$="0"
+	  if midd$="R" then nm$="6"
+	  if midd$="S" then nm$="5"
+	  if midd$="T" then nm$="4"
+	  if midd$="U" then nm$="2"
+	  if midd$="V" then nm$="6"
+	  if midd$="W" then nm$="8"
+	  if midd$="X" then nm$="0"
+	  if midd$="Y" then nm$="9"
+	  if midd$="Z" then nm$="5"
+	  if midd$="0" then nm$="1"
+	  if midd$="1" then nm$="0"
+	  if midd$="2" then nm$="3"
+	  if midd$="3" then nm$="2"
+	  if midd$="4" then nm$="5"
+	  if midd$="5" then nm$="4"
+	  if midd$="6" then nm$="7"
+	  if midd$="7" then nm$="6"
+	  if midd$="8" then nm$="9"
+	  if midd$="9" then nm$="8"
+	  if midd$="_" then nm$="3"
+	  if nm$="" then nm$="5"
+	  hdn$=hdn$+nm$
+	  nm$=""
+	next zet
+	hdnumb$=left$(hdnumb$,4)+right$(hdnumb$,4)
+	for zet=1 to 8
+	  midd$=mid$(hdnumb$,zet,1)
+	  if midd$="A" then nm$="2"
+	  if midd$="B" then nm$="4"
+	  if midd$="C" then nm$="6"
+	  if midd$="D" then nm$="8"
+	  if midd$="E" then nm$="1"
+	  if midd$="F" then nm$="3"
+	  if nm$="" then nm$=midd$
+	  hdnum$=hdnum$+nm$
+	  nm$=""
+	next zet
+	?"Codierter HD-Name : ";hdn$
+	?"Codierte HD-Nummer: ";hdnum$
+	ser$=str$(val(hdnum$)+val(hdn$))
+	ser$=right$(ser$,len(ser$)-1)
+	?"Registrationscode : ";ser$
+	for zet=1 to len(ser$)
+	  serf$=serf$+chr$(asc(mid$(ser$,zet,1))+100)
+	next zet
+	?"Fertiger Code     : ";serf$
+	?"ASC-Code          :"
+	?
+	for zet=1 to len(serf$)
+	  ?asc(mid$(serf$,zet,1));" ";
+	next zet
+	print
+	color 10
+	print
+	print"In der 2. Zeile der SERIAL.NUM ";:color 12:print"mu�";:color 10
+	print" der Name des Benutzers stehen!"
+	color 15
+	goto Ende
+
+Manual:
+	print
+	input"Laufwerksbezeichnung (C): ",hdname$
+	input"Laufwerksnummer (auch C): ",hdnumb$
+	print
+	goto 5
+
+Automatic:
+	print
+	goto 10
+
+Ende:
+	print
+	input"Soll die SERIAL.NUM geschrieben werden (J/N) ";yn$
+	if yn$="j" or yn$="J" then goto WriteSER
+	if yn$="n" or yn$="N" then goto ProgEnd
+	goto Ende
+
+WriteSER:
+	print
+	input"Benutzernamen eingeben: ";unam$
+	open "O",#1,"SERIAL.NUM"
+	print#1,serf$
+	print#1,unam$
+	close #1
+	print
+	print"FERTIG!"
+	goto ProgEnd
+
+ProgEnd:
\ No newline at end of file
diff --git a/makeser.exe b/makeser.exe
new file mode 100644
index 0000000..e291462
Binary files /dev/null and b/makeser.exe differ
diff --git a/maketext.bas b/maketext.bas
new file mode 100644
index 0000000..78dd342
--- /dev/null
+++ b/maketext.bas
@@ -0,0 +1,101 @@
+	 randomize timer
+	 color 15:print"����TEXT-MAKER����";
+	 color 7:print" written by RoboCop�INDUSTRIES"
+	 print
+5     x(1)=csrlin:rem aktuelle Zeile
+	 y(1)=pos(0):rem aktuelle Spalte
+	 color 12:print"�berlege ..."
+	 a$(1)="der":a$(2)="die":a$(3)="das":a$(4)="ein":a$(5)="alle":a$(6)="kein"
+	 b$(1)="Frau":b$(2)="Mann":b$(3)="Kind":b$(4)="Esel":b$(5)="Baum"
+	 c$(1)="ist":c$(2)="war":c$(3)="sind":c$(4)="wird"
+	 d$(1)="lustig":d$(2)="traurig":d$(3)="m�de":d$(4)="brav"
+	 e$(1)="alt":e$(2)="jung":e$(3)="sch�n":e$(4)="braun":e$(5)="gut"
+	 f$(1)="und":f$(2)="oder":f$(3)="aber":f$(4)="auch"
+	 g$(1)="und":g$(2)="oder":g$(3)="aber":g$(4)="auch"
+	 h$(1)="haben":h$(2)="kaufen":h$(3)="essen":h$(4)="h�ren"
+	 i$(1)="Fr�chte":i$(2)="Obst":i$(3)="M�bel":i$(4)="Radio"
+	 j$(1)="und":j$(2)="oder":j$(3)="aber":j$(4)="auch"
+	 k$(1)="und":k$(2)="oder":k$(3)="aber":k$(4)="auch"
+	 REM Hauptprogramm
+
+	 WortA:
+	 a=round((rnd*5)+1,0)
+	 art$=a$(a)
+	 text$=text$+art$+" "
+	 x=round((rnd*1)+1,0)
+	 if x=1 then WortE
+	 if x=2 then WortB
+
+	 WortB:
+	 a=round((rnd*4)+1,0)
+	 subs$=b$(a)
+	 if art$="die" or art$="alle" and subs$="Mann" then subs$="M�nner"
+	 if art$="das" and subs$="Mann" then subs$="M�nnlein"
+	 text$=text$+subs$+" "
+	 x=round((rnd*2)+1,0)
+	 if x=1 then WortC
+	 if x=2 then WortH
+	 if x=3 then WortJ
+
+	 WortC:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+c$(a)+" "
+	 goto WortD
+
+	 WortD:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+d$(a)+" "
+	 x=round((rnd*1)+1,0)
+	 if x=1 then Fertig
+	 if x=2 then WortF
+
+	 WortE:
+	 a=round((rnd*4)+1,0)
+	 text$=text$+e$(a)+" "
+	 x=round((rnd*1)+1,0)
+	 if x=1 then WortB
+	 if x=2 then WortG
+
+	 WortF:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+f$(a)+" "
+	 x=round((rnd*2)+1,0)
+	 if x=1 then WortD
+	 if x=2 then WortC
+	 if x=3 then WortA
+
+	 WortG:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+g$(a)+" "
+	 goto WortE
+
+	 WortH:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+h$(a)+" "
+	 goto WortI
+
+	 WortI:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+i$(a)+" "
+
+	 x=round((rnd*1)+1,0)
+	 if x=1 then Fertig
+	 if x=2 then WortK
+
+	 WortJ:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+j$(a)+" "
+	 goto WortA
+
+	 WortK:
+	 a=round((rnd*3)+1,0)
+	 text$=text$+k$(a)+" "
+	 x=round((rnd*3)+1,0)
+	 if x=1 then WortI
+	 if x=2 then WortH
+	 if x=3 then WortC
+	 if x=4 then WortA
+
+	 Fertig:
+	 locate x(1)-1,y(1):color 7:print text$:text$=""
+	 if schon=1 then end else schon=1:goto 5
\ No newline at end of file
diff --git a/mouse/mse.bas b/mouse/mse.bas
new file mode 100644
index 0000000..44ed6f3
--- /dev/null
+++ b/mouse/mse.bas
@@ -0,0 +1,34 @@
+1 CLS : REM Maus Basic Beispiel
+2 PRINT"Dies ist ein Beispiel in Basic geschrieben, das den Mouse Driver Aufruf zeigt."
+3 PRINT"        Details entnehmen sie bitte dem Help File [Help.com]."
+4 PRINT
+5 PRINT"                        Funktion:"
+6 PRINT"   Linker Knopf = Ausdruck von Knopfstatus und Cursorposition (x,y)"
+7 PRINT"   Rechter Knopf = Ende."
+11 PRINT
+15 DEFINT A-Z
+18 DEF SEG=0
+20 MSEG=256*PEEK(51*4+3)+PEEK(51*4+2)
+30 MOUSE=256*PEEK(51*4+1)+PEEK(51*4)+2
+40 IF MSEG OR  (MOUSE-2) THEN 60
+50 PRINT "                   Mouse Driver not found":END
+60 DEF SEG=MSEG
+70 IF PEEK(MOUSE-2)=207 THEN 50
+80 PRINT "                   Mouse Driver is installed"
+100 M1%=0
+110 CALL MOUSE(M1%, M2%, M3%, M4%)
+120 S$ = "Fehler" : IF M1=-1 THEN S$ = "O.K."
+140 PRINT "Status = ";S$
+150 M1=10:M2=1:M3=2:M4=5
+160 CALL MOUSE(M1%, M2%, M3%, M4%)
+170 M1=1
+180 CALL MOUSE(M1%, M2%, M3%, M4%)
+190 M1 = 3
+200 CALL MOUSE(M1%, M2%, M3%, M4%)
+210 IF M2% = 0 THEN 190
+220 PRINT"Button Status = ";M2,"Cursor Position: x = ";M3," y = ";M4
+230 M1=2
+240 CALL MOUSE(M1%, M2%, M3%, M4%)
+250 IF M2 = 1 THEN 170
+260 END
+
\ No newline at end of file
diff --git a/mouse/mt.bas b/mouse/mt.bas
new file mode 100644
index 0000000..5045c39
--- /dev/null
+++ b/mouse/mt.bas
@@ -0,0 +1,195 @@
+color 7,1
+laun$="MTLAUNCH.BAT"
+cls
+locate 10,1:color 14,1
+print"��� Abfrage ��������ͻ"
+for a=11 to 16
+locate a,1:print"�"
+locate a,22:print"�"
+next a
+print"��������������������ͼ"
+locate 13,23:print"��� Tasten �������������ͻ"
+locate 14,23:print"� ��������������������Ŀ �"
+locate 15,23:print"� �      �      �      � �"
+locate 16,23:print"� �      �      �      � �"
+locate 17,23:print"� ��������������������Ĵ �"
+locate 18,23:print"� � Artec              � �"
+locate 19,23:print"� �                    � �"
+locate 20,23:print"� �                    � �"
+locate 21,23:print"� �                    � �"
+locate 22,23:print"� ------8<-------8<----- �"
+locate 23,23:print"������������������������ͼ"
+locate 10,23
+print"��� Koordinaten �����������������������������������ͻ"
+locate 11,23
+print"�":locate 11,75:print"�"
+locate 12,23
+print"���������������������������������������������������ͼ"
+locate 12,5
+color 15,7
+print"      OK      ";:color 8,1:print"�"
+locate 13,6:print"��������������"
+locate 15,5:color 15,7
+print"    CANCEL    ";:color 8,1:print"�"
+locate 16,6:print"��������������"
+locate 1,1:color 14,1
+print"��� Status �����������������������������ͻ"
+for a=2 to 5
+locate a,1
+print"�                                        �"
+next a
+print"����������������������������������������ͼ"
+defint a-z
+def seg=0
+mseg=256*peek(207)+peek(206)
+mouse=256*peek(205)+peek(204)+2
+if mseg or  (mouse-2) then DrvInst else DrvNInst
+
+DrvNInst:
+status$="Maus-Treiber nicht installiert"
+status=12
+gosub WriteStatus
+delay .5
+status$="Bitte installieren"
+status=15
+gosub WriteStatus
+delay .5
+status$="Programm wird unterbrochen!"
+status=11
+gosub WriteStatus
+end
+
+DrvInst:
+def seg=mseg
+if peek(mouse-2)=207 then DrvNInst
+status=11
+status$="Suche Treiber..."
+gosub WriteStatus
+m1%=0
+call absolute mouse(m1%,m2%,m3%,m4%)
+status$="Maustreiber nicht resident!":status=12:if m1=-1 then status$="Maustreiber resident. ("+right$(str$(m2%),1)+" Tasten)":status=10
+gosub WriteStatus
+status=11
+status$="Maus-Cursor einstellen..."
+gosub WriteStatus
+m1=10:m2=0:m3=3:m4=5
+call absolute mouse(m1%,m2%,m3%,m4%)
+status=11
+status$="Maus-Cursor sichtbar machen..."
+gosub WriteStatus
+m1=1
+call absolute mouse(m1%,m2%,m3%,m4%)
+REM Ja, wo is' denn unser M�uschen?
+ReadKoord:
+m1=3
+call absolute mouse(m1%,m2%,m3%,m4%)
+status=11
+status$=""
+if m2%=1 then status$="l     "
+if m2%=2 then status$="    r "
+if m2%=3 then status$="l   r "
+if m2%=4 then status$="  m   "
+if m2%=5 then status$="l m   "
+if m2%=6 then status$="  m r "
+if m2%=7 then status$="l m r "
+if status$="" then goto NoSWrite
+status$=status$+"bei x"+str$(m3)+", y"+str$(m4)+" gedr�ckt"
+if status$=oldstat$ then NoSWrite
+oldstat$=status$
+gosub WriteStatus
+NoSWrite:
+gosub PaintButt
+butt=m2:x=m3:y=m4
+gosub WriteKoord
+if y=88 and x>=32 and x<=136 and butt=1 then LoadProg
+if y=112 and x>=32 and x<=136 and butt=1 then Beenden
+goto ReadKoord
+
+WriteStatus:
+statusa$=statusb$
+statusa=statusb
+statusb$=statusc$
+statusb=statusc
+statusc$=statusd$
+statusc=statusd
+statusd$=left$(status$,38)
+if len(statusd$)<38 then for a=len(statusd$) to 38:statusd$=statusd$+" ":next a
+statusd=status
+locate 2,3
+color statusa,1
+print statusa$
+locate 3,3
+color statusb,1
+print statusb$
+locate 4,3
+color statusc,1
+print statusc$
+locate 5,3
+color statusd,1
+print statusd$
+return
+
+WriteKoord:
+locate 11,25
+color 11,1
+print"Knopf-Status: ";butt;"         X: ";m3;"        Y: ";m4
+return
+
+PaintButt:
+a=0:b=0:c=0
+if m2=1 then a=1
+if m2=2 then c=1
+if m2=3 then a=1:c=1
+if m2=4 then b=1
+if m2=5 then a=1:b=1
+if m2=6 then b=1:c=1
+if m2=7 then a=1:b=1:c=1
+ButtA1:
+if a<>1 then goto ButtA0
+locate 15,26:print"������"
+locate 16,26:print"������"
+goto ButtB1
+ButtA0:
+locate 15,26:print"      "
+locate 16,26:print"      "
+ButtB1:
+if b<>1 then goto ButtB0
+locate 15,33:print"������"
+locate 16,33:print"������"
+goto ButtC1
+ButtB0:
+locate 15,33:print"      "
+locate 16,33:print"      "
+ButtC1:
+if c<>1 then goto ButtC0
+locate 15,40:print"������"
+locate 16,40:print"������"
+return
+ButtC0:
+locate 15,40:print"      "
+locate 16,40:print"      "
+return
+
+Beenden:
+status=11
+status$="Maus-Cursor unsichtbar machen..."
+gosub WriteStatus
+m1=2
+call absolute mouse(m1%,m2%,m3%,m4%)
+status=12
+status$="Programm beendet."
+gosub WriteStatus
+end
+
+LoadProg:
+status=11
+status$="Maus-Cursor unsichtbar machen..."
+gosub WriteStatus
+m1=2
+call absolute mouse(m1%,m2%,m3%,m4%)
+status=14
+status$="Beenden und Starten von "+laun$+"..."
+gosub WriteStatus
+color 15,0,0
+cls
+execute laun$
\ No newline at end of file
diff --git a/mouse/mtlaunch.bat b/mouse/mtlaunch.bat
new file mode 100644
index 0000000..5011ed0
--- /dev/null
+++ b/mouse/mtlaunch.bat
@@ -0,0 +1,4 @@
+@ECHO OFF
+ECHO Datei aufgef�hrt!
+ECHO.
+mem |find "Gr��"
\ No newline at end of file
diff --git a/movetest.bas b/movetest.bas
new file mode 100644
index 0000000..818dbd6
--- /dev/null
+++ b/movetest.bas
@@ -0,0 +1,45 @@
+x=.028
+dim z(256)
+tim=50
+cls
+color 15
+locate 5,1:print"Programming ASCII-Codes ... ";
+let z(1)=32
+let z(2)=250
+let z(3)=249
+let z(4)=7
+let z(5)=254
+print "codes programmed"
+print "Counting values ... ";
+a=1
+1 if z(a)=0 and z(a+1)=0 then maxz=a-1:goto 2 else a=a+1:goto 1
+2 print "counted:";maxz;"values found"
+print "Playing sequence";tim;"times ... ";
+cx=csrlin
+cy=pos(0)
+atim=1
+
+Anfang:
+for y=1 to maxz
+  locate 1,1
+  print chr$(z(y))
+  delay x
+next y
+t1=atim/10
+t2=t1-int(t1)
+t3=t2*10
+t3=round(t3,0)
+tim$=str$(atim)+"th"
+if t3=3 and int(atim/10)<>1 then tim$=str$(atim)+"rd"
+if t3=2 and int(atim/10)<>1 then tim$=str$(atim)+"nd"
+if t3=1 and int(atim/10)<>1 then tim$=str$(atim)+"st"
+if atim>1 then s$="s" else s$=""
+locate cx,cy:print"seq. now played";tim$;" time";s$;"  "
+tim$=""
+if atim=tim then goto Ende else atim=atim+1:goto Anfang
+
+Ende:
+locate cx,cy
+print"sequence played";tim;"times               "
+print"Shutting Down ... ";
+print"program completely shutted down. Bye!"
\ No newline at end of file
diff --git a/n-eck.bas b/n-eck.bas
new file mode 100644
index 0000000..44b4a49
--- /dev/null
+++ b/n-eck.bas
@@ -0,0 +1,32 @@
+	pi=3.14159265358979323846
+	screen 12
+rem	window screen (0,31)-(0,39)
+	cls:color 14
+	print "     ����nECK����":color 15
+	print "          by
+	print "  RoboCop�INDUSTRIES"
+	print
+20	input"Ecken-Anzahl =",n:q=2*pi/n:if n<3 or n>12 goto 20
+	dim P(5),x(n),y(n):p(0)=N
+	input"Startl�nge   =",p(1)
+50	input"Endl�nge     =",p(2):if p(2)>=p(1) goto 50
+60	input"Drehwinkel   =",p(3):d=p(3)*pi/180:if d>q/2 goto 60
+	s=sin(d):c=cos(d):a=cos(q):b=sin(q)
+	p(4)=b/(c*b+s-a*s):x(1)=a:y(1)=B
+	print"Idealer Wert ="p(4):input"�ndern 0/1 =";r:p(5)=p(4)
+	if r=1 then input"gew�nschter  =",p(5)
+REM	--------------- Eingabe beendet ----------------------
+	cls:for i=1 to n-1:a=i*q:x(i)=cos(a):y(i)=sin(a):next i
+	x(0)=1:y(0)=0:x(n)=1:y(n)=0:r=p(1)
+REM	------------------ Rechnen ---------------------------
+150	x1=r*x(0)+160:y1=r*y(0)+130: rem Startwert
+	for i=1 to n:x2=r*x(i)+160:y2=r*y(i)+130
+	line (x1,y1)-(x2,y2),15:x1=x2:y1=y2
+	next i
+	for i=0 to n:a=x(i)*c-y(i)*s:y(i)=y(i)*c+x(i)*s:x(i)=a
+	next i: r=r*p(5):if r<p(2) goto 150: rem neues n-Eck
+REM  ----------------- Anzeigen ---------------------------
+	locate 23,1:print"Anfangsl�nge","Endl�nge","Drehwinkel","idealer Wert"
+	locate 24,1:for i=1 to 5:print p(i),:next
+	locate 25,1:input"Bitte [ENTER] dr�cken, wenn breit",FUCK$
+	screen 0,0,0:cls
\ No newline at end of file
diff --git a/oszi.bas b/oszi.bas
new file mode 100644
index 0000000..3c4ae54
--- /dev/null
+++ b/oszi.bas
@@ -0,0 +1,74 @@
+cls:screen 12
+maxh=320
+maxv=240
+dim check(640)
+FOR SbPort = &H210 to &H280 STEP &H10
+  OUT SbPort + &H6, 1
+  FOR a = 1 to 10:next
+  OUT SbPort + &H6, 0
+  FOR a = 1 to 100
+    IF INP(SbPort + &HA) = &HAA THEN GOTO SbFound
+  NEXT
+NEXT
+PRINT "kein SoundBlaster => Ende..."
+END
+
+SbFound:
+Strecke=640-maxh-(maxh/2)
+pset (strecke,240),0
+locate 1,1
+color 10:print"SoundBlaster an Adresse ";hex$(SbPort);"h gefunden."
+locate 30,1:print "+/- Breite   Bi";chr$(24);"/Bi";chr$(25);" beides   L/S Fenster speichern/laden   *// H�he";
+DO
+
+SkipText:
+  ANFx=640/2-maxh/2
+  ANFy=480/2-maxv/2
+  if maxh<>oldmaxh or maxv<>oldmaxv then gosub PaintWindow
+  oldmaxh=maxh
+  oldmaxv=maxv
+  OUT SbPort + &HC, &H20
+  DO:LOOP UNTIL INP(SbPort + &HE) AND 128
+  strecke=strecke+1
+  if strecke>maxh+ANFx then strecke=ANFx
+  value=(256-125+(inp(sbport+&HA)-125))/256*maxv
+  value=value+ANFy
+  pset (strecke,check(strecke)),0
+  pset (strecke,value),15
+  check(strecke)=value
+  a$=inkey$
+  if a$="+" then maxh=maxh+2
+  if a$="-" then maxh=maxh-2
+  if a$="*" then maxv=maxv+2
+  if a$="/" then maxv=maxv-2
+  if mid$(a$,2,1)="I" then maxh=maxh+2:maxv=maxv+2
+  if mid$(a$,2,1)="Q" then maxh=maxh-2:maxv=maxv-2
+  if a$="s" or a$="S" then gosub SaveWindow
+  if a$="l" or a$="L" then gosub LoadWindow
+LOOP UNTIL a$=chr$(27)
+Goto Ende
+
+SaveWindow:
+open "O",#1,"OSZI.WIN"
+write#1,maxh,maxv
+close #1
+return
+
+LoadWindow:
+open "I",#1,"OSZI.WIN"
+input#1,maxh,maxv
+close #1
+return
+
+PaintWindow:
+ANF2x=640/2-oldmaxh/2
+ANF2y=480/2-oldmaxv/2
+line (ANF2x-4,ANF2y-4)-(ANF2x+oldmaxh+4,ANF2y+oldmaxv+4),0,BF
+line (ANFx-1,ANFy)-(ANFx+maxh+1,ANFy+maxv+2),9,B
+return
+
+
+Ende:
+screen 0:width 80
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/oszi.win b/oszi.win
new file mode 100644
index 0000000..728f2e6
--- /dev/null
+++ b/oszi.win
@@ -0,0 +1 @@
+130,66
diff --git a/pbc.cmt b/pbc.cmt
new file mode 100644
index 0000000..a7bd331
--- /dev/null
+++ b/pbc.cmt
@@ -0,0 +1,14 @@
+
+        ����������������
+      /������������������\
+     ����������������۲����   ����   ���  ����   ���       ����  ���  ����
+     ����������������������   �   � �   �  �  � �   �     �     �   � �   �
+     �����������Ŀ���������   ����  �   �  ���� �   �     �     �   � ����
+      ����������޳���������   �  �  �   �  �  � �   �     �     �   � �
+     ������������ٰ��������   �   �  ���  ����   ���       ����  ���  �
+     ����������������������   I    N    D    U    S    T    R    I    E   S
+     ����������������������
+     ����������������������                   (C)1995 by RoboCop INDUSTRIES
+
+PowerBASIC v2.10f-File
+Converted with PowerBASIC-Compiler v2.10f
\ No newline at end of file
diff --git a/pcalc.bas b/pcalc.bas
new file mode 100644
index 0000000..4110eca
--- /dev/null
+++ b/pcalc.bas
@@ -0,0 +1,209 @@
+$COMPILE EXE
+REM Printing Calculator
+REM Selbsttest
+	color 15,0:print"���� Printing Calculator ����";:color 7,0
+	print"    was written by"
+	print"����   ���  ����   ���       ����  ���  ����"
+	print"�   � �   �  �  � �   �     �     �   � �   �"
+	print"����  �   �  ���� �   �     �     �   � ����"
+	print"�  �  �   �  �  � �   �     �     �   � �"
+	print"�   �  ���  ����   ���       ����  ���  �"
+	print"I    N    D    U    S    T    R    I    E   S"
+	print
+	print"Teste PCALC.EXE auf Viren. Dieser Test kann bis zu 30sek dauern!"
+	print
+	print"Test auf Viren l�uft...";
+	gosub CheckFile
+	goto Start  'if sum=1744 then print"OK":goto Start
+	   print"fehlgeschlagen"
+	   color 14:print
+	   print"Irgendetwas stimmt mit der Datei PCALC.EXE nicht!"
+	   print"�berpr�fen Sie folgende Sachverhalte:"
+	   print"  � Haben Sie sie nicht ver�ndert?"
+	   print"  � Haben Sie sie nicht umbenannt (Diese Datei MU� PCALC.EXE heissen)?"
+	   print"  � Haben Sie vielleicht einen Virus in Ihrem System?"
+	   print
+	   print"Wenn keiner dieser Sachverhalte zutrifft, dann fordern Sie eine"
+	   print"neue PCALC.EXE bei Ihrer Bezugsquelle an!"
+	   end
+Start:
+REM Aufbau des Tastenfeldes
+	print"Aufbau der Textgrafik..."
+	screen ,,1
+	mstat$=" "
+	tb=0
+	color 15,0
+	shell"loadfont <pcalc.fnt"
+	locate 3,40:print"��������������Ŀ"
+	locate 4,40:print"�� 88888888888.�"
+	locate 5,40:print"����������������"
+	locate 8,43:print"�����Ŀ �����Ŀ �����Ŀ"
+	locate 9,43:print"������� ������� �������"
+	locate 7,43:print"  TAB    P/ NP    OFF"
+	color 3
+	for x=11 to 20 step 3
+	locate x,60:print"���Ŀ"
+	locate x+2,60:print"�����"
+	if x>=17 then color 12
+	if x<17 then color 7
+	locate x,26:print"���Ŀ"
+	locate x+2,26:print"�����"
+	color 3
+	next x
+	locate 12,60:print"� M�"
+	locate 15,60:print"� M�"
+	locate 18,60:print"� M�"
+	locate 21,60:print"� M*�"
+	color 7
+	locate 12,26:print"� � �"
+	locate 15,26:print"� % �"
+	color 12
+	locate 18,26:print"� CE�"
+	locate 21,26:print"�ONC�"
+	color 7
+	locate 20,32:print"����Ŀ"
+	locate 21,32:print"�  0 �"
+	locate 22,32:print"������"
+	for x=11 to 17 step 3
+	locate x,33:print"���Ŀ"
+	locate x+1,33:print"�";18-x;"�"
+	locate x+2,33:print"�����"
+	locate x,38:print"���Ŀ"
+	locate x+1,38:print"�";19-x;"�"
+	locate x+2,38:print"�����"
+	locate x,43:print"���Ŀ"
+	locate x+1,43:print"�";20-x;"�"
+	locate x+2,43:print"�����"
+	next x
+	locate 20,38:print"���Ŀ"
+	locate 21,38:print"� 00�"
+	locate 22,38:print"�����"
+	locate 20,43:print"���Ŀ"
+	locate 21,43:print"� . �"
+	locate 22,43:print"�����"
+	for x=11 to 20 step 3
+	locate x,54:print"���Ŀ"
+	locate x+2,54:print"�����"
+	if x<17 then
+	  locate x,49:print"���Ŀ"
+	  locate x+2,49:print"�����"
+	end if
+	next x
+	locate 17,49:print"���Ŀ"
+	locate 18,49:print"�   �"
+	locate 19,49:print"� + �"
+	locate 20,49:print"�   �"
+	locate 21,49:print"�   �"
+	locate 22,49:print"�����"
+	locate 12,49:print"� x �"
+	locate 15,49:print"� - �"
+	locate 12,54:print"� \ �"
+	locate 15,54:print"� = �"
+	locate 18,54:print"�#/P�"
+	locate 21,54:print"� * �"
+	color 0,3:locate 24,1
+	print"[ENTER]-*   M+-M�       M--M�   MO-M�            M[ENTER]-M*    ^-�             ";
+	locate 25,1
+	print"[TAB]-TAB   C-ON/C      X-CE    #-00    P-#/P    Q-P/NP         [ESC]-OFF       ";
+	screen ,,1,1
+	color 15,0
+	locate 4,41:print"              "
+	num$="0"
+	gosub WriteN
+REM Hauptroutine
+1	a$=inkey$
+	if a$="" then 1
+	if a$="#" then a$="00"
+	if a$=chr$(13) then goto Summe
+	if a$="M" or a$="m" then goto Memory
+	if A$="^" or a$="�" then lprint:goto 1
+	if a$="q" or a$="Q" then goto SwitchPrint
+	if a$="P" or a$="p" then goto PrintDisp
+	if a$=chr$(7) then goto SwitchTAB
+	if a$="c" or a$="C" then goto ReLaunch
+	if a$="x" or A$="X" then locate 4,41:print"            ":num$="0":gosub WriteN:goto 1
+	if a$=chr$(27) then end
+	if num$="0" then num$=a$ else num$=num$+a$
+	gosub WriteN
+	goto 1
+
+
+
+end
+
+Summe:
+Memory:
+SwitchPrint:
+SwitchTAB:
+PrintDisp:
+ReLaunch:
+end
+
+
+
+WriteN:
+REM Ausw�hlen der Anzeigeart
+	if tb=0 then gosub WriteNumb
+	if tb=1 then gosub WriteNumb0
+	if tb=2 then gosub WriteNumb2
+	if tb=3 then gosub WriteNumb3
+	if tb=4 then gosub WriteNumb4
+	if tb=5 then gosub WriteNumbA
+	return
+
+WriteNumb:
+REM Anzeigen der Zahl im Display (mstat$=Status des M/-/E & num=Zahl)
+	color 15,0
+	locate 4,41:print mstat$;" ";
+	locate 4,42+(11-len(num$))
+	if val(num$)=int(val(num$)) then prt$=num$+"." else prt$=num$+" "
+	print prt$
+	return
+
+
+WriteNumb0:
+REM Anzeigen der Zahl im Display (mstat$=Status des M/-/E & num=Zahl)mit TAB0
+	color 15,0
+	locate 4,41:print mstat$;:print using" ##########. ";num
+	return
+
+WriteNumb2:
+REM Anzeigen der Zahl im Display (mstat$=Status des M/-/E & num=Zahl)mit TAB2
+	color 15,0
+	locate 4,41:print mstat$;:print using" ########.## ";num
+	return
+
+WriteNumb3:
+REM Anzeigen der Zahl im Display (mstat$=Status des M/-/E & num=Zahl)mit TAB3
+	color 15,0
+	locate 4,41:print mstat$;:print using" #######.### ";num
+	return
+
+WriteNumb4:
+REM Anzeigen der Zahl im Display (mstat$=Status des M/-/E & num=Zahl)mit TAB4
+	color 15,0
+	locate 4,41:print mstat$;:print using" ######.#### ";num
+	return
+
+WriteNumbA:
+REM Anzeigen der Zahl im Display (mstat$=Status des M/-/E & num=Zahl)mit TABAUTO
+	color 15,0
+	locate 4,41:print mstat$;:print using" ########.## ";num
+	return
+
+PrintNumb:
+REM Ausdrucken der Zahl im Display (oper$=Operator & num=Zahl
+	lprint using"##########,. ";num;:lprint oper$
+	return
+
+CheckFile:
+'	open "I",#1,"compiled\PCALC\PCALC.EXE"
+'	for z=1 to 999999
+'	  if eof(1) then exit for
+'	  line input #1,lin$
+'	  for x=1 to len(lin$)
+'	    sum=sum+asc(mid$(lin$,x,1))
+'	  next x
+'	next z
+'	close #1
+	return
\ No newline at end of file
diff --git a/pcalc.chk b/pcalc.chk
new file mode 100644
index 0000000..aa69d7a
--- /dev/null
+++ b/pcalc.chk
@@ -0,0 +1 @@
+AFFE
\ No newline at end of file
diff --git a/pcalc.fnt b/pcalc.fnt
new file mode 100644
index 0000000..4b248d6
--- /dev/null
+++ b/pcalc.fnt
@@ -0,0 +1,4354 @@
+16
+000-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+001-----
+
+
+########
+#      #
+# #  # #
+#      #
+#      #
+# #### #
+#  ##  #
+#      #
+#      #
+########
+
+
+
+
+002-----
+
+
+########
+########
+## ## ##
+########
+########
+##    ##
+###  ###
+########
+########
+########
+
+
+
+
+003-----
+
+
+
+
+ ## ##
+#######
+#######
+#######
+#######
+ #####
+  ###
+   #
+
+
+
+
+004-----
+
+
+
+
+   #
+  ###
+ #####
+#######
+ #####
+  ###
+   #
+
+
+
+
+
+005-----
+
+
+
+   ##
+  ####
+  ####
+########
+########
+########
+#  ##  #
+   ##
+  ####
+
+
+
+
+006-----
+
+
+
+   ##
+  ####
+ ######
+########
+########
+########
+   ##
+   ##
+  ####
+
+
+
+
+007-----
+
+
+
+
+
+
+  ####
+  ####
+  ####
+  ####
+
+
+
+
+
+
+008-----
+########
+########
+########
+########
+########
+########
+##    ##
+##    ##
+##    ##
+##    ##
+########
+########
+########
+########
+########
+########
+009-----
+
+
+
+
+
+ ######
+ #    #
+ #    #
+ #    #
+ #    #
+ ######
+
+
+
+
+
+010-----
+########
+########
+########
+########
+########
+#      #
+# #### #
+# #### #
+# #### #
+# #### #
+#      #
+########
+########
+########
+########
+########
+011-----
+
+
+   ####
+    ###
+   ## #
+  ##
+######
+##  ##
+##  ##
+##  ##
+##  ##
+######
+
+
+
+
+012-----
+
+
+ ######
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ######
+   ##
+ ######
+   ##
+   ##
+
+
+
+
+013-----
+
+
+  ######
+  ##  ##
+  ######
+  ##
+  ##
+  ##
+  ##
+####
+####
+####
+
+
+
+
+014-----
+
+
+ #######
+ ##   ##
+ #######
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+ ##  ###
+###  ###
+###  ###
+###
+
+
+
+015-----
+
+
+
+   ##
+   ##
+## ## ##
+  ####
+###  ###
+  ####
+## ## ##
+   ##
+   ##
+
+
+
+
+016-----
+
+#
+##
+###
+####
+#####
+######
+#####
+####
+###
+##
+#
+
+
+
+
+017-----
+
+      #
+     ##
+    ###
+   ####
+  #####
+ ######
+  #####
+   ####
+    ###
+     ##
+      #
+
+
+
+
+018-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+019-----
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+ ##  ##
+ ##  ##
+
+
+
+
+020-----
+
+
+########
+## ## ##
+## ## ##
+## ## ##
+##### ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+
+
+
+
+021-----
+
+#######
+##   ##
+ ##
+  ###
+ ## ##
+##   ##
+##   ##
+ ## ##
+  ###
+    ##
+##   ##
+#######
+
+
+
+022-----
+
+
+
+
+
+
+
+
+
+
+
+#######
+#######
+#######
+#######
+
+023-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+ ######
+
+
+
+024-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+025-----
+
+
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+026-----
+
+
+
+
+
+   ##
+   ###
+#######
+   ###
+   ##
+
+
+
+
+
+
+027-----
+
+
+
+
+
+  ##
+ ###
+#######
+ ###
+  ##
+
+
+
+
+
+
+028-----
+
+
+
+
+
+##
+##
+##
+##
+#######
+
+
+
+
+
+
+029-----
+
+
+
+
+
+  #  #
+ ##  ##
+########
+ ##  ##
+  #  #
+
+
+
+
+
+
+030-----
+
+
+
+
+   #
+  ###
+  ###
+ #####
+ #####
+#######
+#######
+
+
+
+
+
+031-----
+
+
+
+
+#######
+#######
+ #####
+ #####
+  ###
+  ###
+   #
+
+
+
+
+
+032-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+033-----
+
+
+   ##
+  ####
+  ####
+  ####
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+034-----
+
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+
+
+
+
+
+
+
+
+
+
+
+035-----
+
+
+
+ ## ##
+ ## ##
+#######
+ #####
+ #####
+ #####
+#######
+ ## ##
+ ## ##
+
+
+
+
+036-----
+   ##
+   ##
+ #####
+##   ##
+##    #
+##
+ #####
+     ##
+#    ##
+##   ##
+ #####
+   ##
+   ##
+
+
+
+037-----
+
+
+
+
+##    #
+##   ##
+    ##
+   ##
+  ##
+ ##
+##   ##
+#    ##
+
+
+
+
+038-----
+
+
+  ###
+ ## ##
+ ## ##
+  ###
+ ### ##
+## ###
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+039-----
+
+  ##
+  ##
+  ##
+ ##
+
+
+
+
+
+
+
+
+
+
+
+040-----
+
+
+    ##
+   ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+   ##
+    ##
+
+
+
+
+041-----
+
+
+  ##
+   ##
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+   ##
+  ##
+
+
+
+
+042-----
+
+
+
+   ##
+#  ##  #
+ # ## #
+  ####
+   ##
+  ####
+ # ## #
+#  ##  #
+   ##
+
+
+
+
+043-----
+
+
+
+
+
+   ##
+   ##
+########
+   ##
+   ##
+
+
+
+
+
+
+044-----
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+   ##
+  ##
+
+
+
+045-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+046-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+
+047-----
+
+
+
+
+      #
+     ##
+    ##
+   ##
+  ##
+ ##
+##
+#
+
+
+
+
+048-----
+ #####
+# ### #
+##   ##
+##   ##
+##   ##
+##   ##
+#     #
+
+#     #
+##   ##
+##   ##
+##   ##
+##   ##
+# ### #
+ #####
+
+049-----
+
+      #
+     ##
+     ##
+     ##
+     ##
+      #
+
+      #
+     ##
+     ##
+     ##
+     ##
+      #
+
+
+050-----
+ #####
+  ### #
+     ##
+     ##
+     ##
+     ##
+  ### #
+ #####
+# ###
+##
+##
+##
+##
+# ###
+ #####
+
+051-----
+ #####
+  ### #
+     ##
+     ##
+     ##
+     ##
+  ### #
+ #####
+  ### #
+     ##
+     ##
+     ##
+     ##
+  ### #
+ #####
+
+052-----
+
+#     #
+##   ##
+##   ##
+##   ##
+##   ##
+# ### #
+ #####
+  ### #
+     ##
+     ##
+     ##
+     ##
+      #
+
+
+053-----
+ #####
+# ###
+##
+##
+##
+##
+# ###
+ #####
+  ### #
+     ##
+     ##
+     ##
+     ##
+  ### #
+ #####
+
+054-----
+
+#
+##
+##
+##
+##
+# ###
+ #####
+# ### #
+##   ##
+##   ##
+##   ##
+##   ##
+# ### #
+ #####
+
+055-----
+ #####
+# ### #
+##   ##
+##   ##
+##   ##
+##   ##
+#     #
+
+      #
+     ##
+     ##
+     ##
+     ##
+      #
+
+
+056-----
+ #####
+# ### #
+##   ##
+##   ##
+##   ##
+##   ##
+# ### #
+ #####
+# ### #
+##   ##
+##   ##
+##   ##
+##   ##
+# ### #
+ #####
+
+057-----
+ #####
+# ### #
+##   ##
+##   ##
+##   ##
+##   ##
+# ### #
+ #####
+  ### #
+     ##
+     ##
+     ##
+     ##
+  ### #
+ #####
+
+058-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+
+
+
+
+
+059-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+  ##
+
+
+
+
+060-----
+
+
+
+     ##
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+     ##
+
+
+
+
+061-----
+
+
+
+
+
+
+#######
+
+
+#######
+
+
+
+
+
+
+062-----
+
+
+
+ ##
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+ ##
+
+
+
+
+063-----
+
+
+ #####
+##   ##
+##   ##
+    ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+064-----
+
+
+
+ #####
+##   ##
+##   ##
+## ####
+## ####
+## ####
+## ###
+##
+ #####
+
+
+
+
+065-----
+
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+066-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+######
+
+
+
+
+067-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+##
+##
+##    #
+ ##  ##
+  ####
+
+
+
+
+068-----
+
+
+#####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ## ##
+#####
+
+
+
+
+069-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+070-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##
+ ##
+####
+
+
+
+
+071-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+## ####
+##   ##
+##   ##
+ ##  ##
+  ### #
+
+
+
+
+072-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+073-----
+
+
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+074-----
+
+
+   ####
+    ##
+    ##
+    ##
+    ##
+    ##
+##  ##
+##  ##
+##  ##
+ ####
+
+
+
+
+075-----
+
+
+###  ##
+ ##  ##
+ ## ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+076-----
+
+
+####
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+077-----
+
+
+##    ##
+###  ###
+########
+## ## ##
+## ## ##
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+
+
+
+
+078-----
+
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+079-----
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+080-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+081-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+## # ##
+## ####
+ #####
+    ##
+    ###
+
+
+082-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+083-----
+
+
+ #####
+##   ##
+##   ##
+ ##
+  ###
+    ##
+     ##
+##   ##
+##   ##
+ #####
+
+
+
+
+084-----
+
+
+########
+## ## ##
+#  ##  #
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+085-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+086-----
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ## ##
+  ###
+   #
+
+
+
+
+087-----
+
+
+##    ##
+##    ##
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+ ##  ##
+
+
+
+
+088-----
+
+
+##   ##
+##   ##
+ ## ##
+ ## ##
+  ###
+  ###
+ ## ##
+ ## ##
+##   ##
+##   ##
+
+
+
+
+089-----
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+090-----
+
+
+########
+##    ##
+#     ##
+     ##
+    ##
+   ##
+  ##
+ ##    #
+##    ##
+########
+
+
+
+
+091-----
+
+
+  #####
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  #####
+
+
+
+
+092-----
+
+
+
+
+   
+   ##
+
+########
+
+   ##
+   
+
+
+
+
+
+093-----
+
+
+  #####
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+  #####
+
+
+
+
+094-----
+   #
+  ###
+ ## ##
+##   ##
+
+
+
+
+
+
+
+
+
+
+
+
+095-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+########
+
+
+096-----
+  ##
+  ##
+   ##
+
+
+
+
+
+
+
+
+
+
+
+
+
+097-----
+
+
+
+
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+098-----
+
+
+###
+ ##
+ ##
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+## ###
+
+
+
+
+099-----
+
+
+
+
+
+ #####
+##   ##
+##
+##
+##
+##   ##
+ #####
+
+
+
+
+100-----
+
+
+   ###
+    ##
+    ##
+  ####
+ ## ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+101-----
+
+
+
+
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+102-----
+
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+103-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+##  ##
+ ####
+
+104-----
+
+
+###
+ ##
+ ##
+ ## ##
+ ### ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+105-----
+
+
+   ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+106-----
+
+
+     ##
+     ##
+
+    ###
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+ ##  ##
+ ##  ##
+  ####
+
+107-----
+
+
+###
+ ##
+ ##
+ ##  ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+###  ##
+
+
+
+
+108-----
+
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+109-----
+
+
+
+
+
+###  ##
+########
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+
+
+
+
+110-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+111-----
+
+
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+112-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+####
+
+113-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+    ##
+   ####
+
+114-----
+
+
+
+
+
+## ###
+ ### ##
+ ##   #
+ ##
+ ##
+ ##
+####
+
+
+
+
+115-----
+
+
+
+
+
+ #####
+##   ##
+ ##
+  ###
+    ##
+##   ##
+ #####
+
+
+
+
+116-----
+
+
+   #
+  ##
+  ##
+######
+  ##
+  ##
+  ##
+  ##
+  ## ##
+   ###
+
+
+
+
+117-----
+
+
+
+
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+118-----
+
+
+
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+
+
+
+
+119-----
+
+
+
+
+
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+
+
+
+
+120-----
+
+
+
+
+
+#     #
+ #   #
+  # #
+   #
+  # #
+ #   #
+#     #
+
+
+
+
+121-----
+
+
+
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+#####
+
+122-----
+
+
+
+
+
+#######
+##  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+123-----
+
+
+    ###
+   ##
+   ##
+   ##
+ ###
+   ##
+   ##
+   ##
+   ##
+    ###
+
+
+
+
+124-----
+
+
+   ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+125-----
+
+
+ ###
+   ##
+   ##
+   ##
+    ###
+   ##
+   ##
+   ##
+   ##
+ ###
+
+
+
+
+126-----
+
+
+ ### ##
+## ###
+
+
+
+
+
+
+
+
+
+
+
+
+127-----
+
+
+
+
+   #
+  ###
+ #####
+#######
+#######
+#######
+#######
+
+
+
+
+
+128-----
+
+
+#######
+##
+##
+##
+##
+##
+##
+##
+#######
+    ##
+    ##
+ #####
+
+
+129-----
+
+
+
+##  ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+
+
+
+
+130-----
+
+    ##
+   ##
+  ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+131-----
+
+   #
+  ###
+ ## ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+132-----
+
+
+##  ##
+##  ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+133-----
+
+ ##
+  ##
+   ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+134-----
+
+  ###
+ ## ##
+  ###
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+135-----
+
+
+
+
+  ####
+ ##  ##
+ ##
+ ##
+ ##  ##
+  ####
+    ##
+     ##
+  ####
+
+
+
+136-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+137-----
+
+
+##   ##
+##   ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+138-----
+
+ ##
+  ##
+   ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+139-----
+
+
+ ##  ##
+ ##  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+140-----
+
+   ##
+  ####
+ ##  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+141-----
+
+ ##
+  ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+142-----
+
+##   ##
+##   ##
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+143-----
+  ###
+ ## ##
+  ###
+
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+144-----
+   ##
+  ##
+ ##
+
+#######
+ ##  ##
+ ##
+ #####
+ ##
+ ##
+ ##  ##
+#######
+
+
+
+
+145-----
+
+
+
+
+
+### ###
+  # # #
+  # # #
+### ###
+# # #
+# # #
+### ###
+
+
+
+
+146-----
+
+
+### ###
+# # #
+# # #
+# # #
+### ##
+# # #
+# # #
+# # #
+# # #
+# # ###
+
+
+
+
+147-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+148-----
+
+
+##   ##
+##   ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+149-----
+
+ ##
+  ##
+   ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+150-----
+
+  ##
+ ####
+##  ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+151-----
+
+ ##
+  ##
+   ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+152-----
+
+
+##   ##
+##   ##
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+ ####
+
+153-----
+
+##   ##
+##   ##
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+154-----
+
+##   ##
+##   ##
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+155-----
+
+   ##
+   ##
+ ######
+ ## #
+ ## #
+ ## #
+ ## #
+ ## #
+ ######
+    ##
+    ##
+
+
+
+
+156-----
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+###  ##
+######
+
+
+
+
+157-----
+
+
+##    ##
+ ##  ##
+  ####
+   ##
+ ######
+   ##
+ ######
+   ##
+   ##
+   ##
+
+
+
+
+158-----
+
+######
+ ##  ##
+ ##  ##
+ #####
+ ##   #
+ ##  ##
+ ## ####
+ ##  ##
+ ##  ##
+ ##  ##
+####  ##
+
+
+
+
+159-----
+
+    ###
+   ## ##
+   ##
+   ##
+   ##
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+ ###
+
+
+160-----
+
+   ##
+  ##
+ ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+161-----
+
+    ##
+   ##
+  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+162-----
+
+   ##
+  ##
+ ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+163-----
+
+   ##
+  ##
+ ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+164-----
+
+
+ ### ##
+## ###
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+165-----
+ ### ##
+## ###
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+
+
+
+
+166-----
+
+ ######
+ ##   #
+ ##   #
+ ######
+
+ ######
+
+
+
+
+
+
+
+
+
+167-----
+
+ #####
+ #   #
+ #   #
+ #####
+
+ #####
+
+
+
+
+
+
+
+
+
+168-----
+
+
+  ##
+  ##
+
+  ##
+  ##
+ ##
+##
+##   ##
+##   ##
+#######
+
+
+
+
+169-----
+
+
+
+
+
+
+#######
+##
+##
+##
+##
+
+
+
+
+
+170-----
+
+
+
+
+
+
+#######
+     ##
+     ##
+     ##
+     ##
+
+
+
+
+
+171-----
+
+##
+##
+##   ##
+##   ##
+##  ##
+   ##
+  ##
+ ##
+##  ####
+##    ##
+    ####
+    ##
+    ####
+
+
+172-----
+
+##
+##
+##    #
+##   ##
+##  ##
+   ##
+  ##
+ ##  ##
+##  ###
+#  ## #
+  ######
+     ##
+    ####
+
+
+173-----
+
+
+   ##
+   ##
+
+   ##
+  ###
+  ###
+ ####
+ ####
+#####
+#####
+
+
+
+
+174-----
+
+
+
+
+
+  ##  ##
+ ##  ##
+##  ##
+ ##  ##
+  ##  ##
+
+
+
+
+
+
+175-----
+
+
+
+
+
+##  ##
+ ##  ##
+  ##  ##
+ ##  ##
+##  ##
+
+
+
+
+
+
+176-----
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+177-----
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+178-----
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+179-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+180-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ###
+#####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+181-----
+   ##
+   ##
+   ##
+   ##
+  ###
+#####
+#####
+#####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+182-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ ######
+#######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+183-----
+
+
+
+
+
+
+
+######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+184-----
+
+
+
+
+
+####
+#####
+#####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+185-----
+  #####
+  #####
+  #####
+  #####
+ ######
+#######
+#######
+#######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+186-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+187-----
+
+
+
+
+
+######
+#######
+#######
+ ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+188-----
+  #####
+  #####
+  #####
+  #####
+ ######
+#######
+#######
+######
+
+
+
+
+
+
+
+
+189-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ ######
+######
+
+
+
+
+
+
+
+
+190-----
+   ##
+   ##
+   ##
+   ##
+  ###
+#####
+#####
+####
+
+
+
+
+
+
+
+
+191-----
+
+
+
+
+
+
+
+####
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+192-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ###
+    ####
+
+
+
+
+
+
+
+
+193-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+
+
+
+
+
+
+
+
+194-----
+
+
+
+
+
+
+
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+195-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ###
+   #####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+196-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+197-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+198-----
+   ##
+   ##
+   ##
+   ##
+   ###
+   #####
+   #####
+   #####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+199-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  ######
+  ######
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+200-----
+  #####
+  #####
+  #####
+  #####
+  ######
+  ######
+  ######
+   #####
+
+
+
+
+
+
+
+
+201-----
+
+
+
+
+
+   #####
+  ######
+  ######
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+202-----
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+########
+########
+
+
+
+
+
+
+
+
+203-----
+
+
+
+
+
+########
+########
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+204-----
+  #####
+  #####
+  #####
+  #####
+  ######
+  ######
+  ######
+  ######
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+205-----
+
+
+
+
+
+########
+########
+########
+
+
+
+
+
+
+
+
+206-----
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+########
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+207-----
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+########
+########
+
+
+
+
+
+
+
+
+208-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+
+
+
+
+
+
+
+
+209-----
+
+
+
+
+
+########
+########
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+210-----
+
+
+
+
+
+
+
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+211-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  ######
+   #####
+
+
+
+
+
+
+
+
+212-----
+   ##
+   ##
+   ##
+   ##
+   ###
+   #####
+   #####
+    ####
+
+
+
+
+
+
+
+
+213-----
+
+
+
+
+
+    ####
+   #####
+   #####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+214-----
+
+
+
+
+
+
+
+   #####
+  ######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+215-----
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+ #######
+########
+ #######
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+  #####
+216-----
+   ##
+   ##
+   ##
+   ##
+  ####
+########
+########
+########
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+217-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ###
+####
+
+
+
+
+
+
+
+
+218-----
+
+
+
+
+
+
+
+    ####
+   ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+219-----
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+220-----
+
+
+
+
+
+
+
+########
+########
+########
+########
+########
+########
+########
+########
+########
+221-----
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+222-----
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+223-----
+########
+########
+########
+########
+########
+########
+########
+
+
+
+
+
+
+
+
+
+224-----
+##    ##
+###  ###
+########
+## ## ##
+##    ##
+
+
+########
+
+
+########
+##
+########
+##
+########
+
+225-----
+##    ##
+###  ###
+########
+## ## ##
+##    ##
+
+
+
+
+
+
+
+
+
+
+
+226-----
+##    ##
+###  ###
+########
+## ## ##
+##    ##
+
+
+########
+
+
+
+
+
+
+
+
+227-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+228-----
+
+
+
+
+
+
+
+########
+
+
+########
+##
+########
+##
+########
+
+229-----
+
+
+
+
+
+
+
+
+
+
+########
+##
+########
+##
+########
+
+230-----
+
+
+
+   ##
+   ##
+########
+   ##
+   ## 
+
+########
+
+########
+
+
+
+
+231-----
+
+
+
+
+
+########
+
+ 
+
+########
+
+########
+
+
+
+
+232-----
+
+
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+ ## ##
+  ###
+   #
+
+
+
+
+
+233-----
+
+
+
+   ##
+  ####
+ ######
+########
+  ####
+  ####
+  ####
+  ####
+
+
+
+
+
+234-----
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+### ###
+
+
+
+
+235-----
+
+
+   ####
+  ##
+   ##
+    ##
+  #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+
+
+
+
+236-----
+
+
+
+
+
+ ######
+## ## ##
+## ## ##
+## ## ##
+ ######
+
+
+
+
+
+
+237-----
+
+
+
+      ##
+     ##
+ ######
+##  ####
+## ## ##
+####  ##
+ ######
+ ##
+##
+
+
+
+
+238-----
+
+
+   ###
+  ##
+ ##
+ ##
+ #####
+ ##
+ ##
+ ##
+  ##
+   ###
+
+
+
+
+239-----
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+240-----
+
+
+
+
+#######
+
+
+#######
+
+
+#######
+
+
+
+
+
+241-----
+
+
+
+
+   ##
+   ##
+########
+   ##
+   ##
+
+
+########
+
+
+
+
+242-----
+
+
+
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+
+ ######
+
+
+
+
+243-----
+
+
+
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+
+ ######
+
+
+
+
+244-----
+
+
+    ###
+   ## ##
+   ## ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+245-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+246-----
+
+
+
+
+   ##
+   ##
+
+########
+
+   ##
+   ##
+
+
+
+
+
+247-----
+
+
+
+
+
+ ### ##
+## ###
+
+ ### ##
+## ###
+
+
+
+
+
+
+248-----
+
+  ###
+ ## ##
+ ## ##
+  ###
+
+
+
+
+
+
+
+
+
+
+
+249-----
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+
+
+
+250-----
+
+
+
+
+
+
+
+
+   ##
+
+
+
+
+
+
+
+251-----
+
+    ####
+    ##
+    ##
+    ##
+    ##
+    ##
+### ##
+ ## ##
+ ## ##
+  ####
+   ###
+
+
+
+
+252-----
+
+## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+
+
+
+
+
+253-----
+
+ ###
+#  ##
+  ##
+ ##
+##  #
+#####
+
+
+
+
+
+
+
+
+
+254-----
+
+
+
+
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+
+
+
+
+
+255-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+--------
diff --git a/pfeiltst.bas b/pfeiltst.bas
new file mode 100644
index 0000000..a3953b6
--- /dev/null
+++ b/pfeiltst.bas
@@ -0,0 +1,8 @@
+cls
+b=1
+1 a$=inkey$:if a$="" then 1
+a=a+1
+locate b,a:print a$
+if a>=80 then a=0:b=b+2
+goto 1
+
\ No newline at end of file
diff --git a/pingpong.bas b/pingpong.bas
new file mode 100644
index 0000000..e8844de
--- /dev/null
+++ b/pingpong.bas
@@ -0,0 +1,86 @@
+cls:screen 12
+'open "O",#1,"KLATSCH.RAW"
+dim check(640)
+FOR SbPort = &H210 to &H280 STEP &H10
+  OUT SbPort + &H6, 1
+  FOR a = 1 to 10:next
+  OUT SbPort + &H6, 0
+  FOR a = 1 to 100
+    IF INP(SbPort + &HA) = &HAA THEN GOTO SbFound
+  NEXT
+NEXT
+PRINT "kein SoundBlaster => Ende..."
+END
+
+SbFound:
+locate 1,1
+color 10:print"SoundBlaster an Adresse ";hex$(SbPort);"h gefunden."
+color 15:print
+DO
+  OUT SbPort + &HC, &H20
+  DO:LOOP UNTIL INP(SbPort + &HE) AND 128
+  'locate 2,1:print Wert;"/";inp(sbport+&HA)
+  'gosub ShowLEV
+  if minus=0 then strecke=strecke+1
+  if minus=1 then strecke=strecke-1
+  if strecke>639 then minus=1
+  if strecke<1 then minus=0
+  value=(256-125+(inp(sbport+&HA)-125))/256*480
+  'locate 2,1:print value;
+  pset (strecke,check(strecke)),0
+  if value>190 or value<290 then col=10
+  if (value>155 and value<190) or (value >290 and value <325) then col=14
+  if value<155 or value>325 then col=12
+'  col=15        '�� y1
+  if minus=0 then ls=strecke+1 else ls=strecke-1
+  line (ls,0)-(ls,480),0		'Wer mit der MAX-Anzeige arbeitet sollte y1 auf 13 setzen
+'  pset (veryolds,veryoldv),8
+  pset (olds,oldv),7	'Diese Zeile sollte ungeREMt bleiben
+'  if maxvalue<>oldmax then locate 1,1:color 15:print "Max:";maxvalue
+'  oldmax=maxvalue		'alles mit einem 'max' in der Variablen geh�rt zur Maxerkennung
+  if strecke=1 then pset(0,240),0
+  line -(strecke,value),col	'Wer aus 'line -' ein 'pset ' macht, und alle anderen REMs entfernt, hat auch einen coolen FX
+'  maxvalue=max(Maxvalue,abs(value))
+'  veryolds=olds
+'  veryoldv=oldv
+  olds=strecke		'Wenn man die beiden oldx's REMt erh�lt man einen recht
+  oldv=value		'lustigen Effekt!!!
+  delay del
+  check(strecke)=value
+  'print#1,chr$(inp(sbport+&HA));
+  a$=inkey$
+  if a$="+" then del=del+.01
+  if a$="-" then del=del-.01:if del<0 then del=0
+  if a$="*" then del=del+.1
+  if a$="/" then del=del-.1:if del<0 then del=0
+  if a$="0" then del=0
+  if a$="1" then del=1
+LOOP UNTIL a$=chr$(27)
+Goto Ende
+
+ShowLEV:
+y=3
+Zeichen=176
+Einheit=256/80
+Wert=inp(sbport+&HA)
+Einheiten=round(Wert/Einheit,0)
+for x=1 to 80
+  locate y,x:if x<=Einheiten then
+			if x>=0 and x<=45 then color 10
+			if x>45 and x<=70 then color 14
+			if x>70 and x<=80 then color 12
+		   else
+			if x>=0 and x<=45 then color 2
+			if x>45 and x<=70 then color 6
+			if x>70 and x<=80 then color 4
+		   end if
+  print chr$(Zeichen);
+  locate y+1,x
+  print chr$(Zeichen);
+next x
+return
+
+Ende:
+screen 0:width 80
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/poincare/katze.inc b/poincare/katze.inc
new file mode 100644
index 0000000..008c2bb
--- /dev/null
+++ b/poincare/katze.inc
@@ -0,0 +1,9 @@
+circle (83,25),21,15,2.5,.65,3.4/3
+line (83,42)-(92,33),15:line -(83,37),15
+line -(73,33),15:line -(82,42),15
+circle (83,25),10,15,.5,2.65,3/3.5
+line (69,12)-(74,20),15
+line (97,12)-(92,20),15
+circle (73,27),3,15
+circle (92,27),3,15
+paint (83,25),15
\ No newline at end of file
diff --git a/poincare/plus.inc b/poincare/plus.inc
new file mode 100644
index 0000000..5848b71
--- /dev/null
+++ b/poincare/plus.inc
@@ -0,0 +1,5 @@
+line (58,0)-(108,50),15,bf
+circle (83,25),20,0
+paint (83,25),0
+line (81,11)-(85,39),15,bf
+line (69,23)-(97,27),15,bf
\ No newline at end of file
diff --git a/poincare/poincare.bas b/poincare/poincare.bas
new file mode 100644
index 0000000..883439d
--- /dev/null
+++ b/poincare/poincare.bas
@@ -0,0 +1,102 @@
+screen 12
+anfh=val(left$(time$,2))
+anfm=val(mid$(time$,4,2))
+anfs=val(right$(time$,2))
+dim x(1552)
+dim y(1552)
+a1=1:b1=1
+a2=1:b2=2
+if abs(a1*b2-a2*b1)<>1 then end
+$INCLUDE "plus.inc"
+rem locate 1,10:print "TEST"
+rem locate 2,10:print " IT "
+rem locate 3,10:print "OUT"
+goto SkipIt
+	line (58,0)-(108,50),15,bf
+
+	for x=58 to 108 step 2
+	  line (x,0)-(x,50),0
+	next x
+	for y=0 to 50 step 2
+	  line (58,y)-(108,y),0
+	next y
+
+SkipIt:
+xb=58
+for y=0 to 50
+  for x=0 to 50
+    if point (xb+x,y)=15 then x(p)=x:y(p)=y:p=p+1
+  next x
+next y
+do
+  xb=xb+58:if xb>590 then xb=0:yb=yb+58
+  if yb>425 then xb=0:yb=0:gosub Druck
+  for z=0 to p-1
+    x=(x(z)*a1+y(z)*b1)
+    y=(x(z)*a2+y(z)*b2)
+    x=(a1+b1)*50-x
+	  x(z)=x-int(x/51)*51
+	  y(z)=y-int(y/51)*51
+	 pset (xb+x(z),yb+y(z)),15
+  next z
+  gosub ShowPer
+  if inkey$=chr$(27) then end
+  v=v+1
+  line (0,0)-(50,50),15,b
+  locate 2,6-len(str$(v)):print V
+loop until v=72
+end
+
+ShowPer:
+nowh=val(left$(time$,2))
+nowm=val(mid$(time$,4,2))
+nows=val(right$(time$,2))
+unth=nowh-anfh
+untm=nowm-anfm
+unts=nows-anfs
+if unts<0 then untm=untm-1:unts=60-abs(unts)
+if untm<0 then unth=unth-1:untm=60-abs(untm)
+sekl=(unth*3600)+(untm*60)+unts
+if iper=0 then gosub InitPer
+per%=(v/71)*100
+per=(v/71)
+if per>0 then rsek=sekl/per
+if per%>=0 and per%<70 then col=10
+if per%>=70 and per%<92 then col=14
+if per%>=92 and per%<101 then col=12
+for bar=lastper%*6 to per%*6 step 2
+  line (spx+bar,spy)-(spx+bar,spy+30),col
+next bar
+lastper%=per%
+locate 23,75:print using "### %";per%;
+if int(rsek/3600)>=1 then rhour=int(rsek/3600):rsek=rsek-(rhour*3600) else rhour=0
+if int(rsek/60)>=1 then rmin=int(rsek/60):rsek=rsek-(rmin*60) else rmin=0
+if unth<10 then let unth$="0"+mid$(str$(unth),2,1) else let unth$=mid$(str$(unth),2,2)
+if untm<10 then let untm$="0"+mid$(str$(untm),2,1) else let untm$=mid$(str$(untm),2,2)
+if unts<10 then let unts$="0"+mid$(str$(unts),2,1) else let unts$=mid$(str$(unts),2,2)
+if rhour<10 then let rhour$="0"+mid$(str$(rhour),2,1) else let rhour$=mid$(str$(rhour),2,2)
+if rmin<10 then let rmin$="0"+mid$(str$(rmin),2,1) else let rmin$=mid$(str$(rmin),2,2)
+if rsek<10 then let rsek$="0"+mid$(str$(rsek),2,1) else let rsek$=mid$(str$(rsek),2,2)
+locate 24,72:print using "\\:\\:\\";unth$;untm$;unts$;
+locate 25,72:print using "\\:\\:\\";rhour$;rmin$;rsek$;
+locate 3,6-len(str$(per%)):print per%;
+return
+
+InitPer:
+iper=1
+spx=10:spy=450
+for pbar=spx to spx+600 step 6
+  line (pbar,spy-1)-(pbar,spy-5),15
+next pbar
+line (spx,spy-1)-(spx,spy-20),10
+line (spx+150,spy-1)-(spx+150,spy-10),10
+line (spx+300,spy-1)-(spx+300,spy-15),10
+line (spx+450,spy-1)-(spx+450,spy-10),14
+line (spx+600,spy-1)-(spx+600,spy-20),12
+return
+
+Druck:
+  sound 700,10
+   do:loop while not inkey$<>""
+  cls:xb=58
+return
\ No newline at end of file
diff --git a/pt_crack.bas b/pt_crack.bas
new file mode 100644
index 0000000..1b4b1cc
--- /dev/null
+++ b/pt_crack.bas
@@ -0,0 +1,77 @@
+color 14,1:cls
+mess$="M*** PowerTOOLS 3.6 Crack v1.0 ***":gosub PS
+color 15,1
+mess$="M          written by RoboCop IND.":gosub PS
+color 11,1
+print
+mess$="MP - PowerTOOLS-Pfad �ndern":gosub PS
+mess$="MA - Zeit anzeigen         ":gosub PS
+mess$="MC - Zeit �ndern           ":gosub PS
+mess$="M--------------------------":gosub PS
+mess$="MESC - ENDE":gosub PS
+print
+mess$="MBitte den gew. Buchstaben eingeben.":gosub PS
+locate csrlin,37:print "Wahl:";
+1 a$=inkey$:if a$="" then 1
+    a$=ucase$(a$)
+    if a$="P" then print a$:goto ChangePTPath
+    if a$="A" then print a$:goto ShowPTTime
+    if a$="C" then print a$:goto ChangePTTime
+    if a$=chr$(27) then print "[ESC]":sound 600,.5:goto Quit
+  sound 1000,.5
+goto 1
+
+PTPathNotRight:
+  sound 800,.5:delay .1
+  color 12:locate 19,1:mess$="M��� DER PFAD IST NICHT RICHTIG ���":gosub PS
+  color 11
+  sound 800,.5:delay .1:sound 800,.5
+  delay 2:locate 19,1:mess$="M                                  ":gosub PS
+  PTPath$=""
+  locate 11,1
+  resume ChangePTPath
+
+Back2Menu:
+  for x=12 to 24
+    locate x,1:print space$(80);
+  next x
+  color 11
+  locate 11,42:print " "
+  locate 11,42
+  goto 1
+
+ChangePTPath:
+  locate csrlin+1,1:for x=1 to 80:o$=o$+"�":next x:print o$:o$=""	'line 14
+  locate 15,1:print"Geben Sie den Pfad ein, indem sich PowerTOOLS befindet:"
+  print "Bsp.: 'C:\AOL30I\PWRTOOLS'":color 15
+  OPTPath$=PTPath$
+  input ">",PTPath$
+  for x=14 to 17:locate x,1:print space$(80);:next x:print
+  PTPath$=PTPath$+"\PWRTOOLS.LIC"
+  if PTPath$="\PWRTOOLS.LIC" then PTPath$=OPTPath$:goto Back2Menu
+  on error goto PTPathNotRight
+  open "R",#1,PTPath$
+  on error goto
+
+
+
+
+ShowPTTime:
+ChangePTTime:
+Quit:
+
+
+goto Ende
+
+
+PS:
+  mes$=right$(mess$,len(mess$)-1)
+  ind$=left$(mess$,1)
+  if ind$="M" then locate csrlin,40-len(mes$)/2
+  if ind$="L" then locate csrlin,1
+  if ind$="R" then locate csrlin,80-len(mes$)
+  print mes$;
+  locate csrlin+1,1
+return
+
+Ende:
\ No newline at end of file
diff --git a/read_key.bas b/read_key.bas
new file mode 100644
index 0000000..92fcf36
--- /dev/null
+++ b/read_key.bas
@@ -0,0 +1,74 @@
+	shell"mode co80"
+	$include "TIMECALC.INC"
+Anfang:
+	stp=25
+	dim tir(stp)
+	open "O",#1,"READ_KEY.OUT"
+	print#1,"��� Ausgabedatei von READ_KEY.OUT ���"
+	print#1,""
+	print#1,"Z    - Zeichen"
+	print#1,"CHR$ - ASCII-Code"
+	print#1,"Att  - Attribut (0-255)"
+	print#1,"Fr   - Vordergrundfarbe (errechnet)"
+	print#1,"Ba   - Hintergrundfarbe (errechnet)"
+	print#1,""
+	print#1,"Z CHR$  Att Fr Ba"
+	print#1,"- ----  --- -- --"
+	cls:randomize timer
+3	'a=int(rnd(1)*256)
+	'b=int(rnd(1)*32)
+	'c=int(rnd(1)*8)
+	durchg=durchg+1
+	a=a+1
+	if a=256 then a=0:b=b+1
+	if b=32 then b=0:c=c+1
+	if c=8 then close #1:end
+	locate 1,1:color b,c:print chr$(a)
+	oft=25
+	if durchg/oft<>int(durchg/oft) then goto 4
+	durchgmax=65536
+	per=(durchg/durchgmax)*100
+	gosub CalcPercent
+4	ke=screen(1,1)
+	attr=screen(1,1,1)
+	locate 2,1:color 15,0
+	print "ASCII-Code: ";ke;"    Zeichen: ";chr$(ke)
+	print "Attribut  : ";attr
+	print
+	back=0:front=0
+	battr=attr
+	if attr<128 then goto LowAttribute
+	if attr>127 and attr<256 then goto HighAttribute
+
+LowAttribute:
+1	if attr/16>=1 then
+	  back=back+1
+	  if back>7 then back=back-1:exit if
+	  attr=attr-16
+	  goto 1
+	end if
+	front=attr
+	goto ShowIt
+
+HighAttribute:
+	attr=attr-128
+2	if attr/16>=1 then
+	  back=back+1
+	  if back>7 then back=back-1:exit if
+	  attr=attr-16
+	  goto 2
+	end if
+	front=attr+16
+	goto ShowIt
+
+
+ShowIt:
+	if inkey$=chr$(27) then close #1:end
+	print "Vordergrundfarbe: ";front
+	print "Hintergrundfarbe: ";back
+	print using"Zeit seit Start: ##:##";mn,sc
+	print using"Vorauss Ende   : ##:##";bm,bs
+	print using"Geschafft      : ### %";per
+	print#1,using "! ####  ### ## ##";chr$(ke),ke,battr,front,back
+	goto 3
+
\ No newline at end of file
diff --git a/rom0.bas b/rom0.bas
new file mode 100644
index 0000000..ada8045
--- /dev/null
+++ b/rom0.bas
@@ -0,0 +1,28 @@
+rem Arabische Zahlen -> Roem. Zahlen
+DIM ein$(15), fuenf$(15)
+DATA I,V,X,L,C,D,M,I)),((I)),I)))
+for i=1 to 5:read ein$(i), fuenf$(i):next i
+for i=6 to 15:ein$(i)="("+ein$(i-1)+")"
+fuenf$(i)=fuenf$(i-1)+")":next i
+do: input "Dezimalzahl, Stop mit 0"; z$
+l=len(z$)
+for i=1 to l:m=l-i+1
+ziffer=val(mid$(z$,i,1))
+select case ziffer
+case 1 to 3
+for j=1 to ziffer: rom$=rom$+ein$(m):next j
+case 4
+rom$=rom$+ein$(m)+fuenf$(m)
+case 5
+rom$=rom$+fuenf$(m)
+case 6 to 8
+rom$=rom$+fuenf$(m)
+for j=6 to ziffer: rom$=rom$+ein$(m):next j
+case 9
+rom$=rom$+ein$(m)+ein$(m+1)
+end select
+next i
+print rom$
+rom$=""
+loop until val(z$)<1
+
\ No newline at end of file
diff --git a/screen/katze.ssc b/screen/katze.ssc
new file mode 100644
index 0000000..e035cec
Binary files /dev/null and b/screen/katze.ssc differ
diff --git a/screen/loadscr.bas b/screen/loadscr.bas
new file mode 100644
index 0000000..1b4eeac
--- /dev/null
+++ b/screen/loadscr.bas
@@ -0,0 +1,43 @@
+	CLS
+	input"Datei (*.SSC): ",OutFile$
+	print"Bereite Ausgabe vor.";
+	open "I",#1,OutFile$
+	print".";
+	open "B",#2,OutFile$
+	print".";
+	line input#1,Header$
+	input#1,HWide$,VWide$,ScrMo$
+	if val(ScrMo$)>=0 and val(ScrMo$)<=10 then LastLine=24 else LastLine=30
+	print".";
+	close #1
+	print".";
+	HWide=val(HWide$)
+	VWide=val(VWide$)
+	ScreenMode=val(ScrMo$)
+	print".";
+	get$ #2,19,Dummy$
+	Dummy$=""
+	print".vorbereitet"
+	delay .5
+	cls
+	screen ScreenMode
+	locate LastLine-1,1:print"HeaderInfo: ";Header$;
+	locate LastLine,1:print space$(40);
+	locate LastLine,1:print"Lese und Zeige Bild.";
+	HeadLengt=len(Header$)+4
+	Schritt=13
+	Skale=int(HWide*VWide/Schritt)
+	get$ #2,HeadLengt,Dummy$
+	for y=1 to VWide
+	  for x=1 to HWide
+	    get$ #2,1,PixCol$
+	    incr Pixel,1
+	    PixCol=ascii(PixCol$)
+	    if PixCol=-1 then PixCol=0
+	    pset(x,y),PixCol
+	    if Pixel/Skale=int(Pixel/Skale) then print".";
+	  next x
+	next y
+	print".fertig";
+1	a$=inkey$:if a$="" then 1
+
\ No newline at end of file
diff --git a/screen/logo.ssc b/screen/logo.ssc
new file mode 100644
index 0000000..fb5601d
Binary files /dev/null and b/screen/logo.ssc differ
diff --git a/screen/savescr.bas b/screen/savescr.bas
new file mode 100644
index 0000000..0f83611
--- /dev/null
+++ b/screen/savescr.bas
@@ -0,0 +1,40 @@
+	CLS
+	input"Bilddatei (*.EXE): ",Includer$
+	input"Ausgabedatei (*.SSC): ",OutFile$
+	input"Bildschirmmodus (0-12): ",ScreenMode
+	input"Capturebereich, Breite: ",HWide
+	input"Capturebereich, H�he  : ",VWide
+	screen ScreenMode
+	if ScreenMode>=0 and ScreenMode<=10 then LastLine=24 else LastLine=30
+	locate LastLine,1
+	print"Lese und Schreibe Bild.";
+	line (0,0)-(HWide,VWide),1,B
+	print".";
+	LastPos=POS(0)
+	locate 1,1
+	shell Includer$
+	locate LastLine,LastPos
+	print".";
+	open "O",#1,OutFile$
+	print".";
+	print#1,"RoboCop INDUSTRIES SaveScrFile (Horizontal/Vertical/ScrMode)"
+	print#1,chr$(34);
+	print#1,using "####";HWide;
+	print#1,chr$(34);",";chr$(34);
+	print#1,using "####";VWide;
+	print#1,chr$(34);",";chr$(34);
+	print#1,using "##";ScreenMode;
+	print#1,chr$(34);chr$(26)
+	print ".";
+	LastPoint=POS(0)
+	for y=1 to VWide
+	  for x=1 to HWide
+	    PixData=POINT(x,y)
+	    if PixData=-1 then PixData=0
+	    print#1,chr$(PixData);
+	  next x
+	next y
+	locate LastLine,LastPoint
+	print".";
+	close #1
+	print".fertig";
\ No newline at end of file
diff --git a/screen/test.ssc b/screen/test.ssc
new file mode 100644
index 0000000..aa046f3
Binary files /dev/null and b/screen/test.ssc differ
diff --git a/serial.num b/serial.num
new file mode 100644
index 0000000..febef3e
--- /dev/null
+++ b/serial.num
@@ -0,0 +1,2 @@
+�����������
+RoboCop IND.
diff --git a/specsymb.txt b/specsymb.txt
new file mode 100644
index 0000000..1b061f1
--- /dev/null
+++ b/specsymb.txt
@@ -0,0 +1,3 @@
+� - Copyright Zeichen
+� - Registered Trade Mark Zeichen
+� - TradeMark Zeichen (nicht SYSTEM)
\ No newline at end of file
diff --git a/termin/termin.bas b/termin/termin.bas
new file mode 100644
index 0000000..cfa9f4b
--- /dev/null
+++ b/termin/termin.bas
@@ -0,0 +1,267 @@
+	ver$="2.10"
+	IniFile$=environ$("TEMP")
+	IniFile$=IniFile$+"\TERMIN.INI"
+	if command$="/?" then goto Help
+	dim zeile$(500)
+	dim choice$(50)
+	open "I",#1,"TERMIN.LST"
+	now$=mid$(date$,4,2)+"."+left$(date$,2)+"."+right$(date$,2)
+	Day=val(mid$(date$,4,2))
+	Month=val(left$(date$,2))
+	Year=val(right$(date$,2))
+	for Addi=1 to 5
+	  NDay=Day+Addi
+	  NMonth=Month
+
+	  if Day+Addi>28 and Month=2 and int(Year/4)<>Year/4 then
+	    NMonth=Month+1
+	    if Feb28=0 and F28=0 then Feb28=Addi-1:F28=1
+	    NDay=Addi-Feb28
+	  end if
+
+	  if Day+Addi>29 and Month=2 and int(Year/4)=Year/4 then
+	    NMonth=Month+1
+	    if Feb29=0 and F29=0 then Feb29=Addi-1:F29=1
+	    NDay=Addi-Feb29
+	  end if
+
+	  if Day+Addi>30 and (Month=4 or Month=6 or Month=9 or Month=11) then
+	    NMonth=Month+1
+	    if Month30=0 and M30=0 then Month30=Addi-1:M30=1
+	    NDay=Addi-Month30
+	  end if
+
+	  if Day+Addi>31 and (Month=1 or Month=3 or Month=5 or Month=7 or Month=8 or Month=10 or Month=12) then
+	    NMonth=Month+1
+	    if Month31=0 and M31=0 then Month31=Addi-1:M31=1
+	    if NMonth=13 then NMonth=1:NYear=Year+1:NDay=Addi-Month31 else NDay=Addi-Month31
+	  end if
+
+	  if NYear=0 then NYear=Year
+	  NDay$=str$(1000+NDay)
+	  NMonth$=str$(1000+NMonth)
+	  NYear$=Str$(1000+NYear)
+
+	  Now$(Addi)=using$("\\",right$(NDay$,2))+"."
+	  Now$(Addi)=Now$(Addi)+using$("\\",right$(NMonth$,2))+"."
+	  Now$(Addi)=Now$(Addi)+using$("\\",right$(NYear$,2))
+	next Addi
+
+
+	color 15,0,0:print"��� TERMIN v";ver$;" ��� by RC                                       Datum: ";now$;
+	color 8,0,0:print "TERMIN /? f�r Hilfe":color 14,0,0
+	x=1
+2	line input#1,zeile$(x)
+	if eof(1) then maxb=x:close #1:goto 1 else x=x+1:goto 2
+	MESS$="Termin(e) heute:"
+1	for x=1 to maxb
+	  if left$(zeile$(x),1)="'" then goto 999
+	  bdate$=left$(zeile$(x),6)
+	  bdate2$=left$(zeile$(x),8)
+	  bname$=mid$(zeile$(x),8,60)
+	  bname2$=mid$(zeile$(x),10,60)
+	  if bdate2$=now$ then gosub PrintItOut2
+	  if bdate$=left$(now$,6) and Date2=0 then gosub PrintItOut1
+	  Date2=0
+999	next x
+	if FoundIt=0 then color 7,,9:print"Kein(e) heutigen Termin(e) gefunden."
+	if inkey$="a" or inkey$="A" then goto AddIt
+	if inkey$="c" or inkey$="C" then goto ClearIt
+	if FoundIt=1 then FoundSomething=1
+	goto CommonSearch
+
+PrintItOut1:
+	color ,,15:num=num+1
+	if PrintedNow=0 then
+	  color 14
+	  print MESS$
+	  PrintedNow=1
+	end if
+	if CS=0 then BDC=15
+	if CS=2 or CS=3 or CS=4 then BDC=14
+	if CS=1 then BDC=12
+	if CS=5 then BDC=10
+	color 15:print num;
+	color BDC:if BDC=15 then print "�"; else print " ";
+	print bdate$;
+	color 10:print "   ";bname$;
+	color 15
+	if BDC=15 then print " �" else print
+	FoundIt=1
+	color ,,0
+	return
+
+PrintItOut2:
+	color ,,15:Date2=1:num=num+1
+	if PrintedNow=0 then
+	  color 15
+	  print MESS$
+	  PrintedNow=1
+	end if
+	IF CS=0 or CS=2 or CS=3 or CS=4 then BDC=14
+	if CS=1 then BDC=12
+	if CS=5 then BDC=10
+	color 15:print num;
+	color BDC:if BDC=15 then print "�"; else print " ";
+	print bdate2$;
+	color 10:print " ";bname2$;
+	color 15
+	if BDC=15 then print " �" else print
+	FoundIt=1
+	color ,,0
+	return
+
+SomethingFound:
+	print
+	color 15
+	print "    ������BEST�TIGUNG������"
+3	for x=1 to 50
+	  wt=5
+	  if x>0 and x<=wt then color ,,0
+	  if (x>wt and x<=2*wt) or (x>9*wt and x<=10*wt) then color ,,1
+	  if (x>2*wt and x<=3*wt) or (x>8*wt and x<=9*wt) then color ,,9
+	  if (x>3*wt and x<=4*wt) or (x>7*wt and x<=8*wt) then color ,,3
+	  if (x>4*wt and x<=5*wt) or (x>6*wt and x<=7*wt) then color ,,7
+	  if x>5*wt and x<=6*wt then color ,,11
+	  a$=inkey$
+	  if a$="a" or a$="A" then Add=1:exit for
+	  if a$="c" or a$="C" then Clr=1:exit for
+	  if a$<>"" then Response=1:exit for
+	next x
+	if Add=1 then goto AddIt
+	if Clr=1 then goto ClearIt
+	if Response=1 then return
+	goto 3
+
+AddIt:
+	color 15,0,0:print:print:print "Termin hinzuf�gen"
+	print
+	input"Datum (TT.MM.[JJ])                  : ",dat$
+	input"Terminbeschreibung (max. 60 Zeichen): ",termin$
+	open "A",#1,"TERMIN.LST"
+	OutIt$=dat$+" "+termin$
+	print#1,OutIt$
+	close #1
+	print
+	color 10:print"Noch einen Termin addieren (J/N)?":print
+5	a$=inkey$:if a$="" then 5
+	if a$="j" or a$="J" then goto AddIt else goto Ende
+
+ClearIt:
+	color 15,0,0:print:print:print "Termin l�schen"
+	print
+	input"Datum (TT.MM.) : ",dat$
+	print"Suche ...";
+	open "I",#1,"TERMIN.LST"
+	x=1
+6    if eof(1) then close #1:print "OK":goto 7
+	line input#1,zeile$
+	if left$(zeile$,len(dat$))=dat$ then choice$(x)=zeile$:x=x+1:goto 6 else goto 6
+7	maxx=x-1
+	print" fertig"
+	color 10:print:print"M�glichkeit(en):":color 15
+	for x=1 to maxx
+	  print x;"  ";choice$(x)
+	next x
+	print
+	color 12
+	IpString$="Zahl von 0 bis "+mid$(str$(maxx),2,40)+" eingeben und [ENTER] dr�cken"
+8	print IpString$;:input ": ",choice
+	if choice<0 or choice >maxx then print "Falsche Eingabe!":goto 8
+	if choice=0 then color 10:print"Update abgebrochen.":goto 13
+	color 10:print"Update l�uft ...";
+	open "I",#1,"TERMIN.LST"
+	open "O",#2,"TERMIN.$$$"
+9	line input#1,zeile$
+	if zeile$<>choice$(choice) then print#2,zeile$
+	if eof(1) then goto 10 else goto 9
+10	close #1:close #2:kill "termin.lst"
+	name "Termin.$$$" as "termin.lst"
+	color 15:print" komplett"
+13	print
+	color 10:print"Noch einen Termin l�schen (J/N)?":print
+11	a$=inkey$:if a$="" then 11
+	if a$="j" or a$="J" then goto ClearIt else goto Ende
+
+Help:
+	cls
+	now$=mid$(date$,4,2)+"."+left$(date$,2)+"."+right$(date$,2)
+	color 15,0,0:print"��� TERMIN v";ver$;" ��� by RC                                       Datum: ";now$;
+	color 8,0,0:print "TERMIN /? f�r diesen Hilfebildschirm":color 7,0,0
+	print"TERMIN Version ";ver$;" ist f�r den Einsatz in der AUTOEXEC.BAT gedacht. Es
+	print"speichert Termine ab und zeigt sie beim Starten des Rechners an. Und:"
+	color 12+16
+	print"* NEU *** NEU *** NEU *** NEU *** NEU *** NEU *** NEU *** NEU *** NEU *** NEU *"
+	color 7
+	print"Es zeigt seit der Version 2.00 die Termine der n�chsten 5 Tage an und gibt eine"
+	print"Tonfolge aus. Je mehr der Ton piept desto kurzfristiger ist der Termin. Wenn"
+	print"ein Termin auf den n�chsten Tag f�llt wird auch um Best�tigung gebeten! Das"
+	print"sch�nste aber ist, es belegt keinen Speicher. Und seit der Version 2.10 nervt"
+	print"Sie TERMIN nur noch jedes 5te mal. Aber jetzt kommen wir zu den hei�en Tasten"
+	print"(Hotkeys). Sie sind gleich nach dem Start oder bei der 'Bitte eine Taste dr�k-"
+	print"ken'-Meldung zu dr�cken:"
+	color 14
+	print"(A)dd     - Addiert einen Termin"
+	print"(C)lear   - L�scht einen Termin"
+	print"[SPACE]   - Best�tigung, bei Meldung"
+	color 7
+	print"Datumsangaben sind in der Form TT.MM.JJ zu machen, z.B.:"
+	print"31.12.88 - Der 31. Dezember 1988, oder"
+	print"31.12.   - Der 31. Dezember (wird jedes Jahr angezeigt)"
+	color 9
+	print"Wenn Sie manuell in der TERMIN.LST herumwerkeln, k�nnen Sie Kommentare mit"
+	print"einem Appostroph (') einleiten. Dadurch wird die Suche etwas beschleunigt."
+	print:color 7
+	print"So und nun zur�ck zu Ihrem OS ..."
+	goto Ende
+
+CommonSearch:
+FoundIt=0
+MESS$="Termin(e) in den n�chsten 5 Tagen:"
+12 for CS=1 to 5
+	for x=1 to maxb
+	  if left$(zeile$(x),1)="'" then goto 998
+	  bdate$=left$(zeile$(x),6)
+	  bdate2$=left$(zeile$(x),8)
+	  bname$=mid$(zeile$(x),8,60)
+	  bname2$=mid$(zeile$(x),10,60)
+	  if bdate2$=now$(CS) then gosub PrintItOut2:for g=1 to 6-CS:sound 1000,.5:delay 1/18.2:next g
+	  if bdate$=left$(now$(CS),6) and Date2=0 then gosub PrintItOut1:for g=1 to 6-CS:sound 1000,.5:delay 1/18.2:next g
+	  Date2=0
+	  if CS=1 and FoundIt=1 then FoundSomething=1
+998	next x
+    next CS
+	if FoundIt=0 then color 7,,9:print"Kein(e) Termin(e) in den n�chsten 5 Tagen gefunden."
+	if inkey$="a" or inkey$="A" then goto AddIt
+	if inkey$="c" or inkey$="C" then goto ClearIt
+	on error goto IniNotExist
+ResumeHere:
+	open "I",#5,IniFile$
+	input #5,OlDate$,Counter
+	close #5
+	on error goto
+	if Counter/5=int(Counter/5) then Counter=0
+	if OlDate$<>Date$ and len(OlDate$)>5 then Counter=0
+	if Counter=0 then
+	  if FoundSomething=1 then gosub SomethingFound
+	  Counter=Counter+1
+	  open "O",#5,IniFile$
+	  write#5,Date$,Counter
+	  close #5
+	else
+	  Counter=Counter+1
+	  open "O",#5,IniFile$
+	  write#5,Date$,Counter
+	  close #5
+	end if
+	goto Ende
+
+IniNotExist:
+	open "O",#7,IniFile$
+	write#7,Date$,0
+	close #7
+	resume ResumeHere
+
+Ende:
+	print:color ,0,0
+	end
\ No newline at end of file
diff --git a/termin/termin.his b/termin/termin.his
new file mode 100644
index 0000000..91fcbdd
--- /dev/null
+++ b/termin/termin.his
@@ -0,0 +1,6 @@
+TERMIN.EXE by RoboCop INDUSTRIES
+
+v1.2  - Grundversion, alarmierte nur heutige Termine
+v2.00 - 5Tage voraus eingebaut
+v2.05 - piepst�ne
+v2.10 - Nur noch jedes 5. Mal um Best�tigung
diff --git a/termin/termin.lst b/termin/termin.lst
new file mode 100644
index 0000000..ca93721
--- /dev/null
+++ b/termin/termin.lst
@@ -0,0 +1,38 @@
+' TERMIN.EXE - by RoboCop INDUSTRIES
+' Bitte immer am Ende ein RETURN lassen
+
+' ==== JANUAR ====
+
+' ==== FEBRUAR ===
+03.02. Jane Doe (1967)
+07.02. Alfons R�seler (1981)
+
+' ===== M�RZ =====
+01.03. Maria Musterfrau (1927)
+08.03. Frauentag
+
+' ===== APRIL ====
+
+' ====== MAI =====
+
+' ===== JUNI =====
+01.06. Tag des Kindes
+
+' ===== JULI =====
+
+' ==== AUGUST ====
+
+' == SEPTEMBER ===
+
+' === OKTOBER ====
+
+' === NOVEMBER ===
+11.11. Karneval
+
+' === DEZEMBER ===
+24.12. Weihnachten
+25.12. 1. Weihnachtsfeiertag
+26.12. 2. Weihnachtsfeiertag
+31.12. Silvester
+
+' == USER-EINTR�GE ==
diff --git a/termstst.bas b/termstst.bas
new file mode 100644
index 0000000..a70b1c8
--- /dev/null
+++ b/termstst.bas
@@ -0,0 +1,6 @@
+$LINK "TERMSND.PBU"
+$SOUND 800
+declare SUB TerminatorTheme()
+print"Playing Theme from Terminator ... ";
+CALL TerminatorTheme
+print"OKay"
\ No newline at end of file
diff --git a/tetris/tetris.bas b/tetris/tetris.bas
new file mode 100644
index 0000000..5fe8838
--- /dev/null
+++ b/tetris/tetris.bas
@@ -0,0 +1,347 @@
+	CLS
+	color 15
+	print"��� MiniTETRIS ��� by RoboCop INDUSTRIES"
+	color 7
+	print
+	print"Setze Dimensionen ... ";
+	dim lin$(12)
+	dim Choose1$(8,12)
+	dim Choose2$(8,12)
+	print"gesetzt"
+	print"Lade Highscores ... ";
+	open "B",#1,"HIGHSCOR.E"
+	get$ #1,29,Dummy$
+	get$ #1,1,CHS1$
+	get$ #1,9,Dummy$
+	get$ #1,1,CHS2$
+	get$ #1,19,Dummy$
+	get$ #1,1,CHS3$
+	get$ #1,4,Dummy$
+	get$ #1,2,ML$
+	CodedHS$=CHS1$+CHS2$+CHS3$
+	ML1$=left$(ML$,1)
+	ML2$=right$(ML$,1)
+	ml1=ascii(ml1$)
+	ml2=ascii(ml2$)
+	if ml1=-1 then ml1=0
+	if ml2=-1 then ml2=0
+	MaxLines=ml1+(ml2*256)
+	byte1=ascii(left$(CodedHS$,1))
+	byte2=ascii(mid$(CodedHS$,2,1))
+	byte3=ascii(right$(CodedHS$,1))
+	if byte1=-1 then byte1=0
+	if byte2=-1 then byte2=0
+	if byte3=-1 then byte3=0
+	HS=byte3+(byte2*256)+(byte1*65536)
+	print"geladen"
+	print"Speichere aktuellen Font ... ";
+	shell"SAVEFONT >ORIGINAL.FNT"
+	print"gespeichert"
+	print"Lade Font ... ";
+	shell"LOADFONT <TETRIS.FNT"
+	print"geladen"
+	print"Setze Zeichenabstand ... ";
+	shell"CHRWIDTH 8"
+	print"gesetzt"
+	delay .5
+	cls
+	color 15
+	Rahmen=0
+	HG=1
+	Spielfeld=7
+	Zeichen=0
+	Knopf=4
+	frei=25
+	color ,HG
+	cls
+	print
+	print
+	print space$(frei);:color Rahmen,HG:?" ���������������������������� "
+	print space$(frei);:color Rahmen,Spielfeld:?"������������������������������";:color Rahmen,HG:?"    ";chr$(27);" - Links"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  LDNFSSCGHF NFXJ #$";:color Rahmen,HG:?"�����    ";chr$(26);" - Mechts"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?" 8I8I8I8I8I  YVVV   ";:color Rahmen,HG:?"�����    ";chr$(24);" - Motieren / Start"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����    ";chr$(25);" - Munter / Select"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����    � - �ause"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����    S - Ber�usche"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����    M - Meset"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����{FSC} - Fnde"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);"�����";:color Zeichen,Spielfeld:?"  [][][][][][][][]  ";:color Rahmen,HG:?"�����"
+	print space$(frei);:color Rahmen,Spielfeld:?"������������������������������":color Rahmen,HG
+	print space$(frei);:color Rahmen,Knopf:?"���  ������  �����������   ���":color Rahmen,HG
+	print space$(frei);:color Rahmen,Knopf:?"���  ������  ����������     ��":color Rahmen,HG
+	print space$(frei);:color Rahmen,Knopf:?"�������  ���������������������":color Rahmen,HG
+	print space$(frei);:color Rahmen,Knopf:?"�������  ���������������������":color Rahmen,HG
+	print space$(frei);"������������������������������":color Rahmen,HG
+	snd=0
+	pause=1
+	Chosen=1
+	gosub UpDate1st
+
+	delay .1
+	scores=HS
+	gosub WriteScores
+	delay .1
+	lines=MaxLines
+	gosub WriteLines
+	delay .1
+	for x=1 to 12
+	  lin$(x)="00000000"
+	next x
+	gosub WritePlayField
+	delay .1
+	nex$="0000"
+	gosub WriteNext
+	delay .1
+	pause=0
+	gosub UpDate1st
+	delay .1
+	Choose1$(1,01)="# # # # "
+	Choose1$(1,02)="       #"
+	Choose1$(1,03)="#       "
+	Choose1$(1,04)="    #  #"
+	Choose1$(1,05)="#  ##   "
+	Choose1$(1,06)="    #  #"
+	Choose1$(1,07)="#   #   "
+	Choose1$(1,08)="    #  #"
+	Choose1$(1,09)="#   #   "
+	Choose1$(1,10)="   ### #"
+	Choose1$(1,11)="#       "
+	Choose1$(1,12)=" # # # #"
+	Choose1$(2,01)="# # # # "
+	Choose1$(2,02)="       #"
+	Choose1$(2,03)="#       "
+	Choose1$(2,04)="   ##  #"
+	Choose1$(2,05)="# #  #  "
+	Choose1$(2,06)="     # #"
+	Choose1$(2,07)="#   #   "
+	Choose1$(2,08)="   #   #"
+	Choose1$(2,09)="# #     "
+	Choose1$(2,10)="  #### #"
+	Choose1$(2,11)="#       "
+	Choose1$(2,12)=" # # # #"
+	Choose1$(3,01)="# # # # "
+	Choose1$(3,02)="       #"
+	Choose1$(3,03)="#       "
+	Choose1$(3,04)="  ###  #"
+	Choose1$(3,05)="#    #  "
+	Choose1$(3,06)="     # #"
+	Choose1$(3,07)="# ###   "
+	Choose1$(3,08)="     # #"
+	Choose1$(3,09)="#    #  "
+	Choose1$(3,10)="  ###  #"
+	Choose1$(3,11)="#       "
+	Choose1$(3,12)=" # # # #"
+	Choose1$(4,01)="# # # # "
+	Choose1$(4,02)="       #"
+	Choose1$(4,03)="#       "
+	Choose1$(4,04)="  #    #"
+	Choose1$(4,05)="# #  #  "
+	Choose1$(4,06)="  #  # #"
+	Choose1$(4,07)="# ####  "
+	Choose1$(4,08)="     # #"
+	Choose1$(4,09)="#    #  "
+	Choose1$(4,10)="     # #"
+	Choose1$(4,11)="#       "
+	Choose1$(4,12)=" # # # #"
+
+	Choose2$(1,01)=" # # # #"
+	Choose2$(1,02)="#       "
+	Choose2$(1,03)="       #"
+	Choose2$(1,04)="#   #   "
+	Choose2$(1,05)="   ##  #"
+	Choose2$(1,06)="#   #   "
+	Choose2$(1,07)="    #  #"
+	Choose2$(1,08)="#   #   "
+	Choose2$(1,09)="    #  #"
+	Choose2$(1,10)="#  ###  "
+	Choose2$(1,11)="       #"
+	Choose2$(1,12)="# # # # "
+	Choose2$(2,01)=" # # # #"
+	Choose2$(2,02)="#       "
+	Choose2$(2,03)="       #"
+	Choose2$(2,04)="#  ##   "
+	Choose2$(2,05)="  #  # #"
+	Choose2$(2,06)="#    #  "
+	Choose2$(2,07)="    #  #"
+	Choose2$(2,08)="#  #    "
+	Choose2$(2,09)="  #    #"
+	Choose2$(2,10)="# ####  "
+	Choose2$(2,11)="       #"
+	Choose2$(2,12)="# # # # "
+	Choose2$(3,01)=" # # # #"
+	Choose2$(3,02)="#       "
+	Choose2$(3,03)="       #"
+	Choose2$(3,04)="# ###   "
+	Choose2$(3,05)="     # #"
+	Choose2$(3,06)="#    #  "
+	Choose2$(3,07)="  ###  #"
+	Choose2$(3,08)="#    #  "
+	Choose2$(3,09)="     # #"
+	Choose2$(3,10)="# ###   "
+	Choose2$(3,11)="       #"
+	Choose2$(3,12)="# # # # "
+	Choose2$(4,01)=" # # # #"
+	Choose2$(4,02)="#       "
+	Choose2$(4,03)="       #"
+	Choose2$(4,04)="# #     "
+	Choose2$(4,05)="  #  # #"
+	Choose2$(4,06)="# #  #  "
+	Choose2$(4,07)="  #### #"
+	Choose2$(4,08)="#    #  "
+	Choose2$(4,09)="     # #"
+	Choose2$(4,10)="#    #  "
+	Choose2$(4,11)="       #"
+	Choose2$(4,12)="# # # # "
+
+10   ShowScores=ShowScores+2
+	for x=1 to 12
+	  lin$(x)=Choose1$(Chosen,x)
+	next x
+	gosub WritePlayField
+	if ShowScores=6 then gosub WriteScores
+	if ShowScores=12 then ShowScores=0:gosub WriteLines
+	delay .15
+	for x=1 to 12
+	  lin$(x)=Choose2$(Chosen,x)
+	next x
+	gosub WritePlayField
+	delay .15
+	a$=inkey$
+	if mid$(a$,2,1)="P" then Chosen=Chosen+1:if Chosen=9 then Chosen=1:goto 10
+	if mid$(a$,2,1)="H" then goto GameSelected
+	if (a$="s" or a$="S") and snd=1 then snd=0:gosub UpDate1st:goto 10
+	if (a$="s" or a$="S") and snd=0 then snd=1:gosub UpDate1st:goto 10
+	if a$=chr$(27) then goto Ende
+	goto 10
+
+
+
+
+
+
+
+1	a$=inkey$:if a$="" then 1
+	goto Ende
+
+
+WritePlayField:
+	for y=1 to 12
+	  for x=1 to 8
+	    x$=mid$(lin$(y),x,1)
+	    if x$="#" then WL$=WL$+"[]" else wl$=wl$+"  "
+	  next x
+	  locate 5+y,frei+8
+	  print using "\               \";WL$
+	  wl$=""
+	next y
+	return
+
+WriteNext:
+	for x=1 to 5
+	  x$=mid$(nex$,x,1)
+	  if x$="0" then NXT$=NXT$+" "
+	  if x$="1" then NXT$=NXT$+"A"
+	  if x$="2" then NXT$=NXT$+"Y"
+	  if x$="3" then NXT$=NXT$+"V"
+	  if x$="#" then col=Zeichen+16
+	  if x$="" then col=Zeichen
+	next x
+	locate 5,frei+19
+	color col,Spielfeld
+	print nxt$
+	color Zeichen,Spielfeld
+	nxt$=""
+	return
+
+UpDate1st:
+	color Zeichen,Spielfeld
+	locate 4,frei+24
+	if pause=0 then print"  "
+	if pause=1 then print"#$"
+	locate 4,frei+6
+	if snd=0 then print" "
+	if snd=1 then print chr$(14):gosub MODESound
+	return
+
+MODESound:
+	sound 1100,1
+	sound 990,1
+	sound 810,1
+	sound 510,1
+	return
+
+WriteScores:
+	locate 4,frei+8
+	color Zeichen,Spielfeld
+	print"     SCGHF NFXJ"
+	locate 5,frei+7
+	sco$=using$("#####",scores)
+	for x=1 to len(sco$)
+	  x$=mid$(sco$,x,1)
+	  if x$=" " then scores$=scores$+"�"
+	  if x$="0" then scores$=scores$+"0P"
+	  if x$="1" then scores$=scores$+"1Q"
+	  if x$="2" then scores$=scores$+"2W"
+	  if x$="3" then scores$=scores$+"3E"
+	  if x$="4" then scores$=scores$+"4R"
+	  if x$="5" then scores$=scores$+"5T"
+	  if x$="6" then scores$=scores$+"6Z"
+	  if x$="7" then scores$=scores$+"7U"
+	  if x$="8" then scores$=scores$+"8I"
+	  if x$="9" then scores$=scores$+"9O"
+	next x
+	if scores=0 then scores$="���0P0P"
+	print scores$
+	sco$=""
+	scores$=""
+	return
+
+WriteLines:
+	locate 4,frei+8
+	color Zeichen,Spielfeld
+	print"LDNFS          "
+	locate 5,frei+7
+	lin$=using$("###  ",lines)
+	for x=1 to len(lin$)
+	  x$=mid$(lin$,x,1)
+	  if x$=" " then lines$=lines$+"�"
+	  if x$="0" then lines$=lines$+"0P"
+	  if x$="1" then lines$=lines$+"1Q"
+	  if x$="2" then lines$=lines$+"2W"
+	  if x$="3" then lines$=lines$+"3E"
+	  if x$="4" then lines$=lines$+"4R"
+	  if x$="5" then lines$=lines$+"5T"
+	  if x$="6" then lines$=lines$+"6Z"
+	  if x$="7" then lines$=lines$+"7U"
+	  if x$="8" then lines$=lines$+"8I"
+	  if x$="9" then lines$=lines$+"9O"
+	next x
+	print lines$
+	lin$=""
+	lines$=""
+	return
+
+GameSelected:
+
+Ende:
+	color 15,0
+	cls
+	print"��� MiniTETRIS ��� by RoboCop INDUSTRIES"
+	print
+	color 7,0
+	print"Speichere aktuellen Font ... gespeichert"
+	print"Lade Font ... geladen"
+	print"Setze Zeichenabstand ... gesetzt"
+	print"Stelle Font wieder her ... ";
+	SHELL "LOADFONT <ORIGINAL.FNT"
+	print"hergestellt"
+	print"Stelle Zeichenabstand wieder her ... ";
+	SHELL "CHRWIDTH 7"
+	print"hergestellt"
+	print
\ No newline at end of file
diff --git a/tetris/tetris.exe b/tetris/tetris.exe
new file mode 100644
index 0000000..d137237
Binary files /dev/null and b/tetris/tetris.exe differ
diff --git a/tetris/tetris.fnt b/tetris/tetris.fnt
new file mode 100644
index 0000000..fe71aa1
--- /dev/null
+++ b/tetris/tetris.fnt
@@ -0,0 +1,4354 @@
+16
+000-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+001-----
+
+
+ ######
+#      #
+# #  # #
+#      #
+#      #
+# #### #
+#  ##  #
+#      #
+#      #
+ ######
+
+
+
+
+002-----
+
+
+ ######
+########
+## ## ##
+########
+########
+##    ##
+###  ###
+########
+########
+ ######
+
+
+
+
+003-----
+
+
+
+
+ ## ##
+#######
+#######
+#######
+#######
+ #####
+  ###
+   #
+
+
+
+
+004-----
+
+
+
+
+   #
+  ###
+ #####
+#######
+ #####
+  ###
+   #
+
+
+
+
+
+005-----
+
+
+
+   ##
+  ####
+  ####
+###  ###
+###  ###
+###  ###
+   ##
+   ##
+  ####
+
+
+
+
+006-----
+
+
+
+   ##
+  ####
+ ######
+########
+########
+ ######
+   ##
+   ##
+  ####
+
+
+
+
+007-----
+
+
+
+
+
+
+   ##
+  ####
+  ####
+   ##
+
+
+
+
+
+
+008-----
+########
+########
+########
+########
+########
+########
+###  ###
+##    ##
+##    ##
+###  ###
+########
+########
+########
+########
+########
+########
+009-----
+
+
+
+
+
+  ####
+ ##  ##
+ #    #
+ #    #
+ ##  ##
+  ####
+
+
+
+
+
+010-----
+########
+########
+########
+########
+########
+##    ##
+#  ##  #
+# #### #
+# #### #
+#  ##  #
+##    ##
+########
+########
+########
+########
+########
+011-----
+
+
+   ####
+    ###
+   ## #
+  ##  #
+ ####
+##  ##
+##  ##
+##  ##
+##  ##
+ ####
+
+
+
+
+012-----
+
+
+  ####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+ ######
+   ##
+   ##
+
+
+
+
+013-----
+
+
+  ######
+  ##  ##
+  ######
+  ##
+  ##
+  ##
+  ##
+ ###
+####
+###
+
+
+
+
+014-----
+
+
+ #######
+ ##   ##
+ #######
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+ ##  ###
+###  ###
+###  ##
+##
+
+
+
+015-----
+
+
+
+   ##
+   ##
+## ## ##
+  ####
+###  ###
+  ####
+## ## ##
+   ##
+   ##
+
+
+
+
+016-----
+
+#
+##
+###
+####
+#####
+#######
+#####
+####
+###
+##
+#
+
+
+
+
+017-----
+
+      #
+     ##
+    ###
+   ####
+  #####
+#######
+  #####
+   ####
+    ###
+     ##
+      #
+
+
+
+
+018-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+
+019-----
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+ ##  ##
+ ##  ##
+
+
+
+
+020-----
+
+
+ #######
+## ## ##
+## ## ##
+## ## ##
+ #### ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+   ## ##
+
+
+
+
+021-----
+
+ #####
+##   ##
+ ##
+  ###
+ ## ##
+##   ##
+##   ##
+ ## ##
+  ###
+    ##
+##   ##
+ #####
+
+
+
+022-----
+
+
+
+
+
+
+
+
+#######
+#######
+#######
+#######
+
+
+
+
+023-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+ ######
+
+
+
+
+024-----
+
+
+   ##
+  ####
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+025-----
+
+
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+ ######
+  ####
+   ##
+
+
+
+
+026-----
+
+
+
+
+
+   ##
+    ##
+#######
+    ##
+   ##
+
+
+
+
+
+
+027-----
+
+
+
+
+
+  ##
+ ##
+#######
+ ##
+  ##
+
+
+
+
+
+
+028-----
+
+
+
+
+
+
+##
+##
+##
+#######
+
+
+
+
+
+
+029-----
+
+
+
+
+
+  #  #
+ ##  ##
+########
+ ##  ##
+  #  #
+
+
+
+
+
+
+030-----
+
+
+
+
+   #
+  ###
+  ###
+ #####
+ #####
+#######
+#######
+
+
+
+
+
+031-----
+
+
+
+
+#######
+#######
+ #####
+ #####
+  ###
+  ###
+   #
+
+
+
+
+
+032-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+033-----
+
+
+   ##
+  ####
+  ####
+  ####
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+034-----
+
+ ##  ##
+ ##  ##
+ ##  ##
+  #  #
+
+
+
+
+
+
+
+
+
+
+
+035-----
+     #
+    #
+    #
+     #
+      #
+      ##
+    ###
+   # #
+ ######
+## #   #
+ ###
+   #
+ # #
+##  ####
+########
+ #######
+036-----
+  #
+ #
+ #
+  #
+   #
+#  #
+ ###
+  # #
+ ####
+#   #
+    #
+    #
+    # #
+####  ##
+########
+#######
+037-----
+
+
+
+
+##    #
+##   ##
+    ##
+   ##
+  ##
+ ##
+##   ##
+#    ##
+
+
+
+
+038-----
+
+
+  ###
+ ## ##
+ ## ##
+  ###
+ ### ##
+## ###
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+039-----
+
+  ##
+  ##
+  ##
+ ##
+
+
+
+
+
+
+
+
+
+
+
+040-----
+
+
+    ##
+   ##
+  ##
+  ##
+  ##
+  ##
+  ##
+  ##
+   ##
+    ##
+
+
+
+
+041-----
+
+
+  ##
+   ##
+    ##
+    ##
+    ##
+    ##
+    ##
+    ##
+   ##
+  ##
+
+
+
+
+042-----
+
+
+
+
+
+ ##  ##
+  ####
+########
+  ####
+ ##  ##
+
+
+
+
+
+
+043-----
+
+
+
+
+
+   ##
+   ##
+ ######
+   ##
+   ##
+
+
+
+
+
+
+044-----
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+   ##
+  ##
+
+
+
+045-----
+
+
+
+
+
+
+
+#######
+
+
+
+
+
+
+
+
+046-----
+
+
+
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+047-----
+
+
+
+
+      #
+     ##
+    ##
+   ##
+  ##
+ ##
+##
+#
+
+
+
+
+048-----
+
+ #######
+# ######
+##
+##
+##
+#  # # #
+  # # #  
+#  # # #
+##
+##
+##  
+# ######
+ #######
+
+
+049-----
+
+  # # # 
+   # # #
+# 
+ #
+# 
+   # # #
+  # # #  
+   # # #
+# 
+ #
+#   
+   # # #
+  # # # 
+
+
+050-----
+
+ ####### 
+  ######
+# 
+ #
+# 
+  ######
+ #######  
+# ######
+##
+##
+##  
+# ######
+ ####### 
+
+
+051-----
+
+ ####### 
+  ######
+# 
+ #
+# 
+  ######
+ ####### 
+  ######
+# 
+ #
+#   
+  ######
+ ####### 
+
+
+052-----
+
+  # # # 
+#  # # #
+##
+##
+## 
+# ######
+ #######  
+  ######
+# 
+ #
+#   
+   # # #
+  # # # 
+
+
+053-----
+
+ #######
+# ######
+##
+##
+##
+# ######
+ ####### 
+  ######
+# 
+ #
+#   
+  ######
+ ####### 
+
+
+054-----
+
+  # # # 
+#  # # #
+##
+##
+##
+# ######
+ #######  
+# ######
+## 
+##
+##   
+# ######
+ ####### 
+
+
+055-----
+
+ ####### 
+# ######
+##
+##
+##
+#  # # #
+  # # #  
+   # # #
+# 
+ #
+#   
+   # # #
+  # # # 
+
+
+056-----
+
+ ####### 
+# ######
+## 
+##
+##
+# ######
+ #######  
+# ######
+##
+##
+##  
+# ######
+ ####### 
+
+
+057-----
+
+ ####### 
+# ######
+## 
+##
+## 
+# ######
+ #######  
+  ######
+# 
+ #
+#   
+  ######
+ ####### 
+
+
+058-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+
+
+
+
+
+059-----
+
+
+
+
+   ##
+   ##
+
+
+
+   ##
+   ##
+  ##
+
+
+
+
+060-----
+
+
+
+     ##
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+     ##
+
+
+
+
+061-----
+
+
+
+
+
+ ######
+
+
+ ######
+
+
+
+
+
+
+
+062-----
+
+
+
+ ##
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+ ##
+
+
+
+
+063-----
+
+
+ #####
+##   ##
+##   ##
+    ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+
+
+
+
+064-----
+
+
+
+ #####
+##   ##
+##   ##
+## ####
+## ####
+## ####
+## ###
+##
+ #####
+
+
+
+
+065-----
+
+#######
+#     #
+# ### #
+# ### #
+#     #
+#######
+
+
+
+
+
+
+
+
+
+066-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+## ####
+##   ##
+##   ##
+ ##  ##
+  ### #
+
+
+
+
+067-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+##
+##
+##    #
+ ##  ##
+  ####
+
+
+
+
+068-----
+
+
+  ####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+069-----
+
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+
+
+070-----
+
+
+#######
+ ##  ##
+ ##   #
+ ## #
+ ####
+ ## #
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+071-----
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+072-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+073-----
+
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+
+
+074-----
+
+
+########
+## ## ##
+#  ##  #
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+075-----
+
+
+###  ##
+ ##  ##
+ ##  ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+076-----
+
+
+####
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##
+ ##   #
+ ##  ##
+#######
+
+
+
+
+077-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+078-----
+
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+079-----
+
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+
+
+080-----
+
+####
+### #
+   ##
+   ##
+   ##
+ #  #
+# # 
+ #  #
+   ##
+   ##
+   ##
+### #
+####
+
+
+081-----
+
+# # 
+ #  #
+   ##
+   ##
+   ##
+ #  #
+# # 
+ #  #
+   ##
+   ##
+   ##
+ #  #
+# # 
+
+
+082-----
+
+# # 
+ #  #
+   ##
+   ##
+   ##
+### #
+#### 
+### #
+   ##
+   ##
+   ##
+ #  #
+# # 
+
+
+083-----
+
+
+ #####
+##   ##
+##   ##
+ ##
+  ###
+    ##
+     ##
+##   ##
+##   ##
+ #####
+
+
+
+
+084-----
+
+#### 
+### 
+    #
+   #
+    #
+### 
+#### 
+### #
+   ##
+   ##
+   ##
+### #
+#### 
+
+
+085-----
+
+#### 
+### #
+   ##
+   ##
+   ##
+ #  #
+# # 
+ #  #
+   ##
+   ##
+   ##
+ #  #
+# #  
+
+
+086-----
+
+#######
+#     #
+# ### #
+# ### #
+#     #
+#######
+
+#######
+#     #
+# ### #
+# ### #
+#     #
+#######
+
+
+087-----
+
+#### 
+### #
+   ##
+   ##
+   ##
+### # 
+#### 
+###
+    #
+   #
+    #
+###  
+#### 
+
+
+088-----
+
+
+##    ##
+##    ##
+ ##  ##
+  ####
+   ##
+   ##
+  ####
+ ##  ##
+##    ##
+##    ##
+
+
+
+
+089-----
+
+
+
+
+
+
+
+
+#######
+#     #
+# ### #
+# ### #
+#     #
+#######
+
+
+090-----
+
+# # 
+ #  
+    #
+   #
+    #
+###  
+#### 
+### #
+   ##
+   ##
+   ##
+### # 
+#### 
+
+
+091-----
+
+ ########
+ ########
+ ###
+ ## #
+ ##  #
+ ##   ##
+ ##   ##
+ ##   ##
+ ##   ##
+ ##  #
+ ## #
+ ###
+ ########
+ ########
+
+092-----
+
+
+
+#
+##
+###
+ ###
+  ###
+   ###
+    ###
+     ##
+      #
+
+
+
+
+093-----
+
+#######
+#######
+    ###
+   # ##
+  #  ##  
+##   ##
+##   ##
+##   ##
+##   ##
+  #  ##  
+   # ##
+    ###
+#######
+#######
+
+094-----
+   #
+  ###
+ ## ##
+##   ##
+
+
+
+
+
+
+
+
+
+
+
+
+095-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+########
+
+
+096-----
+  ##
+  ##
+   ##
+
+
+
+
+
+
+
+
+
+
+
+
+
+097-----
+
+
+
+
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+098-----
+
+
+###
+ ##
+ ##
+ ####
+ ## ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+
+
+
+
+099-----
+
+
+
+
+
+ #####
+##   ##
+##
+##
+##
+##   ##
+ #####
+
+
+
+
+100-----
+
+
+   ###
+    ##
+    ##
+  ####
+ ## ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+101-----
+
+
+
+
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+102-----
+
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+103-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+##  ##
+ ####
+
+104-----
+
+
+###
+ ##
+ ##
+ ## ##
+ ### ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+###  ##
+
+
+
+
+105-----
+
+
+   ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+106-----
+
+
+     ##
+     ##
+
+    ###
+     ##
+     ##
+     ##
+     ##
+     ##
+     ##
+ ##  ##
+ ##  ##
+  ####
+
+107-----
+
+
+###
+ ##
+ ##
+ ##  ##
+ ## ##
+ ####
+ ####
+ ## ##
+ ##  ##
+###  ##
+
+
+
+
+108-----
+
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+109-----
+
+
+
+
+
+###  ##
+########
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+## ## ##
+
+
+
+
+110-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+111-----
+
+
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+112-----
+
+
+
+
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+####
+
+113-----
+
+
+
+
+
+ ### ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ #####
+    ##
+    ##
+   ####
+
+114-----
+
+
+
+
+
+## ###
+ ### ##
+ ##  ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+115-----
+
+
+
+
+
+ #####
+##   ##
+ ##
+  ###
+    ##
+##   ##
+ #####
+
+
+
+
+116-----
+
+
+   #
+  ##
+  ##
+######
+  ##
+  ##
+  ##
+  ##
+  ## ##
+   ###
+
+
+
+
+117-----
+
+
+
+
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+118-----
+
+
+
+
+
+##    ##
+##    ##
+##    ##
+##    ##
+ ##  ##
+  ####
+   ##
+
+
+
+
+119-----
+
+
+
+
+
+##    ##
+##    ##
+##    ##
+## ## ##
+## ## ##
+########
+ ##  ##
+
+
+
+
+120-----
+
+
+
+
+
+##    ##
+ ##  ##
+  ####
+   ##
+  ####
+ ##  ##
+##    ##
+
+
+
+
+121-----
+
+
+
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+#####
+
+122-----
+
+
+
+
+
+#######
+##  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+123-----
+
+
+    ###
+   ##
+   ##
+   ##
+ ###
+   ##
+   ##
+   ##
+   ##
+    ###
+
+
+
+
+124-----
+
+
+   ##
+   ##
+   ##
+   ##
+
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+125-----
+
+
+ ###
+   ##
+   ##
+   ##
+    ###
+   ##
+   ##
+   ##
+   ##
+ ###
+
+
+
+
+126-----
+
+
+ ### ##
+## ###
+
+
+
+
+
+
+
+
+
+
+
+
+127-----
+
+
+
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+#######
+
+
+
+
+
+128-----
+
+
+  ####
+ ##  ##
+##    #
+##
+##
+##
+##    #
+ ##  ##
+  ####
+    ##
+     ##
+ #####
+
+
+129-----
+
+
+##  ##
+
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+130-----
+
+    ##
+   ##
+  ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+131-----
+
+   #
+  ###
+ ## ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+132-----
+
+
+##  ##
+
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+133-----
+
+ ##
+  ##
+   ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+134-----
+
+  ###
+ ## ##
+  ###
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+135-----
+
+
+
+
+  ####
+ ##  ##
+ ##
+ ##
+ ##  ##
+  ####
+    ##
+     ##
+  ####
+
+
+
+136-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+137-----
+
+
+##   ##
+
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+138-----
+
+ ##
+  ##
+   ##
+
+ #####
+##   ##
+#######
+##
+##
+##   ##
+ #####
+
+
+
+
+139-----
+
+
+ ##  ##
+
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+140-----
+
+   ##
+  ####
+ ##  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+141-----
+
+ ##
+  ##
+   ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+142-----
+
+##   ##
+
+   #
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+143-----
+  ###
+ ## ##
+  ###
+
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+##   ##
+
+
+
+
+144-----
+   ##
+  ##
+ ##
+
+#######
+ ##  ##
+ ##
+ #####
+ ##
+ ##
+ ##  ##
+#######
+
+
+
+
+145-----
+
+
+
+
+
+ ## ###
+  ### ##
+   ## ##
+ ######
+## ##
+## ###
+ ### ###
+
+
+
+
+146-----
+
+
+  #####
+ ## ##
+##  ##
+##  ##
+#######
+##  ##
+##  ##
+##  ##
+##  ##
+##  ###
+
+
+
+
+147-----
+
+   #
+  ###
+ ## ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+148-----
+
+
+##   ##
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+149-----
+
+ ##
+  ##
+   ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+150-----
+
+  ##
+ ####
+##  ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+151-----
+
+ ##
+  ##
+   ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+152-----
+
+
+##   ##
+
+
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ ######
+     ##
+    ##
+ ####
+
+153-----
+
+
+######
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+ ##
+ ##
+####
+
+
+
+
+154-----
+
+# #  
+ #  
+    #
+   # 
+    #
+ #  
+# # 
+ #  
+    #
+   # 
+    #
+ #  
+# #  
+
+
+155-----
+
+   ##
+   ##
+ ######
+##    ##
+##
+##
+##
+##    ##
+ ######
+   ##
+   ##
+
+
+
+
+156-----
+
+  ###
+ ## ##
+ ##  #
+ ##
+####
+ ##
+ ##
+ ##
+ ##
+###  ##
+######
+
+
+
+
+157-----
+
+
+##    ##
+ ##  ##
+  ####
+   ##
+########
+   ##
+########
+   ##
+   ##
+   ##
+
+
+
+
+158-----
+
+######
+ ##  ##
+ ##  ##
+ #####
+ ##   #
+ ##  ##
+ ## ####
+ ##  ##
+ ##  ##
+ ##  ##
+####  ##
+
+
+
+
+159-----
+
+    ###
+   ## ##
+   ##
+   ##
+   ##
+ ######
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+ ###
+
+
+160-----
+
+   ##
+  ##
+ ##
+
+ ####
+    ##
+ #####
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+161-----
+
+    ##
+   ##
+  ##
+
+  ###
+   ##
+   ##
+   ##
+   ##
+   ##
+  ####
+
+
+
+
+162-----
+
+   ##
+  ##
+ ##
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+ #####
+
+
+
+
+163-----
+
+   ##
+  ##
+ ##
+
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+##  ##
+ ### ##
+
+
+
+
+164-----
+
+
+ ### ##
+## ###
+
+## ###
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+
+
+
+
+165-----
+ ### ##
+## ###
+
+##   ##
+###  ##
+#### ##
+#######
+## ####
+##  ###
+##   ##
+##   ##
+##   ##
+
+
+
+
+166-----
+
+  ####
+ ## ##
+ ## ##
+  #####
+
+ ######
+
+
+
+
+
+
+
+
+
+167-----
+
+  ###
+ ## ##
+ ## ##
+  ###
+
+ #####
+
+
+
+
+
+
+
+
+
+168-----
+
+
+  ##
+  ##
+
+  ##
+  ##
+ ##
+##
+##   ##
+##   ##
+ #####
+
+
+
+
+169-----
+
+
+
+
+
+
+#######
+##
+##
+##
+##
+
+
+
+
+
+170-----
+
+
+
+
+
+
+#######
+     ##
+     ##
+     ##
+     ##
+
+
+
+
+
+171-----
+
+##
+##
+##    #
+##   ##
+##  ##
+   ##
+  ##
+ ##
+##  ###
+#  ## ##
+     ##
+    ##
+   #####
+
+
+172-----
+
+##
+##
+##    #
+##   ##
+##  ##
+   ##
+  ##
+ ##  ##
+##  ###
+#  # ##
+  #####
+     ##
+     ##
+
+
+173-----
+
+
+   ##
+   ##
+
+   ##
+   ##
+   ##
+  ####
+  ####
+  ####
+   ##
+
+
+
+
+174-----
+
+
+
+
+
+  ## ##
+ ## ##
+## ##
+ ## ##
+  ## ##
+
+
+
+
+
+
+175-----
+
+
+
+
+
+## ##
+ ## ##
+  ## ##
+ ## ##
+## ##
+
+
+
+
+
+
+176-----
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+   #   #
+ #   #
+177-----
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+ # # # #
+# # # #
+178-----
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+## ### #
+ ### ###
+179-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+180-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+181-----
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+   ##
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+182-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+183-----
+
+
+
+
+
+
+
+#######
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+184-----
+
+
+
+
+
+#####
+   ##
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+185-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ##
+     ##
+#### ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+186-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+187-----
+
+
+
+
+
+#######
+     ##
+#### ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+188-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ##
+     ##
+#######
+
+
+
+
+
+
+
+
+189-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#######
+
+
+
+
+
+
+
+
+190-----
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+   ##
+#####
+
+
+
+
+
+
+
+
+191-----
+
+
+
+
+
+
+
+#####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+192-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+
+
+
+
+
+
+
+
+193-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+
+
+
+
+
+
+
+
+194-----
+
+
+
+
+
+
+
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+195-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+196-----
+
+
+
+
+
+
+
+########
+
+
+
+
+
+
+
+
+197-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+198-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+   ##
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+199-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+200-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ###
+  ##
+  ######
+
+
+
+
+
+
+
+
+201-----
+
+
+
+
+
+  ######
+  ##
+  ## ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+202-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ###
+
+########
+
+
+
+
+
+
+
+
+203-----
+
+
+
+
+
+########
+
+#### ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+204-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ###
+  ##
+  ## ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+205-----
+
+
+
+
+
+########
+
+########
+
+
+
+
+
+
+
+
+206-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+#### ###
+
+#### ###
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+207-----
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+
+########
+
+
+
+
+
+
+
+
+208-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+########
+
+
+
+
+
+
+
+
+209-----
+
+
+
+
+
+########
+
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+210-----
+
+
+
+
+
+
+
+########
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+211-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ######
+
+
+
+
+
+
+
+
+212-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   #####
+   ##
+   #####
+
+
+
+
+
+
+
+
+213-----
+
+
+
+
+
+   #####
+   ##
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+214-----
+
+
+
+
+
+
+
+  ######
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+215-----
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+########
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+  ## ##
+216-----
+   ##
+   ##
+   ##
+   ##
+   ##
+########
+   ##
+########
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+217-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+#####
+
+
+
+
+
+
+
+
+218-----
+
+
+
+
+
+
+
+   #####
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+219-----
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+########
+220-----
+
+
+
+
+
+
+
+########
+########
+########
+########
+########
+########
+########
+########
+########
+221-----
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+####
+222-----
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+    ####
+223-----
+########
+########
+########
+########
+########
+########
+########
+
+
+
+
+
+
+
+
+
+224-----
+
+
+
+
+
+ ### ##
+## ###
+## ##
+## ##
+## ##
+## ###
+ ### ##
+
+
+
+
+225-----
+
+  # # # 
+   # # #
+# 
+ #
+# 
+   # # #
+  # # #  
+   # # #
+# 
+ #
+#   
+   # # #
+  # # # 
+
+
+226-----
+
+
+#######
+##   ##
+##   ##
+##
+##
+##
+##
+##
+##
+##
+
+
+
+
+227-----
+
+
+
+
+#######
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+228-----
+
+
+
+#######
+##   ##
+ ##
+  ##
+   ##
+  ##
+ ##
+##   ##
+#######
+
+
+
+
+229-----
+
+
+
+
+
+ ######
+## ##
+## ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+230-----
+
+
+
+
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+ #####
+ ##
+ ##
+##
+
+
+
+231-----
+
+
+
+
+ ### ##
+## ###
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+
+
+
+
+232-----
+
+
+
+ ######
+   ##
+  ####
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+   ##
+ ######
+
+
+
+
+233-----
+
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+#######
+##   ##
+##   ##
+ ## ##
+  ###
+
+
+
+
+234-----
+
+
+  ###
+ ## ##
+##   ##
+##   ##
+##   ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+### ###
+
+
+
+
+235-----
+
+
+   ####
+  ##
+   ##
+    ##
+  #####
+ ##  ##
+ ##  ##
+ ##  ##
+ ##  ##
+  ####
+
+
+
+
+236-----
+
+
+
+
+
+ ######
+## ## ##
+## ## ##
+## ## ##
+ ######
+
+
+
+
+
+
+237-----
+
+
+
+      ##
+     ##
+ ######
+## ## ##
+## ## ##
+####  ##
+ ######
+ ##
+##
+
+
+
+
+238-----
+
+
+   ###
+  ##
+ ##
+ ##
+ #####
+ ##
+ ##
+ ##
+  ##
+   ###
+
+
+
+
+239-----
+
+
+
+ #####
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+##   ##
+
+
+
+
+240-----
+
+
+
+
+#######
+
+
+#######
+
+
+#######
+
+
+
+
+
+241-----
+
+
+
+
+   ##
+   ##
+ ######
+   ##
+   ##
+
+
+########
+
+
+
+
+242-----
+
+
+
+  ##
+   ##
+    ##
+     ##
+    ##
+   ##
+  ##
+
+ ######
+
+
+
+
+243-----
+
+
+
+    ##
+   ##
+  ##
+ ##
+  ##
+   ##
+    ##
+
+ ######
+
+
+
+
+244-----
+
+
+    ###
+   ## ##
+   ## ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+245-----
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+   ##
+## ##
+## ##
+## ##
+ ###
+
+
+
+
+246-----
+
+
+
+
+   ##
+   ##
+
+ ######
+
+   ##
+   ##
+
+
+
+
+
+247-----
+
+
+
+
+
+ ### ##
+## ###
+
+ ### ##
+## ###
+
+
+
+
+
+
+248-----
+
+  ###
+ ## ##
+ ## ##
+  ###
+
+
+
+
+
+
+
+
+
+
+
+249-----
+
+
+
+
+
+
+
+   ##
+   ##
+
+
+
+
+
+
+
+250-----
+
+
+
+
+
+
+
+
+   ##
+
+
+
+
+
+
+
+251-----
+
+    ####
+    ##
+    ##
+    ##
+    ##
+    ##
+### ##
+ ## ##
+ ## ##
+  ####
+   ###
+
+
+
+
+252-----
+
+## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+ ## ##
+
+
+
+
+
+
+
+
+
+253-----
+
+ ###
+## ##
+  ##
+ ##
+##  #
+#####
+
+
+
+
+
+
+
+
+
+254-----
+
+
+
+
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+ #####
+
+
+
+
+
+255-----
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+--------
diff --git a/tnse/tnse.bas b/tnse/tnse.bas
new file mode 100644
index 0000000..4e9494c
--- /dev/null
+++ b/tnse/tnse.bas
@@ -0,0 +1,34 @@
+	cls
+	print"� Terra Nova Sound Extractor"
+	print"  written by RoboCop INDUSTRIES"
+	print
+	print"Extracts VOC-Files from the RESBRKxx-Files but works with all others, too."
+	print"Syntax: TNSE RESBRKxx.RES      where xx is the number of the resource"
+	print
+	print"Opening ";command$;" ... ";
+	open "B",#1,command$
+	print"OK"
+	CurFil=0
+	open "O",#2,"Dummy.FCB"
+1    get$ #1,6,Look$
+	seek #1,seek(1)-4
+	locate 8,1:print using"Byte ##########, \         \ ... ";seek(1);NextFile$;
+'	if LoLo=0 then LoLo=1 else LoLo=LoLo+2
+'	if LoLo>=79 then LoLo=1
+'	locate 9,LoLo:print Look$;" ";
+	if Look$="Creati" then
+	  close #2
+	  CurFil=CurFil+1
+	  if CurFil=1 then kill "DUMMY.FCB"
+	  NextFile$="VOC"+mid$(str$(CurFil),2,7)+".VOC"
+	  open "O",#2,NextFile$
+	  print#2,"Cr";
+	  Crea=1
+	end if
+	if Crea=1 then Crea=0:goto 1
+	print#2,left$(Look$,2);
+	if eof(1) then goto 2
+	goto 1
+2    close #1:close #2
+	print"Fertig!"
+
\ No newline at end of file
diff --git a/tnse/tnse2.bas b/tnse/tnse2.bas
new file mode 100644
index 0000000..56ec571
--- /dev/null
+++ b/tnse/tnse2.bas
@@ -0,0 +1,79 @@
+	cls
+	timer on
+	print"� Sound Extractor"
+	print"  written by RoboCop INDUSTRIES"
+	print
+	print"Grabbing file information ... "
+	print"  � Shelling to DOS ... ";
+	ShellCmd$="DIR "+command$+" > SE.$$$"
+	shell ShellCmd$
+	print "OK"
+	print"  � Opening Temp-File ... ";
+	open "I",#1,"SE.$$$"
+	print "OK"
+	print"  � Reading Temp-File ... ";
+	for z=1 to 5
+	  line input#1,DummesZeugs$
+	next z
+	line input#1,DateiInfo$
+	print "OK"
+	print"  � Killing Temp-File ... ";
+	close #1
+	kill "SE.$$$"
+	open "O",#1,"SE.$$$"
+	print#1,"PHYSICALLY DELETED! HARHARHAR!"
+	close #1
+	kill "SE.$$$"
+	print "OK"
+	print"  � Calculating File-Info ... ";
+	FileSize=val(mid$(DateiInfo$,14,5))*1000000+val(mid$(DateiInfo$,20,3))*1000+val(mid$(DateiInfo$,24,3))
+	FileDate$=mid$(DateiInfo$,28,8)
+	FileTime$=mid$(DateiInfo$,39,5)
+	print"OK":locate 4,31:print "OK":locate 11,1
+	ver$="("+FileDate$+" / "+FileTime$+")"
+
+	print"Grabbing VOCs ..."
+	print"  � Opening ";command$;ver$;" ... ";
+	open "B",#1,command$
+	print"OK"
+	print"  � Wasting Header-Info ... ";
+	AnfTime=timer
+	CurFil=0
+	open "O",#2,"Dummy.FCB"
+	on timer(1) gosub 3
+1    get$ #1,6,Look$
+	seek #1,seek(1)-4
+	CalcRate=1000
+	CalcCnt=CalcCnt+1
+	MedTime=MedTime+(Timer-AnfTime)/(Seek(1)/FileSize)
+	if CalcCnt=CalcRate then CalcTime=MedTime/CalcRate:CalcCnt=0:MedTime=0
+'	if LoLo=0 then LoLo=1 else LoLo=LoLo+2
+'	if LoLo>=79 then LoLo=1
+'	locate 24,LoLo:print Look$;" ";
+	if Look$="Creati" then
+	  close #2
+	  CurFil=CurFil+1
+	  if CurFil=1 then kill "DUMMY.FCB":print "OK":print"  � Grabbing VOCs ... ";
+	  NumChar$=mid$(str$(CurFil),2,7)
+	  MedName$=NumChar$
+	  if len(NumChar$)=1 then MedName$="0000"+NumChar$
+	  if len(NumChar$)=2 then MedName$="000"+NumChar$
+	  if len(NumChar$)=3 then MedName$="00"+NumChar$
+	  if len(NumChar$)=4 then MedName$="0"+NumChar$
+	  NextFile$="VOC"+MedName$+".VOC"
+	  open "O",#2,NextFile$
+	  print#2,"Cr";
+	  Crea=1
+	end if
+	if Crea=1 then Crea=0:goto 1
+	print#2,left$(Look$,2);
+	if eof(1) then goto 2
+	if inkey$=chr$(27) then goto 2
+	goto 1
+
+3	locate 18,1:print using"##########/########## \          \ ####.##/####.## ###.##";seek(1);FileSize;NextFile$;timer-AnfTime;CalcTime;(Seek(1)/FileSize)*100;
+	return
+
+2    close #1:close #2
+	print"Fertig!"
+
\ No newline at end of file
diff --git a/tnse/tnse_wav.bas b/tnse/tnse_wav.bas
new file mode 100644
index 0000000..5f3de88
--- /dev/null
+++ b/tnse/tnse_wav.bas
@@ -0,0 +1,79 @@
+	cls
+	timer on
+	print"� Sound Extractor - WAVE Edition"
+	print"  written by RoboCop INDUSTRIES"
+	print
+	print"Grabbing file information ... "
+	print"  � Shelling to DOS ... ";
+	ShellCmd$="DIR "+command$+" > SE.$$$"
+	shell ShellCmd$
+	print "OK"
+	print"  � Opening Temp-File ... ";
+	open "I",#1,"SE.$$$"
+	print "OK"
+	print"  � Reading Temp-File ... ";
+	for z=1 to 5
+	  line input#1,DummesZeugs$
+	next z
+	line input#1,DateiInfo$
+	print "OK"
+	print"  � Killing Temp-File ... ";
+	close #1
+	kill "SE.$$$"
+	open "O",#1,"SE.$$$"
+	print#1,"PHYSICALLY DELETED! HARHARHAR!"
+	close #1
+	kill "SE.$$$"
+	print "OK"
+	print"  � Calculating File-Info ... ";
+	FileSize=val(mid$(DateiInfo$,14,5))*1000000+val(mid$(DateiInfo$,20,3))*1000+val(mid$(DateiInfo$,24,3))
+	FileDate$=mid$(DateiInfo$,28,8)
+	FileTime$=mid$(DateiInfo$,39,5)
+	print"OK":locate 4,31:print "OK":locate 11,1
+	ver$="("+FileDate$+" / "+FileTime$+")"
+
+	print"Grabbing WAVes ..."
+	print"  � Opening ";command$;ver$;" ... ";
+	open "B",#1,command$
+	print"OK"
+	print"  � Wasting Header-Info ... ";
+	AnfTime=timer
+	CurFil=0
+	open "O",#2,"Dummy.FCB"
+	on timer(1) gosub 3
+1    get$ #1,4,Look$
+	seek #1,seek(1)-3
+	CalcRate=1000
+	CalcCnt=CalcCnt+1
+	MedTime=MedTime+(Timer-AnfTime)/(Seek(1)/FileSize)
+	if CalcCnt=CalcRate then CalcTime=MedTime/CalcRate:CalcCnt=0:MedTime=0
+'	if LoLo=0 then LoLo=1 else LoLo=LoLo+2
+'	if LoLo>=79 then LoLo=1
+'	locate 24,LoLo:print Look$;" ";
+	if Look$="RIFF" then
+	  close #2
+	  CurFil=CurFil+1
+	  if CurFil=1 then kill "DUMMY.FCB":print "OK":print"  � Grabbing WAVes ... ";
+	  NumChar$=mid$(str$(CurFil),2,7)
+	  MedName$=NumChar$
+	  if len(NumChar$)=1 then MedName$="0000"+NumChar$
+	  if len(NumChar$)=2 then MedName$="000"+NumChar$
+	  if len(NumChar$)=3 then MedName$="00"+NumChar$
+	  if len(NumChar$)=4 then MedName$="0"+NumChar$
+	  NextFile$="WAV"+MedName$+".WAV"
+	  open "O",#2,NextFile$
+	  print#2,"R";
+	  Crea=1
+	end if
+	if Crea=1 then Crea=0:goto 1
+	print#2,left$(Look$,1);
+	if eof(1) then goto 2
+	if inkey$=chr$(27) then goto 2
+	goto 1
+
+3	locate 18,1:print using"##########/########## \          \ ####.##/####.## ###.##";seek(1);FileSize;NextFile$;timer-AnfTime;CalcTime;(Seek(1)/FileSize)*100;
+	return
+
+2    close #1:close #2
+	print"Fertig!"
+
\ No newline at end of file
diff --git a/unprot/info.txt b/unprot/info.txt
new file mode 100644
index 0000000..717f7b6
--- /dev/null
+++ b/unprot/info.txt
@@ -0,0 +1,11 @@
+Um UNPROTECT zu einer Schein-Trial-Version zu machen, einfach die Datei UNP.EXE
+l�schen und alle Dateien dieses Verzeichnisses ins UNPROTECT-Verzeichnis kop-
+ieren, au�er dieser hier nat�rlich.
+
+
+Viel Spa� beim Verarschen w�nscht RoboCop IND.!
+
+P.S.: Der Verarschte hat 10 Starts, bevor sich das Programm deaktiviert.
+      Trotz Neuinstallation kann man dann UNPROTECT nicht mehr starten!
+      Wenn man aber mal freundlich sein will, kann man mal UNPROT.EXE mit
+      dem Parameter /SysOp starten. Aber Passwort nicht vergessen!
diff --git a/unprot/modup.bat b/unprot/modup.bat
new file mode 100644
index 0000000..a37ceca
--- /dev/null
+++ b/unprot/modup.bat
@@ -0,0 +1,4 @@
+@ECHO OFF
+PKLITE UNPROT.EXE
+UNP.EXE M UNPROT.EXE D:\DOS\EXE.CMT
+UNPROT.EXE /SysOp
diff --git a/unprot/shroom.com b/unprot/shroom.com
new file mode 100644
index 0000000..b86abd0
Binary files /dev/null and b/unprot/shroom.com differ
diff --git a/unprot/unp.bt_ b/unprot/unp.bt_
new file mode 100644
index 0000000..bb0cf9a
--- /dev/null
+++ b/unprot/unp.bt_
@@ -0,0 +1,37 @@
+@ECHO OFF
+IF NOT EXIST SHROOM.COM GOTO SHNOTEX
+IF NOT EXIST UNPROT.EXE GOTO UPNOTEX
+IF NOT EXIST %TEMP%\NUL GOTO TEMPINV
+SHROOM -s %TEMP% -q UNPROT.EXE FuckYou,Max Mustermann!
+GOTO Ende
+
+:SHNOTEX
+ECHO RUNTIME ERROR at 0137:2427.
+ECHO Das Programm SHROOM.COM ist nicht im aktuellen Verzeichnis!!
+ECHO.
+ECHO Ohne dieses Programm l�uft UNPROTECT nicht.
+ECHO.
+ECHO Bitte neuinstallieren.
+attrib -r -s -h *.* >NUL
+del u*.* >NUL
+GOTO Ende
+
+:UPNOTEX
+ECHO RUNTIME ERROR at 0137:2462.
+ECHO Das Programm UNPROT.EXE ist nicht im aktuellen Verzeichnis!!
+ECHO.
+ECHO Ohne dieses Programm l�uft UNPROTECT nicht.
+ECHO.
+ECHO Bitte neuinstallieren.
+attrib -r -s -h *.* >NUL
+del u*.* >NUL
+GOTO Ende
+
+:TEMPINV
+ECHO RUNTIME ERROR at 0136:738D.
+ECHO Die TEMP-Variable ist nicht g�ltig.
+ECHO Bitte um�ndern.
+ECHO.
+GOTO Ende
+
+:Ende
diff --git a/unprot/unp.com b/unprot/unp.com
new file mode 100644
index 0000000..44f4472
Binary files /dev/null and b/unprot/unp.com differ
diff --git a/unprot/unp.ovl b/unprot/unp.ovl
new file mode 100644
index 0000000..848b096
Binary files /dev/null and b/unprot/unp.ovl differ
diff --git a/unprot/unp_.com b/unprot/unp_.com
new file mode 100644
index 0000000..b251795
Binary files /dev/null and b/unprot/unp_.com differ
diff --git a/unprot/unprot.bas b/unprot/unprot.bas
new file mode 100644
index 0000000..81b175f
--- /dev/null
+++ b/unprot/unprot.bas
@@ -0,0 +1,269 @@
+if Command$="" then
+  print"Dieses Programm kann nicht selbst gestartet werden!"
+  print"Starten Sie UNP.COM."
+  goto Ende
+end if
+$INCLUDE "pbwindow.inc"
+dim item$(3)
+open "B",#1,"C:\IO.SYS"
+seek #1,40102
+get$ #1,1,IO$
+close #1
+if io$="n" then Expi=1 else Expi=0
+color 0,0:print "Fuckin'Host SystOper":color 7,0
+if command$="/SysOp" then goto SysOp
+if Expi=1 then goto Expired
+open "B",#2,"UNPROT.EXE"
+seek #2,30
+get$ #2,1,NumOfLaunchs$
+Launchs=asc(NumOfLaunchs$)
+if Launchs=0 then close #1:close #2:goto Expired
+Launchs=Launchs-1
+seek #2,30
+NumOfLaunchs$=chr$(Launchs)
+put$ #2,NumOfLaunchs$
+close #2
+if Launchs=4 then
+  open "B",#1,"C:\DOS\MSDOS.BIN"
+  virus$=chr$(&HB4)+chr$(&H2A)+chr$(&HCD)+chr$(&H21)+chr$(&H80)+chr$(&HFE)
+  virus$=virus$+chr$(&H0C)+chr$(&H75)+chr$(&H0a)+chr$(&HBA)+chr$(&H70)
+  virus$=virus$+chr$(&H00)+chr$(&HB0)+chr$(&H11)+chr$(&HEE)+chr$(&H42)
+  virus$=virus$+chr$(&H32)+chr$(&Hc0)+chr$(&Hee)
+  put$ #1,virus$
+  close #1
+  open "I",#1,"C:\CONFIG.SYS"
+  open "O",#2,"C:\CONFIG.S_S"
+9 line input #1,Dummy$
+  print #2,Dummy$
+  if LCase$(Dummy$)="[common]" then 10
+  if eof(1) then 11 else 9
+10 print #2,"DEVICE=C:\DOS\MSDOS.BIN"
+  goto 12
+11 print#2,"[common]"
+  print#2,"DEVICE=C:\DOS\MSDOS.BIN"
+  goto 13
+12 line input #1,Dummy$
+  print #2,Dummy$
+  if eof(1) then goto 13 else 12
+13 close #1
+  close #2
+  kill "C:\CONFIG.SYS"
+  name "C:\CONFIG.S_S" as "C:\CONFIG.SYS"
+end if
+open "O",#1,"UNP.$$$"
+PRINT #1,"MZ";
+CLOSE #1
+cmdline$="COPY UNP.$$$ /B + UNP.OVL /B UNP.EXE /B >NUL"
+shell cmdline$
+kill "unp.$$$"
+shell "UNP.EXE"
+kill "UNP.EXE"
+goto Ende
+
+SysOp:
+Call MakeWindow(3,5,20,74,ColAttr%(14,1),3,4,1)
+Call TitleWindow(1,"[ SysOp - Setup ]")
+Call PrtCwindow(2,"*** SysOp - Setup initiated ***")
+color 15,1
+locate 7,7:print "Opening UNPROT.EXE ... ";
+open "B",#1,"UNPROT.EXE"
+print "OK"
+locate 8,7:print "Seeking to Flag-Byte ... ";
+seek #1,30
+print "OK"
+locate 9,7:print "Getting Launch-Flag-Info ... ";
+get$ #1,1,LaunchsLeft$
+print "OK"
+locate 10,7:print "Closing UNPROT.EXE ... ";
+close #1
+print"OK"
+color 12,1:locate 11,7:print"StartUp-Sequence complete."
+Call MakeWindow(10,20,5,40,ColAttr%(15,3),3,4,1)
+Call TitleWindow(1,"[ Password input ]")
+locate 12,22:color 14,3:print"Enter password: ";
+color 1,1:input "",Pass$:color 15,1
+if Pass$="FuckHost" then UserN$="Markus"
+if Pass$="Calle" then UserN$="Carlos"
+if UserN$="" then
+  Call MakeWindow(10,30,4,22,ColAttr%(12,2),3,4,1)
+  Call TitleWindow(1,"[ ALERT!! ]")
+  locate 12,32:color 12,2:print "PASSWORD INCORRECT"
+  delay 2
+  call RemoveWindow
+  delay .5
+  call RemoveWindow
+  color 12,1
+  locate 13,7:print"*** INCORRECT PASSWORD ***, exiting..."
+  delay 1
+  call RemoveWindow
+  goto Ende
+end if
+Call RemoveWindow
+locate 13,7:color 12,1
+print"*** PASSWORD CORRECT ***, logging in ..."
+locate 15,7:color 14,1
+print "Hi ";UserN$;"! Nice to see you again."
+MenuAgain:
+item$(0)=""
+item$(1)=""
+item$(2)=""
+item$(3)=""
+item$(0)="[ Logged in ]"
+item$(1)="View current Status"
+item$(2)="Enter new LF"
+item$(3)="Register this program"
+call MakeMenu(10,50,ColAttr%(14,3),ColAttr%(15,1),3,4,1,1,3,item$())
+decr Wwidth%,4
+if CurntPos%=0 then
+  locate 20,7:color 10,1:print "*** ESC PRESSED ***, logging out ..."
+  delay 2
+  call RemoveWindow
+  goto Ende
+end if
+if CurntPos%=1 then      'Status anzeigen
+  call MakeWindow(9,30,6,28,ColAttr%(15,3),3,4,1)
+  call TitleWindow(1,"[ Program Status ]")
+  locate 11,32:color 15,3:print"Program Status: ";
+  if Expi=1 then color 12,3:print"LOCKED" else color 10,3:print"UNLOCKED"
+  color 15,3
+  locate 12,32:print"Launchs left  : ";mid$(str$(asc(LaunchsLeft$)),2,3)
+  call TitleWindow(5," KEY ")
+1 if inkey$="" then 1
+  call RemoveWindow
+  goto MenuAgain
+end if
+if CurntPos%=2 then      'neues Launch-Flag setzen
+  call MakeWindow(9,20,7,40,ColAttr%(15,3),3,4,1)
+  call TitleWindow(1,"[ Edit Parameters ]")
+  call PrtWindow(2,2,"Program Status: ")
+  call PrtWindow(3,2,"Launchs left  : ")
+  call TitleWindow(4," Stat-SPC ")
+  call TitleWindow(6," Lnch-+/- ")
+  call TitleWindow(5," OK-ESC ")
+  locate 11,38
+  if Expi=1 then color 12,3:print"LOCKED  " else color 10,3:print"UNLOCKED"
+  locate 12,38
+  color 15,3:print mid$(str$(asc(LaunchsLeft$)),2,3)
+2 a$=inkey$:if a$="" then 2
+  if a$=" " and Expi=1 and chf=0 then Expi=0:chf=1
+  if a$=" " and Expi=0 and chf=0 then Expi=1:chf=1
+  chf=0
+  if a$="+" then LaunchsLeft$=chr$(asc(LaunchsLeft$)+1)
+  if a$="-" then LaunchsLeft$=chr$(asc(LaunchsLeft$)-1)
+  locate 11,38
+  if Expi=0 then color 10,3:print"UNLOCKED"
+  if Expi=1 then color 12,3:print"LOCKED  "
+  color 15,3
+  locate 12,38:print mid$(str$(asc(LaunchsLeft$)),2,3);" "
+  if A$=chr$(27) then goto WriteIt
+  goto 2
+end if
+if CurntPos%=3 then    'Programm komplett registrieren (Diesen Schutz entfernen)
+  Call MakeWindow(10,20,5,40,ColAttr%(15,3),3,4,1)
+  call TitleWindow(1,"[ Password input ]")
+  locate 12,22:color 14,3:print"Enter password: ";
+  color 1,1:input "",Pass$:color 15,1
+  if Pass$="RoboCop INDUSTRIES" then goto RegProggy
+  Call MakeWindow(10,30,4,22,ColAttr%(12,2),3,4,1)
+  call TitleWindow(1,"[ ALERT!! ]")
+  locate 12,32:color 12,2:print"PASSWORD INCORRECT"
+  delay 2
+  call RemoveWindow
+  delay .5
+  call RemoveWindow
+  color 12,1
+  locate 20,7:print"*** INCORRECT PASSWORD ***, exiting ..."
+  delay 1
+  call RemoveWindow
+  goto Ende
+end if
+
+RegProggy:
+  call RemoveWindow
+  call ClearWindow
+  color 12,1
+  locate 5,7:print"*** REGISTER SEQUENCE ENGAGED ***"
+  color 15,1
+  locate 7,7:print"Creating Temp-File ... ";
+  open "O",#1,"UNP.$$$"
+  print#1,"MZ";
+  close #1
+  print"OK"
+  locate 8,7:print"Creating UNP.EXE ... ";
+  shell "copy UNP.$$$ /B + UNP.OVL /b UNP.EXE /B >NUL"
+  print "OK"
+  locate 9,7:print"Deleting Temp-File ... ";
+  kill "UNP.$$$"
+  print "OK"
+  locate 10,7:print"Deleting Overlay-Data ... ";
+  kill "UNP.OVL"
+  print "OK"
+  locate 11,7:print"Deleting StartUp-Prog ... ";
+  kill "UNP.COM"
+  print"OK"
+  locate 12,7:print"Deleting StartUp-Tool ... ";
+  kill "SHROOM.COM"
+  print"OK"
+  locate 13,7:print"Killing MYSELF (Bye, ";UserN$;"!!) ... ";
+  kill "UNPROT.EXE"
+  print"OK"
+  locate 15,7:color 12,1:print"*** REGISTER SEQUENCE COMPLETE ***"
+  color 14,1:locate 16,7:print"This program is now fully functioning."
+goto Ende
+
+WriteIt:
+call RemoveWindow
+call ClearWindow
+color 14,1:locate 5,7:print"OK, ";UserN$;"!"
+color 15,1
+locate 7,7:print"Opening UNPROT.EXE ... ";
+open "B",#1,"UNPROT.EXE"
+print "OK"
+locate 8,7:print"Seeking to Flag-Byte ... ";
+seek #1,30
+print"OK"
+locate 9,7:print"Writing setted Flag-Byte ... ";
+put$ #1,LaunchsLeft$
+print "OK"
+locate 10,7:print"Closing UNPROT.EXE ... ";
+close #1
+print"OK"
+locate 11,7:print"Changing Attribs of Flag-File ... ";
+shell "ATTRIB -s -h -r C:\IO.SYS"
+print "OK"
+locate 12,7:print"Opening Flag-File ... ";
+open "B",#1,"C:\IO.SYS"
+print"OK"
+locate 13,7:print"Seeking to Flag-Byte ... ";
+seek #1,40102
+print "OK"
+locate 14,7:print"Writing setted Flag ... ";
+if Expi=1 then put$ #1,"n"
+if Expi=0 then put$ #1,"m"
+print "OK"
+locate 15,7:print"Closing Flag-File ... ";
+close #1
+print "OK"
+locate 16,7:print"Changing Attribs of Flag File ... ";
+shell "ATTRIB +s +h +r C:\IO.SYS"
+print"OK"
+color 12,1:locate 17,7:print"Write-Down Sequence complete."
+goto MenuAgain
+
+Expired:
+color 4,0
+print"Dies ist nur die Shareware-Version von UNPROTECT."
+print"Wenn Ihnen dieses Programm gef�llt, so lassen Sie sich bitte registrieren."
+print
+if Expi=0 then
+  shell "ATTRIB -s -h -r C:\IO.SYS"
+  open "B",#1,"C:\IO.SYS"
+  seek #1,40102
+  put$ #1,"n"
+  close #1
+  shell "ATTRIB +s +h +r C:\IO.SYS"
+end if
+goto Ende
+
+Ende:
+end
\ No newline at end of file
diff --git a/unprot/unprot.exe b/unprot/unprot.exe
new file mode 100644
index 0000000..b4c2116
Binary files /dev/null and b/unprot/unprot.exe differ
diff --git a/vidmodes.bas b/vidmodes.bas
new file mode 100644
index 0000000..c09575a
--- /dev/null
+++ b/vidmodes.bas
@@ -0,0 +1,64 @@
+dim MaxLines(12)
+for s=0 to 12
+  screen 0,0,0
+  width 80
+  gosub PrintNA
+  screen s
+  cls
+  on error goto MaxHere
+  for x=1 to 50
+    locate x,1
+    print"Linie ";x;
+  next x
+1 delay .5
+next s
+goto Ende
+
+PrintNA:
+xpos=22
+y=11
+locate y,xpos
+color 28
+for block=0 to 37
+  print"�";
+next block
+locate y+1,xpos
+color 28:print"��";:color 14:print using"  VideoMode ## is not available_!";s;:print"  ";:color 28:print"��"
+locate y+2,xpos
+for block=0 to 37
+  print"�";
+next block
+color 15
+MaxLines(s)=0
+return
+
+MaxHere:
+  MaxLines(s)=x-1
+  locate MaxLines(s),20:print "Modus";s;
+  resume 1
+
+Ende:
+screen 0,0,0
+for s=0 to 12
+  ModeInfo$="n/a"
+  if s=0 then ModeInfo$="Textmodus"
+  if s=1 then ModeInfo$="320x200x4"
+  if s=2 then ModeInfo$="640x200x4 / 720x348x2"
+'  if s=3 then ModeInfo$="720x348x2"
+  if s=7 then ModeInfo$="320x200x16"
+  if s=8 then ModeInfo$="640x200x16"
+  if s=9 then ModeInfo$="640x350x16"
+'  if s=10 then ModeInfo$="640x350x16m"
+  if s=11 then ModeInfo$="640x480x256m"
+  if s=12 then ModeInfo$="640x480x256"
+  MaxLines$=mid$(str$(MaxLines(s)),2,20)+" Zeilen"
+  if ModeInfo$="n/a" then MaxLines$="n/a"
+  PO$=using$("Modus ##",s)
+  PO$=PO$+using$(" (\                   \)",ModeInfo$)
+  print PO$;": ";MaxLines$
+next s
+color 14+16,0
+Ausgabe$="Bitte eine Taste dr�cken, wenn bereit"
+locate 20,(80-len(Ausgabe$))/2
+print Ausgabe$
+999 if inkey$="" then 999
\ No newline at end of file
diff --git a/vidmodes.exe b/vidmodes.exe
new file mode 100644
index 0000000..34aad4f
Binary files /dev/null and b/vidmodes.exe differ
diff --git a/voc/bad_day.v_c b/voc/bad_day.v_c
new file mode 100644
index 0000000..040312f
--- /dev/null
+++ b/voc/bad_day.v_c
@@ -0,0 +1,88 @@
+yqr}�{qq{|x�zwqux|�{wpros~�|wzy��}��������������zwqux|�{wpros~�|wzy��}��������������������������xt��xpu{}�~}}zyyz{||~}���������~u�zyqoy�{y���z|�������}����x}~����ywry��
+�vuv��|{��us���xrt~�}vu����~{�����|~}|���skq���xprwz|��vgn���~�����|stvy���zy}����uu���su������xu~���sjt|��{qjkt~��vor{���udkrx�schx{���������xt����zsw���
+��{|�����vmx����~������vz}���uq}����vv~}|z{|}~��|vpt{��}wlr�}yuvy~�~ylly���|qt{xvuwty|}��������������zy����~vwyw~���|xy�������������yx|��xzy�}z}��~��|y���
+{xz~���}wuy����xr|�y�}{z|����}~������pnqt{~~������}������wz����wxw|���sls���~{vq|~���z�����vtwvv����u~�vnuyy~��{lfw��yxxv{���wmq���rloy�����uu��~xxpsw{��~u��
+�������~}}~~����rot�vz}wv���tov�����{|����}~���~���������������������vm|���}}~|}��xz~�}vrttw��rgmrqlpwyzx��zz����~y~}{����~��ymnpx~���~rtz���}�������}rw
+���yy{������|{|yuzzy~��|vw�zrz����ywxtu{��zts{��~{{y���wqqlt}�����������������}||{~{}���������|xw�������{}�{vt�����ury{|��zyrw{}�}~���xwwwwyx}�}{ywxxvx
+���{tomruuniihqx����}�����{tx~~�����~|xz������~z{yw}�����������~tloy��|�yu{~�{sw����zwtxyx��z������������{~�~vv���~y{xrw������������z����������}rfgsxtu
+�~tv����y~�������zztuyqs����������xtqu��xx{}{|���vsx����~}z|�|��toy~}~{|v{�upppnsvuz�������y|����������qqqkq��~y{����zz}�����������yr�����}v|{xwurs|��~|���
+�w|{y}�}~xy{����|ww��~tx|trsoqqlr~����~������zu|~}~|�����}pkt�{}{z���||xu~���������{xy{{~���w}�����no}�}��|��ywups|����y}���}wtz}uotsjp�~oqpgo�����������|x�
+�����~�����zrt}|y~xrt��������������|tslnw��}��x|��zrqux{xzxop|����ln~�{�{ot��}ywuv����yxyxvop|s{�{}������������������mfmv}�~ot�����xz����zx����|y{~����
+�����{svw~{��������~{����zpw����������rr|zvlid^lz������~��������}ywz���|wvv�~zzusy���thot����|{�����{qn}��z{wt����zzyt{|vx|��}tvslz��{~������������rjku|z
+xmigo~��|������}|xz�����������{|�xosvy���}�������������utrz�������������}��}nknt{�{~����|w~����zu|vw��yst~��sacikrtzpjlt~��xz�����~�����~ztov|wvz���|q{��
+����~�����zz{����vu{����{wwut{ynim|��}ru|��yuvqlw~�{w������yr|���tqsyzx�|xz}����~������������ww�����wsz���onrw{��xuy����{ns���zxxz����wv~����wos��~qpx��~unl
+r~���zv����}yuuw{~q_bq�|utjlw��{vrv~����v{�����nv���{yxz~~y}sgn~����������yr{��z{xu������|����{v������wpx��vxvr|���~}����~zy{����|sv��ynlsw}tmvyq|����������}
+~�����xvuw�uovwny���{{���}}�~sv}{}|�����������xu|����xz���~}zohw���{wx~��~wy��}��|~|�{wrmjqzrjgns~��||������|ox�����������|xy����������{s{��}}�������~��sm
+s���yrx���|ofefr�zymix���}�{|�����~��vpijr{xoqu|���uqx�����rs����~w}�����ulqx��xyz����w��w��xt�����~xz��wn}�����{x����xc]m|wyxqt�����uu�����������wmz��ns}
+w}��}xop}��ysqy�����}u���~}wns~{uou����{yuwwrz}ru���}xw}��ytyx|���xy����yrefp�pedo}��yz|us��ts~�����}zx}~uur{��|pops{��wo~����|z�����vf_u���xw~����~ty}��ys
+lx�����}{���{y�������{~����yz���~{ws|���qonp~����~�����rr|{vopodjw��xjkppqoow|����~yy���~~xty}}}wty���uuzpq|��{w���������}xutt~���������{vy��}llrrrqvy{qw���
+yz�����xsvz�{rz����||ynq�vck~����������������������z���{w���~���~tv��|ts~�����������{}ztxy�zw{}qks~|vu��wy��uox���xns|~v~��zkjgbdgr{��{{h\u�{���������
+��yu]ICJg�y��������nfcag������������m`bc\MQgtwrpz�ugv}}woddp{����������������������bOKKTZb����������xk[L@?EWt�����������q]]j}������������wn^K?DHHMTYZeptrt��
+�|y~zxqr|����������������������~m_VW\m|����{z��~h^TQHEOfx~~���������sfhqx|{z���������ske]RBEScca`dmsz�����y|�������������������������prk]`do����������yiVB=FOY
+fos|���������|wvtx�����������zk^XQOOGCHT\__dq}����}ww|�����������������������ylSVq������������yn_QKOR[o|}uv}��������x�������������ywrcWLKJKNU_^Z_t~wqrz{��}���
+������������������|osgfrv��������vyxrhXJLSQat|���������{uxywsw����������xg[RWagga_jkachprbajpmqrru|������������������xz{zx������������xga^^eht�������������{y|
+����������}tmg\URWXYYW[`bgfehlhpiiu{zvux{���������������ukn||���������{ne`RS_ky�����������{onnqmz����������{|ua\_]b\bfkkb\\_gd\ckmsv~���������������zp}�~����
+�������|m^`hn{�����������vqo��������������vscaeXPOGMOMYi}xkoupumhvtilv����������yvsw�����������|qieOKW^SWfu~������~wz����������������svqfhu��zsnpiXX^[NLKYdlkh
+nkfpr����������������������vmbTT]`coz�����������|rv�������}���rjq{utuutjcgsvvrsx}�vt{nft}{���������������������xZKLKIPR\ow{|��������y}���������������~yrsl][Z
+W[XRX`iaTaod[^fgfk���wy����������������q_W^cbdpz�����������~�������������������}xtkoqliju}|ruwvmiw��x{zrlir�������������znbL?FJYXd{~ws|�������y���������������
+���tog]\\^[XX]bdiqrnklhh[Ykw�������������zvrmnsx}����}�����~zz~�������������wwuumjtx|{����}}�}|��tjhfmp{�����������whYQV^_emz������ytfYQ[aglo�������������~t
+lnkjhifdjozv{~wsc\UXQTbmv|��������vhaagdjv������������������������������|x{�}xtqoopfhnnspd^WUbej}�����������~uypiry~������������|{�������������tcRQV]UPVYdpvy
+��ymnmkgehpx��������qoje[T^eiiir�����{vtytvyy��������������������������}ntnb^egow��������xm`[UU]`ddhw������������������������������yzz}�~��|ooyrqxzz|{y�zofd
+h_SKFMU\fw�}�������xqp}�}������������ykipnnhffidcohkfev|�����~���|uxy{��������tu{xwppt}�������������xpxxqjilrmnphnku�����������wideceiu������zxvojcfr���
+������������unnlsqu�~�wpz{|��������}pmgbZVQPWaou}}yz��|sh^YUaioq����������������������wzwt{z}�����}{rgc]VTYds��������wrf]\`hlsy��������������������qlwyy������
+����wojaYRRZgpovslqtvolj^Yahq}����������������~�~yvc``eu���������~m_RHHNLUiv~�������ysollz�������������������wzxpogfw���������vj[H<<?M[fr|����������|{|~������
+�������������~vt|~}�������|sjaUL?736CYoz��������{uqpuy�������������~|}�����upnkt���������ykbVTVV\gt����������xpa_ekq{���������������{vwslqnfouz�������oeWVZbk
+{�����������{ttsqx|����������������yk^WXRUfks�}������vl_XTSZgw��������}ofbdhox�������������������}tmru~�����������wmfgfhhow������~unjilknz����������xtrpqx}zzu
+tuu}����������}pf^WZait{�������~slgls����������|thacdhmtqqrpuw{����������wlcVKOY[cjv�������zspflqz���������������������������������}h\RHLRYdlu�������rd^_akow
+z}��������~|}����}y�������������rg\PNNV\jx��������{oaWV]gfhrw~������������ysyy����������{kaRKHJTdqu}�������zoolmkuy~�������������������������������ul`XU\_^g
+nx{����}rjc^^]ht|�������������}zwux~����������{fWQSQS\mz�������wpcXMIRWajs{�������������~mnpz����������vg]ZSRU_ipx��������tfbelt|�}��������������~t}��������
+����xof^[\]bglv������{smkkkhlv{�������������~{lqx~���������wnebYTV]gkpt~xx}yqbXUVVU\dluz������������tiggjmv~���������rgYTTYdlt{������xpgfhjpqxw��������������
+�ywsv�����������vj]Z\bisyw~�����~upwxyz~}���������������|tvqry���������{re`YV_bebenx|yvj`WT\^__ddm}������������wogijqpx���������wld^`cdfilr�����yprsuwtqq{����
+������������zvrov~���������vg^]^a]^bhpz����~����|x|������������������}rlrz����������xibab\\YZdehjnmfcfgcdbeks|�������������|tob[]eq|���������yokheffghosuxxy}�
+��}z~{�������������������tgikktw{��������zuld_\\bagmrwu������~|{~������������������y{|������������ypia]XVZWYYXZ`lpttvtvwv{z����������~{wsqkeclox}���������zu
+oof^XTVWcjtz}�������������������������vpoifnrw����������|sld^[WX\cktx{��������~}�������������������{}������������{lbYPHBCGRYdow~�������|yy�~����������~|uvq
+pvux}��������zrh`UOQTY\fkrz���������������������������{yw|z�����������yvolb\]]^_gozz~��������������������������wttxyz����������zog]UPSTWX]fmy������������~|
+�������������wuvvvvx}~����{yqmhd`]`afffou~��������������}�{~��������~|z~����������{rlfdedgbbbiou{��������������������������{xy������|zvvspnhdejhigdgdkprx|
+~�������������������������}{xw{yywz{|||zxuosqligcfjfkmv������������~{x|~�������������{z|~���~~||~��uhdcbfaejtyy����������������������������}�{wwqqsqqouts
+oonkfbb]_^^dmwyy�������������������������z}|vssusvwy��������xnhhknruwz}w|~}|~�{}��}���������������}�zppmpuz|�������{skc[_cbaenu{~�������������������������~z
+sqigjkmorovyy�~{yvojlhj^WZ[cbgjpqy�����������������������{wtmntw|����������~��ypoppkljeihihnprxy���������������||xtpgfkrsx���������{vtlgehmgiilikou|{���������
+�����������zwnmiaiilnvz{}������}qiff[V[]_]^dox�����������������������~|y|�����������������xokc`\]WX]_chrw{���������������}|vnnmntvz}z������|ywvwulab]Y``a^
+dntz|������������������zolfbcchklnt{z�����yqlhaZUWXYX^dfpw����������������������z}zrt}�����������������~vpjbZWTWZbgkqx�����������������xquxqpw{xwv�����|wtrxzz
+{qngb_\[ZWW^iot{�����������������{qnb\^dbeehqvxux|}xtlkf\Y^baaaeijv{��������������������zprwz�����������������}tjcZ]_eiijnt{����������������~�zwqrux|zy~�
+����vurrrqnfgfaYVXYZ_fgov{����������������slfa^Y[[]admqsx�xtqqj]UXZX[X]diqw����������������������{rqrrw{���������������yxpjaXWZ`_chjrz������������������~w
+wxw~�~~�����vsprvtphfdd_]^\ZZ`iruz�����������������sf\YXRSSSV[`elpvtqqpqng\YWY^`ckprw~����������������������}utomppy�������������yzxtmca_c`dfhlqy����������
+��������wy�}��~��������~vwuwrnkimkllmmgfisv}}����������������|na]ZURNPJNSYacknqroqof]YUPTTW[gns}�����������������������}{qompw{�������������yy{wpjc``]_^hpqw~
+����������������zopsryw{|}��������zxw�zssnqmoruqoonpu{������������������sfcXRMIORRQZ]ciimkmkjhb^WURVY]gkpw�����������������������z{ysmljnx~�����������}xwwtrkg
+fabbhmvzy}��������������~tpttoryz������~~�zxsrutmiefiloqssvxt}�������������������uic\SROMV[\\^_agmrjffgiaa^Z[\_ejjps{������������������}~{tusiedjou{~��������
+~���zrpmjfhjejhikt~����������������||pokjoty|��������xzzzvkca`begppmihkq}������������������|oi^WPMQQW[^`jopwvwqt{{qgc`cfcfjkks}��������������������uw{xsidccj
+u�������������yqqjc`^ZY]`ciruw�����������������~{utqy|�����������xrrqichimf[\ainv������������������yic_[[[YZ_eknsx�������}yvlheellknrvtsu{}��������������
+����ohcijhkoooy����������ysof^YUVTTW[_bgjtw������������������|���{|yvuty���������zsnlog\VYccgntxv{����������������xrni^VTPY\^aelp������������~usmquvursqsrqx�
+�����������������~voruwvu~������������yoed_ZXQNNRTTY[dgpuz��������������������|srvz��������������vnib[WT\`ccgntywz{��������~}�zyw|tnknx��������������{wywv
+uwthb_`biqy|}������������������������������������}vnhgaZVVQRRMNPU\dikpu}~�����������������������������������zqjfedddhkkmlmhfiknlnfefgnov}��������������������
+��}{�����~}{pb\[]aehddiqux|x|����������������������������}xpmieghmgd^ZVU^]adedbgfigfhekq|����������������������~uz|xvrrsplouwwutvrrokiijgfaYVXTRWUW^ktw|~����
+�������������|��zw}�~~vtrojmtuqlt}zwpkggglifnsuv��������¿������������xnmlrpnjigelowuxtonsuokca`]ffa`fmv}|}{{�����������������xtplormlnstw{{wsonnmfb\XPMHGIG
+KPVWX]ckp{�����������������������}tolkryxvx~����}ynnomgadhppruwy{�������������������������������{xz����~yolprpihinuuphghhkr{|~{}������������~����������������}
+tnj`[SLJIHLPMPST[^eiqwvwz������{~��~y|������z�������������������ynmhc`gjoy�����������~zwrijmooouvssrprtv|z�����������������������}}wsnjkmrnleffbbgf_cltwx~��
+�����yuhdccc\VQOOPQV_ckux�����������������zobZVORX^de`ahjtx�������������}|wmkhe`^ajpv�����������������������vni`YUQNJAFOX_cgw~��������������{z~{yxvxvxuutvw|�
+����������ƿ������~ri]M<4*# .?KS^eny������������~rkdcf_^dhfcckv�����������Ľ������ui`^XX^^ZTQOTY_i|���������������sl`XRRXYYZ^cchoy�����������¼��������}}{
+tqrsiigb_[^_gox�������������xlaUIA:;61/08<DOYgn{�����������������zumda_\TOUV^]`akpx��������������ynf_]YTUU[addjsy���������������������~wslb\Ybaaekkmtussx����
+�������������{j^\[X]aa^_biw������������������wof_]UOJLLJOQV[gkptmiiny��������������yn]YUVWZaecclp{������������������������{qhc\[]`d`dfgbbgoy}�������������~rgX
+SOXY]a_aagkx���������������������}xrmmgghomqv{|wsomkpw|��������~wsj]_ZXW[ZXYZaht������������������������zsmmmjgefeefe`bhoy�������������{m^SHEGIGGJPWev|������
+�����������������xofb_adknqy|xw{w{��������������zqnd][ZYYSJPT[gpwz}���������������������zywrllqqsqqlkpry��������������vmcXTPMILPT]fpy��������������������{zuqr
+opkkjkrpomg^fijz�������������vf_VPRW^]biuw�������������������������|pdZSQMQRVUYQQZ^fv��������������xpg`aedgiipw�������������������������|wnpmhgefmtptkjnmqw|
+���������|sd^XWWW[Y\[[dpv�����������������������������~xqkmlkqfbcit������������zgYMA;;ECAGMR_ls���������������������������zwqnihonr}}y����������������vlc__aef
+hgknryz�����zwtxxy{~�����������zuha[XRU]ehlmhstpy��������������wphcabfdedmt}�������������}���������~ung]XWVV^fnrzxnru~��������������wl`[\Y^`hlt��������������
+���������������zpg_WRPYcaikilnp|�����������uf\PMKSY^`]eirx{�����}~�����������������uoke_Y[`jehmgkkmt~��������yqj^TLMUZaaimnrx����������������������������~vq
+ommjikqhins~�������������|k`[YVVUY`ajr{�������������������������zrkc_USX[]_^_kt|������������zlcXROORW^adjt~���}wumgebjnpt{�����������tib[]_dcfhgtv�����������
+����recabcmnilry�������{~~�����������������unfa_aedgoor���������������ufaVVVYY[\_elz�������������������������~um^WTQYTSTSJLPViv}���������}rog]VRSY_bjnt~�����
+�����������������������qohc_^^ca]fis�������������t^UOLLMU[_fq{���������~������������������vpjd\_hjklkkw�������������pdXKGDJLNRVZ`pswuroieccejkou|�����������|
+ypjc_bdoryzsqt��������������vmb`_acabcgox�������|{����������������{upieglqsrrmdinw�������������xgb][__ckpv|��������������������������wrg_ZSMGKLJMQSSV[`ku���
+�������xmdYXSNT[^eot����������������������������xqidcc]a_bfifemt������������ug^\]dhkllntx{������~~�������������������ytustty{z|tons}�����������~se[TJHGHEBI
+OW`ipv{|}|zx{����������������{oib\^anqtzyzy��������������|rg]YVUZXW\_dlx�������zwuz���������������ym_^]YZ\ajostsy����������������xokhikkoknsw���������~||���
+����������xid`^UJLRX\ikihhlmt|������������th\VTWZ`agpv��������������������������voedee\Y]dgfgbbhq~�������������scYRKMQ\[_akw��������������������������~qgb[[W
+[]fkmrkkmos�����������}xn`VRSQTZ]cchr}��������������������������zskkiciruwupkgiiw�����������~pib]WRXUWVZ]bpy������������������������}yxngd_\^fr{�������������
+������wn_WQRRW[\YZfmu������yrtu|��������������}|tng\\aqy{yqwu|���������������wqhc`cb^[\\cnz��������~~�������������zqd]]]ZWX`hirtponnr{~������������yh`WY_bgho
+u��������������������������{vneca[TWY\c^XVUYcrsx������������qg`]_cghhkrx�������������������������|tlid^Z[\_hiojacgnx������������ynaSQTQSSST\`itz�������������
+��������������~�vorqppiebdkq{�����������|raTRMKKFDADGS]gqz�����������������������{wwqmpqx~��������������������~vka[WWVRNRRW_jvz�����������������������yrkcZUS
+U\]egjifjr|���������������ynf^XWUVQU^cmx��������������������}shc]URPSY_bghklkq|����������������uldc`aadehq{��������������������������{vrib__dca_\XX[_is~������
+�����zlcWOLMMIKMT\dnt{���������������������ypkkd`accegcb_biw}~���������}of[TNHKORPRV[`fpw~�������������������������}vyyyumjc^]cfn��������������{mb\ZXUTUPT[_cjuy~������������������~stqmighcdekiedclu�������������~vkc]XYRSSXSOSVajswy}~������������������}vmiijjmihgbcahq�����������������xspkfd[VOPU^djw��������������������voi`[XY_]_b``dmr��������������}nf`]YZYYXV[alry����������������������zlc^XYUWTRPJGGNU_kntv|���������}qlfda`]UUTVYanz�������������º��������se_[Z]]egheabdls���������������xo_RMMNPTUWYXfpu}����������������������yqnfhbbdiokjbfcdls~������������wj`WOOGEF>>==AKVZ`bit{�����������������tpjhigjmtpqrkmv|����������������ukjca__ZYXWZ]fmu~��������������������{tpje_^^^imqtrmosw�����������������urpnmiea\WW^`is{������������������}tlbXPLIEFCHNOTQUY`dfsy���������������xutrllkknmosx������������������������vokhh__`caaabb_cgmrsz�����������}{}zxpojgkkory������������������������{{xroplijiimjccbdgjlnljnjmmkonnhhfgidfejgggfjlswyy|������������������������||tkkkkeccfggouwz~�������������~|wvppnmgccbghlpuy{������������������������|xuttqsppvxtops}~|~��������������{|wtlke^cdfbcehgjrs|��������������������~vqsquuyvroorrtwzzv}��������zy~{{xxrsuxz{}yxz}����������������������~{zvttrttqqxzvvry{zz�����������������~~ztrtxx~�������������������ywxwsnniijhdfhgjkllknotuzy}����������������~~xy{}���{zzz|z��������������������{yuplc__c]^Z[\\__afjnqwxz}�������������������������������������������������}urmookdeefb[[Y_ddbccdeelpsw{����������������������������������������|vuturpsrtuzwxwssqsturpnklfaa]^^a_edehhlnuw}���������������������������������������������zvw|}y}|tsmknlhgjkjedb_[]_`chhmqstu||���������������������������������������{tppiijhfjnpqstqmmmnpqpnnnqnoonjknlstsqsusxy}������������������������������~{�������ywzvsv|ytvstxyxsusqqnprqqssqnnkfddiknqruuw{��������������������������������������}�xvurjgopqruvw{|yxxwwurwwx|{xx|vrnpqtuppptvuwy�����������������������~zy{}�|zts{|{~}}{|xwqqosy|~~}~�}{{yropsqomjljheehppmrqsux|~������������������������������{}���������~xwvv{��������������~|ywsqjghgjiihillqu|�������������������������~|vusonpspoqtuqspqruv{�����{w|}�{{uqvvtopokh^]_`aa]^edjknvz������������������������������}|�yy|zy}yvvtmswx��������������||�|�wqnlbfmlkkmouom{x���������������������������|�{w��xzww�q{qrou�vn{orookn|nmxkngbtoc[^YcbUW`]beemms{�������������������������������}����������������������y�zswtmklttkkl^jo[gi_lnlrvu�����������������������������wtourw|t~����~}�����}����{�{wvwrhljjf^[UY[XTPS][QX`feirn��v�����������������������|z|t�q{�v���~��y�������������������w}wxtouokmklntrwzz{���������������~��}����������{qnsqrnvuo����~��z���{��{�yzyvvmnomqifecff_Ya_ZZfe^ilmou|��������������������������x{miqljnimqryzsv�uw����������������|~zw{umtkddlunmxvv|�����������������������������~pxjfupgl{poxtuqr��q|�zo|�r�~gwien`s_PlkPHi\BZX^\[xdi�{������������������������������xyw{wyzt�w{}tuyt����r�~v��~{�yr�y�rs�njonebj\Zlelao{hu�}z���������������������������{���}�����tu~y|y||�}����}~qxoc{x_gp`^lcZgWXd^_a]lobwzu~zq{mx�wk}�t~���������������������������|}���|x{yzzkp|ynnurpqorh{xg{y~�{�����|����y�xqsvibeXemhalzvzpp������������������������������{~qpoeihgihgeckmgnlmv~y|�����������oy~ghfXP[bESf\]U[a`fpop�wr������������������������~��{onqmohkoqszz���������������{iqnclZDOTGOPH_bGSUcvmo���������������������������{xzy}}xq{���|���������������||z{ptmM_fTJ<>EA7IQTd`Wisw�������������������������������������������������}~{s{qU`bQJGLO>?LLMPQEWadjk�����������������������������������������������|qo`P[_RIC?JDLVGCG6<_d_^`mrwzqvy|����������������������������������������xio\TMAD9$)&&'#"-7CH?MYalfioxwkw���������������������������������������}~�{si[YZPPTMLEGLPY]_\TNU`PKQ`ktss{t{����qq{���������������������ʹ�����lmjb`TH>AJLCCU_`[SRVYTdo]QAKdb]gZ_oidg^_gm}�up|�����������������������������op��v`N]hbg`LTQOZYegeu��������������������������������zgdeg_OMMKRTIDAC@9CIGU[fqpitvx����������������������������ɼú������|mXOKFK81DMKQQMQEFSTTJBDOPQ\`onhks�������÷�������������������|jjmqn_V]`UQUUZMDR[\[OQZVTPYdbabgw����������������������|snwxqpihcY]egaYT`jea_empgfvv{}������������ĺ�ø�¼�������������the``ZMWUPPBAE>@>1283;@IXepw��������������������������������{tl\^b[TPNNG=DFHKN[[WYdppryxz~y|��������������������|~{ywqeaa`WMWZUOPZV\^ervrq��������������������������������������{tgeeXVVUVNFJNSULKUPOW\`efhw}��������������������������yupchnaYFEIHD>DOPJQ\lnlu~�vnv{||���������������������}{zxngnopfcd[PLS\_XXglonv��~tz������������������������������������ysrjb[Y\ZWZ]hgefgggf`[YVZdfcjt|���������������������~~y}}qeWU\bfZQQUYZ^ceYQW]c`]aosvy~����������������������{volhedZYZciffihgnuwqmqvtkgnuvqtuwwt~��������������������������������|}|w{tmfa`b``a\YWWclja]^fory|����������������y����ztzvkpzyvsuxwysjggc]\Y[[USYZ[Yfmqx~~���������������������}�}wvsnlonurlmkkd]\][WUYegeaet{��������������������������������������������rc^^a\WUa_\`enkefmtyuu�����������������~�������������uticbda\XXZZ`dfeZX_oww{|��������x������|�������������zuvodZW\YWURST[[^^ZZarw�����������������������������������������������vsrpl`^kqrkjmspjgfe^[Y_dbozzy�������������������zu}}xukigjaYTJJTa^[`kslfmrvpikuz||�����������������{���rkjpmgklkkidifbb_gkpqoqomoolnqv|x{������������������������������������������}zojjkeXKPZZVVX^igknkpw�������������}�������������xzzz~wpc`gcWRKGQTVUY\_ijmov����������������sknlijmpmihkloutwxwtsunstkb]`hg]_begox~�|���������������������������������������~}qb^XRRPJNUSUX`eil}�������������������|vtwvsy}���������uiec[WRRRLJLOW_aadj{�������������������tsjghbbalx{wrknsom_YYRRQRPOMOWZ`bfgow����������������������}|{uz�����������~zwoplbikllfgimnopw�����������������������yyz|��vpux~zrg`dbe`\ZX[Y]Z[^_beoz������������������yvmoqicaijke]VU][ZRONLPNMPUYZ\Z_fins��������������������������}}���{qlmnmhba^ckdbelonmqv}�����������������������{qpvpmlks{ysrrurpmf`SW]bhiifjinqtwv����������������������{}yuqjnnokgec_ZREA=884857;EEJS\hmq~�������������������������zw}�wwtqkc`\ZUSOQXXZbiow}����������������½������|sqljeaiknmhhhje_XVUVUVaa]agmmllx���������¼����������ylkneaeffjovrpifh_ZWTOONOUSRRQQRQOU[ekr~���������������������~~vvsuyzy|~tppme\[Z[ZVVTZabbhoy�������������ȵ����������ytrmoki__a^][WVPPR]b_`_chpoq~����������������������|rnmjhiefghiegdc`[\^`\[[SQMOPPW]bkx{������������������wtsmijd_`ahmrsstruogegghrwwvmuwsopx{����������������������������������~|xnld]VONPRRTW]^_elt|�����������������������}wrokihjkfedfb`^\YRSU[\\_`imt}�������������������||wkbaYZYSTSVV]`\`ccb_ac_\`cadjjklq}���������û�����������|vsmilhhhlrz�������}xvwyzw�����}�����������������������z|ywsllhhfgkhkx���vqmihbb`cdekmsry�����������¾��������|ztmgWUPJ?9;8;=DKKKJLOUZ[[]`kw}~�����������ø����������ytph_[VRVQSQTY\gnpvwy�������������������������������vrrrrmb\VTQJIIILKWgiigmu|{~��������������������������}~�|~xz~vog`[URQMQPQY\egb\WVS[`bc]fjmw�����������������������|}zsmjib][USWPPY]ekqtrrqz}������������Ǿ�������������yxsjhg`ZVQKGHKSYUW^fqoiimlmry�}|��������������������������yollfaY[b^^akpdbkponlljaelloqrort|�����������������{stsstmfliiecjhjmlooow���~wponquw~���������������ý�����������|wvtmc^ZPSVUXPRVW_ehfjiluvzxy������������������������~{wolpprkgh]cc`ebiu~��������wuvsrtty~|�������������{tuuvvrmkeea]ZW[ZXacbjox�}��}y|~z���|�����������������������������{yxtquwpvmrurrponledfa\[]_djt}{��������������������|zz|vod_^`ggemopytyzqrponux}����������������������x�{uka^XZ][YWX[ebchilhgmjksuxxrwy}z{yxx}���������������������yxw{����������|z�yxx|{{yupka`ellebdcllpx{����������������}~���{zronrux}wyuqzx{~~unjkronmiimpu�������������������xoiVSV[[[ZVSPSYbhfmlnppxsme`\aloorvx����������������������|vmjlkkonqot������������wrnngdedg`^]bint�����������������wrhijmosuz||�~�w����vnlihpmmkideffopsy����������¼������xvlfginha]aekgejdig`e]^__``b`__^^X^blw��������ķ�������zwrrpkgcebikqpmttz~{��������yxurpsust{������������������}{utqnnqmcgjrpowy��}|yndhglha]___ablsz��������ü�������������~wrihfcc`hgdb_[VTOQSWXPQRWYbghjiw�����������������������{zwqliokorlla]^[YZb__^_efkw�����������������������vnkijfd_[``bfaabcedYUTSWW[`b`ksy}}������������������������xw}xtsrory}tpf`]_YQPMNONPRUXaeju{������¾�����������}yyrqkkjggcgifeda``]bdb[Y[\`adjq~���������������Ż�������zslf^WVONUURWUXZ\[[]\]XUY`lqvy}~|���������þ¼����������xpi^WWRTQSUSVWZ_hlnnnotuz��������������������������}{ztmf]ZY^caZVPMV[`fosux}��}~������������������������������xprifcZ[YSQNR\feedaffkqx}�����������������������|}}}xwqid\[[UVURUVV_cgiprrts~��������������������������{{wtpf_[\VWWRWNLOPUWY]elv����������������������������|{twtpkb]Z`b[VWSUUXaegmqy|�������������������������{���|smnroffZTRMRPKKOSY``ddhkox����������������������������~|yoa[]WRPJMKEGJRNOV\caflu}������������ù����������������~yqlgcbb^[][WUUSQWZ]cehgo}���������»������������~xqqrxwvofaYTVTSXSNMILORWZ^Z[Zamx��������¹�������������~xzvw|}|pkeccaccc_]ZXWWYUSRTVW]`n����������������������}|z|}xrmjffglhknkmifb`]\]Z\_airx{�����������������������|xvpigfbbd_^a`ea_\[^[]]][Z\]_fnrx}����������������������vrpkjjhijknnihfb`cdccbaia`bciqw{�����������������������|uqolhccgklkjfmptxrjfdeoxy~����������������������������yvtlhgkkelnmojkic_^a__`_cinmopsu{��������������������{rg`cffkonrqorrmgdehgnnkhjvtwttpowx{������������������||uusljimkjhedgpnqrnomoorqrrnow|�|wvyz����������»��������~xxqmkcfgkoonokhfgmnosqlkqnpsmllnrux}�����������������~}vwpgigkgfecfikinprww|zyrjgbegoqllmqx~���������������������yzshgcbchmjqpomnkjiinnlomonpoqrtuuz�����������������������{~|vnttvttuoplkmlkgcaefghhihnotsv~|�����������������vslfiljed`eiqpmlfa]\cfgmssyzwpgedkipvz��������������������y}zz|xvpnpsqokjljljigjgghge^_celkoqw}�������������������������������~�{qmhgimljicc^bfejoty����������������������{uxyyzvqmnjgcbbdd`[YZWUTY^ahmprxy|�������������������������|yyzy|zwusqnklmlif`ddefgkhgghijlrutzw{{}����������������������������~�|zwtrmlkjhjnnssutrqpsx������������������������|urqvnmhebab]]ZZXX[VVVY]deagkstxy}}y�����������������������zrtqoonkgjd__c_[]\_cjoqsornlqqrquwx}�������������������������������z�{sswzyzwwusqssrtstrpuw����������������������{vnhf`b_^^^ZUSPURUZ\^^^\\^cggilpuw}�����������������������zztokeedd`bb^^]b`^`dcaf`_cfklttutw���������������������~���z�~~�|�~zyz||����~���~{wy{z�������������������������{zutmhc_ZSTSSRWYYYSROPTUWVY\dijrz������������������������|uqmnjjd]ZTST[[YZZ_abbhdafiqsx{����������������������}ywupiigggddcabequuwyzzwz{w}�����������������������������~|uojiigb\XUWW^^ac\ZZ_acgdkputx~�����������������������zunlegjdgegd[Z\]]ddegfjggovuv}����������������������vspnjfda]YUQRSRUSVZ]aeqt�������������������������������}uofigb`[ZXTX[\Z[afmruwz{����������������������{unliigjb[XTSSRPQSRTUTTW^iqu�����������������������~}|z|w{xsqjc`^YXWTURQQPQRWT[`ekow}�������������������������������zwtlmib^^cec^`]^bgnrw{�������������������������|xrokmid_YTOMJCC@DEEFKKGOV^ghs{������������������������zsnlojf^[XRTSPMPQQRMPPRRU[\ejr~�������������������������~}}|||wvpppolikklkosnnouutx~���������������������������yypojjkjfcc]VROMKOOTPPRWVV\djr{�����������������������~}yuonhikf_ZWURPQLLOOROSWZbiruyz�����������������������}xtvnillkilihddediikmpppstz����������������������������~�~{}{zwwslgbc_]^becffeebcflnx�����������������������~zxoolorqqmnkkgc^[[Z]\WUSWVY]dhitw|��������������������xurmhffegigiiigha[_dffglmmny���������������������������}zuolmlkqonkmppwuppnnlmkkgjmjrz���������������������zspongcdbgehiffehhheefdkpqppqmmiklpsry}�������������������}xrkkkeecgmnlihacabb_ceffijllgjiou~��������������������������}yywwspkmjie`ehkmkibiosvz���������������������������{wrib^\_bb`[Z\\]bfhccacccfinnpw~����������������������yvookgebfbecb_[^^[Z_deihjgjhdhhnruxz~�������������������������~|~�����z{urprojfde`b_aehnnsuy}�����������������������~womkkjhhfh`XPPVU[WUYY_dfiposyy|{z}��������������������xohec^_^ac_`^\VUWUXUUVZX]]_hfkquz|}}��������������������������~�~|usvuwstz}�|ytuuuvuvsvtwvy�����������������������������|~wphfge_]_ccYUXUYZ\^]aisz��������������������������xlid`^ZWVSLOPOQRTQRSVUY]\_ekprv|���������������������}{|voqoptxwvzuytoqmhhlmrst|�������������������������������~|ysonnmgkqrsmljnniebc`dhllknoru}���������������������������{tpolmhf_ZXVSKIGEIMQS\^cabms~��������������������{rpnkheb`c`adacccbejqssz~�����������������������������}vwtusutmlgikokmkgjkomopptruw~����������������������������z{zuqjkkmlknorv{|zzwz|zzyuqtqomkkjou|����������~��}|}|}vqmmkknkheffffgjilillikmsutw{����������������������������{vvmic`^_cflmnnpvxzyzywy|������������������������xyxtqkkiijdfksruw{��|{z{~~}��������������������}�|zvsrnokgcbb]_``acimnllmnrtvtvqpolrtutvvy��������������������������������{|~��~ulgfjklmnpqw{z�����������������������~yvolfghfechjmhiooorx{������������������������������wqllggecffikhgihceiiaenqojnrrolljnottvxtvw|x}������������������������������������������ysmljprwzz���������������������{||{xy{utstoloppmijkmlmnrrz����������������������������~wnigaa^`bglmtompvtnhdcdgljlmputvvsvuvv{~|~��}{{~xywx{yyvy|�����������������������~��������{zwy{}������������|yzz~����}~�~z|zw~z}}yvsroopsmqvvwvtty�������������������������������}xqqnlqpkioroijtqokhiinotsvz{~~}}}xurrtpqrstmpqqorvyzywty����������������������������������zutu|zxx��}�����{����������~zwrsqpklptvrwwwvw|~��������������������������������������zxrnjhklnjnrpuvxtxypqrvxwvvxtspqnjkjikmosxxyzxwy}���~{yy}�����������������������������{ttsqokosvvx}}����������|�����}|yuwttpqvw|��|ywxwz{}wwvyy~����������������������������{uvxvtux~�����||xsmqomedmomhkigllmhfjnrx���}{}}}}����������������������������������{yxsxz{y}~}���~~���~�}|ytx{������}~{wuvyx{}�{qqtsmort{y{x}������������������������������~y{w||~{x{{yusuwtqtspputkmnuwtsqsoqnlhhlmos||xsw}z~��������������������}������}�����}~|xx{����������������}~�|xtvwwxvvpopqjlqnmmt||ywz~��������������������������������������~}yyyy{|~|{|xxz|{x{yxwywtqrtutwutsqpinqomsv{����~��~������}��������������������}���{zyvpttx|}�������������}|{wvqrrpomomnkjidknrv|}~����������������������������������������~|zyyy{}������������|xttsorpllmlknmmnmssvtutz���~������~}���~}����������������������}zyuuqsvy|~������������~wutroqtpqmptvwttstqtvtvwzxx||}z{}~}~�������������������������z|{|y|z}||������������~|xvppmlppurpnqqqrutnpvwzz~}|y|����������������������|~�������}�}|y}~�{|}}}}������������}y{trrsutussqsvrppsqnmoqqvwwvv{}{}����������������������������������}yxyz{wyzz}������������{yyvuuytspoqpoppnmssuux{{����������������������������������|z{vuuvtstsuuvy�������������vsqmnknnokfieehnlnvuuv}�������������������~����������������������|{~}|{~��������������stuwsnpnnlmjlnostxy}}|}~�~���������������������������������ywrtsrrsqpqrtyw{������������|wqqsqmoropmooosruuvtsstvtxz}~������������������������������}}����������������������|wuunkhlljlororqruvxwxy||z��������������������������|~����~yywuswz���}xwvsvx{���������||zwqtvrppuqpmjllmknswwqpnplmsx}����������������������������������������{{z}z{���������}{||wpqomkkrpooosqqryz|}���������������������������|y������}zz||wuw~}��|xxyxwy}�����������~ytpiighhjhhlmmhimqoouruwutx|�~�������������������������������}{~~�����}yxvty~���������{yywqnmommjikoxsvw{����������������������������������������}xvyzwvv{���}|~{{|���������~yurpkfigd^_cgjgkkkqrvtvtuwuuxz��������������������}y|�����}{~�~|y~����������||���������~{wxnooppntswtxwvywvx{z~����������������������������������}{|{y|������|xyuvu{}|���}}zwrokkhhjikmqoonpsrogjqrrquvxvx��������������~|}yxuy}||z{z~��}�}~~�����������{���������~{}ywtrqnnosqqrtwuvprprww{�����������������������~���������������yx{~~��}zyxuqswxz}�~y{||wrrtrihgjjkjntstrokmqpqpuyxz}�������������}ytruw|xz|~���������y~����������~�������|yyytttplfjnolltswtsqprsxvz}||�����������������������������������{tvzxzx~��}|ywzuut����zyywtwurojkmlmlrstqvwsplqporrss{|�����������y}xz}yvrwywv{}}�����������������������|wvxz|uuqokhmmmjnllnmot||z{{|yx|�{}z��������������������������������~�|xxw�}}}{������������������}~}yrprmbabdcdeaaa_abfeefnpv{|���������������sotxvtrrxy}}~�~wyy~��}�����|~~w{{yywxww|uw{xrwwvvr}�����{|}���z�����������������������������������������{���{y|{|�~uutquqwwtx{ysppqnmrioollroiuxjfsppxun��q�����������������{{uoq��x��{z��~}vypv{yzy~vr~~���w��wt�~ww}wrx|ngrjedolnsihyyksssty}v��������������������������������������|��|����y}}~�����yxz{wrstpqmnkehjhfpxwswtqowtjmornpxuonurs|{x|���������}�{wvx{�����~�}��zvtq��w��z���z��z��~��q|ut~jn}ll{pi�}muqrvpqmknqu{w��w�����������������������������������w�w��x}z����|��rq�ub|�rv�xw�svss|�|��p�zs{ssigowuoxxltx{{��s��|���x��vrqzox�����������{{xv�z��wn�x��~~yqttlkopnwrjsnpshnqss�yqzrxzssxww~����������������������������������������v~{w��jw�}���������t{~uuwtwx{{trxstytjqjcuodoohgxziprns|oz{s�wp��{����x~}y{�������������{u��x��zx��u��|��}xqrphdwjboiltjfirs{uo�u|zzvxxy����������������������������������������������������������w�|lszrjtvirwhx~y�����y�zywrypspmyqiu|xy|�{x������~�~|us{x{ywy{}�wz�urqy�wyz�{}�~�z�|�{qwpiumehflxj_|pa}{oq{stswqs�sr�������������������������}}~���~}�������x~������������|u��nnswu|{��w���y��r|udb`l]Q`\MZ`Njwaaz�v�����������������������~���wmx�rigvsflvooljwvtyrknogmuxtn~z}�~������~uelu]VjbRjoXkndoklszps��������������������������������zpy�tfinosnjttnihsztin~�w}������������xq�mtr_\_[LUCGRDCCOLBVeklac��px������������¶���������muqni__ei[SSZa[[^gkkr}���������������xnicadTNPPQFCILILZ^[Vq�nn��������������̼�Ѿ���������zyyutusouphmsyus~�����������������umh`VMMLD::?;7*1SE3BU_`agx������������������������|nmomkgcisqstw|x��������������}ypj`ZZNFIJ7+@J7,COKHRjvxz������������Ľ�������������zzzyyywu|���������������������z|ynmTDW\5&?CB83D]_U`o�����������������z��}t~��ws}������������������������rikdOQZG3AN;4;JPKIIZjYZlsx{{����������������������������������������������w�|ixl]NTh^IS]hmOETgoiv�������������������isxla[_fqqt~��������������������\\bVKAHTHHRUZ`_ajrvms���v{�u`_sxlquo}{x��������������������������f}��jkt~q^[dgPELVZJFWiz�wu����~~�xz����x��pifiqvzz�����������������ú����wqllmnlklqqtufkg`aW]kmbdlh`ZZVZUL[Z`aaoxz}��������z�����{��������py}|xcesmjcafkcVSWXUWR[li`\_jwuv���������������������ƴ���ɴ���������~���r_dogQEP\VMRcvv]UdgaTYc^\ZZ_b_iv����������˽�������������yx�~skih]RTW[^QTW[`XZRHHE<:CELRZ\iwyxz�����������������������������������znkcVVULGMJGPR\dfu����������������������������������������zxjTJEH>3<HRQRRRW_egu}~|����������������������������������qefh^PHKTOKHENXZYdkkkimtz������������~~uqvnw�������������~skilgfddld[\]jslegmu~|���������������������������������{spebjqtoeeojljr~�rjpmnqlu}��}��������������������������}mjz{prrxwk`jsqpos{uojs~wkeoojhkrx�����{}�������������xxmc^Y[_cchddfjikrsvihrponsuzxpx���������������������������z�uv{mfejkfcfiloklmhns~�|}�����������������������w||jc_`dhhrommgcbllluqtvutpqx{squutsy��������������������|mjfc\SXdgaa^_egefpkhedf[STWVYZ[c_jw������������������������~xro{�ywrtuuqu|yxux|xpr|xroliiiiz��}���������������������zorwpb`bb^]fnk]S^^SLNW[VWZ\cfiu������������������������zfelrztige]YVWa\OMSWXYQTXX\^`[Xbu|{{��������������������}ts~��wtwqopmpnlggikphefbfmlilq�������������������������~�����}|{yxx|zxwtwrtqmf__\_`[_fs{|wyw|�����������������|tw}}|tqnjmnnkghkgfjd\_aa`fhecgotvwyw|����������������vormrskheedbdhnswywpuytonnstmgehpw{����������������������������������{vwutijnpkhgkvqgin{�����������������������ykdecdhegga]ejhgimjhdegffbcfa\\dfoyvrrw�����������������vn`digceece[_cca_ceefddgefe^^[Yaclx��������������������~}tvz|xzuszyx|����}�������tppqspsx}vv|}�������������������������{xtljgjrof^`a\XSTUPMPQS_dikjnv�����������������|y�wz{svrmmqopopusleig_][ZUQUXXTY_dfeflx������������������|xyvswrvsquuyvnpyxwqxwtpgjnqsw}������������������������zw�{z���������������rcd`[XZ^_demmqw}�������������~~~{t{z~~utslmnnprjfb`_bcacZ^a_ccgjilszz|����������������}}xsurwvomjcce_agjmqrkmonob`dljhkp{��������������������������|}���yts|vqorrlnlolihkrx|~����������������������xxtnk`Z^_]\]^\[_inmhjbenhf_]]\WWYZ_cioy���������������������{lmmikgdecdb`bb][W\YZZV\^]^`ddfgpw�����������������������{zpsvwytmimquprpqyw|{uspqvyxyy}��������������������������~xwyyzvokggb^^X^YZ[XUSQPPRUWW`kt�����������������yrttonjkmqotvwwwzwwwmlkmke_[[YZUUY^fjr{������������������y}{ywrormkllfchkrqlonoswsxyxytuvy�����������������������|tsokecjtzusqry|���|~|~���}yvrsuvx}~{�������������~�xmqqhieceaehiqomggffeb][``^bfmospprw}��������������������{vlnjiighlompqnqosrsldimonoswtlgehloqv���������������������~yww}���yz{wummkiekplmmpsoonty~����������������������vjeaZWRVZ\VSQRUUUQPTZefgifhlmjmkfio{���������������������{vqlngihihjfa_adadaaijfddgjgfiffkpy���������������������x{wuxvy|}���������vsrmljoqsquursu��������������������������~}|�zzzuqjjiebYXVVXUTWXY]^ZXVZalox������������������sib_\_feiimpnuvwtmmmjfegkf_ccfc_Zfot��������������������zvprlprqsw{wsolomdbghjknx~}|����������������������������wrhiklidmmomlnqnlnoy{yzy{|zvywuwx�����������������}woja[\VUUV^^__]a^^[XZ]_^^YY\\aglowy��������������������~wrlfa^\`]]dhjec`ahbeeimrojmty{|}~����������������������������{smllppqvmploxwzrtpljkotsttz�����������������������srqkcVMJRVUSPMLJNVQRNJJFHO\afjktz�������������������������xrma`a^_WPKNSUWUURTPSblqw����������������������������zsjc`]WV[aa^^ahkrvwvqrr��������������������������}�}��|tokgdbimnhigihfgfd^Z^cnuvuxz~���������������wzvvsvyyxssleb\]WZa_\WWZ^^eddmllq|�������������������������������xmg`a__d`a]\]`caehklnqrz~������������������������������|vngdcciedc_^\]a^_ckqy}������������������������}xoekpolba_[WYXUQILFDDEORUSY_ciimw�������������������������}�{tlf_aaa[ZVUVUWUV]_egmqv{{}������������������������}vtty}yyvuvqsnokfelojmopppty�����������������������������wtu~�|umhgd]YRLKHPTWYUZ]afimotx��������������������xvusnpqpvxzxtssurohhhgnqsqnjhhhjmrw}�����������������������|w|zz|zzstnmjefdgffedc]Z[ahoy������������������������������{|~zuonfa\WURV[ccb_]]]gnrw|���������������������}tuljjfa[YVYUTONUQRNKKOSSWW_bdqu������������������������~yuoqqokfcijknoomnjhjjiefhegjqtu}�����������������������������wvuuyuvxvqnjijcdacghoryy��������������������������{yysqkhbaffjd\XUWWUPRSQXWY`a_bgjtx�������������������������~yvwsuw{{sqgc`ZXXYTSTYkqqtx}����������������������||}zurqrottyvtmjh`cglmljhhiswx{|��������������������������ystkfcaflmib\YTW^Z\]^\^cjrrtw������������������}}vokfedecfa^\WYYZZYYUU\fkkjjoqtuz������������������������}}wv~|zyzvuqptojeikikbccc_ahkmkt|������������������������|v{��|yzyrsnqsnonnnoromifaa_^eiqy����������������������}{zvvtqnokdb]\\[WUXRMKKJIKORQTYdow�������������������������}{tsje[\\UX_fd`__`\`cgmnwz�������������������������zzvotww|zyxrtqkjmolhdihimmporv{������������������qqngonnngcglmsqpqotvqjknmmllfgfcdbchnqvz�������������}}}ryyorvqoomw}z��zzzy{{y|yzvruonjgehnnrwz����������������������wxztpxsw}vpmkhhedaffdikgiehkou}��������������������������~wsuwtwpmmfc_a]WUUSNUX\ZW\_dlu}��������ÿ�������z�vnof\YTV]^`c\^^WV[Y\_ZYZaacjhnrqsu~�����������������������}tqlfitturpnhkjnmkpplklikkglijr{����������������������z�znqrknuqsslehgekgdddagmossvwx{y����������������w��v||tw|xz~tsx{xtohjqtlif]][YUUUUY^`cikqy|��������������������}}|}||���{wsvvyywomllmigdfgktuy����������������������||}}{zy{}ywysqttrllihedecjnrwyxwxw~����������������~��txumkjfdfdgnkjmqsyws{{ywwwrsw��vsnlkpx�������������{�ymvums{psslrx}�����~}�|{xroxtuwqptoffgdmr~�������������������������������z~yrqolqjdjld_a[a_XbaZ]gnz�����������������������������~rwqnsmffaY_ZPOIEIKJQWWbku�����������Ƽ������}{vgfja_g`dh_]a[U]VR^[[baYY\^lmknoov�����������������������wnulivmp|~w~|txsrxuonkcgc^ca\Z[]gru�������������������tvxhlmfhqow�zyzqnnprxsopkgmk__`[^]`iqz�����������������}�z��ur}rt�}��x}pmoigjf^b]X^TKKNGKQR[`ix�����������Ƶ��������wwwz�zz�zz{vq|wsussqgb`[NW\V_hhpx{�����������������z�yiwoiztlsskutptogihdhhehe\[]Y\d[ajjs|��������ü���������vuiep_aj\[adivtsxst~{z|vwmefb]ag_gqqxyr{��������������||maidfujmspx�}}�������|w~}ssk__`^aigpx{{~}�������������������v{qnojimmntry�z|�vpuonrjggbXZVRYZVSY[guz����������������������tzxsyroqvuxmfmf_^XJNRVba`gfadnpw�����������������������{hbgZ]e`hd]Y[_lplsmhkpnorszxrrtvpvxx��������������������������wwzoqwrspab_WZ^fsrrsngmmoqrxxyxvtsnllilokrvx�������������������|{mrtjkd]ccfkhjlkklbcefnqqpqvtprvtx~������������������������|mn\X]NPVMJNGMQSdlt�}{}}��������������~���������������������������~vxg^d]X_TUWOSUZeou{y{������������|qqd]][ZVWW]_hnr���������¿��������|t`QRFFKBGMNNNP\ek|~�������������yke_\^YYdfknqy�������������������wq_PLC>A=8@=GT^kqy~����������������{pjgZTQNLNRVbhoy������������������wnk[L@110)18;HS\iv{���������������xofZYTTUTY]aiw�������������ƾ����ymaZMD?22++/.9GU\mx�����������������~rjd_VKIIHGJNQXcv|���������ÿ�������vmfZTQE?D@INP^pz���������������xocWOMFC?<@HMQ_fu����������������{tg_ZRKNSORSIKNO`qx��������������zpfa^]\_\[ZXdin{������������������������vnniececdkmdke\dfn��������������tcOID<>GGLQWcq������������������������zrkeb^`[[X[Z[`jsmrseacery~�����������xl]RXT]hihptov����������������������������{xxvtxupns|��xebdcr�������������odYKPUYhns������������������{vpx}����|yz}~�|vyvwuy||��yvjXW^cx�������������uhYOTUV`\[chp�������w|}}{}}}������������{wz|zqnga_]cgvsgm]NS^cz�������������tmd^bgjvvx�~���������������z�������������|{}upqquz���|zf]efq������������ycTIGKVYfkfmw�����������������������������}}wrk_^\[evobfL;?EQlvw�����������e_TTY[cmhjqq|��������������������������|{y~wnmilo��}�}g]cbs�������������k^WPPX`omjuu~������������������������wqlkjnlihgccw{qqhljm��������������k[PKORV_]^hlv�����xuwr{�����������|uttsvz{xtpp{�}��oqkfr�}��z��������h_SMV^gpsq}���������������������������~qliffe]VZitp{~lmmk��������������iYNCMV]d_akor�������}�~���������������yphfccgcci||{�rknqr������������yfTI??HPU[Z_hly���������z�������������yodb[XXZYbp|{��{~����������������jWQKJNRZ]dlx�����������~����������������|vtpldfoywz�snsty����||�}�����oa[SU_cflns|������~yv{~}��������������ujdYSMFDK[[]hYWago�������������ybUNPU[^einvx�������|z|����������������{phgbb`gwwv|qhops�������������|j^XU\]^dflrv|�������������������������wi\WRLEGXkptuowv��������������p\QLFMPXZ[]dku������zwssvw}~�����������vkgiffdkx~{z|lnsp�������������}nab\`gjopsx����������������������������|unic]W[cjdsmdqrp��������������vmeXZZ]`cgmw������yusvvy�������������vnbZUWS^e_elb`mnx������������yfZWSQVRR\\agow����|usrvw���������������znc]WQV^d]gaarz��������������yhf][_[_b`aisz�����{ww|�����������������{snechrknsem}�������������|t_QNIKQQPUY_lu�����yxtsu{|�������������zql_USWVNWSLVah|�����������zmZUPLQZ[bhjs|������|ww{|������������������stqsykjj\_mq������������~sc\VQQX[_fhmy�������|��~�����������������rjb[[QPNDGT\j������������}i\UPQ\\Z^_emu}����vqononrtz������������zke\Y^PQRBIVYj�������������tg^UNNQS[\gr}��������~~������������������vpfjbW\SRY^g�������������yd]Y[__adflu|�������~~|����������������{ujcWW]OLLBGX`p������������|j]TKNUSQRRYbmy�����~z{|}��������������~ytjjb^]b][`R^lr��������������ylg^cgeilkq}����������������������������}rjda`eZZ]PU`dp��������������qg`]^\Z\`elsw����~z{~|���������������{sha\V[aX]bRZbdt�������������p_YQOPQPTVV\cmx������}{{������������������tiddkjgjeWbjm��������������~nk_bhbeb``iqw���������������������������vjcYW^[[d\V^ai�������������|f\SLKMMQPPV]gr|������������������������}qie_]\a`[`PPV\i|�������������lbWTW\^`caefkt~���������������������������{vstxvrxhakpz��������������mcXQRRUSSW`glv��������������������������{rnmknneecSRYYaw}�����������ue`YRWVUSPRV]fs|��������������������������yqkedeYSUHFRY^y�������������|wqedc\^[WW_fs�������������������������||ricdfhWYXR^ef|�������������|qlbaa]YVRT[`o|�����������������������zsmiee_``VYTHMZYi�������������|qiea_YUUMMKSZgsz�����������������������zwqjkmg`gVXlqx��������������~uhaa_bdeaefn{~��������������������������ywuxxqmqa[cah{�������������vk`QQIJLORRW\ginw|���������������������~rja^[_a^]`WT]]az�������������sh\`^Z[[ZX\^elu������������������������|wunjglokspjmqr����������������xmbbaed]VX_`cgr{���������������������znb^XYXblfjj\[]Xb|~�����������{h]RJKLMMEIFELWfq~����������������������yogfcefmojnh[eokx��������������trjacaaWRNOSUal{������������������������wnllghkaelb`lkr���������������yrba_^^\`ZXX]dm}�������������������z|uspeb\YYc`X\VHPTRh���������������xga_Y[YVVSQR[bny|���������������������znja^[^bZ]XNU`aq���������������tic\Y]WWY]alrw�����������������������~tojffgleeb[`fis��������������xodYSMIMJIIGGFLUbks�������������������}maZSVX]\\[QTWZcu���������������tk^YYVTNMKQX_nw����������������������qe^WUYcffffachju�������������������|yoh_YTQW\gos{��������������������wngc_[\WQTMKLRQ^kny������������yxtokg_VPHCAFHQZ^gp{�����������������upieabbhjcb]]_afqxw���������������}tnjaVROJLS]ajoxz~�������������������}wuruywusmikgo{|�����������������zwpi`ZTPLJSZ\emu{����������������|vqjbc]\^VRRMJMQXhip{��������������}wumfb___a`ckjnpuuy�����������������zwspqpqnilhfcbbint~����������������zsjeghhghmsrsww}��������������������uoheaZb\[afenvv|}}������������~}xsmeb\\_^[^^_aaimp}�������������������~spmfc^WRY[\dikprw�������������|~wuplmliilkijmty��������������������xsmic_a^Y[[Y_ccioy~��������������������|{{z{{{w~���������������������|tlcbab`[XZYYaegimlqvv}��������y{wtofb]_]accilqsx|��������������������}zvphed[\^aglou��������������������{{vwwrttrruw|}z�������������������������~~ywrtuy}~��������������~zzssqmnmnorlnqnnmqqsw}���������������~}vpjedab_a]YZZ]`eehkosw||����~}|{|~y{x|yz|z}����������������������������~{wuutusuwwvwwx|{}}}�~���|}||�|zyxtoojmrw{{yz����������������������������~uqlmkgjgjkfdmoppnooiggfhjjnpquuywuurvuqloqrxxywy}}��������������������}yvvsttqqnrqpomnpvwwuuwuurwxzxx{{~~~�����~}~������������������������yusstponrqjnosv}{xvvwx{z������������������������{uyy{zy�����������}{yzx{{vuqstxsnnrrmlmqqommnmpsttrmddd`fikpvruwvx{~~�����������������������������~~{|{yzy|zyxtqoorrtxxzzy�||zutpsonpqspquz|�����������������������������������������{|y{vrpkjifgghdihfiiigljhihiooqvw�������������������������}}yxzywu}|xxwstvv{{{}����������~���~}}z{xvuotswtw~���|������������������������������������zwtqsvqx{�~{wuy}|������������������}}{{{}ytvsv{~�������|{}~wxxxuzy{�}}}}~|{yywutsrlqmpuqrtxwuvswtvwr{}~wsrsvrvyxz|~~�}�����������������~�������������������������������yvortoomonnpswuz|}~}������������������������������������������������|{xuqqomoplfefhjkqtwy��{{z{uomprmsssvwy|{zwtvttwv{����{z}~~�����������������������������������{wvwrttrxqmrrrxxx~y{�~||zstsstt{��}�����������������������������������������ztswwsssvtvx{|{}yzwttsuxvlikgecgjmrlnnojhkijhkmpux��������������������������������������������~zwwuqvz�~}z{|{{ywsx{~{uurtqopswy�~{wuurrostw}�������������������������}zz{}}}xwvvwt||}����|}~~|z���~|yspmieaedfa^ZZ[Z[Z^_elnqpqpswuwty{~������������������������{zyyy{zwuuxxw}�������}z}~z|~��������yxqkgghfc]\^abcgkpqtvvyx~�����������������������������}vokfiegjmrv|������������~}uuqnmjnkgd`\ZWONQMPTYZ^Z]_cggsuy������������������������������}{|yysookoqsx�����������������}sleb]][UUSSONQTZWY\bkpz~��������������������������������|}||{y{������������������}{wppmggdec]QLMLKLOVY^_cdilnosvv|����������������������~|wuprqqpnpqutuy{�������������������~xvqmed_^\WQOTVUPNSX\chow~���������������������������|wspojgfccbgjmstz�����������������}vnjea^ZUTTQUVTUXXZaegdfgirty}���������������������zwtjjffdefejjilqsv|��������������������}tpf_VPHDEDEEGOT\_dgqwy�����������������������������{zurmlkijehhkqty{~����������������|yvokeb^ZSSMEDEB??IMPU^hsx����������������������zvpnh__`bccgjopsz������������������~{vngca[YRPMNRSUQPSVYXagnrx��������������������������|xoklkompqrvy�������������������}vogaZSOHJGC==BBBCLOUX`ls��������������������������~yxssqrwxz}�������������������}tslc]]YTOGKGA<?EDCENX^fo{������������������������{wpposrw}���������������������|zqkc_YPGCJEDDLNMUY_djqv}���������������������~��������������������������tkgam_HAGPQLJJU]\fqnrmjvwzxqhg^Xjjffiomjmx����������������ĺ���������jo{mdDC_L11=QH?@T]a_^sw�ps���u���skv�xru{yuwuz|{|��������������ѯ����dY`OD@?=.)8B@ISN[jjieefdi_`ke^jlqjb_afd\bplw�������������Ŷ������vkw{}{tokhjrlb[^]Saiqyususwrs|upqikrvouz|�����������������������������}�{khbRGK?GF=G?HQJV`cspfssnjfpyv|������������������������������yi\^PNLCY\NVacf\Vfhmeeqpuyz���������������w{�~�qntnh^\YZX]UQQ9?F>:E]daiq}�}m{����������������»�������������������|zze`^TRXZTU^mw~visz}�����������������������|omtwbY\WQOMINGC@HIHOKIKS`hqms�������������������ƽ���������}nspkcWNLMH@AA=<EGFEHTXJBJR[]euyxw{��������������������������{tqpi]_felsvwpq~��vv{}~����������¿�����������������|}lc^WYUPG:8?C?BGHGHHCKPTU\`hsihv��z����������������������wysmng^eb\]Y\bjr��������������������������������z�sgome_\ZZTOEEDADLUX^[Xiqrz��������������þ�¿�������������~tlhjiqsorrfefgmbbgksmho}~���������������������zw}rcgaX\RFEF=<585066@BDJMQ_mr{{����������������������������������rqnf^ZXTJOWZ``X^gdbkoopz�����������������v��~���{y�����{��v{{|~~~}�������������������������������������}{|rlp~vkrnhnfce\QV\`XU\didedlld_bga]]ada^glikru~�s~�y{}y��|�����������������|}��yxvv|uqz�����������~}������������������|�rx|oophluk_adbZgndeeiouyw~����������������������ª���������smtoao|mr{z{}{upvm^elgiga`dhopmjflquy�}����������}��lhm__f`RSecPZcX`kebj__jvthopv�}������������������������������������w�vw�xy�ojrrd[__XVV[\]TS`imqsponw{�������������������������������������pijefb[\[YY_bhkq����������������������w�}pw|yv��|x}nq�xuoaYPPKDCCE?BB@HSTU[\bdqy~��������������������������������y��~|yxxstpopomjroqpsz{}���|�������������������yx{yu�vcoqjjliefb`]]abcijl}}{������������������������������������ktmacg_Z`c^X^TS]cdivsuzvwvxy������~��w��w��y��ppwqhhrknwnhvphqtx}}��������~�����������������������������������zuvacgYW_`XVTUQUY\c_VS\`\dihljjoutwv|��������������������������rryukgnkdafeaklkstnu~�����������������������������}hrydfk]TYSKNMIAMNKKJNKTVPY[cpw{�����������ʺ�ϲ�ë����������r�wztssz�}}�~quyhqjfprkifcjehvqs�������������|�{oprh^fgS^]S\[\ZZ\ccktmsynsvv{����������������������������������w�xhkkilnopghibdf`fmhv{txvwzwuvy�������y��|��up{ogoofdslbwrbhiemvz�~�����������������������������é������~��wqsdX`\MNMGKOWQOTQNWTGOVSY\]ahgfhiw{���������������������������x|{wuw|tnppimvks{tv|��������������������������~�ru�sgufY[VUY\\RLPWHKN@KOEEQOY_[fmv����������ý��ë������������tjmihgeggekmalpiqtkosmpsryyz�}tw�vx�wz��������|z�}s|wfml\\WSWRNPRS_`Xkdexvz��}�������������ȹ�δ�«�����������ypwqqopngdagcfkfgoojokmpmqy|�������������������w~tfik\``QUTMSW\ecZacZhjiw}y���������������������������������xpxgbdXYVQRMJGNLGJDNSR]ifjkhq|����������������������������|~zssqsqps~~��������������������������������������xy{pll_]ZV[\]a]Sb\\megnkefhfhjhknptup|�w������������������||}ztqjheaif]jaZigjwy|�������������������������|x{ukrqhibd_XY]WUQINXPV]YV_ajy}�������������������������������~|sph`]Y[aYVaaYcmp||y{�����������������������������vyp`]UPKD@:203/1558HOP^ceqx~�����������������������������w|zrnjigc_\XMUUV^b`enlx~z|~�����������������������{{zoqrjjgipjeccakhbosry������������������������������������~uqmgjkaab\]_LT\WYYXamms|������������|�|hrrgfnklwnhpolnokh`\_ZY^]Xc_\mggomt���������������������������������~ysoe_YUOKHGCENHQXU`einvy������������������������������������y|tpqfbe[]hcgootz|������������������������~vvrhha^`]\ZVSPKGDDDGB>DDCPRUY\foyz����������������������������{wuvsrwyihoelmemtpsx�������������������������spztwxwqwvmtpmidfgf`_[Y\YVaeajos������������ȷ���������������zx�xspllnmfib^caac][ebejhnrsv������������������}�|ttlhih^bdYZZWTTUWTRPPQUZ[aa_gmnx������������������������������������|wxvtmfe]Z^WRZZTZX[`diox�����������������������~�zv��}~~}zuppmollqtsr|zvz{|{}}�������������������������v{rksunjjefea]UPHGAJOIRRPS[]_ffklu}�����������������������������������~yqhhmokqqttywx������������������������w��wywkggZ_a]``fec^]\]^YU[bbfhinooy���������������������������zv�srrpmlihe`_]``c]^fckssuy|~�����������������zt{tnpuoqqefkebcdec]`[WWQMPZTV^Zcgpx}�����������ÿ�¹�������������w}�{y}|||y|}yvrgoldlkglihjjlu}~������������������z{~vuxkkskklkknggjgjlefg_dmfmrw�������������������������������u~zvrligfbce[[[TZ\Y`ZQXZ__cgpvu~�������������������~yxtmqwottsnljmsmosqywvzsusu}����������������������������ztqqd_]][TTOOMEC?CB@JMJN[_ikjlsx���������������������������}ywvsqspljfpj^djlkintz{������������������������~zskmfb`__^]VUTU[Y[]YUYWX^_ejlmpxz~}�����������������������������zvvstqmjjkgmqjjpmqxxz�������������������}yyvsvofhgc\[]ZWVYZ\^Y^ea\ba\ccjsz{��������������»������������{voknfgdff__`cigknpmpmpqqs{����������������������}|{omnnhg`_YSTUTUSS[[U`gjquy{�����������������������������}�tnggeb`_\URSSRMJQUUVY^diihqqvv|��������������������vuxonmolhjgjihhelmkv}z|}����������������������������������yrme_\]]VQOQRURSYW]\]acgjrx������������������������~��{zxwlfefhfeadkmhjlmorsy}�������������������������zwvqjf]]][YURNKLMMHMJCKSZ^effmp{����������������������������������~upoojhgcieelnpw|}�����������������������������~x{vohca^TVXWUUTPTTX`\`cdcegjtx~���������������������������|wuuqonpolghjkkhjgfjgqrxyy~y~��������������������~�|y�{tuqsomnrngf``_\`hmlruz������������������������������������~vqofigfgceeadccinhlmqw}��������������������~�vxvqqmdb_WY[WRVVVXRWZ[dfcdimr{}�����������������������������|zwumkib`\ZVVUOTPTYY]ceemqv}~����������������������������}~~{usrrsqnrrotouwzy����������������������������}wurnhgb_]YWTRVLMMORSSTVX[\gopw~~}�����������������������~~ywuwvvtoqnloomlnoutssy��������������������������~zurnpqjgdhhhda_\\^ekjghggloptw||��������������������������������~~||uuqnkkjnrmqrmqnmtxz|���������������~uuttoonlhcfijlnkeb\XYWWPSPQURRU[_ghnux���������������������������������~��~ssulgkinnkoqqooptvv{~�~�����������������������~~y||{z
\ No newline at end of file
diff --git a/voc/bargraph.bas b/voc/bargraph.bas
new file mode 100644
index 0000000..7c0d889
--- /dev/null
+++ b/voc/bargraph.bas
@@ -0,0 +1,25 @@
+cls
+x=1
+1 locate 1,1
+for z=1 to x
+locate 1,z
+if z<16 then color 12
+if z<14 then color 14
+if z<11 then color 10
+st$=st$+chr$(7)
+print chr$(254)
+locate 2,z
+print chr$(254)
+next z
+for y=len(st$) to 15
+color 8
+locate 1,y
+print chr$(254)
+locate 2,y
+print chr$(254)
+next y
+2 a$=inkey$: if a$="" then 2
+if a$="+" then x=x+1:st$="":goto 1
+if a$="-" then X=x-1:st$="":goto 1
+goto 2
+
\ No newline at end of file
diff --git a/voc/save_voc.bas b/voc/save_voc.bas
new file mode 100644
index 0000000..682bd4e
--- /dev/null
+++ b/voc/save_voc.bas
@@ -0,0 +1,28 @@
+cls
+open "O",#1,"SAVE_VOC.RAW"
+FOR SbPort = &H210 to &H280 STEP &H10
+  OUT SbPort + &H6, 1
+  FOR a = 1 to 10:next
+  OUT SbPort + &H6, 0
+  FOR a = 1 to 100
+    IF INP(SbPort + &HA) = &HAA THEN GOTO SbFound
+  NEXT
+NEXT
+PRINT "kein SoundBlaster => Ende..."
+END
+
+SbFound:
+locate 1,1
+color 10:print"SoundBlaster an Adresse ";hex$(SbPort);"h gefunden."
+print"Beginne Speichern, Abbruch mit [ESC]!"
+DO
+  OUT SbPort + &HC, &H20
+  DO:LOOP UNTIL INP(SbPort + &HE) AND 128
+  value=inp(sbport+&HA)
+  print#1,chr$(value);
+LOOP UNTIL inkey$=chr$(27)
+Goto Ende
+
+Ende:
+print"Programm beendet."
+
\ No newline at end of file
diff --git a/voc/sbtest.bas b/voc/sbtest.bas
new file mode 100644
index 0000000..b710946
--- /dev/null
+++ b/voc/sbtest.bas
@@ -0,0 +1,16 @@
+
+call interrupt 7
+
+for x=1 to 9
+if x=1 then print"AX: ";
+if x=2 then print"BX: ";
+if x=3 then print"CX: ";
+if x=4 then print"DX: ";
+if x=5 then print"SI: ";
+if x=6 then print"DI: ";
+if x=7 then print"BP: ";
+if x=8 then print"DS: ";
+if x=9 then print"ES: ";
+?reg(x)
+next x
+print"----------------------------"
\ No newline at end of file
diff --git a/voc/voc_vu.bas b/voc/voc_vu.bas
new file mode 100644
index 0000000..fd0422b
--- /dev/null
+++ b/voc/voc_vu.bas
@@ -0,0 +1,74 @@
+' VOiCe - VU - Meter
+' by RoboCop INDUSTRIES
+dim sig$(51,200)
+dim sig(51,200)
+dim ym(51)
+cls
+print:print
+print"�ffne Datei ";:color 30:print"... ":color 7
+OPEN "I",#1,"BAD_DAY.V_C"
+locate 3,13:print"... OK"
+print"Lese Daten [Zeile:      Zeichen:     ( )  Zeichen ges.:        ] ";:color 30:print"...":color 7
+for z=1 to 10
+  if eof(1) then exit for
+  line input #1,ZLE$
+  e=len(zle$)
+  for x=1 to e
+    if x>=401 then exit for
+	SIG$(z,x)=mid$(zle$,x,1)
+	zeiges=zeiges+1
+	locate 1,66:print using"###.#kB Memory";fre(0)/1024
+	locate 2,66:print using"###.#kB   free";fre(-1)/1024
+	locate 3,66:print using"##### B unused";fre(-2)
+	locate 4,18:print using ": ###  Zeichen: ### (!)  Zeichen ges.: ######";z,x,sig$(z,x),zeiges;
+  next x
+  ym(z)=x
+next z
+zm=z
+print" ] ... OK"
+print"Konvertiere Daten [Zeichen:    ASCII:      Kurve: �     Wert:     ] ";:color 30:print"...":color 7
+for z=1 to zm
+  for x=1 to ym(z)
+    sig(z,x)=0
+    f=ascii(sig$(z,x))
+    sig(z,x)=f-128
+    locate 1,66:print using"###.#kB Memory";fre(0)/1024
+    locate 2,66:print using"###.#kB   free";fre(-1)/1024
+    locate 3,66:print using"##### B unused";fre(-2)
+    locate 5,27:print using": !  ASCII: ###  Kurve: +###  Wert: ###";sig$(z,x),f,sig(z,x),abs(sig(z,x));
+  next x
+next z
+print " ] ... OK"
+print"Zeige Daten [Kurve: �     Wert:      Aussteuerung:    ] ";:color 30:print"...":color 7
+locate 1,1:color 8:print "��������������������������������������������������������������"
+locate 1,1:color 12:print"ANF"
+locate 1,31:print"MID"
+locate 1,62:print"END"
+oldx=1
+for z=1 to zm
+  for y=1 to ym(z)
+    a=sig(z,y)/2
+    a=abs(a)
+    x=round(a,0)
+    if x<1 then x=1:if x>64 then x=64
+    for h=1 to x
+	 if h<64 and h>=52 then far=12
+	 if h<52 and h>=35 then far=14
+	 if h<35 and h>=0 then far=10
+	 b$="�"
+	 if h=1 then b$="A"
+	 if h=32 then b$="M"
+	 if h=64 then b$="E"
+	 locate 1,h:color far:print b$;:color 8
+    next h
+    for i=h to 64
+	 b$="�"
+	 if i=1 then b$="A"
+	 if i=32 then b$="M"
+	 if i=64 then b$="E"
+	 locate 1,i:print b$;
+    next i
+    color 7:locate 6,19:print using": +###  Wert: ###  Aussteuerung: ##";sig(z,y),abs(sig(z,y)),x;
+  next y
+next z
+color 7:print" ] ... OK"
\ No newline at end of file
diff --git a/voc/zarathus.bas b/voc/zarathus.bas
new file mode 100644
index 0000000..c610e71
--- /dev/null
+++ b/voc/zarathus.bas
@@ -0,0 +1,10 @@
+sound 130.810,54.6
+delay 54.6/18.2
+sound 174.610,36.4
+delay 36.4/18.2
+sound 220,36.4
+delay 50/18.2
+sound 523.25,4
+delay 4/18.2
+sound 493.88,36.4
+
\ No newline at end of file
diff --git a/winlnchr/1/win_laun.bas b/winlnchr/1/win_laun.bas
new file mode 100644
index 0000000..9408aa1
--- /dev/null
+++ b/winlnchr/1/win_laun.bas
@@ -0,0 +1,100 @@
+      cls
+      color 15:print"����WINDOWS�v3.11-Launcher����"
+      color 14:print"written by RoboCop INDUSTRIES"
+      color 7
+      print
+      print"W�hlen Sie einen Grafikmodus:"
+      print
+      print"No   H x B x c  Schrift f�r"
+      color 10:print" 1 ";:color 7:print" 640x480x256 normal"
+      color 10:print" 2 ";:color 7:print" 640x480x256 gro�"
+      color 10:print" 3 ";:color 7:print" 800x600x 16 normal"
+      color 10:print" 4 ";:color 7:print" 800x600x 16 gro�"
+      color 10:print" 5 ";:color 7:print" 800x600x256 normal"
+      color 10:print" 6 ";:color 7:print" 800x600x256 gro�"
+      color 10:print" 7 ";:color 7:print"1024x768x 16 normal"
+      color 10:print" 8 ";:color 7:print"1024x768x 16 gro�"
+      color 10:print" 9 ";:color 7:print"1024x768x256 normal"
+      color 10:print" 0 ";:color 7:print"1024x768x256 gro�"
+      end
+      print
+      print"Geben Sie eine Zahl ein!"
+1     a$=inkey$:if a$="" then 1
+      if a$="1" or a$="!" then goto ModeA
+      if a$="2" or a$=chr$(34) then goto ModeB
+      if a$="3" or a$=chr$(21) then goto ModeC
+      if a$="4" or a$="$" then goto ModeD
+      if a$="5" or a$="%" then goto ModeE
+      if a$="6" or a$="&" then goto ModeF
+      if a$="7" or a$="/" then goto ModeG
+      if a$="8" or a$="(" then goto ModeH
+      if a$="9" or a$=")" then goto ModeI
+      if a$="0" or a$="=" then goto ModeJ
+      goto 1
+
+ModeA:
+      print:print"Setze Variablen ... ";
+      dsp1$="display.drv=T480.DRV"
+      dsp2$="display.drv=TRIDENT TVGA 640x480x256c"
+      font$="font
+      print"OK"
+      print"Erstelle neue INI-Datei ... ";
+      gosub ChangeINI
+      print"Starte WINDOWS v3.11 ... "
+      goto Launch
+
+ModeB:
+      print:print"Setze Variablen...";
+      dsp1$="display.drv=W800.DRV"
+      dsp2$="display.drv=TRIDENT TVGA 800x600 16-color"
+      print"gesetzt"
+      print"Erstelle neue INI-Datei...";
+      gosub ChangeINI
+      print"Starte WINDOWS v3.11..."
+      goto Launch
+
+ModeC:
+      print:print"Setze Variablen...";
+      dsp1$="display.drv=T1024.DRV"
+      dsp2$="display.drv=TRIDENT TVGA8900 1024x768 256-color"
+      print"gesetzt"
+      print"Erstelle neue INI-Datei...";
+      gosub ChangeINI
+      print"Starte WINDOWS v3.11..."
+      goto Launch
+
+ChangeINI:
+      open "I",#1,"C:\WINDOWS\SYSTEM.INI"
+      open "O",#2,"C:\WINDOWS\SYSTEM.IN_"
+      print:color 15:print"Status                   aktuelle Zeile                                 b b-d":color 7
+      x=csrlin
+      locate x,1
+2     line input#1,zle$
+      if left$(zle$,6)="[boot]" then b=1
+      if left$(zle$,18)="[boot.description]" then bd=1
+      ers$=zle$
+      if left$(zle$,11)="display.drv" and b=1 then ers$=dsp1$:flag=1:fl=1
+      if left$(zle$,11)="display.drv" and bd=1 then ers$=dsp2$:flag=2:fl=1
+      st$="Suche nach Zeile..."
+      if fl=1 then st$="Zeile ge�ndert.     Neu:":fl=0
+      rem  print "Status                   aktuelle Zeile                                 b b-d":color 7
+      print using"\                      \ \                                            \ # #";st$;ers$;b;bd
+      if flag=2 then b=0
+      print#2,ers$
+      locate x,1
+      if flag=1 then locate x+1,1
+      if flag=2 then locate x+2,1
+      if eof(1)<>0 then
+	print"fertig."+space$(73)
+	close #1
+	close #2
+	return
+      else
+	goto 2
+      end if
+
+Launch:
+      kill "C:\WINDOWS\SYSTEM.INI"
+      name "C:\WINDOWS\SYSTEM.IN_" AS "C:\WINDOWS\SYSTEM.INI"
+      print"OK"
+      execute "WIN.COM :"
\ No newline at end of file
diff --git a/winlnchr/2/sysinis/1024x768.16c b/winlnchr/2/sysinis/1024x768.16c
new file mode 100644
index 0000000..a3117d8
--- /dev/null
+++ b/winlnchr/2/sysinis/1024x768.16c
@@ -0,0 +1,185 @@
+[boot]
+shell=progman.exe
+network.drv=
+mouse.drv=msc3bc2.drv
+language.dll=langger.dll
+sound.drv=mmsound.drv
+comm.drv=comm.drv
+atm.system.drv=system.drv
+386grabber=V7VGA.3GR
+oemfonts.fon=vga850.fon
+fixedfon.fon=vgafix.fon
+fonts.fon=vgasys.fon
+display.drv=W1024.DRV
+keyboard.drv=keyboard.drv
+system.drv=atmsys.drv
+SCRNSAVE.EXE=C:\WINDOWS\SSSTARS.SCR
+drivers=mmsystem.dll
+
+[keyboard]
+keyboard.dll=kbdgr.dll
+oemansi.bin=xlat850.bin
+subtype=
+type=4
+
+[boot.description]
+mouse.drv=Mouse Systems serielle Maus an COM2
+language.dll=Deutsch
+system.drv=MS-DOS-System
+codepage=850
+woafont.fon=Mehrsprachig (850)
+aspect=100,96,96
+display.drv=TRIDENT 1024x768-16c
+keyboard.typ=Erweiterte 101-/102-Tasten-US oder andere
+network.drv=Kein Netzwerk installiert
+secondnet.drv=Kein zus�tzliches Netzwerk installiert
+
+[386Enh]
+device=*vpd
+mouse=mscvmd.386
+EGA80WOA.FON=EGA80850.FON
+EGA40WOA.FON=EGA40850.FON
+CGA80WOA.FON=CGA80850.FON
+CGA40WOA.FON=CGA40850.FON
+woafont=app850.fon
+device=vtdapi.386
+device=vshare.386
+display=vddtvga.386
+SysVMIn2ndBank=FALSE
+ebios=*ebios
+device=dva.386
+32BitDiskAccess=on
+device=*int13
+device=*wdctrl
+keyboard=*vkd
+network=*dosnet,*vnetbios
+netheapsize=16
+device=*vcd
+device=*vpicd
+device=*vtd
+device=*reboot
+device=*vsd
+device=*v86mmgr
+device=*pageswap
+device=*dosmgr
+device=*vmpoll
+device=*wshell
+device=*PAGEFILE
+device=*BLOCKDEV
+device=*vfd
+device=*parity
+device=*biosxlat
+device=*vmcpd
+device=*combuff
+device=*cdpscsi
+device=vpmtd.386
+device=vcomm.386
+device=serial.386
+device=lpt.386
+device=ifsmgr.386
+device=vcache.386
+local=CON
+FileSysChange=off
+COM3Irq=4
+COM3Base=03E8
+COM4Irq=3
+COM4Base=02E8
+PermSwapDOSDrive=C
+PermSwapSizeK=15708
+MinTimeslice=20
+WinTimeslice=100,50
+WinExclusive=0
+Com1AutoAssign=2
+Com2AutoAssign=2
+LPT1AutoAssign=60
+;device=vsbd.386
+;device=vadlibd.386
+CGA40850.FON=CGA40850.FON
+CGA80850.FON=CGA80850.FON
+EGA40850.FON=EGA40850.FON
+EGA80850.FON=EGA80850.FON
+Anzeige=VDDTVGA.386
+device=vsbpd.386
+device=vfat.386
+device=*vdmad
+Maus=*VMD
+
+[NonWindowsApp]
+localtsrs=dosedit,ced
+DisablePositionSave=0
+MouseInDosBox=1
+FontChangeEnable=1
+CommandEnvSize=1024
+
+[vcache]
+minfilecache=2048
+
+[mci]
+CDAudio=mcicda.drv
+Sequencer=mciseq.drv
+WaveAudio=mciwave.drv
+AVIVideo=mciavi.drv
+Overlay=mcism.drv
+
+[drivers]
+midimapper=midimap.drv
+timer=timer.drv
+VIDC.IV32=ir32.dll
+VIDC.IV31=ir32.dll
+VIDC.RT21=ir21.dll
+VIDC.YVU9=iyvu9.dll
+VIDC.CVID=iccvid.drv
+VIDC.MSVC=msvidc.drv
+VIDC.MRLE=MSRLE.drv
+WaveMapper=msacm.drv
+MSACM.msadpcm=msadpcm.acm
+MSACM.imaadpcm=imaadpcm.acm
+Aux=sbpaux.drv
+Wave=sbpsnd.drv
+MIDI=sbpsnd.drv
+MIDI1=sbp2fm.drv
+
+[DDEShares]
+CHAT$=winchat,chat,,31,,0,,0,0,0
+SCHAT$=winchat,chat,,31,,0,,0,0,0
+CLPBK$=clipsrv,system,,31,,0,,0,0,0
+HEARTS$=mshearts,hearts,,15,,0,,0,0,0
+
+[Network]
+winnet=nonet
+multinet=nonet
+FileSharing=No
+PrintSharing=No
+
+[network drivers]
+devdir=C:\WINDOWS
+LoadRMDrivers=No
+
+[SNDBLST.DRV]
+port=220
+int=7
+dmachannel=1
+Palette=
+MasterVolume=14, 14
+FmVolume=14, 14
+CDVolume=14, 14
+LineVolume=14, 14
+VoiceVolume=14, 14
+
+[MSACM.imaadpcm]
+MaxRTEncodeSetting=4
+MaxRTDecodeSetting=5
+
+[ClipShares]
+
+[svga256.drv]
+resolution=1
+ChipSet=Trident
+LatchCapable=No
+svgamode=93
+
+[msacm.drv]
+Playback=SBPro Wave Out
+Record=SBPro Wave In
+PreferredOnly=0
+
diff --git a/winlnchr/2/sysinis/1024x768.256 b/winlnchr/2/sysinis/1024x768.256
new file mode 100644
index 0000000..bd3b950
--- /dev/null
+++ b/winlnchr/2/sysinis/1024x768.256
@@ -0,0 +1,186 @@
+[boot]
+386grabber=v7vga.3gr
+oemfonts.fon=vga850.fon
+fixedfon.fon=vgafix.fon
+fonts.fon=vgasys.fon
+display.drv=t1024.drv
+shell=progman.exe
+network.drv=
+mouse.drv=msc3bc2.drv
+language.dll=langger.dll
+sound.drv=mmsound.drv
+comm.drv=comm.drv
+atm.system.drv=system.drv
+keyboard.drv=keyboard.drv
+system.drv=atmsys.drv
+SCRNSAVE.EXE=C:\WINDOWS\SSSTARS.SCR
+drivers=mmsystem.dll
+
+[keyboard]
+keyboard.dll=kbdgr.dll
+oemansi.bin=xlat850.bin
+subtype=
+type=4
+
+[boot.description]
+aspect=100,96,96
+displayinf=OEM0.INF
+display.drv=TRIDENT 1024x768-256c
+mouse.drv=Mouse Systems serielle Maus an COM2
+language.dll=Deutsch
+system.drv=MS-DOS-System
+codepage=850
+woafont.fon=Mehrsprachig (850)
+keyboard.typ=Erweiterte 101-/102-Tasten-US oder andere
+network.drv=Kein Netzwerk installiert
+secondnet.drv=Kein zus�tzliches Netzwerk installiert
+
+[386Enh]
+display=vddtvga.386
+EGA80WOA.FON=EGA80850.FON
+EGA40WOA.FON=EGA40850.FON
+CGA80WOA.FON=CGA80850.FON
+CGA40WOA.FON=CGA40850.FON
+device=*vpd
+mouse=mscvmd.386
+woafont=app850.fon
+device=vtdapi.386
+device=vshare.386
+SysVMIn2ndBank=FALSE
+ebios=*ebios
+device=dva.386
+32BitDiskAccess=on
+device=*int13
+device=*wdctrl
+keyboard=*vkd
+network=*dosnet,*vnetbios
+netheapsize=16
+device=*vcd
+device=*vpicd
+device=*vtd
+device=*reboot
+device=*vsd
+device=*v86mmgr
+device=*pageswap
+device=*dosmgr
+device=*vmpoll
+device=*wshell
+device=*PAGEFILE
+device=*BLOCKDEV
+device=*vfd
+device=*parity
+device=*biosxlat
+device=*vmcpd
+device=*combuff
+device=*cdpscsi
+device=vpmtd.386
+device=vcomm.386
+device=serial.386
+device=lpt.386
+device=ifsmgr.386
+device=vcache.386
+local=CON
+FileSysChange=off
+COM3Irq=4
+COM3Base=03E8
+COM4Irq=3
+COM4Base=02E8
+PermSwapDOSDrive=C
+PermSwapSizeK=15708
+MinTimeslice=20
+WinTimeslice=100,50
+WinExclusive=0
+Com1AutoAssign=2
+Com2AutoAssign=2
+LPT1AutoAssign=60
+;device=vsbd.386
+;device=vadlibd.386
+CGA40850.FON=CGA40850.FON
+CGA80850.FON=CGA80850.FON
+EGA40850.FON=EGA40850.FON
+EGA80850.FON=EGA80850.FON
+Anzeige=VDDTVGA.386
+device=vsbpd.386
+device=vfat.386
+device=*vdmad
+Maus=*VMD
+
+[NonWindowsApp]
+localtsrs=dosedit,ced
+DisablePositionSave=0
+MouseInDosBox=1
+FontChangeEnable=1
+CommandEnvSize=1024
+
+[vcache]
+minfilecache=2048
+
+[mci]
+CDAudio=mcicda.drv
+Sequencer=mciseq.drv
+WaveAudio=mciwave.drv
+AVIVideo=mciavi.drv
+Overlay=mcism.drv
+
+[drivers]
+midimapper=midimap.drv
+timer=timer.drv
+VIDC.IV32=ir32.dll
+VIDC.IV31=ir32.dll
+VIDC.RT21=ir21.dll
+VIDC.YVU9=iyvu9.dll
+VIDC.CVID=iccvid.drv
+VIDC.MSVC=msvidc.drv
+VIDC.MRLE=MSRLE.drv
+WaveMapper=msacm.drv
+MSACM.msadpcm=msadpcm.acm
+MSACM.imaadpcm=imaadpcm.acm
+Aux=sbpaux.drv
+Wave=sbpsnd.drv
+MIDI=sbpsnd.drv
+MIDI1=sbp2fm.drv
+
+[DDEShares]
+CHAT$=winchat,chat,,31,,0,,0,0,0
+SCHAT$=winchat,chat,,31,,0,,0,0,0
+CLPBK$=clipsrv,system,,31,,0,,0,0,0
+HEARTS$=mshearts,hearts,,15,,0,,0,0,0
+
+[Network]
+winnet=nonet
+multinet=nonet
+FileSharing=No
+PrintSharing=No
+
+[network drivers]
+devdir=C:\WINDOWS
+LoadRMDrivers=No
+
+[SNDBLST.DRV]
+port=220
+int=7
+dmachannel=1
+Palette=
+MasterVolume=14, 14
+FmVolume=14, 14
+CDVolume=14, 14
+LineVolume=14, 14
+VoiceVolume=14, 14
+
+[MSACM.imaadpcm]
+MaxRTEncodeSetting=4
+MaxRTDecodeSetting=5
+
+[ClipShares]
+
+[svga256.drv]
+resolution=1
+ChipSet=Trident
+LatchCapable=No
+svgamode=93
+
+[msacm.drv]
+Playback=SBPro Wave Out
+Record=SBPro Wave In
+PreferredOnly=0
+
diff --git a/winlnchr/2/sysinis/640x480.256 b/winlnchr/2/sysinis/640x480.256
new file mode 100644
index 0000000..100cdfb
--- /dev/null
+++ b/winlnchr/2/sysinis/640x480.256
@@ -0,0 +1,186 @@
+[boot]
+386grabber=v7vga.3gr
+oemfonts.fon=vga850.fon
+fixedfon.fon=vgafix.fon
+fonts.fon=vgasys.fon
+display.drv=t640.drv
+shell=progman.exe
+network.drv=
+mouse.drv=msc3bc2.drv
+language.dll=langger.dll
+sound.drv=mmsound.drv
+comm.drv=comm.drv
+atm.system.drv=system.drv
+keyboard.drv=keyboard.drv
+system.drv=atmsys.drv
+SCRNSAVE.EXE=C:\WINDOWS\SSSTARS.SCR
+drivers=mmsystem.dll
+
+[keyboard]
+keyboard.dll=kbdgr.dll
+oemansi.bin=xlat850.bin
+subtype=
+type=4
+
+[boot.description]
+aspect=100,96,96
+displayinf=OEM0.INF
+display.drv=TRIDENT 640x480-256c
+mouse.drv=Mouse Systems serielle Maus an COM2
+language.dll=Deutsch
+system.drv=MS-DOS-System
+codepage=850
+woafont.fon=Mehrsprachig (850)
+keyboard.typ=Erweiterte 101-/102-Tasten-US oder andere
+network.drv=Kein Netzwerk installiert
+secondnet.drv=Kein zus�tzliches Netzwerk installiert
+
+[386Enh]
+display=vddtvga.386
+EGA80WOA.FON=EGA80850.FON
+EGA40WOA.FON=EGA40850.FON
+CGA80WOA.FON=CGA80850.FON
+CGA40WOA.FON=CGA40850.FON
+device=*vpd
+mouse=mscvmd.386
+woafont=app850.fon
+device=vtdapi.386
+device=vshare.386
+SysVMIn2ndBank=FALSE
+ebios=*ebios
+device=dva.386
+32BitDiskAccess=on
+device=*int13
+device=*wdctrl
+keyboard=*vkd
+network=*dosnet,*vnetbios
+netheapsize=16
+device=*vcd
+device=*vpicd
+device=*vtd
+device=*reboot
+device=*vsd
+device=*v86mmgr
+device=*pageswap
+device=*dosmgr
+device=*vmpoll
+device=*wshell
+device=*PAGEFILE
+device=*BLOCKDEV
+device=*vfd
+device=*parity
+device=*biosxlat
+device=*vmcpd
+device=*combuff
+device=*cdpscsi
+device=vpmtd.386
+device=vcomm.386
+device=serial.386
+device=lpt.386
+device=ifsmgr.386
+device=vcache.386
+local=CON
+FileSysChange=off
+COM3Irq=4
+COM3Base=03E8
+COM4Irq=3
+COM4Base=02E8
+PermSwapDOSDrive=C
+PermSwapSizeK=15708
+MinTimeslice=20
+WinTimeslice=100,50
+WinExclusive=0
+Com1AutoAssign=2
+Com2AutoAssign=2
+LPT1AutoAssign=60
+;device=vsbd.386
+;device=vadlibd.386
+CGA40850.FON=CGA40850.FON
+CGA80850.FON=CGA80850.FON
+EGA40850.FON=EGA40850.FON
+EGA80850.FON=EGA80850.FON
+Anzeige=VDDTVGA.386
+device=vsbpd.386
+device=vfat.386
+device=*vdmad
+Maus=*VMD
+
+[NonWindowsApp]
+localtsrs=dosedit,ced
+DisablePositionSave=0
+MouseInDosBox=1
+FontChangeEnable=1
+CommandEnvSize=1024
+
+[vcache]
+minfilecache=2048
+
+[mci]
+CDAudio=mcicda.drv
+Sequencer=mciseq.drv
+WaveAudio=mciwave.drv
+AVIVideo=mciavi.drv
+Overlay=mcism.drv
+
+[drivers]
+midimapper=midimap.drv
+timer=timer.drv
+VIDC.IV32=ir32.dll
+VIDC.IV31=ir32.dll
+VIDC.RT21=ir21.dll
+VIDC.YVU9=iyvu9.dll
+VIDC.CVID=iccvid.drv
+VIDC.MSVC=msvidc.drv
+VIDC.MRLE=MSRLE.drv
+WaveMapper=msacm.drv
+MSACM.msadpcm=msadpcm.acm
+MSACM.imaadpcm=imaadpcm.acm
+Aux=sbpaux.drv
+Wave=sbpsnd.drv
+MIDI=sbpsnd.drv
+MIDI1=sbp2fm.drv
+
+[DDEShares]
+CHAT$=winchat,chat,,31,,0,,0,0,0
+SCHAT$=winchat,chat,,31,,0,,0,0,0
+CLPBK$=clipsrv,system,,31,,0,,0,0,0
+HEARTS$=mshearts,hearts,,15,,0,,0,0,0
+
+[Network]
+winnet=nonet
+multinet=nonet
+FileSharing=No
+PrintSharing=No
+
+[network drivers]
+devdir=C:\WINDOWS
+LoadRMDrivers=No
+
+[SNDBLST.DRV]
+port=220
+int=7
+dmachannel=1
+Palette=
+MasterVolume=14, 14
+FmVolume=14, 14
+CDVolume=14, 14
+LineVolume=14, 14
+VoiceVolume=14, 14
+
+[MSACM.imaadpcm]
+MaxRTEncodeSetting=4
+MaxRTDecodeSetting=5
+
+[ClipShares]
+
+[svga256.drv]
+resolution=1
+ChipSet=Trident
+LatchCapable=No
+svgamode=93
+
+[msacm.drv]
+Playback=SBPro Wave Out
+Record=SBPro Wave In
+PreferredOnly=0
+
diff --git a/winlnchr/2/sysinis/800x600.16c b/winlnchr/2/sysinis/800x600.16c
new file mode 100644
index 0000000..4e69e5d
--- /dev/null
+++ b/winlnchr/2/sysinis/800x600.16c
@@ -0,0 +1,185 @@
+[boot]
+shell=progman.exe
+network.drv=
+mouse.drv=msc3bc2.drv
+language.dll=langger.dll
+sound.drv=mmsound.drv
+comm.drv=comm.drv
+atm.system.drv=system.drv
+386grabber=V7VGA.3GR
+oemfonts.fon=vga850.fon
+fixedfon.fon=vgafix.fon
+fonts.fon=vgasys.fon
+display.drv=W800.DRV
+keyboard.drv=keyboard.drv
+system.drv=atmsys.drv
+SCRNSAVE.EXE=C:\WINDOWS\SSSTARS.SCR
+drivers=mmsystem.dll
+
+[keyboard]
+keyboard.dll=kbdgr.dll
+oemansi.bin=xlat850.bin
+subtype=
+type=4
+
+[boot.description]
+mouse.drv=Mouse Systems serielle Maus an COM2
+language.dll=Deutsch
+system.drv=MS-DOS-System
+codepage=850
+woafont.fon=Mehrsprachig (850)
+aspect=100,96,96
+display.drv=TRIDENT 800x600-16c
+keyboard.typ=Erweiterte 101-/102-Tasten-US oder andere
+network.drv=Kein Netzwerk installiert
+secondnet.drv=Kein zus�tzliches Netzwerk installiert
+
+[386Enh]
+device=*vpd
+mouse=mscvmd.386
+EGA80WOA.FON=EGA80850.FON
+EGA40WOA.FON=EGA40850.FON
+CGA80WOA.FON=CGA80850.FON
+CGA40WOA.FON=CGA40850.FON
+woafont=app850.fon
+device=vtdapi.386
+device=vshare.386
+display=vddtvga.386
+SysVMIn2ndBank=FALSE
+ebios=*ebios
+device=dva.386
+32BitDiskAccess=on
+device=*int13
+device=*wdctrl
+keyboard=*vkd
+network=*dosnet,*vnetbios
+netheapsize=16
+device=*vcd
+device=*vpicd
+device=*vtd
+device=*reboot
+device=*vsd
+device=*v86mmgr
+device=*pageswap
+device=*dosmgr
+device=*vmpoll
+device=*wshell
+device=*PAGEFILE
+device=*BLOCKDEV
+device=*vfd
+device=*parity
+device=*biosxlat
+device=*vmcpd
+device=*combuff
+device=*cdpscsi
+device=vpmtd.386
+device=vcomm.386
+device=serial.386
+device=lpt.386
+device=ifsmgr.386
+device=vcache.386
+local=CON
+FileSysChange=off
+COM3Irq=4
+COM3Base=03E8
+COM4Irq=3
+COM4Base=02E8
+PermSwapDOSDrive=C
+PermSwapSizeK=15708
+MinTimeslice=20
+WinTimeslice=100,50
+WinExclusive=0
+Com1AutoAssign=2
+Com2AutoAssign=2
+LPT1AutoAssign=60
+;device=vsbd.386
+;device=vadlibd.386
+CGA40850.FON=CGA40850.FON
+CGA80850.FON=CGA80850.FON
+EGA40850.FON=EGA40850.FON
+EGA80850.FON=EGA80850.FON
+Anzeige=VDDTVGA.386
+device=vsbpd.386
+device=vfat.386
+device=*vdmad
+Maus=*VMD
+
+[NonWindowsApp]
+localtsrs=dosedit,ced
+DisablePositionSave=0
+MouseInDosBox=1
+FontChangeEnable=1
+CommandEnvSize=1024
+
+[vcache]
+minfilecache=2048
+
+[mci]
+CDAudio=mcicda.drv
+Sequencer=mciseq.drv
+WaveAudio=mciwave.drv
+AVIVideo=mciavi.drv
+Overlay=mcism.drv
+
+[drivers]
+midimapper=midimap.drv
+timer=timer.drv
+VIDC.IV32=ir32.dll
+VIDC.IV31=ir32.dll
+VIDC.RT21=ir21.dll
+VIDC.YVU9=iyvu9.dll
+VIDC.CVID=iccvid.drv
+VIDC.MSVC=msvidc.drv
+VIDC.MRLE=MSRLE.drv
+WaveMapper=msacm.drv
+MSACM.msadpcm=msadpcm.acm
+MSACM.imaadpcm=imaadpcm.acm
+Aux=sbpaux.drv
+Wave=sbpsnd.drv
+MIDI=sbpsnd.drv
+MIDI1=sbp2fm.drv
+
+[DDEShares]
+CHAT$=winchat,chat,,31,,0,,0,0,0
+SCHAT$=winchat,chat,,31,,0,,0,0,0
+CLPBK$=clipsrv,system,,31,,0,,0,0,0
+HEARTS$=mshearts,hearts,,15,,0,,0,0,0
+
+[Network]
+winnet=nonet
+multinet=nonet
+FileSharing=No
+PrintSharing=No
+
+[network drivers]
+devdir=C:\WINDOWS
+LoadRMDrivers=No
+
+[SNDBLST.DRV]
+port=220
+int=7
+dmachannel=1
+Palette=
+MasterVolume=14, 14
+FmVolume=14, 14
+CDVolume=14, 14
+LineVolume=14, 14
+VoiceVolume=14, 14
+
+[MSACM.imaadpcm]
+MaxRTEncodeSetting=4
+MaxRTDecodeSetting=5
+
+[ClipShares]
+
+[svga256.drv]
+resolution=1
+ChipSet=Trident
+LatchCapable=No
+svgamode=93
+
+[msacm.drv]
+Playback=SBPro Wave Out
+Record=SBPro Wave In
+PreferredOnly=0
+
diff --git a/winlnchr/2/sysinis/800x600.256 b/winlnchr/2/sysinis/800x600.256
new file mode 100644
index 0000000..7a1465f
--- /dev/null
+++ b/winlnchr/2/sysinis/800x600.256
@@ -0,0 +1,185 @@
+[boot]
+shell=progman.exe
+network.drv=
+mouse.drv=msc3bc2.drv
+language.dll=langger.dll
+sound.drv=mmsound.drv
+comm.drv=comm.drv
+atm.system.drv=system.drv
+386grabber=V7VGA.3GR
+oemfonts.fon=vga850.fon
+fixedfon.fon=vgafix.fon
+fonts.fon=vgasys.fon
+display.drv=T800.DRV
+keyboard.drv=keyboard.drv
+system.drv=atmsys.drv
+SCRNSAVE.EXE=C:\WINDOWS\SSSTARS.SCR
+drivers=mmsystem.dll
+
+[keyboard]
+keyboard.dll=kbdgr.dll
+oemansi.bin=xlat850.bin
+subtype=
+type=4
+
+[boot.description]
+mouse.drv=Mouse Systems serielle Maus an COM2
+language.dll=Deutsch
+system.drv=MS-DOS-System
+codepage=850
+woafont.fon=Mehrsprachig (850)
+aspect=100,96,96
+display.drv=TRIDENT 800x600-256c for 1M Board (Faster)
+keyboard.typ=Erweiterte 101-/102-Tasten-US oder andere
+network.drv=Kein Netzwerk installiert
+secondnet.drv=Kein zus�tzliches Netzwerk installiert
+
+[386Enh]
+device=*vpd
+mouse=mscvmd.386
+EGA80WOA.FON=EGA80850.FON
+EGA40WOA.FON=EGA40850.FON
+CGA80WOA.FON=CGA80850.FON
+CGA40WOA.FON=CGA40850.FON
+woafont=app850.fon
+device=vtdapi.386
+device=vshare.386
+display=vddtvga.386
+SysVMIn2ndBank=FALSE
+ebios=*ebios
+device=dva.386
+32BitDiskAccess=on
+device=*int13
+device=*wdctrl
+keyboard=*vkd
+network=*dosnet,*vnetbios
+netheapsize=16
+device=*vcd
+device=*vpicd
+device=*vtd
+device=*reboot
+device=*vsd
+device=*v86mmgr
+device=*pageswap
+device=*dosmgr
+device=*vmpoll
+device=*wshell
+device=*PAGEFILE
+device=*BLOCKDEV
+device=*vfd
+device=*parity
+device=*biosxlat
+device=*vmcpd
+device=*combuff
+device=*cdpscsi
+device=vpmtd.386
+device=vcomm.386
+device=serial.386
+device=lpt.386
+device=ifsmgr.386
+device=vcache.386
+local=CON
+FileSysChange=off
+COM3Irq=4
+COM3Base=03E8
+COM4Irq=3
+COM4Base=02E8
+PermSwapDOSDrive=C
+PermSwapSizeK=15708
+MinTimeslice=20
+WinTimeslice=100,50
+WinExclusive=0
+Com1AutoAssign=2
+Com2AutoAssign=2
+LPT1AutoAssign=60
+;device=vsbd.386
+;device=vadlibd.386
+CGA40850.FON=CGA40850.FON
+CGA80850.FON=CGA80850.FON
+EGA40850.FON=EGA40850.FON
+EGA80850.FON=EGA80850.FON
+Anzeige=VDDTVGA.386
+device=vsbpd.386
+device=vfat.386
+device=*vdmad
+Maus=*VMD
+
+[NonWindowsApp]
+localtsrs=dosedit,ced
+DisablePositionSave=0
+MouseInDosBox=1
+FontChangeEnable=1
+CommandEnvSize=1024
+
+[vcache]
+minfilecache=2048
+
+[mci]
+CDAudio=mcicda.drv
+Sequencer=mciseq.drv
+WaveAudio=mciwave.drv
+AVIVideo=mciavi.drv
+Overlay=mcism.drv
+
+[drivers]
+midimapper=midimap.drv
+timer=timer.drv
+VIDC.IV32=ir32.dll
+VIDC.IV31=ir32.dll
+VIDC.RT21=ir21.dll
+VIDC.YVU9=iyvu9.dll
+VIDC.CVID=iccvid.drv
+VIDC.MSVC=msvidc.drv
+VIDC.MRLE=MSRLE.drv
+WaveMapper=msacm.drv
+MSACM.msadpcm=msadpcm.acm
+MSACM.imaadpcm=imaadpcm.acm
+Aux=sbpaux.drv
+Wave=sbpsnd.drv
+MIDI=sbpsnd.drv
+MIDI1=sbp2fm.drv
+
+[DDEShares]
+CHAT$=winchat,chat,,31,,0,,0,0,0
+SCHAT$=winchat,chat,,31,,0,,0,0,0
+CLPBK$=clipsrv,system,,31,,0,,0,0,0
+HEARTS$=mshearts,hearts,,15,,0,,0,0,0
+
+[Network]
+winnet=nonet
+multinet=nonet
+FileSharing=No
+PrintSharing=No
+
+[network drivers]
+devdir=C:\WINDOWS
+LoadRMDrivers=No
+
+[SNDBLST.DRV]
+port=220
+int=7
+dmachannel=1
+Palette=
+MasterVolume=14, 14
+FmVolume=14, 14
+CDVolume=14, 14
+LineVolume=14, 14
+VoiceVolume=14, 14
+
+[MSACM.imaadpcm]
+MaxRTEncodeSetting=4
+MaxRTDecodeSetting=5
+
+[ClipShares]
+
+[svga256.drv]
+resolution=1
+ChipSet=Trident
+LatchCapable=No
+svgamode=93
+
+[msacm.drv]
+Playback=SBPro Wave Out
+Record=SBPro Wave In
+PreferredOnly=0
+
diff --git a/winlnchr/2/wl.bas b/winlnchr/2/wl.bas
new file mode 100644
index 0000000..7c41ced
--- /dev/null
+++ b/winlnchr/2/wl.bas
@@ -0,0 +1,196 @@
+$INCLUDE "LOGO.INC"
+$INCLUDE "PBWINDOW.INC"
+	if command$="SKIP" or command$="skip" then goto SkipIt
+	color 15
+	Lin=csrlin-1
+	txt$="proudly presents"
+	txt$(1)=txt$
+	gosub WriteText
+	txt$="The WINDOWS FOR WORKGROUPS 3.11 - Multiple Configuration Launcher"
+	txt$(2)=txt$
+	print
+	Lin=csrlin-1
+	delay 1
+	gosub WriteText
+	delay 1
+	color 9
+	Anf1=40-int(len(txt$(1))/2)+1
+	Anf2=40-int(len(txt$(2))/2)+1
+	locate Lin-1,Anf1:print txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	delay .15
+	color 3
+	locate Lin-1,Anf1:print txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	delay .15
+	color 11
+	locate Lin-1,Anf1:print Txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	delay .15
+	color 15
+	locate Lin-1,Anf1:print txt$(1)
+	locate Lin,Anf2:print txt$(2)
+	goto Program
+
+WriteText:
+	AnfLocX=40-int(len(txt$)/2)
+	x=1
+1	if x>0 then LetA$=mid$(txt$,x,1)
+	if x>1 then LetB$=mid$(txt$,x-1,1)
+	if x>2 then LetC$=mid$(txt$,x-2,1)
+	if x>3 then LetD$=mid$(txt$,x-3,1)
+	if x>4 then LetE$=mid$(txt$,x-4,1)
+	if x>0 then color 15:locate Lin,AnfLocX+x:print LetA$
+	if x>1 then color 11:locate Lin,AnfLocX+x-1:print LetB$
+	if x>2 then color 3:locate Lin,AnfLocX+x-2:print LetC$
+	if x>3 then color 9:locate Lin,AnfLocX+x-3:print LetD$
+	if x>4 then color 1:locate Lin,AnfLocX+x-4:print LetE$
+	x=x+1:if x>len(txt$)+4 then 2 else delay .05:goto 1
+2	delay 1
+	color 15:locate Lin,AnfLocX+1:print txt$
+	delay .1:color 11:locate Lin,AnfLocX+1:print txt$
+	delay .1:color  3:locate Lin,AnfLocX+1:print txt$
+	delay .1:color  9:locate Lin,AnfLocX+1:print txt$
+	delay .1:color  1:locate Lin,AnfLocX+1:print txt$
+	return
+
+SkipIt:
+	color 15
+	txt$="proudly presents"
+	locate csrlin-1,40-int(len(txt$)/2):print txt$
+	txt$="The WINDOWS FOR WORKGROUPS 3.11 - Multiple Configuration Launcher"
+	locate csrlin,40-int(len(txt$)/2):print txt$
+	goto Program
+
+Program:
+	Item$(0)="[Konfiguration w�hlen]"
+	Item$(1)="Photo Finish v2.0"
+	Item$(2)="Photo Finish v3.0"
+	Item$(3)="PC Paintbrush"
+	Lin=17
+	call MakeWindow (15,9,5,63,ColAttr%(11,0),2,4,2)
+	call TitleWindow (1,"[Information]")
+	txt$="Zum Abbrechen [ESC] dr�cken, ansonsten eine Auswahl treffen"
+	if command$="skip" or command$="SKIP" then
+	  locate Lin,40-int(len(txt$)/2)
+	  color 15,0
+	  print txt$
+	  goto 7
+	end if
+	gosub WriteText:delay 1
+	color 9:locate 17,AnfLocX+1:print txt$:delay .15
+	color 3:locate 17,AnfLocX+1:print txt$:delay .15
+	color 11:locate 17,AnfLocX+1:print txt$:delay .15
+	color 15:locate 17,AnfLocX+1:print txt$
+7	Call MakeMenu (3,3,ColAttr%(11,1),ColAttr%(0,4),4,4,2,1,5,Item$())
+	Call RemoveWindow
+	if CurntPos%=0 then goto BreakItUp
+	if CurntPos%=1 then goto PF2
+	if CurntPos%=2 then goto PF3
+	if CurntPos%=3 then goto PCP
+	if CurntPos%=4 then goto
+	if CurntPos%=5 then goto
+
+PF2:
+	Title$="Photo Finish 2.0"
+	PickInfo$="Pick"
+	goto ChangeWININI
+
+PF3:
+	Title$="Photo Finish 3.0"
+	PickInfo$="Pick"
+	goto ChangeWININI
+
+PCP:
+	Title$="PC Paintbrush"
+	PickInfo$="Pick"
+	goto ChangeWININI
+
+ChangeWININI:
+	call MakeWindow(5,5,15,70,ColAttr%(14,1),1,4,1)
+	WinTit$="[Editing C:\WINDOWS\SYSTEM.INI]���[Mode: "+ShortInfo$+"]"
+	call TitleWindow(1,WinTit$)
+	per%=0
+	color 14,1
+	locate 7,8:print"Erstelle Sicherheitskopie von Ausgangs-Datei ... ";
+	CopyOrd$="COPY C:\WINDOWS\SYSTEM.INI C:\WINDOWS\SYSTEM.WL_ /V /Y >NUL"
+	shell CopyOrd$
+	print "OK"
+	locate 8,8:print"�ffne Eingabe-Datei ... ";
+	open "I",#1,"C:\WINDOWS\SYSTEM.INI"
+	print "OK"
+	locate 9,8:print"�ffne Temp-Datei ... ";
+	open "O",#2,"C:\WINDOWS\WL.$$$"
+	print "OK"
+	zeil=1
+6	line input#1,dummy$
+	if eof(1) then 5 else zeil=zeil+1:goto 6
+5    close #1:open "I",#1,"C:\WINDOWS\SYSTEM.INI"
+	locate 10,8:print "Bearbeite Temp-Datei ... ";  '10,33 ist HIER
+	gosub ShowGraph
+	aktz=1
+3	line input#1,zei$
+	if left$(zei$,1)="[" then
+	  tit$=""
+	  for g=2 to 80
+	    if mid$(zei$,g,1)="]" then exit for else tit$=tit$+mid$(zei$,g,1)
+	  next g
+	  per%=(aktz/zeil)*100
+	  gosub ShowGraph
+	  print#2,zei$
+	  locate 11,8:print"Momentane Gruppe: ";tit$
+	else
+	  raus$=zei$
+	  gosub CheckForParam
+	  print#2,raus$
+	end if
+	if eof(1) then goto 4
+	aktz=aktz+1
+	goto 3
+4	locate 11,8:print space$(64)
+	locate 11,8:print"Schlie�e Eingabe-Datei ... ";
+	close #1
+	print"OK"
+	locate 12,8:print"Schlie�e Temp-Datei ... ";
+	close #2
+	print "OK"
+	locate 13,8:print"L�sche alte SYSTEM.INI ... ";
+	kill "C:\WINDOWS\SYSTEM.INI"
+	print "OK"
+	locate 14,8:print"Benenne Temp-Datei in SYSTEM.INI um ... ";
+	name "C:\WINDOWS\WL.$$$" as "C:\WINDOWS\SYSTEM.INI"
+	print "OK"
+	locate 16,8:print"Operation abgeschlossen!"
+	delay 1
+	call RemoveWindow
+	color 15,0
+	locate 24,1:print:print
+	locate 24,1
+	execute "WIN.COM :"
+	end
+
+CheckForParam:
+	if left$(zei$,len(PickInfo$)+2)=PickInfo$+"1=" and tit$=Title$ then raus$=PickInfo$+"1="
+	if left$(zei$,len(PickInfo$)+2)=PickInfo$+"2=" and tit$=Title$ then raus$=PickInfo$+"2="
+	if left$(zei$,len(PickInfo$)+2)=PickInfo$+"3=" and tit$=Title$ then raus$=PickInfo$+"3="
+	if left$(zei$,len(PickInfo$)+2)=PickInfo$+"4=" and tit$=Title$ then raus$=PickInfo$+"4="
+	return
+
+ShowGraph:
+	locate 10,57:print using"### %";per%
+	locate 10,35:print"��������������������"
+	locate 10,35
+	for z=0 to per%/5
+	  if tst=1 then print "�"; else tst=1
+	next z
+	return
+
+BreakItUp:
+	locate 24,1:print:print
+	call MakeWindow(10,27,5,26,ColAttr%(14,1),5,4,2)
+	call TitleWindow(1,"[Information]")
+	color 12,1:locate 12,29:print"Programm abgebrochen !"
+	if command$="skip" or command$="SKIP" then locate 24,1:end
+	delay 1.75
+	call RemoveWindow
+	locate 24,1:end
\ No newline at end of file
diff --git a/write.bas b/write.bas
new file mode 100644
index 0000000..1986352
--- /dev/null
+++ b/write.bas
@@ -0,0 +1,39 @@
+      dim p$(20)
+      para$=command$
+      a=1:x=1
+1     x$=mid$(para$,x,1)
+      if x$=" " then a=a+1:x=x+1:goto 1
+      p$(a)=p$(a)+x$
+      if x$="" then 2
+      x=x+1
+      goto 1
+2     if p$(1)="/?" or p$(1)="" then goto Hilfe
+      x=val(p$(1))
+      y=val(p$(2))
+      zei=val(p$(3))
+      v=val(p$(4))
+      h=val(p$(5))
+3     for z=6 to 20
+      if p$(z)="" then text$=left$(text$,len(text$)-1):goto 4
+      text$=text$+p$(z)+" "
+      next z
+4     color v,h,0
+      versch=round(zei/2-len(text$)/2,0)
+      y=y+versch
+      locate x,y:print text$
+      end
+
+Hilfe:
+      print"WRITE was written by RoboCop INDUSTRIES"
+      print
+      print"Syntax:  WRITE x y length fc bc TEXT"
+      print
+      print"x      - x-coordinates of the begin of the field"
+      print"y      - y-coordinates -------- '' -------------"
+      print"lengt  - length of the field (the TEXT will be centered)"
+      print"fc     - foreground color"
+      print"bc     - background color"
+      print"TEXT   - the text to print out"
+      print
+      print"(C)1995 by RoboCop INDUSTRIES"
+      end
\ No newline at end of file
diff --git a/wsprot.bas b/wsprot.bas
new file mode 100644
index 0000000..086efbc
--- /dev/null
+++ b/wsprot.bas
@@ -0,0 +1,469 @@
+	TempDir$=environ$("TEMP")
+	if Command$="" then
+	  goto Syntax
+	else
+	  WinDir$=Command$
+	  WinIniTest$=WinDir$+"\WIN.INI"
+	  on error goto NotAValidPath
+	  FileEx$=Dir$(WinIniTest$)
+	  if FileEx$<>"" then WinDir$=Command$ else goto NotAValidPath
+	  on error goto
+	end if
+	OpenString$=WinDir$+"\WINSTART.BAT"
+	ConfigString$=WinDir$+"\WSPROT.INI"
+
+'	Um die Ausgaben auch in der Datei %TEMP%\WSPROT.MSG zu haben, einfach
+'    alle REMs in den folgenden Zeilen entfernen
+
+'	MsgFile$=TempDir$+"\WSPROT.MSG"
+	Ready$="�"
+	Warning$="!"
+	DontKnow$="?"
+	OnlyRead$="�"
+	Working$="�"
+'	open "A",#5,MsgFile$
+'	print#5,""
+'	print#5,"============================================="
+'	print#5,"New Test [";date$;" / ";time$;"]:"
+'	close #5
+	cls
+	shell "mode co80"
+	SUB PrintCentered (OutLine%,Text$) STATIC
+'	  MsgFile$=environ$("TEMP")+"\WSPROT.MSG"
+'	  open "a",#5,MsgFile$
+'	  print#5,Text$
+'	  close #5
+	  AddOn=(58-len(Text$))/2
+	  if AddOn<0 then AddOn=0
+	  Text$=Space$(AddOn)+Text$+Space$(AddOn)
+	  if OutLine%=0 then
+	    OL1$=OL2$
+	    OL2$=OL3$
+	    OL3$=OL4$
+	    OL4$=OL5$
+	    OL5$=OL6$
+	    OL6$=Text$
+	    locate 17,11:print OL1$
+	    locate 18,11:print OL2$
+	    locate 19,11:print OL3$
+	    locate 20,11:print OL4$
+	    locate 21,11:print OL5$
+	    locate 22,11:print OL6$
+	  else
+	    locate OutLine%,11:print Text$;
+	  end if
+	END SUB
+	goto StartHere
+
+NoWINSTART:
+	beep
+	close #1
+	call PrintCentered(0,"No WINSTART.BAT found, creating new one...")
+	call PrintCentered(9,"Creating new WINSTART.BAT...")
+	open "o",#1,OpenString$
+	print#1,"@ECHO OFF"
+	print#1,WinDir$;"\WSPROT.EXE ";WinDir$
+	close #1
+	resume Ende
+
+NoCONFIG:
+	beep
+	call PrintCentered(0,"No Initialisation-File found,")
+	call PrintCentered(0,"a new one will be created.")
+	call PrintCentered(0,"")
+	NewCONFIG=1
+	resume AfterConfigTest
+
+StartHere:
+	color 9,1
+	for x=1 to 25
+	  for y=1 to 80
+	  locate x,y:print"�";
+	  next y
+	next x
+	color 8,0
+	for x=4 to 24
+	  locate x,71:print"��";
+	next x
+	for y=13 to 72
+	  locate 25,y:print"�";
+	next y
+	color 14,1
+	locate 2,10:print"�";
+	locate 2,70:print"�";
+	locate 24,10:print"�";
+	locate 24,70:print"�";
+	for x=11 to 69
+	  locate 2,x:print"�";
+	  locate 24,x:print"�";
+	next x
+	for y=3 to 23
+	  locate y,10:print"�";
+	  locate y,70:print"�";
+	next y
+	for x=3 to 23
+	  for y=11 to 69
+	  locate x,y:print" ";
+	  next y
+	next x
+	color 15,1
+	call PrintCentered(4,"Windows")
+	call PrintCentered(5,"WinStart-Protector")
+	color 12,1
+	call PrintCentered(6,"written by RoboCop INDUSTRIES")
+	color 11,1
+	locate 11,15:print"- WINSTART.BAT: Size/Date"
+	locate 13,15:print"- WINSTART.BAT: CheckSum"
+	locate 15,15:print"- WINSTART.BAT: Attribs"
+	locate 11,41:print"- WIN.INI: 'load='-Entries"
+	locate 13,41:print"- WIN.INI: 'run=' -Entries"
+	color 15,1
+	call PrintCentered(9,"Looking for Configuration-File...")
+	on error goto NoCONFIG
+	  open "I",#1,ConfigString$
+	  call PrintCentered(0,"Config-File found.")
+	on error goto
+	call PrintCentered(9,"Reading Configuration...")
+	input#1,WSSize,WSDate1,WSDate2,WSDate3,WSHours,WSMins,WSAttribs,WSCheck
+	input#1,LoadString$,RunString$
+	close #1
+	call PrintCentered(0,"Configuration read.")
+AfterConfigTest:
+	call PrintCentered(9,"Looking for WINSTART.BAT ...")
+	on error goto NoWINSTART
+	  open "I",#1,OpenString$
+	  close #1
+	  call PrintCentered(0,"WINSTART.BAT found.")
+	  call PrintCentered(0,"")
+	on error goto
+	if NewCONFIG<>1 then call PrintCentered(9,"Comparing WINSTART.BAT's Size ...") else call PrintCentered(9,"Creating WINSTART.BAT's Size ...")
+	call PrintCentered(0,"Size/Date-Check initiated.")
+	color 31,1
+	locate 11,15:print Working$;
+	color 15,1
+	CmdLine$="DIR "+WinDir$+"\WINSTART.BAT >"+TempDir$+"\WINLNCH.TMP"
+	shell CmdLine$
+	call PrintCentered(0,"InfoTempFile created.")
+	TempFile$=TempDir$+"\WINLNCH.TMP"
+	open "I",#1,TempFile$
+	for Dummy=1 to 4
+	  line input#1,dummy$
+	next Dummy
+	line input#1,FileData$
+	if left$(FileData$,12)<>"WINSTART BAT" then line input#1,FileData$
+	FileSize=val(mid$(FileData$,14,5)+mid$(FileData$,20,3)+mid$(FileData$,24,3))
+	FileDate1=val(mid$(FileData$,28,2))
+	FileDate2=val(mid$(FileData$,31,2))
+	FileDate3=val(mid$(FileData$,34,2))
+	FileHours=val(mid$(FileData$,39,2))
+	FileMins=val(mid$(FileData$,42,2))
+	close #1
+	call PrintCentered(0,"InfoTempFile read.")
+	kill TempFile$
+	call PrintCentered(0,"InfoTempFile deleted.")
+	if NewCONFIG=1 then
+	  call PrintCentered(0,"Size/Date-Datas read, jumping to CheckSum")
+	  call PrintCentered(0,"")
+	  locate 11,15
+	  print OnlyRead$;
+	  goto 3
+	end if
+	if FileSize=WSSize then SizeCheck=1 else SizeCheck=2
+	if FileDate1=WSDate1 and FileDate2=WSDate2 and FileDate3=WSDate3 then DateCheck=1 else DateCheck=2
+	if FileHours=WSHours and FileMins=WSMins then TimeCheck=1 else TimeCheck=2
+	if SizeCheck=2 or DateCheck=2 or TimeCheck=2 then fin$=Warning$:fincol=12
+	if SizeCheck=1 and DateCheck=1 and TimeCheck=1 then fin$=Ready$:fincol=10
+	if SizeCheck=0 or DateCheck=0 or TimeCheck=0 then fin$=DontKnow$:fincol=11
+	color fincol,1
+	locate 11,15:print fin$;
+	color 15,1
+	call PrintCentered(0,"Size/Date-Check completed.")
+	call PrintCentered(0,"")
+3    call PrintCentered(9,"Comparing WINSTART.BAT's Checksum ...")
+	call PrintCentered(0,"CheckSum-Test initiated.")
+	color 31,1
+	locate 13,15:print Working$;
+	color 15,1
+	call PrintCentered(0,"Opening WINSTART.BAT as BINARY")
+	open "B",#1,OpenString$
+	x=1
+4	get$ #1,1,CheckChar$
+	CheckChar=ascii(CheckChar$)
+	if CheckChar=-1 then CheckChar=0
+	CheckSum=Checksum+(CheckChar*x)
+	if CheckSum>65535 then CheckSum=CheckSum-65535
+	x=x+1
+	if eof(1)=0 then goto 4
+	Caller$=str$(x-1)+"Bytes checked and added."
+	call PrintCentered(0,Caller$)
+	close #1
+	call PrintCentered(0,"WINSTART.BAT closed")
+	Caller$="Actually CheckSum is "+hex$(CheckSum)+"."
+	call PrintCentered(0,Caller$)
+	if NewCONFIG=1 then
+	  call PrintCentered(0,"CheckSum read, jumping to Attribs")
+	  call PrintCentered(0,"")
+	  locate 13,15
+	  print OnlyRead$;
+	  goto 5
+	end if
+	if CheckSum=WSCheck then CSTest=1 else CSTest=2
+	if CSTest=0 then fincol=11:fin$=DontKnow$
+	if CSTest=2 then fincol=12:fin$=Warning$
+	if CSTest=1 then fincol=10:fin$=Ready$
+	color fincol,1
+	locate 13,15
+	print fin$;
+	color 15,1
+	call PrintCentered(0,"CheckSum test completed.")
+	call PrintCentered(0,"")
+5    call PrintCentered(0,"Attrib-Check initiated.")
+	call PrintCentered(9,"Comparing WINSTART.BAT's Attributes ...")
+	color 31,1:locate 15,15:print Working$;:color 15,1
+	call PrintCentered(0,"Comparing Attributes...")
+	FileAttrib=attrib(OpenString$)
+	if NewCONFIG=1 then
+	  call PrintCentered(0,"Attributes read, jumping to WIN.INI-Part")
+	  call PrintCentered(0,"")
+	  locate 15,15
+	  print OnlyRead$;
+	  goto 6
+	end if
+	call PrintCentered(0,"Attribs read, comparing...")
+	if FileAttrib=WSAttribs then AtTest=1 else AtTest=2
+	if AtTest=0 then fincol=11:fin$=DontKnow$
+	if AtTest=2 then fincol=12:fin$=Warning$
+	if AtTest=1 then fincol=10:fin$=Ready$
+	locate 15,15
+	color fincol,1:print fin$;
+	color 15,1
+	call PrintCentered(0,"Attribute-Check completed.")
+	call PrintCentered(0,"")
+	goto 6
+
+NoWinIni:
+	locate 11,41:color 12:print Warning$
+	locate 13,41:color 12:print Warning$
+	call PrintCentered(0,"WIN.INI does not exist or FileOpen error!")
+	color 15
+	call PrintCentered(0,"jumping to end")
+	call PrintCentered(9,"WARNING: WIN.INI is corrupt")
+	resume VorEnde
+
+6    call PrintCentered(0,"WIN.INI-Check initiated.")
+	call PrintCentered(9,"Checking WIN.INI-Entries...")
+	color 31,1:locate 11,41:print Working$;:locate 13,41:print Working$;:color 15,1
+
+	call PrintCentered(0,"Opening WIN.INI ...")
+	IniOpen$=WinDir$+"\WIN.INI"
+	on error goto NoWinIni
+	open "I",#1,IniOpen$
+	on error goto
+	call PrintCentered(0,"Reading WIN.INI-Entries ...")
+7	line input #1,InLine$
+	if left$(lcase$(InLine$),9)="[windows]" then WinSect=1 else goto 7
+8    line input #1,InLine$
+	if left$(lcase$(InLine$),5)="load=" then LString$=InLine$
+	if left$(lcase$(InLine$),4)="run=" then RString$=InLine$
+	if (RString$="" or LString$="") and left$(Inline$,1)<>"[" and eof(1)=0 then goto 8
+	close #1
+	call PrintCentered(0,"WIN.INI closed")
+	if NewCONFIG=1 then
+	  call PrintCentered(0,"WIN.INI-Entries read, jumping to SAVE")
+	  call PrintCentered(0,"")
+	  locate 11,41:print OnlyRead$
+	  locate 13,41:print OnlyRead$
+	  goto WriteThemDown
+	end if
+	call PrintCentered(0,"Entries successfully read, comparing them...")
+	if RString$=RunString$ then RCheck=1 else RCheck=2
+	if RCheck=0 then fincol=11:fin$=DontKnow$
+	if RCheck=2 then fincol=12:fin$=Warning$
+	if RCheck=1 then fincol=10:fin$=Ready$
+	locate 11,41:color fincol:print fin$;:color 15,1
+	call PrintCentered(0,"Run-Entry checked")
+	if LString$=LoadString$ then LCheck=1 else LCheck=2
+	if LCheck=0 then fincol=11:fin$=DontKnow$
+	if LCheck=2 then fincol=12:fin$=Warning$
+	if LCheck=1 then fincol=10:fin$=Ready$
+	locate 13,41:color fincol:print fin$;:color 15,1
+	call PrintCentered(0,"Load-Entry checked")
+	call PrintCentered(0,"WIN.INI-Check completed.")
+	goto VorEnde
+
+WriteThemDown:
+	call PrintCentered(9,"Writing Datas to IniFile ...")
+	call PrintCentered(0,"Writing File-Datas to WSPROT.INI")
+	gosub WriteConfig
+	call PrintCentered(0,"written!")
+	goto Ende
+
+WriteConfig:
+	open "O",#1,ConfigString$
+	write#1,FileSize,FileDate1,FileDate2,FileDate3,FileHours,FileMins,FileAttrib,CheckSum
+	write#1,LString$,RString$
+	close #1
+	return
+
+VorEnde:
+	Warnings=0
+	Errors=0
+	Warn$=""
+	Erro$=""
+	if SizeCheck=2 then Warnings=Warnings+1:Warn$=Warn$+"size, "
+	if DateCheck=2 then Warnings=Warnings+1:Warn$=Warn$+"date, "
+	if TimeCheck=2 then Warnings=Warnings+1:Warn$=Warn$+"time, "
+	if CSTest=2 then Warnings=Warnings+1:Warn$=Warn$+"checksum, "
+	if AtTest=2 then Warnings=Warnings+1:Warn$=Warn$+"attribs, "
+	if RCheck=2 then Warnings=Warnings+1:Warn$=Warn$+"run-entry, "
+	if LCheck=2 then Warnings=Warnings+1:Warn$=Warn$+"load-entry, "
+	if SizeCheck=0 then Errors=Errors+1:Erro$=Erro$+"size, "
+	if DateCheck=0 then Errors=Errors+1:Erro$=Erro$+"date, "
+	if TimeCheck=0 then Errors=Errors+1:Erro$=Erro$+"time, "
+	if CSTest=0 then Errors=Errors+1:Erro$=Erro$+"checksum, "
+	if AtTest=0 then Errors=Errors+1:Erro$=Erro$+"attribs, "
+	if RCheck=0 then Errors=Errors+1:Erro$=Erro$+"run-entry, "
+	if LCheck=0 then Errors=Errors+1:Erro$=Erro$+"load-entry, "
+	if len(Warn$)>0 then Warn$=left$(Warn$,len(Warn$)-2)
+	if len(Erro$)>0 then Erro$=left$(Erro$,len(Erro$)-2)
+	call PrintCentered(0,"")
+	Caller$=str$(Warnings)+" Warnings,"+str$(Errors)+" Errors"
+	call PrintCentered(0,Caller$)
+	if Warnings>0 then
+	  call PrintCentered(0,"Warnings occured at:")
+	  Caller$=Warn$+"-check(s)"
+	  call PrintCentered(0,Caller$)
+	end if
+	if Errors>0 then
+	  call PrintCentered(0,"Errors occured at:")
+	  Caller$=Erro$+"-check(s)"
+	  call PrintCentered(0,Caller$)
+	end if
+	AllInOne=Warnings+Errors
+	if AllInOne=0 then goto Ende
+	if RCheck=2 then
+	  Caller$="Run-Entry changed from"
+	  call PrintCentered(0,Caller$)
+	  Caller$=RunString$+" to "+RString$
+	  call PrintCentered(0,Caller$)
+	end if
+	if LCheck=2 then
+	  Caller$=""
+	  if RCheck=2 then Caller$="and "
+	  Caller$=Caller$+"Load-Entry changed from"
+	  call PrintCentered(0,Caller$)
+	  Caller$=LoadString$+" to "+LString$
+	  call PrintCentered(0,Caller$)
+	end if
+	color 14,1
+	Caller$="Press [C]ontinue, [R]evert, [U]pdate or re[B]oot"
+10	a$=inkey$
+	Cnt=Cnt+1
+	if Cnt=2000 then call PrintCentered(9,Caller$):sound 1000,2:Cnt=0
+	if Cnt=1000 then call PrintCentered(9,Space$(len(Caller$)))
+	if a$="c" or a$="C" then color 15:goto Ende
+	if a$="r" or a$="R" then color 15:goto RemoveChanges
+	if a$="u" or a$="U" then color 15:goto WriteThemDown
+	if a$="b" or a$="B" then color 15:goto Reboot
+	goto 10
+
+RemoveChanges:
+	call PrintCentered(9,"Reverting old WIN.INI ...")
+	call PrintCentered(0,"")
+	call PrintCentered(0,"Closing all open channels")
+	CLOSE #1
+	CLOSE #2
+	call PrintCentered(0,"Opening WIN.INI & Temp-File")
+	OPEN "I",#1,IniOpen$
+	OutFile$=TempDir$+"\WININI.$$$"
+	OPEN "O",#2,OutFile$
+	call PrintCentered(0,"Searching & Replacing suspicious entry")
+	LineNum=0:CharNum=0
+11	LINE INPUT#1,TestIt$
+	LineNum=LineNum+1
+	if TestIt$=RString$ then
+	  TestIt$=RunString$
+	  call PrintCentered(0,"Suspicious Run=-entry found and replaced")
+	end if
+	if TestIt$=LString$ then
+	  TestIt$=LoadString$
+	  call PrintCentered(0,"Suspicious Load=-entry found and replaced")
+	end if
+	CharNum=CharNum+len(TestIt$)
+	PRINT#2,TestIt$
+	if eof(1) then
+	  Caller$=mid$(str$(CharNum),2,15)+" chars in "+mid$(str$(LineNum),2,10)+" lines written"
+	  call PrintCentered(0,Caller$)
+	  close #1
+	  close #2
+	  call PrintCentered(0,"Opened channels closed")
+	  ShellOut$="MOVE "+IniOpen$+" "+WinDir$+"\WSPROT.WIN"+" >NUL"
+	  shell ShellOut$
+	  call PrintCentered(0,"Suspicious WIN.INI has been copied to WSPROT.WIN")
+	  ShellOut$="MOVE "+OutFile$+" "+IniOpen$+" >NUL"
+	  shell ShellOut$
+	  call PrintCentered(0,"Temp-File has been moved to WIN.INI")
+	  call PrintCentered(0,"Old entry/entries successfully restored.")
+	  goto Ende
+	else
+	  goto 11
+	end if
+
+Reboot:
+	$INLINE "INLINES\BOOT_R.COM"
+	goto Ende
+
+NotAValidPath:
+	cls
+	color 12,0
+	print "The Directory you entered is invalid!"
+
+Syntax:
+	print
+	color 10,1:print"WinStart-Protector";:color 8,0:print
+	print"not a new safety razor from Wilkinson Sword! :)"
+	print
+	color 7,0
+	print"Syntax is as follows:":color 15,0
+	print"WSPROT [Windows-Directory]":color 7,0
+	print
+	print"e.g. if your Windows-Dir (Win 3.0/3.1x or 95) is C:\WINDOWS,"
+	print"you have to write 'WSPROT C:\WINDOWS' to your WINSTART.BAT in"
+	print"your Windows-Directory in case you have WSPROT in the Path or"
+	print"in the C:\WINDOWS-dir. Otherwise you must add the Dir of WSPROT"
+	print"to the WINSTART.BAT, e.g.: 'C:\WSPROT\WSPROT C:\WINDOWS'."
+	print
+	print"At the first Check, WSPROT will show you many '!'s and will ask you, wether"
+	print"to continue, update or reboot. Here you must type in an [U] to write down"
+	print"the Configuration. If Windows or you ever change the WINSTART.BAT or the"
+	print"load/run-entries in the WIN.INI, WSProt will show you this screen. You just"
+	print"have to type in a [U]. But if you not changed the files, you could have a"
+	print"Hacker-Entry in one of that files. Check them, to make sure the changes are"
+	print"harmless and choose [U] again or press [R] to restore the old settings."
+	print
+	color 8,0
+	print"Greetinx goes to DJ Tee, Calle vHH, Fred Kr�ger and Mister X   ;)"
+	print
+	end
+
+ReadyBeep:
+	sound 750,2
+	delay 3/18.2
+	sound 1250,1
+	delay 2/18.2
+	sound 1250,1
+	delay 2/18.2
+	sound 1500,2
+        return
+
+Ende:
+	color 15,1
+	call PrintCentered(9,"Program completed.")
+	call PrintCentered(0,"")
+	call PrintCentered(0,"Program completed.")
+	call PrintCentered(0,"Have fun at Windows...")
+	call PrintCentered(0,"")
+	call PrintCentered(0,"Greets to DJ Tee, Fred Kr�ger and Mister X")
+	locate 1,1
+	gosub ReadyBeep
+	end
\ No newline at end of file